libm-0.2.1/.github/workflows/main.yml010066400017500001750000000035751354273027700157500ustar0000000000000000name: CI on: [push, pull_request] jobs: docker: name: Docker runs-on: ubuntu-latest strategy: matrix: target: - aarch64-unknown-linux-gnu - arm-unknown-linux-gnueabi - arm-unknown-linux-gnueabihf - armv7-unknown-linux-gnueabihf - i686-unknown-linux-gnu - mips-unknown-linux-gnu - mips64-unknown-linux-gnuabi64 - mips64el-unknown-linux-gnuabi64 - powerpc-unknown-linux-gnu - powerpc64-unknown-linux-gnu - powerpc64le-unknown-linux-gnu - x86_64-unknown-linux-gnu steps: - uses: actions/checkout@master - name: Install Rust run: rustup update nightly && rustup default nightly - run: rustup target add ${{ matrix.target }} - run: rustup target add x86_64-unknown-linux-musl - run: cargo generate-lockfile - run: ./ci/run-docker.sh ${{ matrix.target }} rustfmt: name: Rustfmt runs-on: ubuntu-latest steps: - uses: actions/checkout@master - name: Install Rust run: rustup update stable && rustup default stable && rustup component add rustfmt - run: cargo fmt -- --check wasm: name: WebAssembly runs-on: ubuntu-latest steps: - uses: actions/checkout@master - name: Install Rust run: rustup update nightly && rustup default nightly - run: rustup target add wasm32-unknown-unknown - run: cargo build --target wasm32-unknown-unknown cb: name: "The compiler-builtins crate works" runs-on: ubuntu-latest steps: - uses: actions/checkout@master - name: Install Rust run: rustup update nightly && rustup default nightly - run: cargo build -p cb benchmarks: name: Benchmarks runs-on: ubuntu-latest steps: - uses: actions/checkout@master - name: Install Rust run: rustup update nightly && rustup default nightly - run: cargo bench --all libm-0.2.1/.gitignore010066400017500001750000000001051346264005500126510ustar0000000000000000**/*.rs.bk .#* /bin /math/src /math/target /target /tests Cargo.lock libm-0.2.1/CHANGELOG.md010066400017500001750000000022341350025140300124630ustar0000000000000000# Change Log All notable changes to this project will be documented in this file. This project adheres to [Semantic Versioning](http://semver.org/). ## [Unreleased] ... ## [v0.1.4] - 2019-06-12 ### Fixed - Restored compatibility with Rust 1.31.0 ## [v0.1.3] - 2019-05-14 ### Added - minf - fmin - fmaxf - fmax ## [v0.1.2] - 2018-07-18 ### Added - acosf - asin - asinf - atan - atan2 - atan2f - atanf - cos - cosf - cosh - coshf - exp2 - expm1 - expm1f - expo2 - fmaf - pow - sin - sinf - sinh - sinhf - tan - tanf - tanh - tanhf ## [v0.1.1] - 2018-07-14 ### Added - acos - acosf - asin - asinf - atanf - cbrt - cbrtf - ceil - ceilf - cosf - exp - exp2 - exp2f - expm1 - expm1f - fdim - fdimf - floorf - fma - fmod - log - log2 - log10 - log10f - log1p - log1pf - log2f - roundf - sinf - tanf ## v0.1.0 - 2018-07-13 - Initial release [Unreleased]: https://github.com/japaric/libm/compare/v0.1.4...HEAD [v0.1.4]: https://github.com/japaric/libm/compare/0.1.3...v0.1.4 [v0.1.3]: https://github.com/japaric/libm/compare/v0.1.2...0.1.3 [v0.1.2]: https://github.com/japaric/libm/compare/v0.1.1...v0.1.2 [v0.1.1]: https://github.com/japaric/libm/compare/v0.1.0...v0.1.1 libm-0.2.1/CONTRIBUTING.md010066400017500001750000000065441354272776700131460ustar0000000000000000# How to contribute - Pick your favorite math function from the [issue tracker]. - Look for the C implementation of the function in the [MUSL source code][src]. - Copy paste the C code into a Rust file in the `src/math` directory and adjust `src/math/mod.rs` accordingly. Also, uncomment the corresponding trait method in `src/lib.rs`. - Write some simple tests in your module (using `#[test]`) - Run `cargo test` to make sure it works - Run `cargo test --features musl-reference-tests` to compare your implementation against musl's - Send us a pull request! Make sure to run `cargo fmt` on your code before sending the PR. Also include "closes #42" in the PR description to close the corresponding issue. - :tada: [issue tracker]: https://github.com/rust-lang/libm/issues [src]: https://git.musl-libc.org/cgit/musl/tree/src/math [`src/math/truncf.rs`]: https://github.com/rust-lang/libm/blob/master/src/math/truncf.rs Check [PR #65] for an example. [PR #65]: https://github.com/rust-lang/libm/pull/65 ## Tips and tricks - *IMPORTANT* The code in this crate will end up being used in the `core` crate so it can **not** have any external dependencies (other than `core` itself). - Only use relative imports within the `math` directory / module, e.g. `use self::fabs::fabs` or `use super::k_cos`. Absolute imports from core are OK, e.g. `use core::u64`. - To reinterpret a float as an integer use the `to_bits` method. The MUSL code uses the `GET_FLOAT_WORD` macro, or a union, to do this operation. - To reinterpret an integer as a float use the `f32::from_bits` constructor. The MUSL code uses the `SET_FLOAT_WORD` macro, or a union, to do this operation. - You may use other methods from core like `f64::is_nan`, etc. as appropriate. - If you're implementing one of the private double-underscore functions, take a look at the "source" name in the comment at the top for an idea for alternate naming. For example, `__sin` was renamed to `k_sin` after the FreeBSD source code naming. Do `use` these private functions in `mod.rs`. - You may encounter weird literals like `0x1p127f` in the MUSL code. These are hexadecimal floating point literals. Rust (the language) doesn't support these kind of literals. The best way I have found to deal with these literals is to turn them into their integer representation using the [`hexf!`] macro and then turn them back into floats. See below: [`hexf!`]: https://crates.io/crates/hexf ``` rust // Step 1: write a program to convert the float into its integer representation #[macro_use] extern crate hexf; fn main() { println!("{:#x}", hexf32!("0x1.0p127").to_bits()); } ``` ``` console $ # Step 2: run the program $ cargo run 0x7f000000 ``` ``` rust // Step 3: copy paste the output into libm let x1p127 = f32::from_bits(0x7f000000); // 0x1p127f === 2 ^ 12 ``` - Rust code panics on arithmetic overflows when not optimized. You may need to use the [`Wrapping`] newtype to avoid this problem. [`Wrapping`]: https://doc.rust-lang.org/std/num/struct.Wrapping.html ## Testing Normal tests can be executed with: ``` cargo test ``` If you'd like to run tests with randomized inputs that get compared against musl itself, you'll need to be on a Linux system and then you can execute: ``` cargo test --features musl-reference-tests ``` Note that you may need to pass `--release` to Cargo if there are errors related to integer overflow. libm-0.2.1/Cargo.toml.orig010066400017500001750000000014601356603201700135530ustar0000000000000000[package] authors = ["Jorge Aparicio "] categories = ["no-std"] description = "libm in pure Rust" documentation = "https://docs.rs/libm" keywords = ["libm", "math"] license = "MIT OR Apache-2.0" name = "libm" repository = "https://github.com/rust-lang/libm" version = "0.2.1" edition = "2018" [features] default = [] # This tells the compiler to assume that a Nightly toolchain is being used and # that it should activate any useful Nightly things accordingly. unstable = [] # Generate tests which are random inputs and the outputs are calculated with # musl libc. musl-reference-tests = ['rand'] [workspace] members = [ "crates/compiler-builtins-smoke-test", "crates/libm-bench", ] [dev-dependencies] no-panic = "0.1.8" [build-dependencies] rand = { version = "0.6.5", optional = true } libm-0.2.1/Cargo.toml0000644000000017650000000000000100250ustar00# THIS FILE IS AUTOMATICALLY GENERATED BY CARGO # # When uploading crates to the registry Cargo will automatically # "normalize" Cargo.toml files for maximal compatibility # with all versions of Cargo and also rewrite `path` dependencies # to registry (e.g., crates.io) dependencies # # If you believe there's an error in this file please file an # issue against the rust-lang/cargo repository. If you're # editing this file be aware that the upstream Cargo.toml # will likely look very different (and much more reasonable) [package] edition = "2018" name = "libm" version = "0.2.1" authors = ["Jorge Aparicio "] description = "libm in pure Rust" documentation = "https://docs.rs/libm" keywords = ["libm", "math"] categories = ["no-std"] license = "MIT OR Apache-2.0" repository = "https://github.com/rust-lang/libm" [dev-dependencies.no-panic] version = "0.1.8" [build-dependencies.rand] version = "0.6.5" optional = true [features] default = [] musl-reference-tests = ["rand"] unstable = [] libm-0.2.1/LICENSE-APACHE010066400017500001750000000251371346257567100126340ustar0000000000000000 Apache License Version 2.0, January 2004 http://www.apache.org/licenses/ TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION 1. Definitions. "License" shall mean the terms and conditions for use, reproduction, and distribution as defined by Sections 1 through 9 of this document. "Licensor" shall mean the copyright owner or entity authorized by the copyright owner that is granting the License. "Legal Entity" shall mean the union of the acting entity and all other entities that control, are controlled by, or are under common control with that entity. For the purposes of this definition, "control" means (i) the power, direct or indirect, to cause the direction or management of such entity, whether by contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the outstanding shares, or (iii) beneficial ownership of such entity. "You" (or "Your") shall mean an individual or Legal Entity exercising permissions granted by this License. "Source" form shall mean the preferred form for making modifications, including but not limited to software source code, documentation source, and configuration files. "Object" form shall mean any form resulting from mechanical transformation or translation of a Source form, including but not limited to compiled object code, generated documentation, and conversions to other media types. "Work" shall mean the work of authorship, whether in Source or Object form, made available under the License, as indicated by a copyright notice that is included in or attached to the work (an example is provided in the Appendix below). "Derivative Works" shall mean any work, whether in Source or Object form, that is based on (or derived from) the Work and for which the editorial revisions, annotations, elaborations, or other modifications represent, as a whole, an original work of authorship. For the purposes of this License, Derivative Works shall not include works that remain separable from, or merely link (or bind by name) to the interfaces of, the Work and Derivative Works thereof. "Contribution" shall mean any work of authorship, including the original version of the Work and any modifications or additions to that Work or Derivative Works thereof, that is intentionally submitted to Licensor for inclusion in the Work by the copyright owner or by an individual or Legal Entity authorized to submit on behalf of the copyright owner. For the purposes of this definition, "submitted" means any form of electronic, verbal, or written communication sent to the Licensor or its representatives, including but not limited to communication on electronic mailing lists, source code control systems, and issue tracking systems that are managed by, or on behalf of, the Licensor for the purpose of discussing and improving the Work, but excluding communication that is conspicuously marked or otherwise designated in writing by the copyright owner as "Not a Contribution." "Contributor" shall mean Licensor and any individual or Legal Entity on behalf of whom a Contribution has been received by Licensor and subsequently incorporated within the Work. 2. Grant of Copyright License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable copyright license to reproduce, prepare Derivative Works of, publicly display, publicly perform, sublicense, and distribute the Work and such Derivative Works in Source or Object form. 3. Grant of Patent License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable (except as stated in this section) patent license to make, have made, use, offer to sell, sell, import, and otherwise transfer the Work, where such license applies only to those patent claims licensable by such Contributor that are necessarily infringed by their Contribution(s) alone or by combination of their Contribution(s) with the Work to which such Contribution(s) was submitted. If You institute patent litigation against any entity (including a cross-claim or counterclaim in a lawsuit) alleging that the Work or a Contribution incorporated within the Work constitutes direct or contributory patent infringement, then any patent licenses granted to You under this License for that Work shall terminate as of the date such litigation is filed. 4. Redistribution. You may reproduce and distribute copies of the Work or Derivative Works thereof in any medium, with or without modifications, and in Source or Object form, provided that You meet the following conditions: (a) You must give any other recipients of the Work or Derivative Works a copy of this License; and (b) You must cause any modified files to carry prominent notices stating that You changed the files; and (c) You must retain, in the Source form of any Derivative Works that You distribute, all copyright, patent, trademark, and attribution notices from the Source form of the Work, excluding those notices that do not pertain to any part of the Derivative Works; and (d) If the Work includes a "NOTICE" text file as part of its distribution, then any Derivative Works that You distribute must include a readable copy of the attribution notices contained within such NOTICE file, excluding those notices that do not pertain to any part of the Derivative Works, in at least one of the following places: within a NOTICE text file distributed as part of the Derivative Works; within the Source form or documentation, if provided along with the Derivative Works; or, within a display generated by the Derivative Works, if and wherever such third-party notices normally appear. The contents of the NOTICE file are for informational purposes only and do not modify the License. You may add Your own attribution notices within Derivative Works that You distribute, alongside or as an addendum to the NOTICE text from the Work, provided that such additional attribution notices cannot be construed as modifying the License. You may add Your own copyright statement to Your modifications and may provide additional or different license terms and conditions for use, reproduction, or distribution of Your modifications, or for any such Derivative Works as a whole, provided Your use, reproduction, and distribution of the Work otherwise complies with the conditions stated in this License. 5. Submission of Contributions. Unless You explicitly state otherwise, any Contribution intentionally submitted for inclusion in the Work by You to the Licensor shall be under the terms and conditions of this License, without any additional terms or conditions. Notwithstanding the above, nothing herein shall supersede or modify the terms of any separate license agreement you may have executed with Licensor regarding such Contributions. 6. Trademarks. This License does not grant permission to use the trade names, trademarks, service marks, or product names of the Licensor, except as required for reasonable and customary use in describing the origin of the Work and reproducing the content of the NOTICE file. 7. Disclaimer of Warranty. Unless required by applicable law or agreed to in writing, Licensor provides the Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, including, without limitation, any warranties or conditions of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are solely responsible for determining the appropriateness of using or redistributing the Work and assume any risks associated with Your exercise of permissions under this License. 8. Limitation of Liability. In no event and under no legal theory, whether in tort (including negligence), contract, or otherwise, unless required by applicable law (such as deliberate and grossly negligent acts) or agreed to in writing, shall any Contributor be liable to You for damages, including any direct, indirect, special, incidental, or consequential damages of any character arising as a result of this License or out of the use or inability to use the Work (including but not limited to damages for loss of goodwill, work stoppage, computer failure or malfunction, or any and all other commercial damages or losses), even if such Contributor has been advised of the possibility of such damages. 9. Accepting Warranty or Additional Liability. While redistributing the Work or Derivative Works thereof, You may choose to offer, and charge a fee for, acceptance of support, warranty, indemnity, or other liability obligations and/or rights consistent with this License. However, in accepting such obligations, You may act only on Your own behalf and on Your sole responsibility, not on behalf of any other Contributor, and only if You agree to indemnify, defend, and hold each Contributor harmless for any liability incurred by, or claims asserted against, such Contributor by reason of your accepting any such warranty or additional liability. END OF TERMS AND CONDITIONS APPENDIX: How to apply the Apache License to your work. To apply the Apache License to your work, attach the following boilerplate notice, with the fields enclosed by brackets "[]" replaced with your own identifying information. (Don't include the brackets!) The text should be enclosed in the appropriate comment syntax for the file format. We also recommend that a file or class name and description of purpose be included on the same "printed page" as the copyright notice for easier identification within third-party archives. Copyright [yyyy] [name of copyright owner] Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. libm-0.2.1/LICENSE-MIT010066400017500001750000000020421346257567100123320ustar0000000000000000Copyright (c) 2018 Jorge Aparicio Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. libm-0.2.1/README.md010066400017500001750000000026771354272777300121740ustar0000000000000000# `libm` A port of [MUSL]'s libm to Rust. [MUSL]: https://www.musl-libc.org/ ## Goals The short term goal of this library is to [enable math support (e.g. `sin`, `atan2`) for the `wasm32-unknown-unknown` target][wasm] (cf. [rust-lang/compiler-builtins][pr]). The longer term goal is to enable [math support in the `core` crate][core]. [wasm]: https://github.com/rust-lang/libm/milestone/1 [pr]: https://github.com/rust-lang/compiler-builtins/pull/248 [core]: https://github.com/rust-lang/libm/milestone/2 ## Already usable This crate is [on crates.io] and can be used today in stable `#![no_std]` programs. The API documentation can be found [here](https://docs.rs/libm). [on crates.io]: https://crates.io/crates/libm ## Benchmark [benchmark]: #benchmark The benchmarks are located in `crates/libm-bench` and require a nightly Rust toolchain. To run all benchmarks: > cargo +nightly bench --all ## Contributing Please check [CONTRIBUTING.md](CONTRIBUTING.md) ## License Licensed under either of - Apache License, Version 2.0 ([LICENSE-APACHE](LICENSE-APACHE) or http://www.apache.org/licenses/LICENSE-2.0) - MIT license ([LICENSE-MIT](LICENSE-MIT) or http://opensource.org/licenses/MIT) at your option. ### Contribution Unless you explicitly state otherwise, any contribution intentionally submitted for inclusion in the work by you, as defined in the Apache-2.0 license, shall be dual licensed as above, without any additional terms or conditions. libm-0.2.1/build.rs010066400017500001750000000356301351065403300123340ustar0000000000000000use std::env; fn main() { println!("cargo:rerun-if-changed=build.rs"); #[cfg(feature = "musl-reference-tests")] musl_reference_tests::generate(); if !cfg!(feature = "checked") { let lvl = env::var("OPT_LEVEL").unwrap(); if lvl != "0" { println!("cargo:rustc-cfg=assert_no_panic"); } } } #[cfg(feature = "musl-reference-tests")] mod musl_reference_tests { use rand::seq::SliceRandom; use rand::Rng; use std::fs; use std::process::Command; // Number of tests to generate for each function const NTESTS: usize = 500; // These files are all internal functions or otherwise miscellaneous, not // defining a function we want to test. const IGNORED_FILES: &[&str] = &["fenv.rs"]; struct Function { name: String, args: Vec, ret: Vec, tests: Vec, } enum Ty { F32, F64, I32, Bool, } struct Test { inputs: Vec, outputs: Vec, } pub fn generate() { let files = fs::read_dir("src/math") .unwrap() .map(|f| f.unwrap().path()) .collect::>(); let mut math = Vec::new(); for file in files { if IGNORED_FILES.iter().any(|f| file.ends_with(f)) { continue; } println!("generating musl reference tests in {:?}", file); let contents = fs::read_to_string(file).unwrap(); let mut functions = contents.lines().filter(|f| f.starts_with("pub fn")); while let Some(function_to_test) = functions.next() { math.push(parse(function_to_test)); } } // Generate a bunch of random inputs for each function. This will // attempt to generate a good set of uniform test cases for exercising // all the various functionality. generate_random_tests(&mut math, &mut rand::thread_rng()); // After we have all our inputs, use the x86_64-unknown-linux-musl // target to generate the expected output. generate_test_outputs(&mut math); //panic!("Boo"); // ... and now that we have both inputs and expected outputs, do a bunch // of codegen to create the unit tests which we'll actually execute. generate_unit_tests(&math); } /// A "poor man's" parser for the signature of a function fn parse(s: &str) -> Function { let s = eat(s, "pub fn "); let pos = s.find('(').unwrap(); let name = &s[..pos]; let s = &s[pos + 1..]; let end = s.find(')').unwrap(); let args = s[..end] .split(',') .map(|arg| { let colon = arg.find(':').unwrap(); parse_ty(arg[colon + 1..].trim()) }) .collect::>(); let tail = &s[end + 1..]; let tail = eat(tail, " -> "); let ret = parse_retty(tail.replace("{", "").trim()); return Function { name: name.to_string(), args, ret, tests: Vec::new(), }; fn parse_ty(s: &str) -> Ty { match s { "f32" => Ty::F32, "f64" => Ty::F64, "i32" => Ty::I32, "bool" => Ty::Bool, other => panic!("unknown type `{}`", other), } } fn parse_retty(s: &str) -> Vec { match s { "(f32, f32)" => vec![Ty::F32, Ty::F32], "(f32, i32)" => vec![Ty::F32, Ty::I32], "(f64, f64)" => vec![Ty::F64, Ty::F64], "(f64, i32)" => vec![Ty::F64, Ty::I32], other => vec![parse_ty(other)], } } fn eat<'a>(s: &'a str, prefix: &str) -> &'a str { if s.starts_with(prefix) { &s[prefix.len()..] } else { panic!("{:?} didn't start with {:?}", s, prefix) } } } fn generate_random_tests(functions: &mut [Function], rng: &mut R) { for function in functions { for _ in 0..NTESTS { function.tests.push(generate_test(function, rng)); } } fn generate_test(function: &Function, rng: &mut R) -> Test { let mut inputs = function .args .iter() .map(|ty| ty.gen_i64(rng)) .collect::>(); // First argument to this function appears to be a number of // iterations, so passing in massive random numbers causes it to // take forever to execute, so make sure we're not running random // math code until the heat death of the universe. if function.name == "jn" || function.name == "jnf" { inputs[0] &= 0xffff; } Test { inputs, // zero output for now since we'll generate it later outputs: vec![], } } } impl Ty { fn gen_i64(&self, r: &mut R) -> i64 { use std::f32; use std::f64; return match self { Ty::F32 => { if r.gen_range(0, 20) < 1 { let i = *[f32::NAN, f32::INFINITY, f32::NEG_INFINITY] .choose(r) .unwrap(); i.to_bits().into() } else { r.gen::().to_bits().into() } } Ty::F64 => { if r.gen_range(0, 20) < 1 { let i = *[f64::NAN, f64::INFINITY, f64::NEG_INFINITY] .choose(r) .unwrap(); i.to_bits() as i64 } else { r.gen::().to_bits() as i64 } } Ty::I32 => { if r.gen_range(0, 10) < 1 { let i = *[i32::max_value(), 0, i32::min_value()].choose(r).unwrap(); i.into() } else { r.gen::().into() } } Ty::Bool => r.gen::() as i64, }; } fn libc_ty(&self) -> &'static str { match self { Ty::F32 => "f32", Ty::F64 => "f64", Ty::I32 => "i32", Ty::Bool => "i32", } } fn libc_pty(&self) -> &'static str { match self { Ty::F32 => "*mut f32", Ty::F64 => "*mut f64", Ty::I32 => "*mut i32", Ty::Bool => "*mut i32", } } fn default(&self) -> &'static str { match self { Ty::F32 => "0_f32", Ty::F64 => "0_f64", Ty::I32 => "0_i32", Ty::Bool => "false", } } fn to_i64(&self) -> &'static str { match self { Ty::F32 => ".to_bits() as i64", Ty::F64 => ".to_bits() as i64", Ty::I32 => " as i64", Ty::Bool => " as i64", } } } fn generate_test_outputs(functions: &mut [Function]) { let mut src = String::new(); let dst = std::env::var("OUT_DIR").unwrap(); // Generate a program which will run all tests with all inputs in // `functions`. This program will write all outputs to stdout (in a // binary format). src.push_str("use std::io::Write;"); src.push_str("fn main() {"); src.push_str("let mut result = Vec::new();"); for function in functions.iter_mut() { src.push_str("unsafe {"); src.push_str("extern { fn "); src.push_str(&function.name); src.push_str("("); let (ret, retptr) = match function.name.as_str() { "sincos" | "sincosf" => (None, &function.ret[..]), _ => (Some(&function.ret[0]), &function.ret[1..]), }; for (i, arg) in function.args.iter().enumerate() { src.push_str(&format!("arg{}: {},", i, arg.libc_ty())); } for (i, ret) in retptr.iter().enumerate() { src.push_str(&format!("argret{}: {},", i, ret.libc_pty())); } src.push_str(")"); if let Some(ty) = ret { src.push_str(" -> "); src.push_str(ty.libc_ty()); } src.push_str("; }"); src.push_str(&format!("static TESTS: &[[i64; {}]]", function.args.len())); src.push_str(" = &["); for test in function.tests.iter() { src.push_str("["); for val in test.inputs.iter() { src.push_str(&val.to_string()); src.push_str(","); } src.push_str("],"); } src.push_str("];"); src.push_str("for test in TESTS {"); for (i, arg) in retptr.iter().enumerate() { src.push_str(&format!("let mut argret{} = {};", i, arg.default())); } src.push_str("let output = "); src.push_str(&function.name); src.push_str("("); for (i, arg) in function.args.iter().enumerate() { src.push_str(&match arg { Ty::F32 => format!("f32::from_bits(test[{}] as u32)", i), Ty::F64 => format!("f64::from_bits(test[{}] as u64)", i), Ty::I32 => format!("test[{}] as i32", i), Ty::Bool => format!("test[{}] as i32", i), }); src.push_str(","); } for (i, _) in retptr.iter().enumerate() { src.push_str(&format!("&mut argret{},", i)); } src.push_str(");"); if let Some(ty) = &ret { src.push_str(&format!("let output = output{};", ty.to_i64())); src.push_str("result.extend_from_slice(&output.to_le_bytes());"); } for (i, ret) in retptr.iter().enumerate() { src.push_str(&format!( "result.extend_from_slice(&(argret{}{}).to_le_bytes());", i, ret.to_i64(), )); } src.push_str("}"); src.push_str("}"); } src.push_str("std::io::stdout().write_all(&result).unwrap();"); src.push_str("}"); let path = format!("{}/gen.rs", dst); fs::write(&path, src).unwrap(); // Make it somewhat pretty if something goes wrong drop(Command::new("rustfmt").arg(&path).status()); // Compile and execute this tests for the musl target, assuming we're an // x86_64 host effectively. let status = Command::new("rustc") .current_dir(&dst) .arg(&path) .arg("--target=x86_64-unknown-linux-musl") .status() .unwrap(); assert!(status.success()); let output = Command::new("./gen").current_dir(&dst).output().unwrap(); assert!(output.status.success()); assert!(output.stderr.is_empty()); // Map all the output bytes back to an `i64` and then shove it all into // the expected results. let mut results = output.stdout.chunks_exact(8).map(|buf| { let mut exact = [0; 8]; exact.copy_from_slice(buf); i64::from_le_bytes(exact) }); for f in functions.iter_mut() { for test in f.tests.iter_mut() { test.outputs = (0..f.ret.len()).map(|_| results.next().unwrap()).collect(); } } assert!(results.next().is_none()); } /// Codegens a file which has a ton of `#[test]` annotations for all the /// tests that we generated above. fn generate_unit_tests(functions: &[Function]) { let mut src = String::new(); let dst = std::env::var("OUT_DIR").unwrap(); for function in functions { src.push_str("#[test]"); src.push_str("fn "); src.push_str(&function.name); src.push_str("_matches_musl() {"); src.push_str(&format!( "static TESTS: &[([i64; {}], [i64; {}])]", function.args.len(), function.ret.len(), )); src.push_str(" = &["); for test in function.tests.iter() { src.push_str("(["); for val in test.inputs.iter() { src.push_str(&val.to_string()); src.push_str(","); } src.push_str("],"); src.push_str("["); for val in test.outputs.iter() { src.push_str(&val.to_string()); src.push_str(","); } src.push_str("],"); src.push_str("),"); } src.push_str("];"); src.push_str("for (test, expected) in TESTS {"); src.push_str("let output = "); src.push_str(&function.name); src.push_str("("); for (i, arg) in function.args.iter().enumerate() { src.push_str(&match arg { Ty::F32 => format!("f32::from_bits(test[{}] as u32)", i), Ty::F64 => format!("f64::from_bits(test[{}] as u64)", i), Ty::I32 => format!("test[{}] as i32", i), Ty::Bool => format!("test[{}] as i32", i), }); src.push_str(","); } src.push_str(");"); for (i, ret) in function.ret.iter().enumerate() { let get = if function.ret.len() == 1 { String::new() } else { format!(".{}", i) }; src.push_str(&(match ret { Ty::F32 => format!("if _eqf(output{}, f32::from_bits(expected[{}] as u32)).is_ok() {{ continue }}", get, i), Ty::F64 => format!("if _eq(output{}, f64::from_bits(expected[{}] as u64)).is_ok() {{ continue }}", get, i), Ty::I32 => format!("if output{} as i64 == expected[{}] {{ continue }}", get, i), Ty::Bool => unreachable!(), })); } src.push_str( r#" panic!("INPUT: {:?} EXPECTED: {:?} ACTUAL {:?}", test, expected, output); "#, ); src.push_str("}"); src.push_str("}"); } let path = format!("{}/musl-tests.rs", dst); fs::write(&path, src).unwrap(); // Try to make it somewhat pretty drop(Command::new("rustfmt").arg(&path).status()); } } libm-0.2.1/ci/docker/aarch64-unknown-linux-gnu/Dockerfile010066400017500001750000000006341346264104000213700ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-aarch64-linux-gnu libc6-dev-arm64-cross \ qemu-user-static ENV CARGO_TARGET_AARCH64_UNKNOWN_LINUX_GNU_LINKER=aarch64-linux-gnu-gcc \ CARGO_TARGET_AARCH64_UNKNOWN_LINUX_GNU_RUNNER=qemu-aarch64-static \ QEMU_LD_PREFIX=/usr/aarch64-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/arm-unknown-linux-gnueabi/Dockerfile010066400017500001750000000006221346264104000215350ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-arm-linux-gnueabi libc6-dev-armel-cross qemu-user-static ENV CARGO_TARGET_ARM_UNKNOWN_LINUX_GNUEABI_LINKER=arm-linux-gnueabi-gcc \ CARGO_TARGET_ARM_UNKNOWN_LINUX_GNUEABI_RUNNER=qemu-arm-static \ QEMU_LD_PREFIX=/usr/arm-linux-gnueabi \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/arm-unknown-linux-gnueabihf/Dockerfile010066400017500001750000000006341346264104000220560ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-arm-linux-gnueabihf libc6-dev-armhf-cross qemu-user-static ENV CARGO_TARGET_ARM_UNKNOWN_LINUX_GNUEABIHF_LINKER=arm-linux-gnueabihf-gcc \ CARGO_TARGET_ARM_UNKNOWN_LINUX_GNUEABIHF_RUNNER=qemu-arm-static \ QEMU_LD_PREFIX=/usr/arm-linux-gnueabihf \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/armv7-unknown-linux-gnueabihf/Dockerfile010066400017500001750000000006401346264104000223300ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-arm-linux-gnueabihf libc6-dev-armhf-cross qemu-user-static ENV CARGO_TARGET_ARMV7_UNKNOWN_LINUX_GNUEABIHF_LINKER=arm-linux-gnueabihf-gcc \ CARGO_TARGET_ARMV7_UNKNOWN_LINUX_GNUEABIHF_RUNNER=qemu-arm-static \ QEMU_LD_PREFIX=/usr/arm-linux-gnueabihf \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/i686-unknown-linux-gnu/Dockerfile010066400017500001750000000002061346264104000206270ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc-multilib libc6-dev ca-certificates libm-0.2.1/ci/docker/mips-unknown-linux-gnu/Dockerfile010066400017500001750000000006531346264104000211110ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-mips-linux-gnu libc6-dev-mips-cross \ binfmt-support qemu-user-static qemu-system-mips ENV CARGO_TARGET_MIPS_UNKNOWN_LINUX_GNU_LINKER=mips-linux-gnu-gcc \ CARGO_TARGET_MIPS_UNKNOWN_LINUX_GNU_RUNNER=qemu-mips-static \ QEMU_LD_PREFIX=/usr/mips-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/mips64-unknown-linux-gnuabi64/Dockerfile010066400017500001750000000010321346264104000221010ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ ca-certificates \ gcc \ gcc-mips64-linux-gnuabi64 \ libc6-dev \ libc6-dev-mips64-cross \ qemu-user-static \ qemu-system-mips ENV CARGO_TARGET_MIPS64_UNKNOWN_LINUX_GNUABI64_LINKER=mips64-linux-gnuabi64-gcc \ CARGO_TARGET_MIPS64_UNKNOWN_LINUX_GNUABI64_RUNNER=qemu-mips64-static \ CC_mips64_unknown_linux_gnuabi64=mips64-linux-gnuabi64-gcc \ QEMU_LD_PREFIX=/usr/mips64-linux-gnuabi64 \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/mips64el-unknown-linux-gnuabi64/Dockerfile010066400017500001750000000010251346264104000224240ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ ca-certificates \ gcc \ gcc-mips64el-linux-gnuabi64 \ libc6-dev \ libc6-dev-mips64el-cross \ qemu-user-static ENV CARGO_TARGET_MIPS64EL_UNKNOWN_LINUX_GNUABI64_LINKER=mips64el-linux-gnuabi64-gcc \ CARGO_TARGET_MIPS64EL_UNKNOWN_LINUX_GNUABI64_RUNNER=qemu-mips64el-static \ CC_mips64el_unknown_linux_gnuabi64=mips64el-linux-gnuabi64-gcc \ QEMU_LD_PREFIX=/usr/mips64el-linux-gnuabi64 \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/mipsel-unknown-linux-gnu/Dockerfile010066400017500001750000000006501346264104000214270ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-mipsel-linux-gnu libc6-dev-mipsel-cross \ binfmt-support qemu-user-static ENV CARGO_TARGET_MIPSEL_UNKNOWN_LINUX_GNU_LINKER=mipsel-linux-gnu-gcc \ CARGO_TARGET_MIPSEL_UNKNOWN_LINUX_GNU_RUNNER=qemu-mipsel-static \ QEMU_LD_PREFIX=/usr/mipsel-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/powerpc-unknown-linux-gnu/Dockerfile010066400017500001750000000006541346264104000216210ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev qemu-user-static ca-certificates \ gcc-powerpc-linux-gnu libc6-dev-powerpc-cross \ qemu-system-ppc ENV CARGO_TARGET_POWERPC_UNKNOWN_LINUX_GNU_LINKER=powerpc-linux-gnu-gcc \ CARGO_TARGET_POWERPC_UNKNOWN_LINUX_GNU_RUNNER=qemu-ppc-static \ QEMU_LD_PREFIX=/usr/powerpc-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/powerpc64-unknown-linux-gnu/Dockerfile010066400017500001750000000010021346264104000217570ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates \ gcc-powerpc64-linux-gnu libc6-dev-ppc64-cross \ binfmt-support qemu-user-static qemu-system-ppc ENV CARGO_TARGET_POWERPC64_UNKNOWN_LINUX_GNU_LINKER=powerpc64-linux-gnu-gcc \ CARGO_TARGET_POWERPC64_UNKNOWN_LINUX_GNU_RUNNER=qemu-ppc64-static \ CC_powerpc64_unknown_linux_gnu=powerpc64-linux-gnu-gcc \ QEMU_LD_PREFIX=/usr/powerpc64-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/powerpc64le-unknown-linux-gnu/Dockerfile010066400017500001750000000007321346264104000223110ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev qemu-user-static ca-certificates \ gcc-powerpc64le-linux-gnu libc6-dev-ppc64el-cross \ qemu-system-ppc ENV CARGO_TARGET_POWERPC64LE_UNKNOWN_LINUX_GNU_LINKER=powerpc64le-linux-gnu-gcc \ CARGO_TARGET_POWERPC64LE_UNKNOWN_LINUX_GNU_RUNNER=qemu-ppc64le-static \ QEMU_CPU=POWER8 \ QEMU_LD_PREFIX=/usr/powerpc64le-linux-gnu \ RUST_TEST_THREADS=1 libm-0.2.1/ci/docker/x86_64-unknown-linux-gnu/Dockerfile010066400017500001750000000001751346264104000210760ustar0000000000000000FROM ubuntu:18.04 RUN apt-get update && \ apt-get install -y --no-install-recommends \ gcc libc6-dev ca-certificates libm-0.2.1/ci/run-docker.sh010077500017500001750000000016161347601346300136760ustar0000000000000000# Small script to run tests for a target (or all targets) inside all the # respective docker images. set -ex run() { local target=$1 echo $target # This directory needs to exist before calling docker, otherwise docker will create it but it # will be owned by root mkdir -p target docker build -t $target ci/docker/$target docker run \ --rm \ --user $(id -u):$(id -g) \ -e CARGO_HOME=/cargo \ -e CARGO_TARGET_DIR=/target \ -v $(dirname $(dirname `which cargo`)):/cargo \ -v `pwd`/target:/target \ -v `pwd`:/checkout:ro \ -v `rustc --print sysroot`:/rust:ro \ --init \ -w /checkout \ $target \ sh -c "HOME=/tmp PATH=\$PATH:/rust/bin exec ci/run.sh $target" } if [ -z "$1" ]; then for d in `ls ci/docker/`; do run $d done else run $1 fi libm-0.2.1/ci/run.sh010077500017500001750000000005341353572366000124320ustar0000000000000000#!/usr/bin/env sh set -ex TARGET=$1 CMD="cargo test --all --target $TARGET" # stable by default $CMD $CMD --release # unstable with a feature $CMD --features 'unstable' $CMD --release --features 'unstable' # also run the reference tests $CMD --features 'unstable musl-reference-tests' $CMD --release --features 'unstable musl-reference-tests' libm-0.2.1/src/lib.rs010066400017500001750000000024571353572366000126050ustar0000000000000000//! libm in pure Rust #![deny(warnings)] #![no_std] #![cfg_attr( all(target_arch = "wasm32", feature = "unstable"), feature(core_intrinsics) )] #![allow(clippy::unreadable_literal)] #![allow(clippy::many_single_char_names)] #![allow(clippy::needless_return)] #![allow(clippy::int_plus_one)] #![allow(clippy::deprecated_cfg_attr)] #![allow(clippy::mixed_case_hex_literals)] #![allow(clippy::float_cmp)] #![allow(clippy::eq_op)] #![allow(clippy::assign_op_pattern)] mod math; use core::{f32, f64}; pub use self::math::*; /// Approximate equality with 1 ULP of tolerance #[doc(hidden)] #[inline] pub fn _eqf(a: f32, b: f32) -> Result<(), u32> { if a.is_nan() && b.is_nan() { Ok(()) } else { let err = (a.to_bits() as i32).wrapping_sub(b.to_bits() as i32).abs(); if err <= 1 { Ok(()) } else { Err(err as u32) } } } #[doc(hidden)] #[inline] pub fn _eq(a: f64, b: f64) -> Result<(), u64> { if a.is_nan() && b.is_nan() { Ok(()) } else { let err = (a.to_bits() as i64).wrapping_sub(b.to_bits() as i64).abs(); if err <= 1 { Ok(()) } else { Err(err as u64) } } } #[cfg(all(test, feature = "musl-reference-tests"))] include!(concat!(env!("OUT_DIR"), "/musl-tests.rs")); libm-0.2.1/src/math/acos.rs010066400017500001750000000073421351140261100136730ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_acos.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* acos(x) * Method : * acos(x) = pi/2 - asin(x) * acos(-x) = pi/2 + asin(x) * For |x|<=0.5 * acos(x) = pi/2 - (x + x*x^2*R(x^2)) (see asin.c) * For x>0.5 * acos(x) = pi/2 - (pi/2 - 2asin(sqrt((1-x)/2))) * = 2asin(sqrt((1-x)/2)) * = 2s + 2s*z*R(z) ...z=(1-x)/2, s=sqrt(z) * = 2f + (2c + 2s*z*R(z)) * where f=hi part of s, and c = (z-f*f)/(s+f) is the correction term * for f so that f+c ~ sqrt(z). * For x<-0.5 * acos(x) = pi - 2asin(sqrt((1-|x|)/2)) * = pi - 0.5*(s+s*z*R(z)), where z=(1-|x|)/2,s=sqrt(z) * * Special cases: * if x is NaN, return x itself; * if |x|>1, return NaN with invalid signal. * * Function needed: sqrt */ use super::sqrt; const PIO2_HI: f64 = 1.57079632679489655800e+00; /* 0x3FF921FB, 0x54442D18 */ const PIO2_LO: f64 = 6.12323399573676603587e-17; /* 0x3C91A626, 0x33145C07 */ const PS0: f64 = 1.66666666666666657415e-01; /* 0x3FC55555, 0x55555555 */ const PS1: f64 = -3.25565818622400915405e-01; /* 0xBFD4D612, 0x03EB6F7D */ const PS2: f64 = 2.01212532134862925881e-01; /* 0x3FC9C155, 0x0E884455 */ const PS3: f64 = -4.00555345006794114027e-02; /* 0xBFA48228, 0xB5688F3B */ const PS4: f64 = 7.91534994289814532176e-04; /* 0x3F49EFE0, 0x7501B288 */ const PS5: f64 = 3.47933107596021167570e-05; /* 0x3F023DE1, 0x0DFDF709 */ const QS1: f64 = -2.40339491173441421878e+00; /* 0xC0033A27, 0x1C8A2D4B */ const QS2: f64 = 2.02094576023350569471e+00; /* 0x40002AE5, 0x9C598AC8 */ const QS3: f64 = -6.88283971605453293030e-01; /* 0xBFE6066C, 0x1B8D0159 */ const QS4: f64 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ fn r(z: f64) -> f64 { let p: f64 = z * (PS0 + z * (PS1 + z * (PS2 + z * (PS3 + z * (PS4 + z * PS5))))); let q: f64 = 1.0 + z * (QS1 + z * (QS2 + z * (QS3 + z * QS4))); p / q } /// Arccosine (f64) /// /// Computes the inverse cosine (arc cosine) of the input value. /// Arguments must be in the range -1 to 1. /// Returns values in radians, in the range of 0 to pi. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn acos(x: f64) -> f64 { let x1p_120f = f64::from_bits(0x3870000000000000); // 0x1p-120 === 2 ^ -120 let z: f64; let w: f64; let s: f64; let c: f64; let df: f64; let hx: u32; let ix: u32; hx = (x.to_bits() >> 32) as u32; ix = hx & 0x7fffffff; /* |x| >= 1 or nan */ if ix >= 0x3ff00000 { let lx: u32 = x.to_bits() as u32; if ((ix - 0x3ff00000) | lx) == 0 { /* acos(1)=0, acos(-1)=pi */ if (hx >> 31) != 0 { return 2. * PIO2_HI + x1p_120f; } return 0.; } return 0. / (x - x); } /* |x| < 0.5 */ if ix < 0x3fe00000 { if ix <= 0x3c600000 { /* |x| < 2**-57 */ return PIO2_HI + x1p_120f; } return PIO2_HI - (x - (PIO2_LO - x * r(x * x))); } /* x < -0.5 */ if (hx >> 31) != 0 { z = (1.0 + x) * 0.5; s = sqrt(z); w = r(z) * s - PIO2_LO; return 2. * (PIO2_HI - (s + w)); } /* x > 0.5 */ z = (1.0 - x) * 0.5; s = sqrt(z); // Set the low 4 bytes to zero df = f64::from_bits(s.to_bits() & 0xff_ff_ff_ff_00_00_00_00); c = (z - df * df) / (s + df); w = r(z) * s + c; 2. * (df + w) } libm-0.2.1/src/math/acosf.rs010066400017500001750000000042521351140316000140360ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_acosf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::sqrtf::sqrtf; const PIO2_HI: f32 = 1.5707962513e+00; /* 0x3fc90fda */ const PIO2_LO: f32 = 7.5497894159e-08; /* 0x33a22168 */ const P_S0: f32 = 1.6666586697e-01; const P_S1: f32 = -4.2743422091e-02; const P_S2: f32 = -8.6563630030e-03; const Q_S1: f32 = -7.0662963390e-01; fn r(z: f32) -> f32 { let p = z * (P_S0 + z * (P_S1 + z * P_S2)); let q = 1. + z * Q_S1; p / q } /// Arccosine (f32) /// /// Computes the inverse cosine (arc cosine) of the input value. /// Arguments must be in the range -1 to 1. /// Returns values in radians, in the range of 0 to pi. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn acosf(x: f32) -> f32 { let x1p_120 = f32::from_bits(0x03800000); // 0x1p-120 === 2 ^ (-120) let z: f32; let w: f32; let s: f32; let mut hx = x.to_bits(); let ix = hx & 0x7fffffff; /* |x| >= 1 or nan */ if ix >= 0x3f800000 { if ix == 0x3f800000 { if (hx >> 31) != 0 { return 2. * PIO2_HI + x1p_120; } return 0.; } return 0. / (x - x); } /* |x| < 0.5 */ if ix < 0x3f000000 { if ix <= 0x32800000 { /* |x| < 2**-26 */ return PIO2_HI + x1p_120; } return PIO2_HI - (x - (PIO2_LO - x * r(x * x))); } /* x < -0.5 */ if (hx >> 31) != 0 { z = (1. + x) * 0.5; s = sqrtf(z); w = r(z) * s - PIO2_LO; return 2. * (PIO2_HI - (s + w)); } /* x > 0.5 */ z = (1. - x) * 0.5; s = sqrtf(z); hx = s.to_bits(); let df = f32::from_bits(hx & 0xfffff000); let c = (z - df * df) / (s + df); w = r(z) * s + c; 2. * (df + w) } libm-0.2.1/src/math/acosh.rs010066400017500001750000000014471351140252100140430ustar0000000000000000use super::{log, log1p, sqrt}; const LN2: f64 = 0.693147180559945309417232121458176568; /* 0x3fe62e42, 0xfefa39ef*/ /// Inverse hyperbolic cosine (f64) /// /// Calculates the inverse hyperbolic cosine of `x`. /// Is defined as `log(x + sqrt(x*x-1))`. /// `x` must be a number greater than or equal to 1. pub fn acosh(x: f64) -> f64 { let u = x.to_bits(); let e = ((u >> 52) as usize) & 0x7ff; /* x < 1 domain error is handled in the called functions */ if e < 0x3ff + 1 { /* |x| < 2, up to 2ulp error in [1,1.125] */ return log1p(x - 1.0 + sqrt((x - 1.0) * (x - 1.0) + 2.0 * (x - 1.0))); } if e < 0x3ff + 26 { /* |x| < 0x1p26 */ return log(2.0 * x - 1.0 / (x + sqrt(x * x - 1.0))); } /* |x| >= 0x1p26 or nan */ return log(x) + LN2; } libm-0.2.1/src/math/acoshf.rs010066400017500001750000000013731351140252100142070ustar0000000000000000use super::{log1pf, logf, sqrtf}; const LN2: f32 = 0.693147180559945309417232121458176568; /// Inverse hyperbolic cosine (f32) /// /// Calculates the inverse hyperbolic cosine of `x`. /// Is defined as `log(x + sqrt(x*x-1))`. /// `x` must be a number greater than or equal to 1. pub fn acoshf(x: f32) -> f32 { let u = x.to_bits(); let a = u & 0x7fffffff; if a < 0x3f800000 + (1 << 23) { /* |x| < 2, invalid if x < 1 or nan */ /* up to 2ulp error in [1,1.125] */ return log1pf(x - 1.0 + sqrtf((x - 1.0) * (x - 1.0) + 2.0 * (x - 1.0))); } if a < 0x3f800000 + (12 << 23) { /* |x| < 0x1p12 */ return logf(2.0 * x - 1.0 / (x + sqrtf(x * x - 1.0))); } /* x >= 0x1p12 */ return logf(x) + LN2; } libm-0.2.1/src/math/asin.rs010066400017500001750000000103001351140333500136700ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_asin.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* asin(x) * Method : * Since asin(x) = x + x^3/6 + x^5*3/40 + x^7*15/336 + ... * we approximate asin(x) on [0,0.5] by * asin(x) = x + x*x^2*R(x^2) * where * R(x^2) is a rational approximation of (asin(x)-x)/x^3 * and its remez error is bounded by * |(asin(x)-x)/x^3 - R(x^2)| < 2^(-58.75) * * For x in [0.5,1] * asin(x) = pi/2-2*asin(sqrt((1-x)/2)) * Let y = (1-x), z = y/2, s := sqrt(z), and pio2_hi+pio2_lo=pi/2; * then for x>0.98 * asin(x) = pi/2 - 2*(s+s*z*R(z)) * = pio2_hi - (2*(s+s*z*R(z)) - pio2_lo) * For x<=0.98, let pio4_hi = pio2_hi/2, then * f = hi part of s; * c = sqrt(z) - f = (z-f*f)/(s+f) ...f+c=sqrt(z) * and * asin(x) = pi/2 - 2*(s+s*z*R(z)) * = pio4_hi+(pio4-2s)-(2s*z*R(z)-pio2_lo) * = pio4_hi+(pio4-2f)-(2s*z*R(z)-(pio2_lo+2c)) * * Special cases: * if x is NaN, return x itself; * if |x|>1, return NaN with invalid signal. * */ use super::{fabs, get_high_word, get_low_word, sqrt, with_set_low_word}; const PIO2_HI: f64 = 1.57079632679489655800e+00; /* 0x3FF921FB, 0x54442D18 */ const PIO2_LO: f64 = 6.12323399573676603587e-17; /* 0x3C91A626, 0x33145C07 */ /* coefficients for R(x^2) */ const P_S0: f64 = 1.66666666666666657415e-01; /* 0x3FC55555, 0x55555555 */ const P_S1: f64 = -3.25565818622400915405e-01; /* 0xBFD4D612, 0x03EB6F7D */ const P_S2: f64 = 2.01212532134862925881e-01; /* 0x3FC9C155, 0x0E884455 */ const P_S3: f64 = -4.00555345006794114027e-02; /* 0xBFA48228, 0xB5688F3B */ const P_S4: f64 = 7.91534994289814532176e-04; /* 0x3F49EFE0, 0x7501B288 */ const P_S5: f64 = 3.47933107596021167570e-05; /* 0x3F023DE1, 0x0DFDF709 */ const Q_S1: f64 = -2.40339491173441421878e+00; /* 0xC0033A27, 0x1C8A2D4B */ const Q_S2: f64 = 2.02094576023350569471e+00; /* 0x40002AE5, 0x9C598AC8 */ const Q_S3: f64 = -6.88283971605453293030e-01; /* 0xBFE6066C, 0x1B8D0159 */ const Q_S4: f64 = 7.70381505559019352791e-02; /* 0x3FB3B8C5, 0xB12E9282 */ fn comp_r(z: f64) -> f64 { let p = z * (P_S0 + z * (P_S1 + z * (P_S2 + z * (P_S3 + z * (P_S4 + z * P_S5))))); let q = 1.0 + z * (Q_S1 + z * (Q_S2 + z * (Q_S3 + z * Q_S4))); p / q } /// Arcsine (f64) /// /// Computes the inverse sine (arc sine) of the argument `x`. /// Arguments to asin must be in the range -1 to 1. /// Returns values in radians, in the range of -pi/2 to pi/2. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn asin(mut x: f64) -> f64 { let z: f64; let r: f64; let s: f64; let hx: u32; let ix: u32; hx = get_high_word(x); ix = hx & 0x7fffffff; /* |x| >= 1 or nan */ if ix >= 0x3ff00000 { let lx: u32; lx = get_low_word(x); if ((ix - 0x3ff00000) | lx) == 0 { /* asin(1) = +-pi/2 with inexact */ return x * PIO2_HI + f64::from_bits(0x3870000000000000); } else { return 0.0 / (x - x); } } /* |x| < 0.5 */ if ix < 0x3fe00000 { /* if 0x1p-1022 <= |x| < 0x1p-26, avoid raising underflow */ if ix < 0x3e500000 && ix >= 0x00100000 { return x; } else { return x + x * comp_r(x * x); } } /* 1 > |x| >= 0.5 */ z = (1.0 - fabs(x)) * 0.5; s = sqrt(z); r = comp_r(z); if ix >= 0x3fef3333 { /* if |x| > 0.975 */ x = PIO2_HI - (2. * (s + s * r) - PIO2_LO); } else { let f: f64; let c: f64; /* f+c = sqrt(z) */ f = with_set_low_word(s, 0); c = (z - f * f) / (s + f); x = 0.5 * PIO2_HI - (2.0 * s * r - (PIO2_LO - 2.0 * c) - (0.5 * PIO2_HI - 2.0 * f)); } if hx >> 31 != 0 { -x } else { x } } libm-0.2.1/src/math/asinf.rs010066400017500001750000000040061351140253700140470ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_asinf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::fabsf::fabsf; use super::sqrt::sqrt; const PIO2: f64 = 1.570796326794896558e+00; /* coefficients for R(x^2) */ const P_S0: f32 = 1.6666586697e-01; const P_S1: f32 = -4.2743422091e-02; const P_S2: f32 = -8.6563630030e-03; const Q_S1: f32 = -7.0662963390e-01; fn r(z: f32) -> f32 { let p = z * (P_S0 + z * (P_S1 + z * P_S2)); let q = 1. + z * Q_S1; p / q } /// Arcsine (f32) /// /// Computes the inverse sine (arc sine) of the argument `x`. /// Arguments to asin must be in the range -1 to 1. /// Returns values in radians, in the range of -pi/2 to pi/2. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn asinf(mut x: f32) -> f32 { let x1p_120 = f64::from_bits(0x3870000000000000); // 0x1p-120 === 2 ^ (-120) let hx = x.to_bits(); let ix = hx & 0x7fffffff; if ix >= 0x3f800000 { /* |x| >= 1 */ if ix == 0x3f800000 { /* |x| == 1 */ return ((x as f64) * PIO2 + x1p_120) as f32; /* asin(+-1) = +-pi/2 with inexact */ } return 0. / (x - x); /* asin(|x|>1) is NaN */ } if ix < 0x3f000000 { /* |x| < 0.5 */ /* if 0x1p-126 <= |x| < 0x1p-12, avoid raising underflow */ if (ix < 0x39800000) && (ix >= 0x00800000) { return x; } return x + x * r(x * x); } /* 1 > |x| >= 0.5 */ let z = (1. - fabsf(x)) * 0.5; let s = sqrt(z as f64); x = (PIO2 - 2. * (s + s * (r(z) as f64))) as f32; if (hx >> 31) != 0 { -x } else { x } } libm-0.2.1/src/math/asinh.rs010066400017500001750000000021161351140252100140420ustar0000000000000000use super::{log, log1p, sqrt}; const LN2: f64 = 0.693147180559945309417232121458176568; /* 0x3fe62e42, 0xfefa39ef*/ /* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ /// Inverse hyperbolic sine (f64) /// /// Calculates the inverse hyperbolic sine of `x`. /// Is defined as `sgn(x)*log(|x|+sqrt(x*x+1))`. pub fn asinh(mut x: f64) -> f64 { let mut u = x.to_bits(); let e = ((u >> 52) as usize) & 0x7ff; let sign = (u >> 63) != 0; /* |x| */ u &= (!0) >> 1; x = f64::from_bits(u); if e >= 0x3ff + 26 { /* |x| >= 0x1p26 or inf or nan */ x = log(x) + LN2; } else if e >= 0x3ff + 1 { /* |x| >= 2 */ x = log(2.0 * x + 1.0 / (sqrt(x * x + 1.0) + x)); } else if e >= 0x3ff - 26 { /* |x| >= 0x1p-26, up to 1.6ulp error in [0.125,0.5] */ x = log1p(x + x * x / (sqrt(x * x + 1.0) + 1.0)); } else { /* |x| < 0x1p-26, raise inexact if x != 0 */ let x1p120 = f64::from_bits(0x4770000000000000); force_eval!(x + x1p120); } if sign { -x } else { x } } libm-0.2.1/src/math/asinhf.rs010066400017500001750000000020611351140252100142070ustar0000000000000000use super::{log1pf, logf, sqrtf}; const LN2: f32 = 0.693147180559945309417232121458176568; /* asinh(x) = sign(x)*log(|x|+sqrt(x*x+1)) ~= x - x^3/6 + o(x^5) */ /// Inverse hyperbolic sine (f32) /// /// Calculates the inverse hyperbolic sine of `x`. /// Is defined as `sgn(x)*log(|x|+sqrt(x*x+1))`. pub fn asinhf(mut x: f32) -> f32 { let u = x.to_bits(); let i = u & 0x7fffffff; let sign = (u >> 31) != 0; /* |x| */ x = f32::from_bits(i); if i >= 0x3f800000 + (12 << 23) { /* |x| >= 0x1p12 or inf or nan */ x = logf(x) + LN2; } else if i >= 0x3f800000 + (1 << 23) { /* |x| >= 2 */ x = logf(2.0 * x + 1.0 / (sqrtf(x * x + 1.0) + x)); } else if i >= 0x3f800000 - (12 << 23) { /* |x| >= 0x1p-12, up to 1.6ulp error in [0.125,0.5] */ x = log1pf(x + x * x / (sqrtf(x * x + 1.0) + 1.0)); } else { /* |x| < 0x1p-12, raise inexact if x!=0 */ let x1p120 = f32::from_bits(0x7b800000); force_eval!(x + x1p120); } if sign { -x } else { x } } libm-0.2.1/src/math/atan.rs010066400017500001750000000132161351140272200136710ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_atan.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* atan(x) * Method * 1. Reduce x to positive by atan(x) = -atan(-x). * 2. According to the integer k=4t+0.25 chopped, t=x, the argument * is further reduced to one of the following intervals and the * arctangent of t is evaluated by the corresponding formula: * * [0,7/16] atan(x) = t-t^3*(a1+t^2*(a2+...(a10+t^2*a11)...) * [7/16,11/16] atan(x) = atan(1/2) + atan( (t-0.5)/(1+t/2) ) * [11/16.19/16] atan(x) = atan( 1 ) + atan( (t-1)/(1+t) ) * [19/16,39/16] atan(x) = atan(3/2) + atan( (t-1.5)/(1+1.5t) ) * [39/16,INF] atan(x) = atan(INF) + atan( -1/t ) * * Constants: * The hexadecimal values are the intended ones for the following * constants. The decimal values may be used, provided that the * compiler will convert from decimal to binary accurately enough * to produce the hexadecimal values shown. */ use super::fabs; use core::f64; const ATANHI: [f64; 4] = [ 4.63647609000806093515e-01, /* atan(0.5)hi 0x3FDDAC67, 0x0561BB4F */ 7.85398163397448278999e-01, /* atan(1.0)hi 0x3FE921FB, 0x54442D18 */ 9.82793723247329054082e-01, /* atan(1.5)hi 0x3FEF730B, 0xD281F69B */ 1.57079632679489655800e+00, /* atan(inf)hi 0x3FF921FB, 0x54442D18 */ ]; const ATANLO: [f64; 4] = [ 2.26987774529616870924e-17, /* atan(0.5)lo 0x3C7A2B7F, 0x222F65E2 */ 3.06161699786838301793e-17, /* atan(1.0)lo 0x3C81A626, 0x33145C07 */ 1.39033110312309984516e-17, /* atan(1.5)lo 0x3C700788, 0x7AF0CBBD */ 6.12323399573676603587e-17, /* atan(inf)lo 0x3C91A626, 0x33145C07 */ ]; const AT: [f64; 11] = [ 3.33333333333329318027e-01, /* 0x3FD55555, 0x5555550D */ -1.99999999998764832476e-01, /* 0xBFC99999, 0x9998EBC4 */ 1.42857142725034663711e-01, /* 0x3FC24924, 0x920083FF */ -1.11111104054623557880e-01, /* 0xBFBC71C6, 0xFE231671 */ 9.09088713343650656196e-02, /* 0x3FB745CD, 0xC54C206E */ -7.69187620504482999495e-02, /* 0xBFB3B0F2, 0xAF749A6D */ 6.66107313738753120669e-02, /* 0x3FB10D66, 0xA0D03D51 */ -5.83357013379057348645e-02, /* 0xBFADDE2D, 0x52DEFD9A */ 4.97687799461593236017e-02, /* 0x3FA97B4B, 0x24760DEB */ -3.65315727442169155270e-02, /* 0xBFA2B444, 0x2C6A6C2F */ 1.62858201153657823623e-02, /* 0x3F90AD3A, 0xE322DA11 */ ]; /// Arctangent (f64) /// /// Computes the inverse tangent (arc tangent) of the input value. /// Returns a value in radians, in the range of -pi/2 to pi/2. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn atan(x: f64) -> f64 { let mut x = x; let mut ix = (x.to_bits() >> 32) as u32; let sign = ix >> 31; ix &= 0x7fff_ffff; if ix >= 0x4410_0000 { if x.is_nan() { return x; } let z = ATANHI[3] + f64::from_bits(0x0380_0000); // 0x1p-120f return if sign != 0 { -z } else { z }; } let id = if ix < 0x3fdc_0000 { /* |x| < 0.4375 */ if ix < 0x3e40_0000 { /* |x| < 2^-27 */ if ix < 0x0010_0000 { /* raise underflow for subnormal x */ force_eval!(x as f32); } return x; } -1 } else { x = fabs(x); if ix < 0x3ff30000 { /* |x| < 1.1875 */ if ix < 0x3fe60000 { /* 7/16 <= |x| < 11/16 */ x = (2. * x - 1.) / (2. + x); 0 } else { /* 11/16 <= |x| < 19/16 */ x = (x - 1.) / (x + 1.); 1 } } else if ix < 0x40038000 { /* |x| < 2.4375 */ x = (x - 1.5) / (1. + 1.5 * x); 2 } else { /* 2.4375 <= |x| < 2^66 */ x = -1. / x; 3 } }; let z = x * x; let w = z * z; /* break sum from i=0 to 10 AT[i]z**(i+1) into odd and even poly */ let s1 = z * (AT[0] + w * (AT[2] + w * (AT[4] + w * (AT[6] + w * (AT[8] + w * AT[10]))))); let s2 = w * (AT[1] + w * (AT[3] + w * (AT[5] + w * (AT[7] + w * AT[9])))); if id < 0 { return x - x * (s1 + s2); } let z = i!(ATANHI, id as usize) - (x * (s1 + s2) - i!(ATANLO, id as usize) - x); if sign != 0 { -z } else { z } } #[cfg(test)] mod tests { use super::atan; use core::f64; #[test] fn sanity_check() { for (input, answer) in [ (3.0_f64.sqrt() / 3.0, f64::consts::FRAC_PI_6), (1.0, f64::consts::FRAC_PI_4), (3.0_f64.sqrt(), f64::consts::FRAC_PI_3), (-3.0_f64.sqrt() / 3.0, -f64::consts::FRAC_PI_6), (-1.0, -f64::consts::FRAC_PI_4), (-3.0_f64.sqrt(), -f64::consts::FRAC_PI_3), ] .iter() { assert!( (atan(*input) - answer) / answer < 1e-5, "\natan({:.4}/16) = {:.4}, actual: {}", input * 16.0, answer, atan(*input) ); } } #[test] fn zero() { assert_eq!(atan(0.0), 0.0); } #[test] fn infinity() { assert_eq!(atan(f64::INFINITY), f64::consts::FRAC_PI_2); } #[test] fn minus_infinity() { assert_eq!(atan(f64::NEG_INFINITY), -f64::consts::FRAC_PI_2); } #[test] fn nan() { assert!(atan(f64::NAN).is_nan()); } } libm-0.2.1/src/math/atan2.rs010066400017500001750000000104031351140321500137440ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== * */ /* atan2(y,x) * Method : * 1. Reduce y to positive by atan2(y,x)=-atan2(-y,x). * 2. Reduce x to positive by (if x and y are unexceptional): * ARG (x+iy) = arctan(y/x) ... if x > 0, * ARG (x+iy) = pi - arctan[y/(-x)] ... if x < 0, * * Special cases: * * ATAN2((anything), NaN ) is NaN; * ATAN2(NAN , (anything) ) is NaN; * ATAN2(+-0, +(anything but NaN)) is +-0 ; * ATAN2(+-0, -(anything but NaN)) is +-pi ; * ATAN2(+-(anything but 0 and NaN), 0) is +-pi/2; * ATAN2(+-(anything but INF and NaN), +INF) is +-0 ; * ATAN2(+-(anything but INF and NaN), -INF) is +-pi; * ATAN2(+-INF,+INF ) is +-pi/4 ; * ATAN2(+-INF,-INF ) is +-3pi/4; * ATAN2(+-INF, (anything but,0,NaN, and INF)) is +-pi/2; * * Constants: * The hexadecimal values are the intended ones for the following * constants. The decimal values may be used, provided that the * compiler will convert from decimal to binary accurately enough * to produce the hexadecimal values shown. */ use super::atan; use super::fabs; const PI: f64 = 3.1415926535897931160E+00; /* 0x400921FB, 0x54442D18 */ const PI_LO: f64 = 1.2246467991473531772E-16; /* 0x3CA1A626, 0x33145C07 */ /// Arctangent of y/x (f64) /// /// Computes the inverse tangent (arc tangent) of `y/x`. /// Produces the correct result even for angles near pi/2 or -pi/2 (that is, when `x` is near 0). /// Returns a value in radians, in the range of -pi to pi. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn atan2(y: f64, x: f64) -> f64 { if x.is_nan() || y.is_nan() { return x + y; } let mut ix = (x.to_bits() >> 32) as u32; let lx = x.to_bits() as u32; let mut iy = (y.to_bits() >> 32) as u32; let ly = y.to_bits() as u32; if ((ix.wrapping_sub(0x3ff00000)) | lx) == 0 { /* x = 1.0 */ return atan(y); } let m = ((iy >> 31) & 1) | ((ix >> 30) & 2); /* 2*sign(x)+sign(y) */ ix &= 0x7fffffff; iy &= 0x7fffffff; /* when y = 0 */ if (iy | ly) == 0 { return match m { 0 | 1 => y, /* atan(+-0,+anything)=+-0 */ 2 => PI, /* atan(+0,-anything) = PI */ _ => -PI, /* atan(-0,-anything) =-PI */ }; } /* when x = 0 */ if (ix | lx) == 0 { return if m & 1 != 0 { -PI / 2.0 } else { PI / 2.0 }; } /* when x is INF */ if ix == 0x7ff00000 { if iy == 0x7ff00000 { return match m { 0 => PI / 4.0, /* atan(+INF,+INF) */ 1 => -PI / 4.0, /* atan(-INF,+INF) */ 2 => 3.0 * PI / 4.0, /* atan(+INF,-INF) */ _ => -3.0 * PI / 4.0, /* atan(-INF,-INF) */ }; } else { return match m { 0 => 0.0, /* atan(+...,+INF) */ 1 => -0.0, /* atan(-...,+INF) */ 2 => PI, /* atan(+...,-INF) */ _ => -PI, /* atan(-...,-INF) */ }; } } /* |y/x| > 0x1p64 */ if ix.wrapping_add(64 << 20) < iy || iy == 0x7ff00000 { return if m & 1 != 0 { -PI / 2.0 } else { PI / 2.0 }; } /* z = atan(|y/x|) without spurious underflow */ let z = if (m & 2 != 0) && iy.wrapping_add(64 << 20) < ix { /* |y/x| < 0x1p-64, x<0 */ 0.0 } else { atan(fabs(y / x)) }; match m { 0 => z, /* atan(+,+) */ 1 => -z, /* atan(-,+) */ 2 => PI - (z - PI_LO), /* atan(+,-) */ _ => (z - PI_LO) - PI, /* atan(-,-) */ } } #[test] fn sanity_check() { assert_eq!(atan2(0.0, 1.0), 0.0); assert_eq!(atan2(0.0, -1.0), PI); assert_eq!(atan2(-0.0, -1.0), -PI); assert_eq!(atan2(3.0, 2.0), atan(3.0 / 2.0)); assert_eq!(atan2(2.0, -1.0), atan(2.0 / -1.0) + PI); assert_eq!(atan2(-2.0, -1.0), atan(-2.0 / -1.0) - PI); } libm-0.2.1/src/math/atan2f.rs010066400017500001750000000055161351140317500141300ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_atan2f.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::atanf; use super::fabsf; const PI: f32 = 3.1415927410e+00; /* 0x40490fdb */ const PI_LO: f32 = -8.7422776573e-08; /* 0xb3bbbd2e */ /// Arctangent of y/x (f32) /// /// Computes the inverse tangent (arc tangent) of `y/x`. /// Produces the correct result even for angles near pi/2 or -pi/2 (that is, when `x` is near 0). /// Returns a value in radians, in the range of -pi to pi. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn atan2f(y: f32, x: f32) -> f32 { if x.is_nan() || y.is_nan() { return x + y; } let mut ix = x.to_bits(); let mut iy = y.to_bits(); if ix == 0x3f800000 { /* x=1.0 */ return atanf(y); } let m = ((iy >> 31) & 1) | ((ix >> 30) & 2); /* 2*sign(x)+sign(y) */ ix &= 0x7fffffff; iy &= 0x7fffffff; /* when y = 0 */ if iy == 0 { return match m { 0 | 1 => y, /* atan(+-0,+anything)=+-0 */ 2 => PI, /* atan(+0,-anything) = pi */ 3 | _ => -PI, /* atan(-0,-anything) =-pi */ }; } /* when x = 0 */ if ix == 0 { return if m & 1 != 0 { -PI / 2. } else { PI / 2. }; } /* when x is INF */ if ix == 0x7f800000 { return if iy == 0x7f800000 { match m { 0 => PI / 4., /* atan(+INF,+INF) */ 1 => -PI / 4., /* atan(-INF,+INF) */ 2 => 3. * PI / 4., /* atan(+INF,-INF)*/ 3 | _ => -3. * PI / 4., /* atan(-INF,-INF)*/ } } else { match m { 0 => 0., /* atan(+...,+INF) */ 1 => -0., /* atan(-...,+INF) */ 2 => PI, /* atan(+...,-INF) */ 3 | _ => -PI, /* atan(-...,-INF) */ } }; } /* |y/x| > 0x1p26 */ if (ix + (26 << 23) < iy) || (iy == 0x7f800000) { return if m & 1 != 0 { -PI / 2. } else { PI / 2. }; } /* z = atan(|y/x|) with correct underflow */ let z = if (m & 2 != 0) && (iy + (26 << 23) < ix) { /*|y/x| < 0x1p-26, x < 0 */ 0. } else { atanf(fabsf(y / x)) }; match m { 0 => z, /* atan(+,+) */ 1 => -z, /* atan(-,+) */ 2 => PI - (z - PI_LO), /* atan(+,-) */ _ => (z - PI_LO) - PI, /* case 3 */ /* atan(-,-) */ } } libm-0.2.1/src/math/atanf.rs010066400017500001750000000060551351140337200140440ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_atanf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::fabsf; const ATAN_HI: [f32; 4] = [ 4.6364760399e-01, /* atan(0.5)hi 0x3eed6338 */ 7.8539812565e-01, /* atan(1.0)hi 0x3f490fda */ 9.8279368877e-01, /* atan(1.5)hi 0x3f7b985e */ 1.5707962513e+00, /* atan(inf)hi 0x3fc90fda */ ]; const ATAN_LO: [f32; 4] = [ 5.0121582440e-09, /* atan(0.5)lo 0x31ac3769 */ 3.7748947079e-08, /* atan(1.0)lo 0x33222168 */ 3.4473217170e-08, /* atan(1.5)lo 0x33140fb4 */ 7.5497894159e-08, /* atan(inf)lo 0x33a22168 */ ]; const A_T: [f32; 5] = [ 3.3333328366e-01, -1.9999158382e-01, 1.4253635705e-01, -1.0648017377e-01, 6.1687607318e-02, ]; /// Arctangent (f32) /// /// Computes the inverse tangent (arc tangent) of the input value. /// Returns a value in radians, in the range of -pi/2 to pi/2. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn atanf(mut x: f32) -> f32 { let x1p_120 = f32::from_bits(0x03800000); // 0x1p-120 === 2 ^ (-120) let z: f32; let mut ix = x.to_bits(); let sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix >= 0x4c800000 { /* if |x| >= 2**26 */ if x.is_nan() { return x; } z = ATAN_HI[3] + x1p_120; return if sign { -z } else { z }; } let id = if ix < 0x3ee00000 { /* |x| < 0.4375 */ if ix < 0x39800000 { /* |x| < 2**-12 */ if ix < 0x00800000 { /* raise underflow for subnormal x */ force_eval!(x * x); } return x; } -1 } else { x = fabsf(x); if ix < 0x3f980000 { /* |x| < 1.1875 */ if ix < 0x3f300000 { /* 7/16 <= |x| < 11/16 */ x = (2. * x - 1.) / (2. + x); 0 } else { /* 11/16 <= |x| < 19/16 */ x = (x - 1.) / (x + 1.); 1 } } else if ix < 0x401c0000 { /* |x| < 2.4375 */ x = (x - 1.5) / (1. + 1.5 * x); 2 } else { /* 2.4375 <= |x| < 2**26 */ x = -1. / x; 3 } }; /* end of argument reduction */ z = x * x; let w = z * z; /* break sum from i=0 to 10 aT[i]z**(i+1) into odd and even poly */ let s1 = z * (A_T[0] + w * (A_T[2] + w * A_T[4])); let s2 = w * (A_T[1] + w * A_T[3]); if id < 0 { return x - x * (s1 + s2); } let id = id as usize; let z = ATAN_HI[id] - ((x * (s1 + s2) - ATAN_LO[id]) - x); if sign { -z } else { z } } libm-0.2.1/src/math/atanh.rs010066400017500001750000000016161351140252100140370ustar0000000000000000use super::log1p; /* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ /// Inverse hyperbolic tangent (f64) /// /// Calculates the inverse hyperbolic tangent of `x`. /// Is defined as `log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2`. pub fn atanh(x: f64) -> f64 { let u = x.to_bits(); let e = ((u >> 52) as usize) & 0x7ff; let sign = (u >> 63) != 0; /* |x| */ let mut y = f64::from_bits(u & 0x7fff_ffff_ffff_ffff); if e < 0x3ff - 1 { if e < 0x3ff - 32 { /* handle underflow */ if e == 0 { force_eval!(y as f32); } } else { /* |x| < 0.5, up to 1.7ulp error */ y = 0.5 * log1p(2.0 * y + 2.0 * y * y / (1.0 - y)); } } else { /* avoid overflow */ y = 0.5 * log1p(2.0 * (y / (1.0 - y))); } if sign { -y } else { y } } libm-0.2.1/src/math/atanhf.rs010066400017500001750000000016141351140252100142030ustar0000000000000000use super::log1pf; /* atanh(x) = log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2 ~= x + x^3/3 + o(x^5) */ /// Inverse hyperbolic tangent (f32) /// /// Calculates the inverse hyperbolic tangent of `x`. /// Is defined as `log((1+x)/(1-x))/2 = log1p(2x/(1-x))/2`. pub fn atanhf(mut x: f32) -> f32 { let mut u = x.to_bits(); let sign = (u >> 31) != 0; /* |x| */ u &= 0x7fffffff; x = f32::from_bits(u); if u < 0x3f800000 - (1 << 23) { if u < 0x3f800000 - (32 << 23) { /* handle underflow */ if u < (1 << 23) { force_eval!((x * x) as f32); } } else { /* |x| < 0.5, up to 1.7ulp error */ x = 0.5 * log1pf(2.0 * x + 2.0 * x * x / (1.0 - x)); } } else { /* avoid overflow */ x = 0.5 * log1pf(2.0 * (x / (1.0 - x))); } if sign { -x } else { x } } libm-0.2.1/src/math/cbrt.rs010066400017500001750000000103671351140255400137070ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrt.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== * * Optimized by Bruce D. Evans. */ /* cbrt(x) * Return cube root of x */ use core::f64; const B1: u32 = 715094163; /* B1 = (1023-1023/3-0.03306235651)*2**20 */ const B2: u32 = 696219795; /* B2 = (1023-1023/3-54/3-0.03306235651)*2**20 */ /* |1/cbrt(x) - p(x)| < 2**-23.5 (~[-7.93e-8, 7.929e-8]). */ const P0: f64 = 1.87595182427177009643; /* 0x3ffe03e6, 0x0f61e692 */ const P1: f64 = -1.88497979543377169875; /* 0xbffe28e0, 0x92f02420 */ const P2: f64 = 1.621429720105354466140; /* 0x3ff9f160, 0x4a49d6c2 */ const P3: f64 = -0.758397934778766047437; /* 0xbfe844cb, 0xbee751d9 */ const P4: f64 = 0.145996192886612446982; /* 0x3fc2b000, 0xd4e4edd7 */ // Cube root (f64) /// /// Computes the cube root of the argument. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn cbrt(x: f64) -> f64 { let x1p54 = f64::from_bits(0x4350000000000000); // 0x1p54 === 2 ^ 54 let mut ui: u64 = x.to_bits(); let mut r: f64; let s: f64; let mut t: f64; let w: f64; let mut hx: u32 = (ui >> 32) as u32 & 0x7fffffff; if hx >= 0x7ff00000 { /* cbrt(NaN,INF) is itself */ return x + x; } /* * Rough cbrt to 5 bits: * cbrt(2**e*(1+m) ~= 2**(e/3)*(1+(e%3+m)/3) * where e is integral and >= 0, m is real and in [0, 1), and "/" and * "%" are integer division and modulus with rounding towards minus * infinity. The RHS is always >= the LHS and has a maximum relative * error of about 1 in 16. Adding a bias of -0.03306235651 to the * (e%3+m)/3 term reduces the error to about 1 in 32. With the IEEE * floating point representation, for finite positive normal values, * ordinary integer divison of the value in bits magically gives * almost exactly the RHS of the above provided we first subtract the * exponent bias (1023 for doubles) and later add it back. We do the * subtraction virtually to keep e >= 0 so that ordinary integer * division rounds towards minus infinity; this is also efficient. */ if hx < 0x00100000 { /* zero or subnormal? */ ui = (x * x1p54).to_bits(); hx = (ui >> 32) as u32 & 0x7fffffff; if hx == 0 { return x; /* cbrt(0) is itself */ } hx = hx / 3 + B2; } else { hx = hx / 3 + B1; } ui &= 1 << 63; ui |= (hx as u64) << 32; t = f64::from_bits(ui); /* * New cbrt to 23 bits: * cbrt(x) = t*cbrt(x/t**3) ~= t*P(t**3/x) * where P(r) is a polynomial of degree 4 that approximates 1/cbrt(r) * to within 2**-23.5 when |r - 1| < 1/10. The rough approximation * has produced t such than |t/cbrt(x) - 1| ~< 1/32, and cubing this * gives us bounds for r = t**3/x. * * Try to optimize for parallel evaluation as in __tanf.c. */ r = (t * t) * (t / x); t = t * ((P0 + r * (P1 + r * P2)) + ((r * r) * r) * (P3 + r * P4)); /* * Round t away from zero to 23 bits (sloppily except for ensuring that * the result is larger in magnitude than cbrt(x) but not much more than * 2 23-bit ulps larger). With rounding towards zero, the error bound * would be ~5/6 instead of ~4/6. With a maximum error of 2 23-bit ulps * in the rounded t, the infinite-precision error in the Newton * approximation barely affects third digit in the final error * 0.667; the error in the rounded t can be up to about 3 23-bit ulps * before the final error is larger than 0.667 ulps. */ ui = t.to_bits(); ui = (ui + 0x80000000) & 0xffffffffc0000000; t = f64::from_bits(ui); /* one step Newton iteration to 53 bits with error < 0.667 ulps */ s = t * t; /* t*t is exact */ r = x / s; /* error <= 0.5 ulps; |r| < |t| */ w = t + t; /* t+t is exact */ r = (r - t) / (w + r); /* r-t is exact; w+r ~= 3*t */ t = t + t * r; /* error <= 0.5 + 0.5/3 + epsilon */ t } libm-0.2.1/src/math/cbrtf.rs010066400017500001750000000041451351140255300140510ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_cbrtf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Debugged and optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* cbrtf(x) * Return cube root of x */ use core::f32; const B1: u32 = 709958130; /* B1 = (127-127.0/3-0.03306235651)*2**23 */ const B2: u32 = 642849266; /* B2 = (127-127.0/3-24/3-0.03306235651)*2**23 */ /// Cube root (f32) /// /// Computes the cube root of the argument. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn cbrtf(x: f32) -> f32 { let x1p24 = f32::from_bits(0x4b800000); // 0x1p24f === 2 ^ 24 let mut r: f64; let mut t: f64; let mut ui: u32 = x.to_bits(); let mut hx: u32 = ui & 0x7fffffff; if hx >= 0x7f800000 { /* cbrt(NaN,INF) is itself */ return x + x; } /* rough cbrt to 5 bits */ if hx < 0x00800000 { /* zero or subnormal? */ if hx == 0 { return x; /* cbrt(+-0) is itself */ } ui = (x * x1p24).to_bits(); hx = ui & 0x7fffffff; hx = hx / 3 + B2; } else { hx = hx / 3 + B1; } ui &= 0x80000000; ui |= hx; /* * First step Newton iteration (solving t*t-x/t == 0) to 16 bits. In * double precision so that its terms can be arranged for efficiency * without causing overflow or underflow. */ t = f32::from_bits(ui) as f64; r = t * t * t; t = t * (x as f64 + x as f64 + r) / (x as f64 + r + r); /* * Second step Newton iteration to 47 bits. In double precision for * efficiency and accuracy. */ r = t * t * t; t = t * (x as f64 + x as f64 + r) / (x as f64 + r + r); /* rounding to 24 bits is perfect in round-to-nearest mode */ t as f32 } libm-0.2.1/src/math/ceil.rs010066400017500001750000000031301353572366000136710ustar0000000000000000use core::f64; const TOINT: f64 = 1. / f64::EPSILON; /// Ceil (f64) /// /// Finds the nearest integer greater than or equal to `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn ceil(x: f64) -> f64 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f64.ceil` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::ceilf64(x) } } } let u: u64 = x.to_bits(); let e: i64 = (u >> 52 & 0x7ff) as i64; let y: f64; if e >= 0x3ff + 52 || x == 0. { return x; } // y = int(x) - x, where int(x) is an integer neighbor of x y = if (u >> 63) != 0 { x - TOINT + TOINT - x } else { x + TOINT - TOINT - x }; // special case because of non-nearest rounding modes if e < 0x3ff { force_eval!(y); return if (u >> 63) != 0 { -0. } else { 1. }; } if y < 0. { x + y + 1. } else { x + y } } #[cfg(test)] mod tests { use super::*; use core::f64::*; #[test] fn sanity_check() { assert_eq!(ceil(1.1), 2.0); assert_eq!(ceil(2.9), 3.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/ceil #[test] fn spec_tests() { // Not Asserted: that the current rounding mode has no effect. assert!(ceil(NAN).is_nan()); for f in [0.0, -0.0, INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(ceil(f), f); } } } libm-0.2.1/src/math/ceilf.rs010066400017500001750000000031271353572366000140450ustar0000000000000000use core::f32; /// Ceil (f32) /// /// Finds the nearest integer greater than or equal to `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn ceilf(x: f32) -> f32 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f32.ceil` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::ceilf32(x) } } } let mut ui = x.to_bits(); let e = (((ui >> 23) & 0xff).wrapping_sub(0x7f)) as i32; if e >= 23 { return x; } if e >= 0 { let m = 0x007fffff >> e; if (ui & m) == 0 { return x; } force_eval!(x + f32::from_bits(0x7b800000)); if ui >> 31 == 0 { ui += m; } ui &= !m; } else { force_eval!(x + f32::from_bits(0x7b800000)); if ui >> 31 != 0 { return -0.0; } else if ui << 1 != 0 { return 1.0; } } f32::from_bits(ui) } #[cfg(test)] mod tests { use super::*; use core::f32::*; #[test] fn sanity_check() { assert_eq!(ceilf(1.1), 2.0); assert_eq!(ceilf(2.9), 3.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/ceil #[test] fn spec_tests() { // Not Asserted: that the current rounding mode has no effect. assert!(ceilf(NAN).is_nan()); for f in [0.0, -0.0, INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(ceilf(f), f); } } } libm-0.2.1/src/math/copysign.rs010066400017500001750000000005271351140252100145770ustar0000000000000000/// Sign of Y, magnitude of X (f64) /// /// Constructs a number with the magnitude (absolute value) of its /// first argument, `x`, and the sign of its second argument, `y`. pub fn copysign(x: f64, y: f64) -> f64 { let mut ux = x.to_bits(); let uy = y.to_bits(); ux &= (!0) >> 1; ux |= uy & (1 << 63); f64::from_bits(ux) } libm-0.2.1/src/math/copysignf.rs010066400017500001750000000005321351140252100147410ustar0000000000000000/// Sign of Y, magnitude of X (f32) /// /// Constructs a number with the magnitude (absolute value) of its /// first argument, `x`, and the sign of its second argument, `y`. pub fn copysignf(x: f32, y: f32) -> f32 { let mut ux = x.to_bits(); let uy = y.to_bits(); ux &= 0x7fffffff; ux |= uy & 0x80000000; f32::from_bits(ux) } libm-0.2.1/src/math/cos.rs010066400017500001750000000043171351140312100135260ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/s_cos.c */ // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunPro, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== use super::{k_cos, k_sin, rem_pio2}; // cos(x) // Return cosine function of x. // // kernel function: // k_sin ... sine function on [-pi/4,pi/4] // k_cos ... cosine function on [-pi/4,pi/4] // rem_pio2 ... argument reduction routine // // Method. // Let S,C and T denote the sin, cos and tan respectively on // [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 // in [-pi/4 , +pi/4], and let n = k mod 4. // We have // // n sin(x) cos(x) tan(x) // ---------------------------------------------------------- // 0 S C T // 1 C -S -1/T // 2 -S -C T // 3 -C S -1/T // ---------------------------------------------------------- // // Special cases: // Let trig be any of sin, cos, or tan. // trig(+-INF) is NaN, with signals; // trig(NaN) is that NaN; // // Accuracy: // TRIG(x) returns trig(x) nearly rounded // #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn cos(x: f64) -> f64 { let ix = (f64::to_bits(x) >> 32) as u32 & 0x7fffffff; /* |x| ~< pi/4 */ if ix <= 0x3fe921fb { if ix < 0x3e46a09e { /* if x < 2**-27 * sqrt(2) */ /* raise inexact if x != 0 */ if x as i32 == 0 { return 1.0; } } return k_cos(x, 0.0); } /* cos(Inf or NaN) is NaN */ if ix >= 0x7ff00000 { return x - x; } /* argument reduction needed */ let (n, y0, y1) = rem_pio2(x); match n & 3 { 0 => k_cos(y0, y1), 1 => -k_sin(y0, y1, 1), 2 => -k_cos(y0, y1), _ => k_sin(y0, y1, 1), } } libm-0.2.1/src/math/cosf.rs010066400017500001750000000046061353572365600137250ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_cosf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{k_cosf, k_sinf, rem_pio2f}; use core::f64::consts::FRAC_PI_2; /* Small multiples of pi/2 rounded to double precision. */ const C1_PIO2: f64 = 1. * FRAC_PI_2; /* 0x3FF921FB, 0x54442D18 */ const C2_PIO2: f64 = 2. * FRAC_PI_2; /* 0x400921FB, 0x54442D18 */ const C3_PIO2: f64 = 3. * FRAC_PI_2; /* 0x4012D97C, 0x7F3321D2 */ const C4_PIO2: f64 = 4. * FRAC_PI_2; /* 0x401921FB, 0x54442D18 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn cosf(x: f32) -> f32 { let x64 = x as f64; let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 let mut ix = x.to_bits(); let sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix <= 0x3f490fda { /* |x| ~<= pi/4 */ if ix < 0x39800000 { /* |x| < 2**-12 */ /* raise inexact if x != 0 */ force_eval!(x + x1p120); return 1.; } return k_cosf(x64); } if ix <= 0x407b53d1 { /* |x| ~<= 5*pi/4 */ if ix > 0x4016cbe3 { /* |x| ~> 3*pi/4 */ return -k_cosf(if sign { x64 + C2_PIO2 } else { x64 - C2_PIO2 }); } else if sign { return k_sinf(x64 + C1_PIO2); } else { return k_sinf(C1_PIO2 - x64); } } if ix <= 0x40e231d5 { /* |x| ~<= 9*pi/4 */ if ix > 0x40afeddf { /* |x| ~> 7*pi/4 */ return k_cosf(if sign { x64 + C4_PIO2 } else { x64 - C4_PIO2 }); } else if sign { return k_sinf(-x64 - C3_PIO2); } else { return k_sinf(x64 - C3_PIO2); } } /* cos(Inf or NaN) is NaN */ if ix >= 0x7f800000 { return x - x; } /* general argument reduction needed */ let (n, y) = rem_pio2f(x); match n & 3 { 0 => k_cosf(y), 1 => k_sinf(-y), 2 => -k_cosf(y), _ => k_sinf(y), } } libm-0.2.1/src/math/cosh.rs010066400017500001750000000017411351140310600136770ustar0000000000000000use super::exp; use super::expm1; use super::k_expo2; /// Hyperbolic cosine (f64) /// /// Computes the hyperbolic cosine of the argument x. /// Is defined as `(exp(x) + exp(-x))/2` /// Angles are specified in radians. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn cosh(mut x: f64) -> f64 { /* |x| */ let mut ix = x.to_bits(); ix &= 0x7fffffffffffffff; x = f64::from_bits(ix); let w = ix >> 32; /* |x| < log(2) */ if w < 0x3fe62e42 { if w < 0x3ff00000 - (26 << 20) { let x1p120 = f64::from_bits(0x4770000000000000); force_eval!(x + x1p120); return 1.; } let t = expm1(x); // exponential minus 1 return 1. + t * t / (2. * (1. + t)); } /* |x| < log(DBL_MAX) */ if w < 0x40862e42 { let t = exp(x); /* note: if x>log(0x1p26) then the 1/t is not needed */ return 0.5 * (t + 1. / t); } /* |x| > log(DBL_MAX) or nan */ k_expo2(x) } libm-0.2.1/src/math/coshf.rs010066400017500001750000000016161351140267500140600ustar0000000000000000use super::expf; use super::expm1f; use super::k_expo2f; /// Hyperbolic cosine (f64) /// /// Computes the hyperbolic cosine of the argument x. /// Is defined as `(exp(x) + exp(-x))/2` /// Angles are specified in radians. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn coshf(mut x: f32) -> f32 { let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 /* |x| */ let mut ix = x.to_bits(); ix &= 0x7fffffff; x = f32::from_bits(ix); let w = ix; /* |x| < log(2) */ if w < 0x3f317217 { if w < (0x3f800000 - (12 << 23)) { force_eval!(x + x1p120); return 1.; } let t = expm1f(x); return 1. + t * t / (2. * (1. + t)); } /* |x| < log(FLT_MAX) */ if w < 0x42b17217 { let t = expf(x); return 0.5 * (t + 1. / t); } /* |x| > log(FLT_MAX) or nan */ k_expo2f(x) } libm-0.2.1/src/math/erf.rs010066400017500001750000000304351351140252100135210ustar0000000000000000use super::{exp, fabs, get_high_word, with_set_low_word}; /* origin: FreeBSD /usr/src/lib/msun/src/s_erf.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* double erf(double x) * double erfc(double x) * x * 2 |\ * erf(x) = --------- | exp(-t*t)dt * sqrt(pi) \| * 0 * * erfc(x) = 1-erf(x) * Note that * erf(-x) = -erf(x) * erfc(-x) = 2 - erfc(x) * * Method: * 1. For |x| in [0, 0.84375] * erf(x) = x + x*R(x^2) * erfc(x) = 1 - erf(x) if x in [-.84375,0.25] * = 0.5 + ((0.5-x)-x*R) if x in [0.25,0.84375] * where R = P/Q where P is an odd poly of degree 8 and * Q is an odd poly of degree 10. * -57.90 * | R - (erf(x)-x)/x | <= 2 * * * Remark. The formula is derived by noting * erf(x) = (2/sqrt(pi))*(x - x^3/3 + x^5/10 - x^7/42 + ....) * and that * 2/sqrt(pi) = 1.128379167095512573896158903121545171688 * is close to one. The interval is chosen because the fix * point of erf(x) is near 0.6174 (i.e., erf(x)=x when x is * near 0.6174), and by some experiment, 0.84375 is chosen to * guarantee the error is less than one ulp for erf. * * 2. For |x| in [0.84375,1.25], let s = |x| - 1, and * c = 0.84506291151 rounded to single (24 bits) * erf(x) = sign(x) * (c + P1(s)/Q1(s)) * erfc(x) = (1-c) - P1(s)/Q1(s) if x > 0 * 1+(c+P1(s)/Q1(s)) if x < 0 * |P1/Q1 - (erf(|x|)-c)| <= 2**-59.06 * Remark: here we use the taylor series expansion at x=1. * erf(1+s) = erf(1) + s*Poly(s) * = 0.845.. + P1(s)/Q1(s) * That is, we use rational approximation to approximate * erf(1+s) - (c = (single)0.84506291151) * Note that |P1/Q1|< 0.078 for x in [0.84375,1.25] * where * P1(s) = degree 6 poly in s * Q1(s) = degree 6 poly in s * * 3. For x in [1.25,1/0.35(~2.857143)], * erfc(x) = (1/x)*exp(-x*x-0.5625+R1/S1) * erf(x) = 1 - erfc(x) * where * R1(z) = degree 7 poly in z, (z=1/x^2) * S1(z) = degree 8 poly in z * * 4. For x in [1/0.35,28] * erfc(x) = (1/x)*exp(-x*x-0.5625+R2/S2) if x > 0 * = 2.0 - (1/x)*exp(-x*x-0.5625+R2/S2) if -6 x >= 28 * erf(x) = sign(x) *(1 - tiny) (raise inexact) * erfc(x) = tiny*tiny (raise underflow) if x > 0 * = 2 - tiny if x<0 * * 7. Special case: * erf(0) = 0, erf(inf) = 1, erf(-inf) = -1, * erfc(0) = 1, erfc(inf) = 0, erfc(-inf) = 2, * erfc/erf(NaN) is NaN */ const ERX: f64 = 8.45062911510467529297e-01; /* 0x3FEB0AC1, 0x60000000 */ /* * Coefficients for approximation to erf on [0,0.84375] */ const EFX8: f64 = 1.02703333676410069053e+00; /* 0x3FF06EBA, 0x8214DB69 */ const PP0: f64 = 1.28379167095512558561e-01; /* 0x3FC06EBA, 0x8214DB68 */ const PP1: f64 = -3.25042107247001499370e-01; /* 0xBFD4CD7D, 0x691CB913 */ const PP2: f64 = -2.84817495755985104766e-02; /* 0xBF9D2A51, 0xDBD7194F */ const PP3: f64 = -5.77027029648944159157e-03; /* 0xBF77A291, 0x236668E4 */ const PP4: f64 = -2.37630166566501626084e-05; /* 0xBEF8EAD6, 0x120016AC */ const QQ1: f64 = 3.97917223959155352819e-01; /* 0x3FD97779, 0xCDDADC09 */ const QQ2: f64 = 6.50222499887672944485e-02; /* 0x3FB0A54C, 0x5536CEBA */ const QQ3: f64 = 5.08130628187576562776e-03; /* 0x3F74D022, 0xC4D36B0F */ const QQ4: f64 = 1.32494738004321644526e-04; /* 0x3F215DC9, 0x221C1A10 */ const QQ5: f64 = -3.96022827877536812320e-06; /* 0xBED09C43, 0x42A26120 */ /* * Coefficients for approximation to erf in [0.84375,1.25] */ const PA0: f64 = -2.36211856075265944077e-03; /* 0xBF6359B8, 0xBEF77538 */ const PA1: f64 = 4.14856118683748331666e-01; /* 0x3FDA8D00, 0xAD92B34D */ const PA2: f64 = -3.72207876035701323847e-01; /* 0xBFD7D240, 0xFBB8C3F1 */ const PA3: f64 = 3.18346619901161753674e-01; /* 0x3FD45FCA, 0x805120E4 */ const PA4: f64 = -1.10894694282396677476e-01; /* 0xBFBC6398, 0x3D3E28EC */ const PA5: f64 = 3.54783043256182359371e-02; /* 0x3FA22A36, 0x599795EB */ const PA6: f64 = -2.16637559486879084300e-03; /* 0xBF61BF38, 0x0A96073F */ const QA1: f64 = 1.06420880400844228286e-01; /* 0x3FBB3E66, 0x18EEE323 */ const QA2: f64 = 5.40397917702171048937e-01; /* 0x3FE14AF0, 0x92EB6F33 */ const QA3: f64 = 7.18286544141962662868e-02; /* 0x3FB2635C, 0xD99FE9A7 */ const QA4: f64 = 1.26171219808761642112e-01; /* 0x3FC02660, 0xE763351F */ const QA5: f64 = 1.36370839120290507362e-02; /* 0x3F8BEDC2, 0x6B51DD1C */ const QA6: f64 = 1.19844998467991074170e-02; /* 0x3F888B54, 0x5735151D */ /* * Coefficients for approximation to erfc in [1.25,1/0.35] */ const RA0: f64 = -9.86494403484714822705e-03; /* 0xBF843412, 0x600D6435 */ const RA1: f64 = -6.93858572707181764372e-01; /* 0xBFE63416, 0xE4BA7360 */ const RA2: f64 = -1.05586262253232909814e+01; /* 0xC0251E04, 0x41B0E726 */ const RA3: f64 = -6.23753324503260060396e+01; /* 0xC04F300A, 0xE4CBA38D */ const RA4: f64 = -1.62396669462573470355e+02; /* 0xC0644CB1, 0x84282266 */ const RA5: f64 = -1.84605092906711035994e+02; /* 0xC067135C, 0xEBCCABB2 */ const RA6: f64 = -8.12874355063065934246e+01; /* 0xC0545265, 0x57E4D2F2 */ const RA7: f64 = -9.81432934416914548592e+00; /* 0xC023A0EF, 0xC69AC25C */ const SA1: f64 = 1.96512716674392571292e+01; /* 0x4033A6B9, 0xBD707687 */ const SA2: f64 = 1.37657754143519042600e+02; /* 0x4061350C, 0x526AE721 */ const SA3: f64 = 4.34565877475229228821e+02; /* 0x407B290D, 0xD58A1A71 */ const SA4: f64 = 6.45387271733267880336e+02; /* 0x40842B19, 0x21EC2868 */ const SA5: f64 = 4.29008140027567833386e+02; /* 0x407AD021, 0x57700314 */ const SA6: f64 = 1.08635005541779435134e+02; /* 0x405B28A3, 0xEE48AE2C */ const SA7: f64 = 6.57024977031928170135e+00; /* 0x401A47EF, 0x8E484A93 */ const SA8: f64 = -6.04244152148580987438e-02; /* 0xBFAEEFF2, 0xEE749A62 */ /* * Coefficients for approximation to erfc in [1/.35,28] */ const RB0: f64 = -9.86494292470009928597e-03; /* 0xBF843412, 0x39E86F4A */ const RB1: f64 = -7.99283237680523006574e-01; /* 0xBFE993BA, 0x70C285DE */ const RB2: f64 = -1.77579549177547519889e+01; /* 0xC031C209, 0x555F995A */ const RB3: f64 = -1.60636384855821916062e+02; /* 0xC064145D, 0x43C5ED98 */ const RB4: f64 = -6.37566443368389627722e+02; /* 0xC083EC88, 0x1375F228 */ const RB5: f64 = -1.02509513161107724954e+03; /* 0xC0900461, 0x6A2E5992 */ const RB6: f64 = -4.83519191608651397019e+02; /* 0xC07E384E, 0x9BDC383F */ const SB1: f64 = 3.03380607434824582924e+01; /* 0x403E568B, 0x261D5190 */ const SB2: f64 = 3.25792512996573918826e+02; /* 0x40745CAE, 0x221B9F0A */ const SB3: f64 = 1.53672958608443695994e+03; /* 0x409802EB, 0x189D5118 */ const SB4: f64 = 3.19985821950859553908e+03; /* 0x40A8FFB7, 0x688C246A */ const SB5: f64 = 2.55305040643316442583e+03; /* 0x40A3F219, 0xCEDF3BE6 */ const SB6: f64 = 4.74528541206955367215e+02; /* 0x407DA874, 0xE79FE763 */ const SB7: f64 = -2.24409524465858183362e+01; /* 0xC03670E2, 0x42712D62 */ fn erfc1(x: f64) -> f64 { let s: f64; let p: f64; let q: f64; s = fabs(x) - 1.0; p = PA0 + s * (PA1 + s * (PA2 + s * (PA3 + s * (PA4 + s * (PA5 + s * PA6))))); q = 1.0 + s * (QA1 + s * (QA2 + s * (QA3 + s * (QA4 + s * (QA5 + s * QA6))))); 1.0 - ERX - p / q } fn erfc2(ix: u32, mut x: f64) -> f64 { let s: f64; let r: f64; let big_s: f64; let z: f64; if ix < 0x3ff40000 { /* |x| < 1.25 */ return erfc1(x); } x = fabs(x); s = 1.0 / (x * x); if ix < 0x4006db6d { /* |x| < 1/.35 ~ 2.85714 */ r = RA0 + s * (RA1 + s * (RA2 + s * (RA3 + s * (RA4 + s * (RA5 + s * (RA6 + s * RA7)))))); big_s = 1.0 + s * (SA1 + s * (SA2 + s * (SA3 + s * (SA4 + s * (SA5 + s * (SA6 + s * (SA7 + s * SA8))))))); } else { /* |x| > 1/.35 */ r = RB0 + s * (RB1 + s * (RB2 + s * (RB3 + s * (RB4 + s * (RB5 + s * RB6))))); big_s = 1.0 + s * (SB1 + s * (SB2 + s * (SB3 + s * (SB4 + s * (SB5 + s * (SB6 + s * SB7)))))); } z = with_set_low_word(x, 0); exp(-z * z - 0.5625) * exp((z - x) * (z + x) + r / big_s) / x } /// Error function (f64) /// /// Calculates an approximation to the “error function”, which estimates /// the probability that an observation will fall within x standard /// deviations of the mean (assuming a normal distribution). pub fn erf(x: f64) -> f64 { let r: f64; let s: f64; let z: f64; let y: f64; let mut ix: u32; let sign: usize; ix = get_high_word(x); sign = (ix >> 31) as usize; ix &= 0x7fffffff; if ix >= 0x7ff00000 { /* erf(nan)=nan, erf(+-inf)=+-1 */ return 1.0 - 2.0 * (sign as f64) + 1.0 / x; } if ix < 0x3feb0000 { /* |x| < 0.84375 */ if ix < 0x3e300000 { /* |x| < 2**-28 */ /* avoid underflow */ return 0.125 * (8.0 * x + EFX8 * x); } z = x * x; r = PP0 + z * (PP1 + z * (PP2 + z * (PP3 + z * PP4))); s = 1.0 + z * (QQ1 + z * (QQ2 + z * (QQ3 + z * (QQ4 + z * QQ5)))); y = r / s; return x + x * y; } if ix < 0x40180000 { /* 0.84375 <= |x| < 6 */ y = 1.0 - erfc2(ix, x); } else { let x1p_1022 = f64::from_bits(0x0010000000000000); y = 1.0 - x1p_1022; } if sign != 0 { -y } else { y } } /// Error function (f64) /// /// Calculates the complementary probability. /// Is `1 - erf(x)`. Is computed directly, so that you can use it to avoid /// the loss of precision that would result from subtracting /// large probabilities (on large `x`) from 1. pub fn erfc(x: f64) -> f64 { let r: f64; let s: f64; let z: f64; let y: f64; let mut ix: u32; let sign: usize; ix = get_high_word(x); sign = (ix >> 31) as usize; ix &= 0x7fffffff; if ix >= 0x7ff00000 { /* erfc(nan)=nan, erfc(+-inf)=0,2 */ return 2.0 * (sign as f64) + 1.0 / x; } if ix < 0x3feb0000 { /* |x| < 0.84375 */ if ix < 0x3c700000 { /* |x| < 2**-56 */ return 1.0 - x; } z = x * x; r = PP0 + z * (PP1 + z * (PP2 + z * (PP3 + z * PP4))); s = 1.0 + z * (QQ1 + z * (QQ2 + z * (QQ3 + z * (QQ4 + z * QQ5)))); y = r / s; if sign != 0 || ix < 0x3fd00000 { /* x < 1/4 */ return 1.0 - (x + x * y); } return 0.5 - (x - 0.5 + x * y); } if ix < 0x403c0000 { /* 0.84375 <= |x| < 28 */ if sign != 0 { return 2.0 - erfc2(ix, x); } else { return erfc2(ix, x); } } let x1p_1022 = f64::from_bits(0x0010000000000000); if sign != 0 { 2.0 - x1p_1022 } else { x1p_1022 * x1p_1022 } } libm-0.2.1/src/math/erff.rs010066400017500001750000000165461351140252100136760ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_erff.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{expf, fabsf}; const ERX: f32 = 8.4506291151e-01; /* 0x3f58560b */ /* * Coefficients for approximation to erf on [0,0.84375] */ const EFX8: f32 = 1.0270333290e+00; /* 0x3f8375d4 */ const PP0: f32 = 1.2837916613e-01; /* 0x3e0375d4 */ const PP1: f32 = -3.2504209876e-01; /* 0xbea66beb */ const PP2: f32 = -2.8481749818e-02; /* 0xbce9528f */ const PP3: f32 = -5.7702702470e-03; /* 0xbbbd1489 */ const PP4: f32 = -2.3763017452e-05; /* 0xb7c756b1 */ const QQ1: f32 = 3.9791721106e-01; /* 0x3ecbbbce */ const QQ2: f32 = 6.5022252500e-02; /* 0x3d852a63 */ const QQ3: f32 = 5.0813062117e-03; /* 0x3ba68116 */ const QQ4: f32 = 1.3249473704e-04; /* 0x390aee49 */ const QQ5: f32 = -3.9602282413e-06; /* 0xb684e21a */ /* * Coefficients for approximation to erf in [0.84375,1.25] */ const PA0: f32 = -2.3621185683e-03; /* 0xbb1acdc6 */ const PA1: f32 = 4.1485610604e-01; /* 0x3ed46805 */ const PA2: f32 = -3.7220788002e-01; /* 0xbebe9208 */ const PA3: f32 = 3.1834661961e-01; /* 0x3ea2fe54 */ const PA4: f32 = -1.1089469492e-01; /* 0xbde31cc2 */ const PA5: f32 = 3.5478305072e-02; /* 0x3d1151b3 */ const PA6: f32 = -2.1663755178e-03; /* 0xbb0df9c0 */ const QA1: f32 = 1.0642088205e-01; /* 0x3dd9f331 */ const QA2: f32 = 5.4039794207e-01; /* 0x3f0a5785 */ const QA3: f32 = 7.1828655899e-02; /* 0x3d931ae7 */ const QA4: f32 = 1.2617121637e-01; /* 0x3e013307 */ const QA5: f32 = 1.3637083583e-02; /* 0x3c5f6e13 */ const QA6: f32 = 1.1984500103e-02; /* 0x3c445aa3 */ /* * Coefficients for approximation to erfc in [1.25,1/0.35] */ const RA0: f32 = -9.8649440333e-03; /* 0xbc21a093 */ const RA1: f32 = -6.9385856390e-01; /* 0xbf31a0b7 */ const RA2: f32 = -1.0558626175e+01; /* 0xc128f022 */ const RA3: f32 = -6.2375331879e+01; /* 0xc2798057 */ const RA4: f32 = -1.6239666748e+02; /* 0xc322658c */ const RA5: f32 = -1.8460508728e+02; /* 0xc3389ae7 */ const RA6: f32 = -8.1287437439e+01; /* 0xc2a2932b */ const RA7: f32 = -9.8143291473e+00; /* 0xc11d077e */ const SA1: f32 = 1.9651271820e+01; /* 0x419d35ce */ const SA2: f32 = 1.3765776062e+02; /* 0x4309a863 */ const SA3: f32 = 4.3456588745e+02; /* 0x43d9486f */ const SA4: f32 = 6.4538726807e+02; /* 0x442158c9 */ const SA5: f32 = 4.2900814819e+02; /* 0x43d6810b */ const SA6: f32 = 1.0863500214e+02; /* 0x42d9451f */ const SA7: f32 = 6.5702495575e+00; /* 0x40d23f7c */ const SA8: f32 = -6.0424413532e-02; /* 0xbd777f97 */ /* * Coefficients for approximation to erfc in [1/.35,28] */ const RB0: f32 = -9.8649431020e-03; /* 0xbc21a092 */ const RB1: f32 = -7.9928326607e-01; /* 0xbf4c9dd4 */ const RB2: f32 = -1.7757955551e+01; /* 0xc18e104b */ const RB3: f32 = -1.6063638306e+02; /* 0xc320a2ea */ const RB4: f32 = -6.3756646729e+02; /* 0xc41f6441 */ const RB5: f32 = -1.0250950928e+03; /* 0xc480230b */ const RB6: f32 = -4.8351919556e+02; /* 0xc3f1c275 */ const SB1: f32 = 3.0338060379e+01; /* 0x41f2b459 */ const SB2: f32 = 3.2579251099e+02; /* 0x43a2e571 */ const SB3: f32 = 1.5367296143e+03; /* 0x44c01759 */ const SB4: f32 = 3.1998581543e+03; /* 0x4547fdbb */ const SB5: f32 = 2.5530502930e+03; /* 0x451f90ce */ const SB6: f32 = 4.7452853394e+02; /* 0x43ed43a7 */ const SB7: f32 = -2.2440952301e+01; /* 0xc1b38712 */ fn erfc1(x: f32) -> f32 { let s: f32; let p: f32; let q: f32; s = fabsf(x) - 1.0; p = PA0 + s * (PA1 + s * (PA2 + s * (PA3 + s * (PA4 + s * (PA5 + s * PA6))))); q = 1.0 + s * (QA1 + s * (QA2 + s * (QA3 + s * (QA4 + s * (QA5 + s * QA6))))); return 1.0 - ERX - p / q; } fn erfc2(mut ix: u32, mut x: f32) -> f32 { let s: f32; let r: f32; let big_s: f32; let z: f32; if ix < 0x3fa00000 { /* |x| < 1.25 */ return erfc1(x); } x = fabsf(x); s = 1.0 / (x * x); if ix < 0x4036db6d { /* |x| < 1/0.35 */ r = RA0 + s * (RA1 + s * (RA2 + s * (RA3 + s * (RA4 + s * (RA5 + s * (RA6 + s * RA7)))))); big_s = 1.0 + s * (SA1 + s * (SA2 + s * (SA3 + s * (SA4 + s * (SA5 + s * (SA6 + s * (SA7 + s * SA8))))))); } else { /* |x| >= 1/0.35 */ r = RB0 + s * (RB1 + s * (RB2 + s * (RB3 + s * (RB4 + s * (RB5 + s * RB6))))); big_s = 1.0 + s * (SB1 + s * (SB2 + s * (SB3 + s * (SB4 + s * (SB5 + s * (SB6 + s * SB7)))))); } ix = x.to_bits(); z = f32::from_bits(ix & 0xffffe000); expf(-z * z - 0.5625) * expf((z - x) * (z + x) + r / big_s) / x } /// Error function (f32) /// /// Calculates an approximation to the “error function”, which estimates /// the probability that an observation will fall within x standard /// deviations of the mean (assuming a normal distribution). pub fn erff(x: f32) -> f32 { let r: f32; let s: f32; let z: f32; let y: f32; let mut ix: u32; let sign: usize; ix = x.to_bits(); sign = (ix >> 31) as usize; ix &= 0x7fffffff; if ix >= 0x7f800000 { /* erf(nan)=nan, erf(+-inf)=+-1 */ return 1.0 - 2.0 * (sign as f32) + 1.0 / x; } if ix < 0x3f580000 { /* |x| < 0.84375 */ if ix < 0x31800000 { /* |x| < 2**-28 */ /*avoid underflow */ return 0.125 * (8.0 * x + EFX8 * x); } z = x * x; r = PP0 + z * (PP1 + z * (PP2 + z * (PP3 + z * PP4))); s = 1.0 + z * (QQ1 + z * (QQ2 + z * (QQ3 + z * (QQ4 + z * QQ5)))); y = r / s; return x + x * y; } if ix < 0x40c00000 { /* |x| < 6 */ y = 1.0 - erfc2(ix, x); } else { let x1p_120 = f32::from_bits(0x03800000); y = 1.0 - x1p_120; } if sign != 0 { -y } else { y } } /// Error function (f32) /// /// Calculates the complementary probability. /// Is `1 - erf(x)`. Is computed directly, so that you can use it to avoid /// the loss of precision that would result from subtracting /// large probabilities (on large `x`) from 1. pub fn erfcf(x: f32) -> f32 { let r: f32; let s: f32; let z: f32; let y: f32; let mut ix: u32; let sign: usize; ix = x.to_bits(); sign = (ix >> 31) as usize; ix &= 0x7fffffff; if ix >= 0x7f800000 { /* erfc(nan)=nan, erfc(+-inf)=0,2 */ return 2.0 * (sign as f32) + 1.0 / x; } if ix < 0x3f580000 { /* |x| < 0.84375 */ if ix < 0x23800000 { /* |x| < 2**-56 */ return 1.0 - x; } z = x * x; r = PP0 + z * (PP1 + z * (PP2 + z * (PP3 + z * PP4))); s = 1.0 + z * (QQ1 + z * (QQ2 + z * (QQ3 + z * (QQ4 + z * QQ5)))); y = r / s; if sign != 0 || ix < 0x3e800000 { /* x < 1/4 */ return 1.0 - (x + x * y); } return 0.5 - (x - 0.5 + x * y); } if ix < 0x41e00000 { /* |x| < 28 */ if sign != 0 { return 2.0 - erfc2(ix, x); } else { return erfc2(ix, x); } } let x1p_120 = f32::from_bits(0x03800000); if sign != 0 { 2.0 - x1p_120 } else { x1p_120 * x1p_120 } } libm-0.2.1/src/math/exp.rs010066400017500001750000000117471351140313500135500ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_exp.c */ /* * ==================================================== * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. * * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* exp(x) * Returns the exponential of x. * * Method * 1. Argument reduction: * Reduce x to an r so that |r| <= 0.5*ln2 ~ 0.34658. * Given x, find r and integer k such that * * x = k*ln2 + r, |r| <= 0.5*ln2. * * Here r will be represented as r = hi-lo for better * accuracy. * * 2. Approximation of exp(r) by a special rational function on * the interval [0,0.34658]: * Write * R(r**2) = r*(exp(r)+1)/(exp(r)-1) = 2 + r*r/6 - r**4/360 + ... * We use a special Remez algorithm on [0,0.34658] to generate * a polynomial of degree 5 to approximate R. The maximum error * of this polynomial approximation is bounded by 2**-59. In * other words, * R(z) ~ 2.0 + P1*z + P2*z**2 + P3*z**3 + P4*z**4 + P5*z**5 * (where z=r*r, and the values of P1 to P5 are listed below) * and * | 5 | -59 * | 2.0+P1*z+...+P5*z - R(z) | <= 2 * | | * The computation of exp(r) thus becomes * 2*r * exp(r) = 1 + ---------- * R(r) - r * r*c(r) * = 1 + r + ----------- (for better accuracy) * 2 - c(r) * where * 2 4 10 * c(r) = r - (P1*r + P2*r + ... + P5*r ). * * 3. Scale back to obtain exp(x): * From step 1, we have * exp(x) = 2^k * exp(r) * * Special cases: * exp(INF) is INF, exp(NaN) is NaN; * exp(-INF) is 0, and * for finite argument, only exp(0)=1 is exact. * * Accuracy: * according to an error analysis, the error is always less than * 1 ulp (unit in the last place). * * Misc. info. * For IEEE double * if x > 709.782712893383973096 then exp(x) overflows * if x < -745.133219101941108420 then exp(x) underflows */ use super::scalbn; const HALF: [f64; 2] = [0.5, -0.5]; const LN2HI: f64 = 6.93147180369123816490e-01; /* 0x3fe62e42, 0xfee00000 */ const LN2LO: f64 = 1.90821492927058770002e-10; /* 0x3dea39ef, 0x35793c76 */ const INVLN2: f64 = 1.44269504088896338700e+00; /* 0x3ff71547, 0x652b82fe */ const P1: f64 = 1.66666666666666019037e-01; /* 0x3FC55555, 0x5555553E */ const P2: f64 = -2.77777777770155933842e-03; /* 0xBF66C16C, 0x16BEBD93 */ const P3: f64 = 6.61375632143793436117e-05; /* 0x3F11566A, 0xAF25DE2C */ const P4: f64 = -1.65339022054652515390e-06; /* 0xBEBBBD41, 0xC5D26BF1 */ const P5: f64 = 4.13813679705723846039e-08; /* 0x3E663769, 0x72BEA4D0 */ /// Exponential, base *e* (f64) /// /// Calculate the exponential of `x`, that is, *e* raised to the power `x` /// (where *e* is the base of the natural system of logarithms, approximately 2.71828). #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn exp(mut x: f64) -> f64 { let x1p1023 = f64::from_bits(0x7fe0000000000000); // 0x1p1023 === 2 ^ 1023 let x1p_149 = f64::from_bits(0x36a0000000000000); // 0x1p-149 === 2 ^ -149 let hi: f64; let lo: f64; let c: f64; let xx: f64; let y: f64; let k: i32; let sign: i32; let mut hx: u32; hx = (x.to_bits() >> 32) as u32; sign = (hx >> 31) as i32; hx &= 0x7fffffff; /* high word of |x| */ /* special cases */ if hx >= 0x4086232b { /* if |x| >= 708.39... */ if x.is_nan() { return x; } if x > 709.782712893383973096 { /* overflow if x!=inf */ x *= x1p1023; return x; } if x < -708.39641853226410622 { /* underflow if x!=-inf */ force_eval!((-x1p_149 / x) as f32); if x < -745.13321910194110842 { return 0.; } } } /* argument reduction */ if hx > 0x3fd62e42 { /* if |x| > 0.5 ln2 */ if hx >= 0x3ff0a2b2 { /* if |x| >= 1.5 ln2 */ k = (INVLN2 * x + HALF[sign as usize]) as i32; } else { k = 1 - sign - sign; } hi = x - k as f64 * LN2HI; /* k*ln2hi is exact here */ lo = k as f64 * LN2LO; x = hi - lo; } else if hx > 0x3e300000 { /* if |x| > 2**-28 */ k = 0; hi = x; lo = 0.; } else { /* inexact if x!=0 */ force_eval!(x1p1023 + x); return 1. + x; } /* x is now in primary range */ xx = x * x; c = x - xx * (P1 + xx * (P2 + xx * (P3 + xx * (P4 + xx * P5)))); y = 1. + (x * c / (2. - c) - lo + hi); if k == 0 { y } else { scalbn(y, k) } } libm-0.2.1/src/math/exp10.rs010066400017500001750000000012561351140252100137010ustar0000000000000000use super::{exp2, modf, pow}; const LN10: f64 = 3.32192809488736234787031942948939; const P10: &[f64] = &[ 1e-15, 1e-14, 1e-13, 1e-12, 1e-11, 1e-10, 1e-9, 1e-8, 1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2, 1e-1, 1e0, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, 1e8, 1e9, 1e10, 1e11, 1e12, 1e13, 1e14, 1e15, ]; pub fn exp10(x: f64) -> f64 { let (mut y, n) = modf(x); let u: u64 = n.to_bits(); /* fabs(n) < 16 without raising invalid on nan */ if (u >> 52 & 0x7ff) < 0x3ff + 4 { if y == 0.0 { return P10[((n as isize) + 15) as usize]; } y = exp2(LN10 * y); return y * P10[((n as isize) + 15) as usize]; } return pow(10.0, x); } libm-0.2.1/src/math/exp10f.rs010066400017500001750000000012331351140252100140420ustar0000000000000000use super::{exp2, exp2f, modff}; const LN10_F32: f32 = 3.32192809488736234787031942948939; const LN10_F64: f64 = 3.32192809488736234787031942948939; const P10: &[f32] = &[ 1e-7, 1e-6, 1e-5, 1e-4, 1e-3, 1e-2, 1e-1, 1e0, 1e1, 1e2, 1e3, 1e4, 1e5, 1e6, 1e7, ]; pub fn exp10f(x: f32) -> f32 { let (mut y, n) = modff(x); let u = n.to_bits(); /* fabsf(n) < 8 without raising invalid on nan */ if (u >> 23 & 0xff) < 0x7f + 3 { if y == 0.0 { return P10[((n as isize) + 7) as usize]; } y = exp2f(LN10_F32 * y); return y * P10[((n as isize) + 7) as usize]; } return exp2(LN10_F64 * (x as f64)) as f32; } libm-0.2.1/src/math/exp2.rs010066400017500001750000000400471351140312500136240ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/s_exp2.c */ //- // Copyright (c) 2005 David Schultz // All rights reserved. // // Redistribution and use in source and binary forms, with or without // modification, are permitted provided that the following conditions // are met: // 1. Redistributions of source code must retain the above copyright // notice, this list of conditions and the following disclaimer. // 2. Redistributions in binary form must reproduce the above copyright // notice, this list of conditions and the following disclaimer in the // documentation and/or other materials provided with the distribution. // // THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND // ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE // IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE // ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE // FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL // DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS // OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) // HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT // LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY // OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF // SUCH DAMAGE. use super::scalbn; const TBLSIZE: usize = 256; #[cfg_attr(rustfmt, rustfmt_skip)] static TBL: [u64; TBLSIZE * 2] = [ // exp2(z + eps) eps 0x3fe6a09e667f3d5d, 0x3d39880000000000, 0x3fe6b052fa751744, 0x3cd8000000000000, 0x3fe6c012750bd9fe, 0xbd28780000000000, 0x3fe6cfdcddd476bf, 0x3d1ec00000000000, 0x3fe6dfb23c651a29, 0xbcd8000000000000, 0x3fe6ef9298593ae3, 0xbcbc000000000000, 0x3fe6ff7df9519386, 0xbd2fd80000000000, 0x3fe70f7466f42da3, 0xbd2c880000000000, 0x3fe71f75e8ec5fc3, 0x3d13c00000000000, 0x3fe72f8286eacf05, 0xbd38300000000000, 0x3fe73f9a48a58152, 0xbd00c00000000000, 0x3fe74fbd35d7ccfc, 0x3d2f880000000000, 0x3fe75feb564267f1, 0x3d03e00000000000, 0x3fe77024b1ab6d48, 0xbd27d00000000000, 0x3fe780694fde5d38, 0xbcdd000000000000, 0x3fe790b938ac1d00, 0x3ce3000000000000, 0x3fe7a11473eb0178, 0xbced000000000000, 0x3fe7b17b0976d060, 0x3d20400000000000, 0x3fe7c1ed0130c133, 0x3ca0000000000000, 0x3fe7d26a62ff8636, 0xbd26900000000000, 0x3fe7e2f336cf4e3b, 0xbd02e00000000000, 0x3fe7f3878491c3e8, 0xbd24580000000000, 0x3fe80427543e1b4e, 0x3d33000000000000, 0x3fe814d2add1071a, 0x3d0f000000000000, 0x3fe82589994ccd7e, 0xbd21c00000000000, 0x3fe8364c1eb942d0, 0x3d29d00000000000, 0x3fe8471a4623cab5, 0x3d47100000000000, 0x3fe857f4179f5bbc, 0x3d22600000000000, 0x3fe868d99b4491af, 0xbd32c40000000000, 0x3fe879cad931a395, 0xbd23000000000000, 0x3fe88ac7d98a65b8, 0xbd2a800000000000, 0x3fe89bd0a4785800, 0xbced000000000000, 0x3fe8ace5422aa223, 0x3d33280000000000, 0x3fe8be05bad619fa, 0x3d42b40000000000, 0x3fe8cf3216b54383, 0xbd2ed00000000000, 0x3fe8e06a5e08664c, 0xbd20500000000000, 0x3fe8f1ae99157807, 0x3d28280000000000, 0x3fe902fed0282c0e, 0xbd1cb00000000000, 0x3fe9145b0b91ff96, 0xbd05e00000000000, 0x3fe925c353aa2ff9, 0x3cf5400000000000, 0x3fe93737b0cdc64a, 0x3d17200000000000, 0x3fe948b82b5f98ae, 0xbd09000000000000, 0x3fe95a44cbc852cb, 0x3d25680000000000, 0x3fe96bdd9a766f21, 0xbd36d00000000000, 0x3fe97d829fde4e2a, 0xbd01000000000000, 0x3fe98f33e47a23a3, 0x3d2d000000000000, 0x3fe9a0f170ca0604, 0xbd38a40000000000, 0x3fe9b2bb4d53ff89, 0x3d355c0000000000, 0x3fe9c49182a3f15b, 0x3d26b80000000000, 0x3fe9d674194bb8c5, 0xbcec000000000000, 0x3fe9e86319e3238e, 0x3d17d00000000000, 0x3fe9fa5e8d07f302, 0x3d16400000000000, 0x3fea0c667b5de54d, 0xbcf5000000000000, 0x3fea1e7aed8eb8f6, 0x3d09e00000000000, 0x3fea309bec4a2e27, 0x3d2ad80000000000, 0x3fea42c980460a5d, 0xbd1af00000000000, 0x3fea5503b23e259b, 0x3d0b600000000000, 0x3fea674a8af46213, 0x3d38880000000000, 0x3fea799e1330b3a7, 0x3d11200000000000, 0x3fea8bfe53c12e8d, 0x3d06c00000000000, 0x3fea9e6b5579fcd2, 0xbd29b80000000000, 0x3feab0e521356fb8, 0x3d2b700000000000, 0x3feac36bbfd3f381, 0x3cd9000000000000, 0x3fead5ff3a3c2780, 0x3ce4000000000000, 0x3feae89f995ad2a3, 0xbd2c900000000000, 0x3feafb4ce622f367, 0x3d16500000000000, 0x3feb0e07298db790, 0x3d2fd40000000000, 0x3feb20ce6c9a89a9, 0x3d12700000000000, 0x3feb33a2b84f1a4b, 0x3d4d470000000000, 0x3feb468415b747e7, 0xbd38380000000000, 0x3feb59728de5593a, 0x3c98000000000000, 0x3feb6c6e29f1c56a, 0x3d0ad00000000000, 0x3feb7f76f2fb5e50, 0x3cde800000000000, 0x3feb928cf22749b2, 0xbd04c00000000000, 0x3feba5b030a10603, 0xbd0d700000000000, 0x3febb8e0b79a6f66, 0x3d0d900000000000, 0x3febcc1e904bc1ff, 0x3d02a00000000000, 0x3febdf69c3f3a16f, 0xbd1f780000000000, 0x3febf2c25bd71db8, 0xbd10a00000000000, 0x3fec06286141b2e9, 0xbd11400000000000, 0x3fec199bdd8552e0, 0x3d0be00000000000, 0x3fec2d1cd9fa64ee, 0xbd09400000000000, 0x3fec40ab5fffd02f, 0xbd0ed00000000000, 0x3fec544778fafd15, 0x3d39660000000000, 0x3fec67f12e57d0cb, 0xbd1a100000000000, 0x3fec7ba88988c1b6, 0xbd58458000000000, 0x3fec8f6d9406e733, 0xbd1a480000000000, 0x3feca3405751c4df, 0x3ccb000000000000, 0x3fecb720dcef9094, 0x3d01400000000000, 0x3feccb0f2e6d1689, 0x3cf0200000000000, 0x3fecdf0b555dc412, 0x3cf3600000000000, 0x3fecf3155b5bab3b, 0xbd06900000000000, 0x3fed072d4a0789bc, 0x3d09a00000000000, 0x3fed1b532b08c8fa, 0xbd15e00000000000, 0x3fed2f87080d8a85, 0x3d1d280000000000, 0x3fed43c8eacaa203, 0x3d01a00000000000, 0x3fed5818dcfba491, 0x3cdf000000000000, 0x3fed6c76e862e6a1, 0xbd03a00000000000, 0x3fed80e316c9834e, 0xbd0cd80000000000, 0x3fed955d71ff6090, 0x3cf4c00000000000, 0x3feda9e603db32ae, 0x3cff900000000000, 0x3fedbe7cd63a8325, 0x3ce9800000000000, 0x3fedd321f301b445, 0xbcf5200000000000, 0x3fede7d5641c05bf, 0xbd1d700000000000, 0x3fedfc97337b9aec, 0xbd16140000000000, 0x3fee11676b197d5e, 0x3d0b480000000000, 0x3fee264614f5a3e7, 0x3d40ce0000000000, 0x3fee3b333b16ee5c, 0x3d0c680000000000, 0x3fee502ee78b3fb4, 0xbd09300000000000, 0x3fee653924676d68, 0xbce5000000000000, 0x3fee7a51fbc74c44, 0xbd07f80000000000, 0x3fee8f7977cdb726, 0xbcf3700000000000, 0x3feea4afa2a490e8, 0x3ce5d00000000000, 0x3feeb9f4867ccae4, 0x3d161a0000000000, 0x3feecf482d8e680d, 0x3cf5500000000000, 0x3feee4aaa2188514, 0x3cc6400000000000, 0x3feefa1bee615a13, 0xbcee800000000000, 0x3fef0f9c1cb64106, 0xbcfa880000000000, 0x3fef252b376bb963, 0xbd2c900000000000, 0x3fef3ac948dd7275, 0x3caa000000000000, 0x3fef50765b6e4524, 0xbcf4f00000000000, 0x3fef6632798844fd, 0x3cca800000000000, 0x3fef7bfdad9cbe38, 0x3cfabc0000000000, 0x3fef91d802243c82, 0xbcd4600000000000, 0x3fefa7c1819e908e, 0xbd0b0c0000000000, 0x3fefbdba3692d511, 0xbcc0e00000000000, 0x3fefd3c22b8f7194, 0xbd10de8000000000, 0x3fefe9d96b2a23ee, 0x3cee430000000000, 0x3ff0000000000000, 0x0, 0x3ff00b1afa5abcbe, 0xbcb3400000000000, 0x3ff0163da9fb3303, 0xbd12170000000000, 0x3ff02168143b0282, 0x3cba400000000000, 0x3ff02c9a3e77806c, 0x3cef980000000000, 0x3ff037d42e11bbca, 0xbcc7400000000000, 0x3ff04315e86e7f89, 0x3cd8300000000000, 0x3ff04e5f72f65467, 0xbd1a3f0000000000, 0x3ff059b0d315855a, 0xbd02840000000000, 0x3ff0650a0e3c1f95, 0x3cf1600000000000, 0x3ff0706b29ddf71a, 0x3d15240000000000, 0x3ff07bd42b72a82d, 0xbce9a00000000000, 0x3ff0874518759bd0, 0x3ce6400000000000, 0x3ff092bdf66607c8, 0xbd00780000000000, 0x3ff09e3ecac6f383, 0xbc98000000000000, 0x3ff0a9c79b1f3930, 0x3cffa00000000000, 0x3ff0b5586cf988fc, 0xbcfac80000000000, 0x3ff0c0f145e46c8a, 0x3cd9c00000000000, 0x3ff0cc922b724816, 0x3d05200000000000, 0x3ff0d83b23395dd8, 0xbcfad00000000000, 0x3ff0e3ec32d3d1f3, 0x3d1bac0000000000, 0x3ff0efa55fdfa9a6, 0xbd04e80000000000, 0x3ff0fb66affed2f0, 0xbd0d300000000000, 0x3ff1073028d7234b, 0x3cf1500000000000, 0x3ff11301d0125b5b, 0x3cec000000000000, 0x3ff11edbab5e2af9, 0x3d16bc0000000000, 0x3ff12abdc06c31d5, 0x3ce8400000000000, 0x3ff136a814f2047d, 0xbd0ed00000000000, 0x3ff1429aaea92de9, 0x3ce8e00000000000, 0x3ff14e95934f3138, 0x3ceb400000000000, 0x3ff15a98c8a58e71, 0x3d05300000000000, 0x3ff166a45471c3df, 0x3d03380000000000, 0x3ff172b83c7d5211, 0x3d28d40000000000, 0x3ff17ed48695bb9f, 0xbd05d00000000000, 0x3ff18af9388c8d93, 0xbd1c880000000000, 0x3ff1972658375d66, 0x3d11f00000000000, 0x3ff1a35beb6fcba7, 0x3d10480000000000, 0x3ff1af99f81387e3, 0xbd47390000000000, 0x3ff1bbe084045d54, 0x3d24e40000000000, 0x3ff1c82f95281c43, 0xbd0a200000000000, 0x3ff1d4873168b9b2, 0x3ce3800000000000, 0x3ff1e0e75eb44031, 0x3ceac00000000000, 0x3ff1ed5022fcd938, 0x3d01900000000000, 0x3ff1f9c18438cdf7, 0xbd1b780000000000, 0x3ff2063b88628d8f, 0x3d2d940000000000, 0x3ff212be3578a81e, 0x3cd8000000000000, 0x3ff21f49917ddd41, 0x3d2b340000000000, 0x3ff22bdda2791323, 0x3d19f80000000000, 0x3ff2387a6e7561e7, 0xbd19c80000000000, 0x3ff2451ffb821427, 0x3d02300000000000, 0x3ff251ce4fb2a602, 0xbd13480000000000, 0x3ff25e85711eceb0, 0x3d12700000000000, 0x3ff26b4565e27d16, 0x3d11d00000000000, 0x3ff2780e341de00f, 0x3d31ee0000000000, 0x3ff284dfe1f5633e, 0xbd14c00000000000, 0x3ff291ba7591bb30, 0xbd13d80000000000, 0x3ff29e9df51fdf09, 0x3d08b00000000000, 0x3ff2ab8a66d10e9b, 0xbd227c0000000000, 0x3ff2b87fd0dada3a, 0x3d2a340000000000, 0x3ff2c57e39771af9, 0xbd10800000000000, 0x3ff2d285a6e402d9, 0xbd0ed00000000000, 0x3ff2df961f641579, 0xbcf4200000000000, 0x3ff2ecafa93e2ecf, 0xbd24980000000000, 0x3ff2f9d24abd8822, 0xbd16300000000000, 0x3ff306fe0a31b625, 0xbd32360000000000, 0x3ff31432edeea50b, 0xbd70df8000000000, 0x3ff32170fc4cd7b8, 0xbd22480000000000, 0x3ff32eb83ba8e9a2, 0xbd25980000000000, 0x3ff33c08b2641766, 0x3d1ed00000000000, 0x3ff3496266e3fa27, 0xbcdc000000000000, 0x3ff356c55f929f0f, 0xbd30d80000000000, 0x3ff36431a2de88b9, 0x3d22c80000000000, 0x3ff371a7373aaa39, 0x3d20600000000000, 0x3ff37f26231e74fe, 0xbd16600000000000, 0x3ff38cae6d05d838, 0xbd0ae00000000000, 0x3ff39a401b713ec3, 0xbd44720000000000, 0x3ff3a7db34e5a020, 0x3d08200000000000, 0x3ff3b57fbfec6e95, 0x3d3e800000000000, 0x3ff3c32dc313a8f2, 0x3cef800000000000, 0x3ff3d0e544ede122, 0xbd17a00000000000, 0x3ff3dea64c1234bb, 0x3d26300000000000, 0x3ff3ec70df1c4ecc, 0xbd48a60000000000, 0x3ff3fa4504ac7e8c, 0xbd3cdc0000000000, 0x3ff40822c367a0bb, 0x3d25b80000000000, 0x3ff4160a21f72e95, 0x3d1ec00000000000, 0x3ff423fb27094646, 0xbd13600000000000, 0x3ff431f5d950a920, 0x3d23980000000000, 0x3ff43ffa3f84b9eb, 0x3cfa000000000000, 0x3ff44e0860618919, 0xbcf6c00000000000, 0x3ff45c2042a7d201, 0xbd0bc00000000000, 0x3ff46a41ed1d0016, 0xbd12800000000000, 0x3ff4786d668b3326, 0x3d30e00000000000, 0x3ff486a2b5c13c00, 0xbd2d400000000000, 0x3ff494e1e192af04, 0x3d0c200000000000, 0x3ff4a32af0d7d372, 0xbd1e500000000000, 0x3ff4b17dea6db801, 0x3d07800000000000, 0x3ff4bfdad53629e1, 0xbd13800000000000, 0x3ff4ce41b817c132, 0x3d00800000000000, 0x3ff4dcb299fddddb, 0x3d2c700000000000, 0x3ff4eb2d81d8ab96, 0xbd1ce00000000000, 0x3ff4f9b2769d2d02, 0x3d19200000000000, 0x3ff508417f4531c1, 0xbd08c00000000000, 0x3ff516daa2cf662a, 0xbcfa000000000000, 0x3ff5257de83f51ea, 0x3d4a080000000000, 0x3ff5342b569d4eda, 0xbd26d80000000000, 0x3ff542e2f4f6ac1a, 0xbd32440000000000, 0x3ff551a4ca5d94db, 0x3d483c0000000000, 0x3ff56070dde9116b, 0x3d24b00000000000, 0x3ff56f4736b529de, 0x3d415a0000000000, 0x3ff57e27dbe2c40e, 0xbd29e00000000000, 0x3ff58d12d497c76f, 0xbd23080000000000, 0x3ff59c0827ff0b4c, 0x3d4dec0000000000, 0x3ff5ab07dd485427, 0xbcc4000000000000, 0x3ff5ba11fba87af4, 0x3d30080000000000, 0x3ff5c9268a59460b, 0xbd26c80000000000, 0x3ff5d84590998e3f, 0x3d469a0000000000, 0x3ff5e76f15ad20e1, 0xbd1b400000000000, 0x3ff5f6a320dcebca, 0x3d17700000000000, 0x3ff605e1b976dcb8, 0x3d26f80000000000, 0x3ff6152ae6cdf715, 0x3d01000000000000, 0x3ff6247eb03a5531, 0xbd15d00000000000, 0x3ff633dd1d1929b5, 0xbd12d00000000000, 0x3ff6434634ccc313, 0xbcea800000000000, 0x3ff652b9febc8efa, 0xbd28600000000000, 0x3ff6623882553397, 0x3d71fe0000000000, 0x3ff671c1c708328e, 0xbd37200000000000, 0x3ff68155d44ca97e, 0x3ce6800000000000, 0x3ff690f4b19e9471, 0xbd29780000000000, ]; // exp2(x): compute the base 2 exponential of x // // Accuracy: Peak error < 0.503 ulp for normalized results. // // Method: (accurate tables) // // Reduce x: // x = k + y, for integer k and |y| <= 1/2. // Thus we have exp2(x) = 2**k * exp2(y). // // Reduce y: // y = i/TBLSIZE + z - eps[i] for integer i near y * TBLSIZE. // Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z - eps[i]), // with |z - eps[i]| <= 2**-9 + 2**-39 for the table used. // // We compute exp2(i/TBLSIZE) via table lookup and exp2(z - eps[i]) via // a degree-5 minimax polynomial with maximum error under 1.3 * 2**-61. // The values in exp2t[] and eps[] are chosen such that // exp2t[i] = exp2(i/TBLSIZE + eps[i]), and eps[i] is a small offset such // that exp2t[i] is accurate to 2**-64. // // Note that the range of i is +-TBLSIZE/2, so we actually index the tables // by i0 = i + TBLSIZE/2. For cache efficiency, exp2t[] and eps[] are // virtual tables, interleaved in the real table tbl[]. // // This method is due to Gal, with many details due to Gal and Bachelis: // // Gal, S. and Bachelis, B. An Accurate Elementary Mathematical Library // for the IEEE Floating Point Standard. TOMS 17(1), 26-46 (1991). /// Exponential, base 2 (f64) /// /// Calculate `2^x`, that is, 2 raised to the power `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn exp2(mut x: f64) -> f64 { let redux = f64::from_bits(0x4338000000000000) / TBLSIZE as f64; let p1 = f64::from_bits(0x3fe62e42fefa39ef); let p2 = f64::from_bits(0x3fcebfbdff82c575); let p3 = f64::from_bits(0x3fac6b08d704a0a6); let p4 = f64::from_bits(0x3f83b2ab88f70400); let p5 = f64::from_bits(0x3f55d88003875c74); // double_t r, t, z; // uint32_t ix, i0; // union {double f; uint64_t i;} u = {x}; // union {uint32_t u; int32_t i;} k; let x1p1023 = f64::from_bits(0x7fe0000000000000); let x1p52 = f64::from_bits(0x4330000000000000); let _0x1p_149 = f64::from_bits(0xb6a0000000000000); /* Filter out exceptional cases. */ let ui = f64::to_bits(x); let ix = ui >> 32 & 0x7fffffff; if ix >= 0x408ff000 { /* |x| >= 1022 or nan */ if ix >= 0x40900000 && ui >> 63 == 0 { /* x >= 1024 or nan */ /* overflow */ x *= x1p1023; return x; } if ix >= 0x7ff00000 { /* -inf or -nan */ return -1.0 / x; } if ui >> 63 != 0 { /* x <= -1022 */ /* underflow */ if x <= -1075.0 || x - x1p52 + x1p52 != x { force_eval!((_0x1p_149 / x) as f32); } if x <= -1075.0 { return 0.0; } } } else if ix < 0x3c900000 { /* |x| < 0x1p-54 */ return 1.0 + x; } /* Reduce x, computing z, i0, and k. */ let ui = f64::to_bits(x + redux); let mut i0 = ui as u32; i0 = i0.wrapping_add(TBLSIZE as u32 / 2); let ku = i0 / TBLSIZE as u32 * TBLSIZE as u32; let ki = ku as i32 / TBLSIZE as i32; i0 %= TBLSIZE as u32; let uf = f64::from_bits(ui) - redux; let mut z = x - uf; /* Compute r = exp2(y) = exp2t[i0] * p(z - eps[i]). */ let t = f64::from_bits(TBL[2 * i0 as usize]); /* exp2t[i0] */ z -= f64::from_bits(TBL[2 * i0 as usize + 1]); /* eps[i0] */ let r = t + t * z * (p1 + z * (p2 + z * (p3 + z * (p4 + z * p5)))); scalbn(r, ki) } #[test] fn i0_wrap_test() { let x = -3.0 / 256.0; assert_eq!(exp2(x), f64::from_bits(0x3fefbdba3692d514)); } libm-0.2.1/src/math/exp2f.rs010066400017500001750000000111611351140303000137600ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/s_exp2f.c //- // Copyright (c) 2005 David Schultz // All rights reserved. // // Redistribution and use in source and binary forms, with or without // modification, are permitted provided that the following conditions // are met: // 1. Redistributions of source code must retain the above copyright // notice, this list of conditions and the following disclaimer. // 2. Redistributions in binary form must reproduce the above copyright // notice, this list of conditions and the following disclaimer in the // documentation and/or other materials provided with the distribution. // // THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND // ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE // IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE // ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE // FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL // DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS // OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) // HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT // LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY // OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF // SUCH DAMAGE. const TBLSIZE: usize = 16; static EXP2FT: [u64; TBLSIZE] = [ 0x3fe6a09e667f3bcd, 0x3fe7a11473eb0187, 0x3fe8ace5422aa0db, 0x3fe9c49182a3f090, 0x3feae89f995ad3ad, 0x3fec199bdd85529c, 0x3fed5818dcfba487, 0x3feea4afa2a490da, 0x3ff0000000000000, 0x3ff0b5586cf9890f, 0x3ff172b83c7d517b, 0x3ff2387a6e756238, 0x3ff306fe0a31b715, 0x3ff3dea64c123422, 0x3ff4bfdad5362a27, 0x3ff5ab07dd485429, ]; // exp2f(x): compute the base 2 exponential of x // // Accuracy: Peak error < 0.501 ulp; location of peak: -0.030110927. // // Method: (equally-spaced tables) // // Reduce x: // x = k + y, for integer k and |y| <= 1/2. // Thus we have exp2f(x) = 2**k * exp2(y). // // Reduce y: // y = i/TBLSIZE + z for integer i near y * TBLSIZE. // Thus we have exp2(y) = exp2(i/TBLSIZE) * exp2(z), // with |z| <= 2**-(TBLSIZE+1). // // We compute exp2(i/TBLSIZE) via table lookup and exp2(z) via a // degree-4 minimax polynomial with maximum error under 1.4 * 2**-33. // Using double precision for everything except the reduction makes // roundoff error insignificant and simplifies the scaling step. // // This method is due to Tang, but I do not use his suggested parameters: // // Tang, P. Table-driven Implementation of the Exponential Function // in IEEE Floating-Point Arithmetic. TOMS 15(2), 144-157 (1989). /// Exponential, base 2 (f32) /// /// Calculate `2^x`, that is, 2 raised to the power `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn exp2f(mut x: f32) -> f32 { let redux = f32::from_bits(0x4b400000) / TBLSIZE as f32; let p1 = f32::from_bits(0x3f317218); let p2 = f32::from_bits(0x3e75fdf0); let p3 = f32::from_bits(0x3d6359a4); let p4 = f32::from_bits(0x3c1d964e); // double_t t, r, z; // uint32_t ix, i0, k; let x1p127 = f32::from_bits(0x7f000000); /* Filter out exceptional cases. */ let ui = f32::to_bits(x); let ix = ui & 0x7fffffff; if ix > 0x42fc0000 { /* |x| > 126 */ if ix > 0x7f800000 { /* NaN */ return x; } if ui >= 0x43000000 && ui < 0x80000000 { /* x >= 128 */ x *= x1p127; return x; } if ui >= 0x80000000 { /* x < -126 */ if ui >= 0xc3160000 || (ui & 0x0000ffff != 0) { force_eval!(f32::from_bits(0x80000001) / x); } if ui >= 0xc3160000 { /* x <= -150 */ return 0.0; } } } else if ix <= 0x33000000 { /* |x| <= 0x1p-25 */ return 1.0 + x; } /* Reduce x, computing z, i0, and k. */ let ui = f32::to_bits(x + redux); let mut i0 = ui; i0 += TBLSIZE as u32 / 2; let k = i0 / TBLSIZE as u32; let ukf = f64::from_bits(((0x3ff + k) as u64) << 52); i0 &= TBLSIZE as u32 - 1; let mut uf = f32::from_bits(ui); uf -= redux; let z: f64 = (x - uf) as f64; /* Compute r = exp2(y) = exp2ft[i0] * p(z). */ let r: f64 = f64::from_bits(EXP2FT[i0 as usize]); let t: f64 = r as f64 * z; let r: f64 = r + t * (p1 as f64 + z * p2 as f64) + t * (z * z) * (p3 as f64 + z * p4 as f64); /* Scale by 2**k */ (r * ukf) as f32 } libm-0.2.1/src/math/expf.rs010066400017500001750000000057241351140307500137170ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_expf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::scalbnf; const HALF: [f32; 2] = [0.5, -0.5]; const LN2_HI: f32 = 6.9314575195e-01; /* 0x3f317200 */ const LN2_LO: f32 = 1.4286067653e-06; /* 0x35bfbe8e */ const INV_LN2: f32 = 1.4426950216e+00; /* 0x3fb8aa3b */ /* * Domain [-0.34568, 0.34568], range ~[-4.278e-9, 4.447e-9]: * |x*(exp(x)+1)/(exp(x)-1) - p(x)| < 2**-27.74 */ const P1: f32 = 1.6666625440e-1; /* 0xaaaa8f.0p-26 */ const P2: f32 = -2.7667332906e-3; /* -0xb55215.0p-32 */ /// Exponential, base *e* (f32) /// /// Calculate the exponential of `x`, that is, *e* raised to the power `x` /// (where *e* is the base of the natural system of logarithms, approximately 2.71828). #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn expf(mut x: f32) -> f32 { let x1p127 = f32::from_bits(0x7f000000); // 0x1p127f === 2 ^ 127 let x1p_126 = f32::from_bits(0x800000); // 0x1p-126f === 2 ^ -126 /*original 0x1p-149f ??????????? */ let mut hx = x.to_bits(); let sign = (hx >> 31) as i32; /* sign bit of x */ let signb: bool = sign != 0; hx &= 0x7fffffff; /* high word of |x| */ /* special cases */ if hx >= 0x42aeac50 { /* if |x| >= -87.33655f or NaN */ if hx > 0x7f800000 { /* NaN */ return x; } if (hx >= 0x42b17218) && (!signb) { /* x >= 88.722839f */ /* overflow */ x *= x1p127; return x; } if signb { /* underflow */ force_eval!(-x1p_126 / x); if hx >= 0x42cff1b5 { /* x <= -103.972084f */ return 0.; } } } /* argument reduction */ let k: i32; let hi: f32; let lo: f32; if hx > 0x3eb17218 { /* if |x| > 0.5 ln2 */ if hx > 0x3f851592 { /* if |x| > 1.5 ln2 */ k = (INV_LN2 * x + HALF[sign as usize]) as i32; } else { k = 1 - sign - sign; } let kf = k as f32; hi = x - kf * LN2_HI; /* k*ln2hi is exact here */ lo = kf * LN2_LO; x = hi - lo; } else if hx > 0x39000000 { /* |x| > 2**-14 */ k = 0; hi = x; lo = 0.; } else { /* raise inexact */ force_eval!(x1p127 + x); return 1. + x; } /* x is now in primary range */ let xx = x * x; let c = x - xx * (P1 + xx * P2); let y = 1. + (x * c / (2. - c) - lo + hi); if k == 0 { y } else { scalbnf(y, k) } } libm-0.2.1/src/math/expm1.rs010066400017500001750000000103411351140265500140010ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use core::f64; const O_THRESHOLD: f64 = 7.09782712893383973096e+02; /* 0x40862E42, 0xFEFA39EF */ const LN2_HI: f64 = 6.93147180369123816490e-01; /* 0x3fe62e42, 0xfee00000 */ const LN2_LO: f64 = 1.90821492927058770002e-10; /* 0x3dea39ef, 0x35793c76 */ const INVLN2: f64 = 1.44269504088896338700e+00; /* 0x3ff71547, 0x652b82fe */ /* Scaled Q's: Qn_here = 2**n * Qn_above, for R(2*z) where z = hxs = x*x/2: */ const Q1: f64 = -3.33333333333331316428e-02; /* BFA11111 111110F4 */ const Q2: f64 = 1.58730158725481460165e-03; /* 3F5A01A0 19FE5585 */ const Q3: f64 = -7.93650757867487942473e-05; /* BF14CE19 9EAADBB7 */ const Q4: f64 = 4.00821782732936239552e-06; /* 3ED0CFCA 86E65239 */ const Q5: f64 = -2.01099218183624371326e-07; /* BE8AFDB7 6E09C32D */ /// Exponential, base *e*, of x-1 (f64) /// /// Calculates the exponential of `x` and subtract 1, that is, *e* raised /// to the power `x` minus 1 (where *e* is the base of the natural /// system of logarithms, approximately 2.71828). /// The result is accurate even for small values of `x`, /// where using `exp(x)-1` would lose many significant digits. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn expm1(mut x: f64) -> f64 { let hi: f64; let lo: f64; let k: i32; let c: f64; let mut t: f64; let mut y: f64; let mut ui = x.to_bits(); let hx = ((ui >> 32) & 0x7fffffff) as u32; let sign = (ui >> 63) as i32; /* filter out huge and non-finite argument */ if hx >= 0x4043687A { /* if |x|>=56*ln2 */ if x.is_nan() { return x; } if sign != 0 { return -1.0; } if x > O_THRESHOLD { x *= f64::from_bits(0x7fe0000000000000); return x; } } /* argument reduction */ if hx > 0x3fd62e42 { /* if |x| > 0.5 ln2 */ if hx < 0x3FF0A2B2 { /* and |x| < 1.5 ln2 */ if sign == 0 { hi = x - LN2_HI; lo = LN2_LO; k = 1; } else { hi = x + LN2_HI; lo = -LN2_LO; k = -1; } } else { k = (INVLN2 * x + if sign != 0 { -0.5 } else { 0.5 }) as i32; t = k as f64; hi = x - t * LN2_HI; /* t*ln2_hi is exact here */ lo = t * LN2_LO; } x = hi - lo; c = (hi - x) - lo; } else if hx < 0x3c900000 { /* |x| < 2**-54, return x */ if hx < 0x00100000 { force_eval!(x); } return x; } else { c = 0.0; k = 0; } /* x is now in primary range */ let hfx = 0.5 * x; let hxs = x * hfx; let r1 = 1.0 + hxs * (Q1 + hxs * (Q2 + hxs * (Q3 + hxs * (Q4 + hxs * Q5)))); t = 3.0 - r1 * hfx; let mut e = hxs * ((r1 - t) / (6.0 - x * t)); if k == 0 { /* c is 0 */ return x - (x * e - hxs); } e = x * (e - c) - c; e -= hxs; /* exp(x) ~ 2^k (x_reduced - e + 1) */ if k == -1 { return 0.5 * (x - e) - 0.5; } if k == 1 { if x < -0.25 { return -2.0 * (e - (x + 0.5)); } return 1.0 + 2.0 * (x - e); } ui = ((0x3ff + k) as u64) << 52; /* 2^k */ let twopk = f64::from_bits(ui); if k < 0 || k > 56 { /* suffice to return exp(x)-1 */ y = x - e + 1.0; if k == 1024 { y = y * 2.0 * f64::from_bits(0x7fe0000000000000); } else { y = y * twopk; } return y - 1.0; } ui = ((0x3ff - k) as u64) << 52; /* 2^-k */ let uf = f64::from_bits(ui); if k < 20 { y = (x - e + (1.0 - uf)) * twopk; } else { y = (x - (e + uf) + 1.0) * twopk; } y } #[cfg(test)] mod tests { #[test] fn sanity_check() { assert_eq!(super::expm1(1.1), 2.0041660239464334); } } libm-0.2.1/src/math/expm1f.rs010066400017500001750000000075571351140320200141530ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_expm1f.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ const O_THRESHOLD: f32 = 8.8721679688e+01; /* 0x42b17180 */ const LN2_HI: f32 = 6.9313812256e-01; /* 0x3f317180 */ const LN2_LO: f32 = 9.0580006145e-06; /* 0x3717f7d1 */ const INV_LN2: f32 = 1.4426950216e+00; /* 0x3fb8aa3b */ /* * Domain [-0.34568, 0.34568], range ~[-6.694e-10, 6.696e-10]: * |6 / x * (1 + 2 * (1 / (exp(x) - 1) - 1 / x)) - q(x)| < 2**-30.04 * Scaled coefficients: Qn_here = 2**n * Qn_for_q (see s_expm1.c): */ const Q1: f32 = -3.3333212137e-2; /* -0x888868.0p-28 */ const Q2: f32 = 1.5807170421e-3; /* 0xcf3010.0p-33 */ /// Exponential, base *e*, of x-1 (f32) /// /// Calculates the exponential of `x` and subtract 1, that is, *e* raised /// to the power `x` minus 1 (where *e* is the base of the natural /// system of logarithms, approximately 2.71828). /// The result is accurate even for small values of `x`, /// where using `exp(x)-1` would lose many significant digits. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn expm1f(mut x: f32) -> f32 { let x1p127 = f32::from_bits(0x7f000000); // 0x1p127f === 2 ^ 127 let mut hx = x.to_bits(); let sign = (hx >> 31) != 0; hx &= 0x7fffffff; /* filter out huge and non-finite argument */ if hx >= 0x4195b844 { /* if |x|>=27*ln2 */ if hx > 0x7f800000 { /* NaN */ return x; } if sign { return -1.; } if x > O_THRESHOLD { x *= x1p127; return x; } } let k: i32; let hi: f32; let lo: f32; let mut c = 0f32; /* argument reduction */ if hx > 0x3eb17218 { /* if |x| > 0.5 ln2 */ if hx < 0x3F851592 { /* and |x| < 1.5 ln2 */ if !sign { hi = x - LN2_HI; lo = LN2_LO; k = 1; } else { hi = x + LN2_HI; lo = -LN2_LO; k = -1; } } else { k = (INV_LN2 * x + (if sign { -0.5 } else { 0.5 })) as i32; let t = k as f32; hi = x - t * LN2_HI; /* t*ln2_hi is exact here */ lo = t * LN2_LO; } x = hi - lo; c = (hi - x) - lo; } else if hx < 0x33000000 { /* when |x|<2**-25, return x */ if hx < 0x00800000 { force_eval!(x * x); } return x; } else { k = 0; } /* x is now in primary range */ let hfx = 0.5 * x; let hxs = x * hfx; let r1 = 1. + hxs * (Q1 + hxs * Q2); let t = 3. - r1 * hfx; let mut e = hxs * ((r1 - t) / (6. - x * t)); if k == 0 { /* c is 0 */ return x - (x * e - hxs); } e = x * (e - c) - c; e -= hxs; /* exp(x) ~ 2^k (x_reduced - e + 1) */ if k == -1 { return 0.5 * (x - e) - 0.5; } if k == 1 { if x < -0.25 { return -2. * (e - (x + 0.5)); } return 1. + 2. * (x - e); } let twopk = f32::from_bits(((0x7f + k) << 23) as u32); /* 2^k */ if (k < 0) || (k > 56) { /* suffice to return exp(x)-1 */ let mut y = x - e + 1.; if k == 128 { y = y * 2. * x1p127; } else { y = y * twopk; } return y - 1.; } let uf = f32::from_bits(((0x7f - k) << 23) as u32); /* 2^-k */ if k < 23 { (x - e + (1. - uf)) * twopk } else { (x - (e + uf) + 1.) * twopk } } libm-0.2.1/src/math/expo2.rs010066400017500001750000000010701351140275700140060ustar0000000000000000use super::{combine_words, exp}; /* exp(x)/2 for x >= log(DBL_MAX), slightly better than 0.5*exp(x/2)*exp(x/2) */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn expo2(x: f64) -> f64 { /* k is such that k*ln2 has minimal relative error and x - kln2 > log(DBL_MIN) */ const K: i32 = 2043; let kln2 = f64::from_bits(0x40962066151add8b); /* note that k is odd and scale*scale overflows */ let scale = combine_words(((0x3ff + K / 2) as u32) << 20, 0); /* exp(x - k ln2) * 2**(k-1) */ exp(x - kln2) * scale * scale } libm-0.2.1/src/math/fabs.rs010066400017500001750000000022451353572366000136760ustar0000000000000000use core::u64; /// Absolute value (magnitude) (f64) /// Calculates the absolute value (magnitude) of the argument `x`, /// by direct manipulation of the bit representation of `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fabs(x: f64) -> f64 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f64.abs` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::fabsf64(x) } } } f64::from_bits(x.to_bits() & (u64::MAX / 2)) } #[cfg(test)] mod tests { use super::*; use core::f64::*; #[test] fn sanity_check() { assert_eq!(fabs(-1.0), 1.0); assert_eq!(fabs(2.8), 2.8); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/fabs #[test] fn spec_tests() { assert!(fabs(NAN).is_nan()); for f in [0.0, -0.0].iter().copied() { assert_eq!(fabs(f), 0.0); } for f in [INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(fabs(f), INFINITY); } } } libm-0.2.1/src/math/fabsf.rs010066400017500001750000000022271353572366000140440ustar0000000000000000/// Absolute value (magnitude) (f32) /// Calculates the absolute value (magnitude) of the argument `x`, /// by direct manipulation of the bit representation of `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fabsf(x: f32) -> f32 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f32.abs` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::fabsf32(x) } } } f32::from_bits(x.to_bits() & 0x7fffffff) } #[cfg(test)] mod tests { use super::*; use core::f32::*; #[test] fn sanity_check() { assert_eq!(fabsf(-1.0), 1.0); assert_eq!(fabsf(2.8), 2.8); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/fabs #[test] fn spec_tests() { assert!(fabsf(NAN).is_nan()); for f in [0.0, -0.0].iter().copied() { assert_eq!(fabsf(f), 0.0); } for f in [INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(fabsf(f), INFINITY); } } } libm-0.2.1/src/math/fdim.rs010066400017500001750000000007261351140272600136730ustar0000000000000000use core::f64; /// Positive difference (f64) /// /// Determines the positive difference between arguments, returning: /// * x - y if x > y, or /// * +0 if x <= y, or /// * NAN if either argument is NAN. /// /// A range error may occur. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fdim(x: f64, y: f64) -> f64 { if x.is_nan() { x } else if y.is_nan() { y } else if x > y { x - y } else { 0.0 } } libm-0.2.1/src/math/fdimf.rs010066400017500001750000000007271351140273100140360ustar0000000000000000use core::f32; /// Positive difference (f32) /// /// Determines the positive difference between arguments, returning: /// * x - y if x > y, or /// * +0 if x <= y, or /// * NAN if either argument is NAN. /// /// A range error may occur. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fdimf(x: f32, y: f32) -> f32 { if x.is_nan() { x } else if y.is_nan() { y } else if x > y { x - y } else { 0.0 } } libm-0.2.1/src/math/fenv.rs010066400017500001750000000011051351140204400136730ustar0000000000000000// src: musl/src/fenv/fenv.c /* Dummy functions for archs lacking fenv implementation */ pub(crate) const FE_UNDERFLOW: i32 = 0; pub(crate) const FE_INEXACT: i32 = 0; pub(crate) const FE_TONEAREST: i32 = 0; pub(crate) const FE_TOWARDZERO: i32 = 0; #[inline] pub(crate) fn feclearexcept(_mask: i32) -> i32 { 0 } #[inline] pub(crate) fn feraiseexcept(_mask: i32) -> i32 { 0 } #[inline] pub(crate) fn fetestexcept(_mask: i32) -> i32 { 0 } #[inline] pub(crate) fn fegetround() -> i32 { FE_TONEAREST } #[inline] pub(crate) fn fesetround(_r: i32) -> i32 { 0 } libm-0.2.1/src/math/floor.rs010066400017500001750000000031301353572366000140760ustar0000000000000000use core::f64; const TOINT: f64 = 1. / f64::EPSILON; /// Floor (f64) /// /// Finds the nearest integer less than or equal to `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn floor(x: f64) -> f64 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f64.floor` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::floorf64(x) } } } let ui = x.to_bits(); let e = ((ui >> 52) & 0x7ff) as i32; if (e >= 0x3ff + 52) || (x == 0.) { return x; } /* y = int(x) - x, where int(x) is an integer neighbor of x */ let y = if (ui >> 63) != 0 { x - TOINT + TOINT - x } else { x + TOINT - TOINT - x }; /* special case because of non-nearest rounding modes */ if e < 0x3ff { force_eval!(y); return if (ui >> 63) != 0 { -1. } else { 0. }; } if y > 0. { x + y - 1. } else { x + y } } #[cfg(test)] mod tests { use super::*; use core::f64::*; #[test] fn sanity_check() { assert_eq!(floor(1.1), 1.0); assert_eq!(floor(2.9), 2.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/floor #[test] fn spec_tests() { // Not Asserted: that the current rounding mode has no effect. assert!(floor(NAN).is_nan()); for f in [0.0, -0.0, INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(floor(f), f); } } } libm-0.2.1/src/math/floorf.rs010066400017500001750000000031701353572366000142500ustar0000000000000000use core::f32; /// Floor (f32) /// /// Finds the nearest integer less than or equal to `x`. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn floorf(x: f32) -> f32 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f32.floor` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::floorf32(x) } } } let mut ui = x.to_bits(); let e = (((ui >> 23) as i32) & 0xff) - 0x7f; if e >= 23 { return x; } if e >= 0 { let m: u32 = 0x007fffff >> e; if (ui & m) == 0 { return x; } force_eval!(x + f32::from_bits(0x7b800000)); if ui >> 31 != 0 { ui += m; } ui &= !m; } else { force_eval!(x + f32::from_bits(0x7b800000)); if ui >> 31 == 0 { ui = 0; } else if ui << 1 != 0 { return -1.0; } } f32::from_bits(ui) } #[cfg(test)] mod tests { use super::*; use core::f32::*; #[test] fn sanity_check() { assert_eq!(floorf(0.5), 0.0); assert_eq!(floorf(1.1), 1.0); assert_eq!(floorf(2.9), 2.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/floor #[test] fn spec_tests() { // Not Asserted: that the current rounding mode has no effect. assert!(floorf(NAN).is_nan()); for f in [0.0, -0.0, INFINITY, NEG_INFINITY].iter().copied() { assert_eq!(floorf(f), f); } } } libm-0.2.1/src/math/fma.rs010066400017500001750000000143501353572366000135260ustar0000000000000000use core::{f32, f64}; use super::scalbn; const ZEROINFNAN: i32 = 0x7ff - 0x3ff - 52 - 1; struct Num { m: u64, e: i32, sign: i32, } fn normalize(x: f64) -> Num { let x1p63: f64 = f64::from_bits(0x43e0000000000000); // 0x1p63 === 2 ^ 63 let mut ix: u64 = x.to_bits(); let mut e: i32 = (ix >> 52) as i32; let sign: i32 = e & 0x800; e &= 0x7ff; if e == 0 { ix = (x * x1p63).to_bits(); e = (ix >> 52) as i32 & 0x7ff; e = if e != 0 { e - 63 } else { 0x800 }; } ix &= (1 << 52) - 1; ix |= 1 << 52; ix <<= 1; e -= 0x3ff + 52 + 1; Num { m: ix, e, sign } } fn mul(x: u64, y: u64) -> (u64, u64) { let t1: u64; let t2: u64; let t3: u64; let xlo: u64 = x as u32 as u64; let xhi: u64 = x >> 32; let ylo: u64 = y as u32 as u64; let yhi: u64 = y >> 32; t1 = xlo * ylo; t2 = xlo * yhi + xhi * ylo; t3 = xhi * yhi; let lo = t1.wrapping_add(t2 << 32); let hi = t3 + (t2 >> 32) + (t1 > lo) as u64; (hi, lo) } /// Floating multiply add (f64) /// /// Computes `(x*y)+z`, rounded as one ternary operation: /// Computes the value (as if) to infinite precision and rounds once to the result format, /// according to the rounding mode characterized by the value of FLT_ROUNDS. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fma(x: f64, y: f64, z: f64) -> f64 { let x1p63: f64 = f64::from_bits(0x43e0000000000000); // 0x1p63 === 2 ^ 63 let x0_ffffff8p_63 = f64::from_bits(0x3bfffffff0000000); // 0x0.ffffff8p-63 /* normalize so top 10bits and last bit are 0 */ let nx = normalize(x); let ny = normalize(y); let nz = normalize(z); if nx.e >= ZEROINFNAN || ny.e >= ZEROINFNAN { return x * y + z; } if nz.e >= ZEROINFNAN { if nz.e > ZEROINFNAN { /* z==0 */ return x * y + z; } return z; } /* mul: r = x*y */ let zhi: u64; let zlo: u64; let (mut rhi, mut rlo) = mul(nx.m, ny.m); /* either top 20 or 21 bits of rhi and last 2 bits of rlo are 0 */ /* align exponents */ let mut e: i32 = nx.e + ny.e; let mut d: i32 = nz.e - e; /* shift bits z<<=kz, r>>=kr, so kz+kr == d, set e = e+kr (== ez-kz) */ if d > 0 { if d < 64 { zlo = nz.m << d; zhi = nz.m >> (64 - d); } else { zlo = 0; zhi = nz.m; e = nz.e - 64; d -= 64; if d == 0 { } else if d < 64 { rlo = rhi << (64 - d) | rlo >> d | ((rlo << (64 - d)) != 0) as u64; rhi = rhi >> d; } else { rlo = 1; rhi = 0; } } } else { zhi = 0; d = -d; if d == 0 { zlo = nz.m; } else if d < 64 { zlo = nz.m >> d | ((nz.m << (64 - d)) != 0) as u64; } else { zlo = 1; } } /* add */ let mut sign: i32 = nx.sign ^ ny.sign; let samesign: bool = (sign ^ nz.sign) == 0; let mut nonzero: i32 = 1; if samesign { /* r += z */ rlo = rlo.wrapping_add(zlo); rhi += zhi + (rlo < zlo) as u64; } else { /* r -= z */ let t = rlo; rlo = rlo.wrapping_sub(zlo); rhi = rhi.wrapping_sub(zhi.wrapping_sub((t < rlo) as u64)); if (rhi >> 63) != 0 { rlo = (-(rlo as i64)) as u64; rhi = (-(rhi as i64)) as u64 - (rlo != 0) as u64; sign = (sign == 0) as i32; } nonzero = (rhi != 0) as i32; } /* set rhi to top 63bit of the result (last bit is sticky) */ if nonzero != 0 { e += 64; d = rhi.leading_zeros() as i32 - 1; /* note: d > 0 */ rhi = rhi << d | rlo >> (64 - d) | ((rlo << d) != 0) as u64; } else if rlo != 0 { d = rlo.leading_zeros() as i32 - 1; if d < 0 { rhi = rlo >> 1 | (rlo & 1); } else { rhi = rlo << d; } } else { /* exact +-0 */ return x * y + z; } e -= d; /* convert to double */ let mut i: i64 = rhi as i64; /* i is in [1<<62,(1<<63)-1] */ if sign != 0 { i = -i; } let mut r: f64 = i as f64; /* |r| is in [0x1p62,0x1p63] */ if e < -1022 - 62 { /* result is subnormal before rounding */ if e == -1022 - 63 { let mut c: f64 = x1p63; if sign != 0 { c = -c; } if r == c { /* min normal after rounding, underflow depends on arch behaviour which can be imitated by a double to float conversion */ let fltmin: f32 = (x0_ffffff8p_63 * f32::MIN_POSITIVE as f64 * r) as f32; return f64::MIN_POSITIVE / f32::MIN_POSITIVE as f64 * fltmin as f64; } /* one bit is lost when scaled, add another top bit to only round once at conversion if it is inexact */ if (rhi << 53) != 0 { i = (rhi >> 1 | (rhi & 1) | 1 << 62) as i64; if sign != 0 { i = -i; } r = i as f64; r = 2. * r - c; /* remove top bit */ /* raise underflow portably, such that it cannot be optimized away */ { let tiny: f64 = f64::MIN_POSITIVE / f32::MIN_POSITIVE as f64 * r; r += (tiny * tiny) * (r - r); } } } else { /* only round once when scaled */ d = 10; i = ((rhi >> d | ((rhi << (64 - d)) != 0) as u64) << d) as i64; if sign != 0 { i = -i; } r = i as f64; } } scalbn(r, e) } #[cfg(test)] mod tests { use super::*; #[test] fn fma_segfault() { // These two inputs cause fma to segfault on release due to overflow: assert_eq!( fma( -0.0000000000000002220446049250313, -0.0000000000000002220446049250313, -0.0000000000000002220446049250313 ), -0.00000000000000022204460492503126, ); assert_eq!(fma(-0.992, -0.992, -0.992), -0.00793599999988632,); } } libm-0.2.1/src/math/fmaf.rs010066400017500001750000000076461351140264600136760ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_fmaf.c */ /*- * Copyright (c) 2005-2011 David Schultz * All rights reserved. * * Redistribution and use in source and binary forms, with or without * modification, are permitted provided that the following conditions * are met: * 1. Redistributions of source code must retain the above copyright * notice, this list of conditions and the following disclaimer. * 2. Redistributions in binary form must reproduce the above copyright * notice, this list of conditions and the following disclaimer in the * documentation and/or other materials provided with the distribution. * * THIS SOFTWARE IS PROVIDED BY THE AUTHOR AND CONTRIBUTORS ``AS IS'' AND * ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE * ARE DISCLAIMED. IN NO EVENT SHALL THE AUTHOR OR CONTRIBUTORS BE LIABLE * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS * OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) * HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT * LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY * OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF * SUCH DAMAGE. */ use core::f32; use core::ptr::read_volatile; use super::fenv::{ feclearexcept, fegetround, feraiseexcept, fesetround, fetestexcept, FE_INEXACT, FE_TONEAREST, FE_TOWARDZERO, FE_UNDERFLOW, }; /* * Fused multiply-add: Compute x * y + z with a single rounding error. * * A double has more than twice as much precision than a float, so * direct double-precision arithmetic suffices, except where double * rounding occurs. */ /// Floating multiply add (f32) /// /// Computes `(x*y)+z`, rounded as one ternary operation: /// Computes the value (as if) to infinite precision and rounds once to the result format, /// according to the rounding mode characterized by the value of FLT_ROUNDS. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmaf(x: f32, y: f32, mut z: f32) -> f32 { let xy: f64; let mut result: f64; let mut ui: u64; let e: i32; xy = x as f64 * y as f64; result = xy + z as f64; ui = result.to_bits(); e = (ui >> 52) as i32 & 0x7ff; /* Common case: The double precision result is fine. */ if ( /* not a halfway case */ ui & 0x1fffffff) != 0x10000000 || /* NaN */ e == 0x7ff || /* exact */ (result - xy == z as f64 && result - z as f64 == xy) || /* not round-to-nearest */ fegetround() != FE_TONEAREST { /* underflow may not be raised correctly, example: fmaf(0x1p-120f, 0x1p-120f, 0x1p-149f) */ if e < 0x3ff - 126 && e >= 0x3ff - 149 && fetestexcept(FE_INEXACT) != 0 { feclearexcept(FE_INEXACT); // prevent `xy + vz` from being CSE'd with `xy + z` above let vz: f32 = unsafe { read_volatile(&z) }; result = xy + vz as f64; if fetestexcept(FE_INEXACT) != 0 { feraiseexcept(FE_UNDERFLOW); } else { feraiseexcept(FE_INEXACT); } } z = result as f32; return z; } /* * If result is inexact, and exactly halfway between two float values, * we need to adjust the low-order bit in the direction of the error. */ fesetround(FE_TOWARDZERO); // prevent `vxy + z` from being CSE'd with `xy + z` above let vxy: f64 = unsafe { read_volatile(&xy) }; let mut adjusted_result: f64 = vxy + z as f64; fesetround(FE_TONEAREST); if result == adjusted_result { ui = adjusted_result.to_bits(); ui += 1; adjusted_result = f64::from_bits(ui); } z = adjusted_result as f32; z } libm-0.2.1/src/math/fmax.rs010066400017500001750000000014031351140336600137010ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmax(x: f64, y: f64) -> f64 { // IEEE754 says: maxNum(x, y) is the canonicalized number y if x < y, x if y < x, the // canonicalized number if one operand is a number and the other a quiet NaN. Otherwise it // is either x or y, canonicalized (this means results might differ among implementations). // When either x or y is a signalingNaN, then the result is according to 6.2. // // Since we do not support sNaN in Rust yet, we do not need to handle them. // FIXME(nagisa): due to https://bugs.llvm.org/show_bug.cgi?id=33303 we canonicalize by // multiplying by 1.0. Should switch to the `canonicalize` when it works. (if x.is_nan() || x < y { y } else { x }) * 1.0 } libm-0.2.1/src/math/fmaxf.rs010066400017500001750000000014041351140274500140500ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmaxf(x: f32, y: f32) -> f32 { // IEEE754 says: maxNum(x, y) is the canonicalized number y if x < y, x if y < x, the // canonicalized number if one operand is a number and the other a quiet NaN. Otherwise it // is either x or y, canonicalized (this means results might differ among implementations). // When either x or y is a signalingNaN, then the result is according to 6.2. // // Since we do not support sNaN in Rust yet, we do not need to handle them. // FIXME(nagisa): due to https://bugs.llvm.org/show_bug.cgi?id=33303 we canonicalize by // multiplying by 1.0. Should switch to the `canonicalize` when it works. (if x.is_nan() || x < y { y } else { x }) * 1.0 } libm-0.2.1/src/math/fmin.rs010066400017500001750000000014031351140317200136720ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmin(x: f64, y: f64) -> f64 { // IEEE754 says: minNum(x, y) is the canonicalized number x if x < y, y if y < x, the // canonicalized number if one operand is a number and the other a quiet NaN. Otherwise it // is either x or y, canonicalized (this means results might differ among implementations). // When either x or y is a signalingNaN, then the result is according to 6.2. // // Since we do not support sNaN in Rust yet, we do not need to handle them. // FIXME(nagisa): due to https://bugs.llvm.org/show_bug.cgi?id=33303 we canonicalize by // multiplying by 1.0. Should switch to the `canonicalize` when it works. (if y.is_nan() || x < y { x } else { y }) * 1.0 } libm-0.2.1/src/math/fminf.rs010066400017500001750000000014041351140325500140430ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fminf(x: f32, y: f32) -> f32 { // IEEE754 says: minNum(x, y) is the canonicalized number x if x < y, y if y < x, the // canonicalized number if one operand is a number and the other a quiet NaN. Otherwise it // is either x or y, canonicalized (this means results might differ among implementations). // When either x or y is a signalingNaN, then the result is according to 6.2. // // Since we do not support sNaN in Rust yet, we do not need to handle them. // FIXME(nagisa): due to https://bugs.llvm.org/show_bug.cgi?id=33303 we canonicalize by // multiplying by 1.0. Should switch to the `canonicalize` when it works. (if y.is_nan() || x < y { x } else { y }) * 1.0 } libm-0.2.1/src/math/fmod.rs010066400017500001750000000031451351140311400136670ustar0000000000000000use core::u64; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmod(x: f64, y: f64) -> f64 { let mut uxi = x.to_bits(); let mut uyi = y.to_bits(); let mut ex = (uxi >> 52 & 0x7ff) as i64; let mut ey = (uyi >> 52 & 0x7ff) as i64; let sx = uxi >> 63; let mut i; if uyi << 1 == 0 || y.is_nan() || ex == 0x7ff { return (x * y) / (x * y); } if uxi << 1 <= uyi << 1 { if uxi << 1 == uyi << 1 { return 0.0 * x; } return x; } /* normalize x and y */ if ex == 0 { i = uxi << 12; while i >> 63 == 0 { ex -= 1; i <<= 1; } uxi <<= -ex + 1; } else { uxi &= u64::MAX >> 12; uxi |= 1 << 52; } if ey == 0 { i = uyi << 12; while i >> 63 == 0 { ey -= 1; i <<= 1; } uyi <<= -ey + 1; } else { uyi &= u64::MAX >> 12; uyi |= 1 << 52; } /* x mod y */ while ex > ey { i = uxi.wrapping_sub(uyi); if i >> 63 == 0 { if i == 0 { return 0.0 * x; } uxi = i; } uxi <<= 1; ex -= 1; } i = uxi.wrapping_sub(uyi); if i >> 63 == 0 { if i == 0 { return 0.0 * x; } uxi = i; } while uxi >> 52 == 0 { uxi <<= 1; ex -= 1; } /* scale result */ if ex > 0 { uxi -= 1 << 52; uxi |= (ex as u64) << 52; } else { uxi >>= -ex + 1; } uxi |= (sx as u64) << 63; f64::from_bits(uxi) } libm-0.2.1/src/math/fmodf.rs010066400017500001750000000031611351140333100140340ustar0000000000000000use core::f32; use core::u32; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn fmodf(x: f32, y: f32) -> f32 { let mut uxi = x.to_bits(); let mut uyi = y.to_bits(); let mut ex = (uxi >> 23 & 0xff) as i32; let mut ey = (uyi >> 23 & 0xff) as i32; let sx = uxi & 0x80000000; let mut i; if uyi << 1 == 0 || y.is_nan() || ex == 0xff { return (x * y) / (x * y); } if uxi << 1 <= uyi << 1 { if uxi << 1 == uyi << 1 { return 0.0 * x; } return x; } /* normalize x and y */ if ex == 0 { i = uxi << 9; while i >> 31 == 0 { ex -= 1; i <<= 1; } uxi <<= -ex + 1; } else { uxi &= u32::MAX >> 9; uxi |= 1 << 23; } if ey == 0 { i = uyi << 9; while i >> 31 == 0 { ey -= 1; i <<= 1; } uyi <<= -ey + 1; } else { uyi &= u32::MAX >> 9; uyi |= 1 << 23; } /* x mod y */ while ex > ey { i = uxi.wrapping_sub(uyi); if i >> 31 == 0 { if i == 0 { return 0.0 * x; } uxi = i; } uxi <<= 1; ex -= 1; } i = uxi.wrapping_sub(uyi); if i >> 31 == 0 { if i == 0 { return 0.0 * x; } uxi = i; } while uxi >> 23 == 0 { uxi <<= 1; ex -= 1; } /* scale result up */ if ex > 0 { uxi -= 1 << 23; uxi |= (ex as u32) << 23; } else { uxi >>= -ex + 1; } uxi |= sx; f32::from_bits(uxi) } libm-0.2.1/src/math/frexp.rs010066400017500001750000000007541351140252100140720ustar0000000000000000pub fn frexp(x: f64) -> (f64, i32) { let mut y = x.to_bits(); let ee = ((y >> 52) & 0x7ff) as i32; if ee == 0 { if x != 0.0 { let x1p64 = f64::from_bits(0x43f0000000000000); let (x, e) = frexp(x * x1p64); return (x, e - 64); } return (x, 0); } else if ee == 0x7ff { return (x, 0); } let e = ee - 0x3fe; y &= 0x800fffffffffffff; y |= 0x3fe0000000000000; return (f64::from_bits(y), e); } libm-0.2.1/src/math/frexpf.rs010066400017500001750000000007451351140252100142400ustar0000000000000000pub fn frexpf(x: f32) -> (f32, i32) { let mut y = x.to_bits(); let ee: i32 = ((y >> 23) & 0xff) as i32; if ee == 0 { if x != 0.0 { let x1p64 = f32::from_bits(0x5f800000); let (x, e) = frexpf(x * x1p64); return (x, e - 64); } else { return (x, 0); } } else if ee == 0xff { return (x, 0); } let e = ee - 0x7e; y &= 0x807fffff; y |= 0x3f000000; (f32::from_bits(y), e) } libm-0.2.1/src/math/hypot.rs010066400017500001750000000033641351140302000141040ustar0000000000000000use core::f64; use super::sqrt; const SPLIT: f64 = 134217728. + 1.; // 0x1p27 + 1 === (2 ^ 27) + 1 fn sq(x: f64) -> (f64, f64) { let xh: f64; let xl: f64; let xc: f64; xc = x * SPLIT; xh = x - xc + xc; xl = x - xh; let hi = x * x; let lo = xh * xh - hi + 2. * xh * xl + xl * xl; (hi, lo) } #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn hypot(mut x: f64, mut y: f64) -> f64 { let x1p700 = f64::from_bits(0x6bb0000000000000); // 0x1p700 === 2 ^ 700 let x1p_700 = f64::from_bits(0x1430000000000000); // 0x1p-700 === 2 ^ -700 let mut uxi = x.to_bits(); let mut uyi = y.to_bits(); let uti; let ex: i64; let ey: i64; let mut z: f64; /* arrange |x| >= |y| */ uxi &= -1i64 as u64 >> 1; uyi &= -1i64 as u64 >> 1; if uxi < uyi { uti = uxi; uxi = uyi; uyi = uti; } /* special cases */ ex = (uxi >> 52) as i64; ey = (uyi >> 52) as i64; x = f64::from_bits(uxi); y = f64::from_bits(uyi); /* note: hypot(inf,nan) == inf */ if ey == 0x7ff { return y; } if ex == 0x7ff || uyi == 0 { return x; } /* note: hypot(x,y) ~= x + y*y/x/2 with inexact for small y/x */ /* 64 difference is enough for ld80 double_t */ if ex - ey > 64 { return x + y; } /* precise sqrt argument in nearest rounding mode without overflow */ /* xh*xh must not overflow and xl*xl must not underflow in sq */ z = 1.; if ex > 0x3ff + 510 { z = x1p700; x *= x1p_700; y *= x1p_700; } else if ey < 0x3ff - 450 { z = x1p_700; x *= x1p700; y *= x1p700; } let (hx, lx) = sq(x); let (hy, ly) = sq(y); z * sqrt(ly + lx + hy + hx) } libm-0.2.1/src/math/hypotf.rs010066400017500001750000000017501351140257000142600ustar0000000000000000use core::f32; use super::sqrtf; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn hypotf(mut x: f32, mut y: f32) -> f32 { let x1p90 = f32::from_bits(0x6c800000); // 0x1p90f === 2 ^ 90 let x1p_90 = f32::from_bits(0x12800000); // 0x1p-90f === 2 ^ -90 let mut uxi = x.to_bits(); let mut uyi = y.to_bits(); let uti; let mut z: f32; uxi &= -1i32 as u32 >> 1; uyi &= -1i32 as u32 >> 1; if uxi < uyi { uti = uxi; uxi = uyi; uyi = uti; } x = f32::from_bits(uxi); y = f32::from_bits(uyi); if uyi == 0xff << 23 { return y; } if uxi >= 0xff << 23 || uyi == 0 || uxi - uyi >= 25 << 23 { return x + y; } z = 1.; if uxi >= (0x7f + 60) << 23 { z = x1p90; x *= x1p_90; y *= x1p_90; } else if uyi < (0x7f - 60) << 23 { z = x1p_90; x *= x1p90; y *= x1p90; } z * sqrtf((x as f64 * x as f64 + y as f64 * y as f64) as f32) } libm-0.2.1/src/math/ilogb.rs010066400017500001750000000012321351140252100140320ustar0000000000000000const FP_ILOGBNAN: i32 = -1 - 0x7fffffff; const FP_ILOGB0: i32 = FP_ILOGBNAN; pub fn ilogb(x: f64) -> i32 { let mut i: u64 = x.to_bits(); let e = ((i >> 52) & 0x7ff) as i32; if e == 0 { i <<= 12; if i == 0 { force_eval!(0.0 / 0.0); return FP_ILOGB0; } /* subnormal x */ let mut e = -0x3ff; while (i >> 63) == 0 { e -= 1; i <<= 1; } e } else if e == 0x7ff { force_eval!(0.0 / 0.0); if (i << 12) != 0 { FP_ILOGBNAN } else { i32::max_value() } } else { e - 0x3ff } } libm-0.2.1/src/math/ilogbf.rs010066400017500001750000000012201351140252100141750ustar0000000000000000const FP_ILOGBNAN: i32 = -1 - 0x7fffffff; const FP_ILOGB0: i32 = FP_ILOGBNAN; pub fn ilogbf(x: f32) -> i32 { let mut i = x.to_bits(); let e = ((i >> 23) & 0xff) as i32; if e == 0 { i <<= 9; if i == 0 { force_eval!(0.0 / 0.0); return FP_ILOGB0; } /* subnormal x */ let mut e = -0x7f; while (i >> 31) == 0 { e -= 1; i <<= 1; } e } else if e == 0xff { force_eval!(0.0 / 0.0); if (i << 9) != 0 { FP_ILOGBNAN } else { i32::max_value() } } else { e - 0x7f } } libm-0.2.1/src/math/j0.rs010066400017500001750000000361551351140252100132630ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_j0.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* j0(x), y0(x) * Bessel function of the first and second kinds of order zero. * Method -- j0(x): * 1. For tiny x, we use j0(x) = 1 - x^2/4 + x^4/64 - ... * 2. Reduce x to |x| since j0(x)=j0(-x), and * for x in (0,2) * j0(x) = 1-z/4+ z^2*R0/S0, where z = x*x; * (precision: |j0-1+z/4-z^2R0/S0 |<2**-63.67 ) * for x in (2,inf) * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)-q0(x)*sin(x0)) * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) * as follow: * cos(x0) = cos(x)cos(pi/4)+sin(x)sin(pi/4) * = 1/sqrt(2) * (cos(x) + sin(x)) * sin(x0) = sin(x)cos(pi/4)-cos(x)sin(pi/4) * = 1/sqrt(2) * (sin(x) - cos(x)) * (To avoid cancellation, use * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) * to compute the worse one.) * * 3 Special cases * j0(nan)= nan * j0(0) = 1 * j0(inf) = 0 * * Method -- y0(x): * 1. For x<2. * Since * y0(x) = 2/pi*(j0(x)*(ln(x/2)+Euler) + x^2/4 - ...) * therefore y0(x)-2/pi*j0(x)*ln(x) is an even function. * We use the following function to approximate y0, * y0(x) = U(z)/V(z) + (2/pi)*(j0(x)*ln(x)), z= x^2 * where * U(z) = u00 + u01*z + ... + u06*z^6 * V(z) = 1 + v01*z + ... + v04*z^4 * with absolute approximation error bounded by 2**-72. * Note: For tiny x, U/V = u0 and j0(x)~1, hence * y0(tiny) = u0 + (2/pi)*ln(tiny), (choose tiny<2**-27) * 2. For x>=2. * y0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x0)+q0(x)*sin(x0)) * where x0 = x-pi/4. It is better to compute sin(x0),cos(x0) * by the method mentioned above. * 3. Special cases: y0(0)=-inf, y0(x<0)=NaN, y0(inf)=0. */ use super::{cos, fabs, get_high_word, get_low_word, log, sin, sqrt}; const INVSQRTPI: f64 = 5.64189583547756279280e-01; /* 0x3FE20DD7, 0x50429B6D */ const TPI: f64 = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ /* common method when |x|>=2 */ fn common(ix: u32, x: f64, y0: bool) -> f64 { let s: f64; let mut c: f64; let mut ss: f64; let mut cc: f64; let z: f64; /* * j0(x) = sqrt(2/(pi*x))*(p0(x)*cos(x-pi/4)-q0(x)*sin(x-pi/4)) * y0(x) = sqrt(2/(pi*x))*(p0(x)*sin(x-pi/4)+q0(x)*cos(x-pi/4)) * * sin(x-pi/4) = (sin(x) - cos(x))/sqrt(2) * cos(x-pi/4) = (sin(x) + cos(x))/sqrt(2) * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) */ s = sin(x); c = cos(x); if y0 { c = -c; } cc = s + c; /* avoid overflow in 2*x, big ulp error when x>=0x1p1023 */ if ix < 0x7fe00000 { ss = s - c; z = -cos(2.0 * x); if s * c < 0.0 { cc = z / ss; } else { ss = z / cc; } if ix < 0x48000000 { if y0 { ss = -ss; } cc = pzero(x) * cc - qzero(x) * ss; } } return INVSQRTPI * cc / sqrt(x); } /* R0/S0 on [0, 2.00] */ const R02: f64 = 1.56249999999999947958e-02; /* 0x3F8FFFFF, 0xFFFFFFFD */ const R03: f64 = -1.89979294238854721751e-04; /* 0xBF28E6A5, 0xB61AC6E9 */ const R04: f64 = 1.82954049532700665670e-06; /* 0x3EBEB1D1, 0x0C503919 */ const R05: f64 = -4.61832688532103189199e-09; /* 0xBE33D5E7, 0x73D63FCE */ const S01: f64 = 1.56191029464890010492e-02; /* 0x3F8FFCE8, 0x82C8C2A4 */ const S02: f64 = 1.16926784663337450260e-04; /* 0x3F1EA6D2, 0xDD57DBF4 */ const S03: f64 = 5.13546550207318111446e-07; /* 0x3EA13B54, 0xCE84D5A9 */ const S04: f64 = 1.16614003333790000205e-09; /* 0x3E1408BC, 0xF4745D8F */ pub fn j0(mut x: f64) -> f64 { let z: f64; let r: f64; let s: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; /* j0(+-inf)=0, j0(nan)=nan */ if ix >= 0x7ff00000 { return 1.0 / (x * x); } x = fabs(x); if ix >= 0x40000000 { /* |x| >= 2 */ /* large ulp error near zeros: 2.4, 5.52, 8.6537,.. */ return common(ix, x, false); } /* 1 - x*x/4 + x*x*R(x^2)/S(x^2) */ if ix >= 0x3f200000 { /* |x| >= 2**-13 */ /* up to 4ulp error close to 2 */ z = x * x; r = z * (R02 + z * (R03 + z * (R04 + z * R05))); s = 1.0 + z * (S01 + z * (S02 + z * (S03 + z * S04))); return (1.0 + x / 2.0) * (1.0 - x / 2.0) + z * (r / s); } /* 1 - x*x/4 */ /* prevent underflow */ /* inexact should be raised when x!=0, this is not done correctly */ if ix >= 0x38000000 { /* |x| >= 2**-127 */ x = 0.25 * x * x; } return 1.0 - x; } const U00: f64 = -7.38042951086872317523e-02; /* 0xBFB2E4D6, 0x99CBD01F */ const U01: f64 = 1.76666452509181115538e-01; /* 0x3FC69D01, 0x9DE9E3FC */ const U02: f64 = -1.38185671945596898896e-02; /* 0xBF8C4CE8, 0xB16CFA97 */ const U03: f64 = 3.47453432093683650238e-04; /* 0x3F36C54D, 0x20B29B6B */ const U04: f64 = -3.81407053724364161125e-06; /* 0xBECFFEA7, 0x73D25CAD */ const U05: f64 = 1.95590137035022920206e-08; /* 0x3E550057, 0x3B4EABD4 */ const U06: f64 = -3.98205194132103398453e-11; /* 0xBDC5E43D, 0x693FB3C8 */ const V01: f64 = 1.27304834834123699328e-02; /* 0x3F8A1270, 0x91C9C71A */ const V02: f64 = 7.60068627350353253702e-05; /* 0x3F13ECBB, 0xF578C6C1 */ const V03: f64 = 2.59150851840457805467e-07; /* 0x3E91642D, 0x7FF202FD */ const V04: f64 = 4.41110311332675467403e-10; /* 0x3DFE5018, 0x3BD6D9EF */ pub fn y0(x: f64) -> f64 { let z: f64; let u: f64; let v: f64; let ix: u32; let lx: u32; ix = get_high_word(x); lx = get_low_word(x); /* y0(nan)=nan, y0(<0)=nan, y0(0)=-inf, y0(inf)=0 */ if ((ix << 1) | lx) == 0 { return -1.0 / 0.0; } if (ix >> 31) != 0 { return 0.0 / 0.0; } if ix >= 0x7ff00000 { return 1.0 / x; } if ix >= 0x40000000 { /* x >= 2 */ /* large ulp errors near zeros: 3.958, 7.086,.. */ return common(ix, x, true); } /* U(x^2)/V(x^2) + (2/pi)*j0(x)*log(x) */ if ix >= 0x3e400000 { /* x >= 2**-27 */ /* large ulp error near the first zero, x ~= 0.89 */ z = x * x; u = U00 + z * (U01 + z * (U02 + z * (U03 + z * (U04 + z * (U05 + z * U06))))); v = 1.0 + z * (V01 + z * (V02 + z * (V03 + z * V04))); return u / v + TPI * (j0(x) * log(x)); } return U00 + TPI * log(x); } /* The asymptotic expansions of pzero is * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. * For x >= 2, We approximate pzero by * pzero(x) = 1 + (R/S) * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 * S = 1 + pS0*s^2 + ... + pS4*s^10 * and * | pzero(x)-1-R/S | <= 2 ** ( -60.26) */ const PR8: [f64; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ -7.03124999999900357484e-02, /* 0xBFB1FFFF, 0xFFFFFD32 */ -8.08167041275349795626e+00, /* 0xC02029D0, 0xB44FA779 */ -2.57063105679704847262e+02, /* 0xC0701102, 0x7B19E863 */ -2.48521641009428822144e+03, /* 0xC0A36A6E, 0xCD4DCAFC */ -5.25304380490729545272e+03, /* 0xC0B4850B, 0x36CC643D */ ]; const PS8: [f64; 5] = [ 1.16534364619668181717e+02, /* 0x405D2233, 0x07A96751 */ 3.83374475364121826715e+03, /* 0x40ADF37D, 0x50596938 */ 4.05978572648472545552e+04, /* 0x40E3D2BB, 0x6EB6B05F */ 1.16752972564375915681e+05, /* 0x40FC810F, 0x8F9FA9BD */ 4.76277284146730962675e+04, /* 0x40E74177, 0x4F2C49DC */ ]; const PR5: [f64; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ -1.14125464691894502584e-11, /* 0xBDA918B1, 0x47E495CC */ -7.03124940873599280078e-02, /* 0xBFB1FFFF, 0xE69AFBC6 */ -4.15961064470587782438e+00, /* 0xC010A370, 0xF90C6BBF */ -6.76747652265167261021e+01, /* 0xC050EB2F, 0x5A7D1783 */ -3.31231299649172967747e+02, /* 0xC074B3B3, 0x6742CC63 */ -3.46433388365604912451e+02, /* 0xC075A6EF, 0x28A38BD7 */ ]; const PS5: [f64; 5] = [ 6.07539382692300335975e+01, /* 0x404E6081, 0x0C98C5DE */ 1.05125230595704579173e+03, /* 0x40906D02, 0x5C7E2864 */ 5.97897094333855784498e+03, /* 0x40B75AF8, 0x8FBE1D60 */ 9.62544514357774460223e+03, /* 0x40C2CCB8, 0xFA76FA38 */ 2.40605815922939109441e+03, /* 0x40A2CC1D, 0xC70BE864 */ ]; const PR3: [f64; 6] = [ /* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ -2.54704601771951915620e-09, /* 0xBE25E103, 0x6FE1AA86 */ -7.03119616381481654654e-02, /* 0xBFB1FFF6, 0xF7C0E24B */ -2.40903221549529611423e+00, /* 0xC00345B2, 0xAEA48074 */ -2.19659774734883086467e+01, /* 0xC035F74A, 0x4CB94E14 */ -5.80791704701737572236e+01, /* 0xC04D0A22, 0x420A1A45 */ -3.14479470594888503854e+01, /* 0xC03F72AC, 0xA892D80F */ ]; const PS3: [f64; 5] = [ 3.58560338055209726349e+01, /* 0x4041ED92, 0x84077DD3 */ 3.61513983050303863820e+02, /* 0x40769839, 0x464A7C0E */ 1.19360783792111533330e+03, /* 0x4092A66E, 0x6D1061D6 */ 1.12799679856907414432e+03, /* 0x40919FFC, 0xB8C39B7E */ 1.73580930813335754692e+02, /* 0x4065B296, 0xFC379081 */ ]; const PR2: [f64; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ -8.87534333032526411254e-08, /* 0xBE77D316, 0xE927026D */ -7.03030995483624743247e-02, /* 0xBFB1FF62, 0x495E1E42 */ -1.45073846780952986357e+00, /* 0xBFF73639, 0x8A24A843 */ -7.63569613823527770791e+00, /* 0xC01E8AF3, 0xEDAFA7F3 */ -1.11931668860356747786e+01, /* 0xC02662E6, 0xC5246303 */ -3.23364579351335335033e+00, /* 0xC009DE81, 0xAF8FE70F */ ]; const PS2: [f64; 5] = [ 2.22202997532088808441e+01, /* 0x40363865, 0x908B5959 */ 1.36206794218215208048e+02, /* 0x4061069E, 0x0EE8878F */ 2.70470278658083486789e+02, /* 0x4070E786, 0x42EA079B */ 1.53875394208320329881e+02, /* 0x40633C03, 0x3AB6FAFF */ 1.46576176948256193810e+01, /* 0x402D50B3, 0x44391809 */ ]; fn pzero(x: f64) -> f64 { let p: &[f64; 6]; let q: &[f64; 5]; let z: f64; let r: f64; let s: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; if ix >= 0x40200000 { p = &PR8; q = &PS8; } else if ix >= 0x40122E8B { p = &PR5; q = &PS5; } else if ix >= 0x4006DB6D { p = &PR3; q = &PS3; } else /*ix >= 0x40000000*/ { p = &PR2; q = &PS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * q[4])))); return 1.0 + r / s; } /* For x >= 8, the asymptotic expansions of qzero is * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. * We approximate pzero by * qzero(x) = s*(-1.25 + (R/S)) * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 * S = 1 + qS0*s^2 + ... + qS5*s^12 * and * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) */ const QR8: [f64; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ 7.32421874999935051953e-02, /* 0x3FB2BFFF, 0xFFFFFE2C */ 1.17682064682252693899e+01, /* 0x40278952, 0x5BB334D6 */ 5.57673380256401856059e+02, /* 0x40816D63, 0x15301825 */ 8.85919720756468632317e+03, /* 0x40C14D99, 0x3E18F46D */ 3.70146267776887834771e+04, /* 0x40E212D4, 0x0E901566 */ ]; const QS8: [f64; 6] = [ 1.63776026895689824414e+02, /* 0x406478D5, 0x365B39BC */ 8.09834494656449805916e+03, /* 0x40BFA258, 0x4E6B0563 */ 1.42538291419120476348e+05, /* 0x41016652, 0x54D38C3F */ 8.03309257119514397345e+05, /* 0x412883DA, 0x83A52B43 */ 8.40501579819060512818e+05, /* 0x4129A66B, 0x28DE0B3D */ -3.43899293537866615225e+05, /* 0xC114FD6D, 0x2C9530C5 */ ]; const QR5: [f64; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ 1.84085963594515531381e-11, /* 0x3DB43D8F, 0x29CC8CD9 */ 7.32421766612684765896e-02, /* 0x3FB2BFFF, 0xD172B04C */ 5.83563508962056953777e+00, /* 0x401757B0, 0xB9953DD3 */ 1.35111577286449829671e+02, /* 0x4060E392, 0x0A8788E9 */ 1.02724376596164097464e+03, /* 0x40900CF9, 0x9DC8C481 */ 1.98997785864605384631e+03, /* 0x409F17E9, 0x53C6E3A6 */ ]; const QS5: [f64; 6] = [ 8.27766102236537761883e+01, /* 0x4054B1B3, 0xFB5E1543 */ 2.07781416421392987104e+03, /* 0x40A03BA0, 0xDA21C0CE */ 1.88472887785718085070e+04, /* 0x40D267D2, 0x7B591E6D */ 5.67511122894947329769e+04, /* 0x40EBB5E3, 0x97E02372 */ 3.59767538425114471465e+04, /* 0x40E19118, 0x1F7A54A0 */ -5.35434275601944773371e+03, /* 0xC0B4EA57, 0xBEDBC609 */ ]; const QR3: [f64; 6] = [ /* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ 4.37741014089738620906e-09, /* 0x3E32CD03, 0x6ADECB82 */ 7.32411180042911447163e-02, /* 0x3FB2BFEE, 0x0E8D0842 */ 3.34423137516170720929e+00, /* 0x400AC0FC, 0x61149CF5 */ 4.26218440745412650017e+01, /* 0x40454F98, 0x962DAEDD */ 1.70808091340565596283e+02, /* 0x406559DB, 0xE25EFD1F */ 1.66733948696651168575e+02, /* 0x4064D77C, 0x81FA21E0 */ ]; const QS3: [f64; 6] = [ 4.87588729724587182091e+01, /* 0x40486122, 0xBFE343A6 */ 7.09689221056606015736e+02, /* 0x40862D83, 0x86544EB3 */ 3.70414822620111362994e+03, /* 0x40ACF04B, 0xE44DFC63 */ 6.46042516752568917582e+03, /* 0x40B93C6C, 0xD7C76A28 */ 2.51633368920368957333e+03, /* 0x40A3A8AA, 0xD94FB1C0 */ -1.49247451836156386662e+02, /* 0xC062A7EB, 0x201CF40F */ ]; const QR2: [f64; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ 1.50444444886983272379e-07, /* 0x3E84313B, 0x54F76BDB */ 7.32234265963079278272e-02, /* 0x3FB2BEC5, 0x3E883E34 */ 1.99819174093815998816e+00, /* 0x3FFFF897, 0xE727779C */ 1.44956029347885735348e+01, /* 0x402CFDBF, 0xAAF96FE5 */ 3.16662317504781540833e+01, /* 0x403FAA8E, 0x29FBDC4A */ 1.62527075710929267416e+01, /* 0x403040B1, 0x71814BB4 */ ]; const QS2: [f64; 6] = [ 3.03655848355219184498e+01, /* 0x403E5D96, 0xF7C07AED */ 2.69348118608049844624e+02, /* 0x4070D591, 0xE4D14B40 */ 8.44783757595320139444e+02, /* 0x408A6645, 0x22B3BF22 */ 8.82935845112488550512e+02, /* 0x408B977C, 0x9C5CC214 */ 2.12666388511798828631e+02, /* 0x406A9553, 0x0E001365 */ -5.31095493882666946917e+00, /* 0xC0153E6A, 0xF8B32931 */ ]; fn qzero(x: f64) -> f64 { let p: &[f64; 6]; let q: &[f64; 6]; let s: f64; let r: f64; let z: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; if ix >= 0x40200000 { p = &QR8; q = &QS8; } else if ix >= 0x40122E8B { p = &QR5; q = &QS5; } else if ix >= 0x4006DB6D { p = &QR3; q = &QS3; } else /*ix >= 0x40000000*/ { p = &QR2; q = &QS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * (q[4] + z * q[5]))))); return (-0.125 + r / s) / x; } libm-0.2.1/src/math/j0f.rs010066400017500001750000000243201351140252100134200ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_j0f.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{cosf, fabsf, logf, sinf, sqrtf}; const INVSQRTPI: f32 = 5.6418961287e-01; /* 0x3f106ebb */ const TPI: f32 = 6.3661974669e-01; /* 0x3f22f983 */ fn common(ix: u32, x: f32, y0: bool) -> f32 { let z: f32; let s: f32; let mut c: f32; let mut ss: f32; let mut cc: f32; /* * j0(x) = 1/sqrt(pi) * (P(0,x)*cc - Q(0,x)*ss) / sqrt(x) * y0(x) = 1/sqrt(pi) * (P(0,x)*ss + Q(0,x)*cc) / sqrt(x) */ s = sinf(x); c = cosf(x); if y0 { c = -c; } cc = s + c; if ix < 0x7f000000 { ss = s - c; z = -cosf(2.0 * x); if s * c < 0.0 { cc = z / ss; } else { ss = z / cc; } if ix < 0x58800000 { if y0 { ss = -ss; } cc = pzerof(x) * cc - qzerof(x) * ss; } } return INVSQRTPI * cc / sqrtf(x); } /* R0/S0 on [0, 2.00] */ const R02: f32 = 1.5625000000e-02; /* 0x3c800000 */ const R03: f32 = -1.8997929874e-04; /* 0xb947352e */ const R04: f32 = 1.8295404516e-06; /* 0x35f58e88 */ const R05: f32 = -4.6183270541e-09; /* 0xb19eaf3c */ const S01: f32 = 1.5619102865e-02; /* 0x3c7fe744 */ const S02: f32 = 1.1692678527e-04; /* 0x38f53697 */ const S03: f32 = 5.1354652442e-07; /* 0x3509daa6 */ const S04: f32 = 1.1661400734e-09; /* 0x30a045e8 */ pub fn j0f(mut x: f32) -> f32 { let z: f32; let r: f32; let s: f32; let mut ix: u32; ix = x.to_bits(); ix &= 0x7fffffff; if ix >= 0x7f800000 { return 1.0 / (x * x); } x = fabsf(x); if ix >= 0x40000000 { /* |x| >= 2 */ /* large ulp error near zeros */ return common(ix, x, false); } if ix >= 0x3a000000 { /* |x| >= 2**-11 */ /* up to 4ulp error near 2 */ z = x * x; r = z * (R02 + z * (R03 + z * (R04 + z * R05))); s = 1.0 + z * (S01 + z * (S02 + z * (S03 + z * S04))); return (1.0 + x / 2.0) * (1.0 - x / 2.0) + z * (r / s); } if ix >= 0x21800000 { /* |x| >= 2**-60 */ x = 0.25 * x * x; } return 1.0 - x; } const U00: f32 = -7.3804296553e-02; /* 0xbd9726b5 */ const U01: f32 = 1.7666645348e-01; /* 0x3e34e80d */ const U02: f32 = -1.3818567619e-02; /* 0xbc626746 */ const U03: f32 = 3.4745343146e-04; /* 0x39b62a69 */ const U04: f32 = -3.8140706238e-06; /* 0xb67ff53c */ const U05: f32 = 1.9559013964e-08; /* 0x32a802ba */ const U06: f32 = -3.9820518410e-11; /* 0xae2f21eb */ const V01: f32 = 1.2730483897e-02; /* 0x3c509385 */ const V02: f32 = 7.6006865129e-05; /* 0x389f65e0 */ const V03: f32 = 2.5915085189e-07; /* 0x348b216c */ const V04: f32 = 4.4111031494e-10; /* 0x2ff280c2 */ pub fn y0f(x: f32) -> f32 { let z: f32; let u: f32; let v: f32; let ix: u32; ix = x.to_bits(); if (ix & 0x7fffffff) == 0 { return -1.0 / 0.0; } if (ix >> 31) != 0 { return 0.0 / 0.0; } if ix >= 0x7f800000 { return 1.0 / x; } if ix >= 0x40000000 { /* |x| >= 2.0 */ /* large ulp error near zeros */ return common(ix, x, true); } if ix >= 0x39000000 { /* x >= 2**-13 */ /* large ulp error at x ~= 0.89 */ z = x * x; u = U00 + z * (U01 + z * (U02 + z * (U03 + z * (U04 + z * (U05 + z * U06))))); v = 1.0 + z * (V01 + z * (V02 + z * (V03 + z * V04))); return u / v + TPI * (j0f(x) * logf(x)); } return U00 + TPI * logf(x); } /* The asymptotic expansions of pzero is * 1 - 9/128 s^2 + 11025/98304 s^4 - ..., where s = 1/x. * For x >= 2, We approximate pzero by * pzero(x) = 1 + (R/S) * where R = pR0 + pR1*s^2 + pR2*s^4 + ... + pR5*s^10 * S = 1 + pS0*s^2 + ... + pS4*s^10 * and * | pzero(x)-1-R/S | <= 2 ** ( -60.26) */ const PR8: [f32; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.0000000000e+00, /* 0x00000000 */ -7.0312500000e-02, /* 0xbd900000 */ -8.0816707611e+00, /* 0xc1014e86 */ -2.5706311035e+02, /* 0xc3808814 */ -2.4852163086e+03, /* 0xc51b5376 */ -5.2530439453e+03, /* 0xc5a4285a */ ]; const PS8: [f32; 5] = [ 1.1653436279e+02, /* 0x42e91198 */ 3.8337448730e+03, /* 0x456f9beb */ 4.0597855469e+04, /* 0x471e95db */ 1.1675296875e+05, /* 0x47e4087c */ 4.7627726562e+04, /* 0x473a0bba */ ]; const PR5: [f32; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ -1.1412546255e-11, /* 0xad48c58a */ -7.0312492549e-02, /* 0xbd8fffff */ -4.1596107483e+00, /* 0xc0851b88 */ -6.7674766541e+01, /* 0xc287597b */ -3.3123129272e+02, /* 0xc3a59d9b */ -3.4643338013e+02, /* 0xc3ad3779 */ ]; const PS5: [f32; 5] = [ 6.0753936768e+01, /* 0x42730408 */ 1.0512523193e+03, /* 0x44836813 */ 5.9789707031e+03, /* 0x45bad7c4 */ 9.6254453125e+03, /* 0x461665c8 */ 2.4060581055e+03, /* 0x451660ee */ ]; const PR3: [f32; 6] = [ /* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ -2.5470459075e-09, /* 0xb12f081b */ -7.0311963558e-02, /* 0xbd8fffb8 */ -2.4090321064e+00, /* 0xc01a2d95 */ -2.1965976715e+01, /* 0xc1afba52 */ -5.8079170227e+01, /* 0xc2685112 */ -3.1447946548e+01, /* 0xc1fb9565 */ ]; const PS3: [f32; 5] = [ 3.5856033325e+01, /* 0x420f6c94 */ 3.6151397705e+02, /* 0x43b4c1ca */ 1.1936077881e+03, /* 0x44953373 */ 1.1279968262e+03, /* 0x448cffe6 */ 1.7358093262e+02, /* 0x432d94b8 */ ]; const PR2: [f32; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ -8.8753431271e-08, /* 0xb3be98b7 */ -7.0303097367e-02, /* 0xbd8ffb12 */ -1.4507384300e+00, /* 0xbfb9b1cc */ -7.6356959343e+00, /* 0xc0f4579f */ -1.1193166733e+01, /* 0xc1331736 */ -3.2336456776e+00, /* 0xc04ef40d */ ]; const PS2: [f32; 5] = [ 2.2220300674e+01, /* 0x41b1c32d */ 1.3620678711e+02, /* 0x430834f0 */ 2.7047027588e+02, /* 0x43873c32 */ 1.5387539673e+02, /* 0x4319e01a */ 1.4657617569e+01, /* 0x416a859a */ ]; fn pzerof(x: f32) -> f32 { let p: &[f32; 6]; let q: &[f32; 5]; let z: f32; let r: f32; let s: f32; let mut ix: u32; ix = x.to_bits(); ix &= 0x7fffffff; if ix >= 0x41000000 { p = &PR8; q = &PS8; } else if ix >= 0x409173eb { p = &PR5; q = &PS5; } else if ix >= 0x4036d917 { p = &PR3; q = &PS3; } else /*ix >= 0x40000000*/ { p = &PR2; q = &PS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * q[4])))); return 1.0 + r / s; } /* For x >= 8, the asymptotic expansions of qzero is * -1/8 s + 75/1024 s^3 - ..., where s = 1/x. * We approximate pzero by * qzero(x) = s*(-1.25 + (R/S)) * where R = qR0 + qR1*s^2 + qR2*s^4 + ... + qR5*s^10 * S = 1 + qS0*s^2 + ... + qS5*s^12 * and * | qzero(x)/s +1.25-R/S | <= 2 ** ( -61.22) */ const QR8: [f32; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.0000000000e+00, /* 0x00000000 */ 7.3242187500e-02, /* 0x3d960000 */ 1.1768206596e+01, /* 0x413c4a93 */ 5.5767340088e+02, /* 0x440b6b19 */ 8.8591972656e+03, /* 0x460a6cca */ 3.7014625000e+04, /* 0x471096a0 */ ]; const QS8: [f32; 6] = [ 1.6377603149e+02, /* 0x4323c6aa */ 8.0983447266e+03, /* 0x45fd12c2 */ 1.4253829688e+05, /* 0x480b3293 */ 8.0330925000e+05, /* 0x49441ed4 */ 8.4050156250e+05, /* 0x494d3359 */ -3.4389928125e+05, /* 0xc8a7eb69 */ ]; const QR5: [f32; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ 1.8408595828e-11, /* 0x2da1ec79 */ 7.3242180049e-02, /* 0x3d95ffff */ 5.8356351852e+00, /* 0x40babd86 */ 1.3511157227e+02, /* 0x43071c90 */ 1.0272437744e+03, /* 0x448067cd */ 1.9899779053e+03, /* 0x44f8bf4b */ ]; const QS5: [f32; 6] = [ 8.2776611328e+01, /* 0x42a58da0 */ 2.0778142090e+03, /* 0x4501dd07 */ 1.8847289062e+04, /* 0x46933e94 */ 5.6751113281e+04, /* 0x475daf1d */ 3.5976753906e+04, /* 0x470c88c1 */ -5.3543427734e+03, /* 0xc5a752be */ ]; const QR3: [f32; 6] = [ /* for x in [4.547,2.8571]=1/[0.2199,0.35001] */ 4.3774099900e-09, /* 0x3196681b */ 7.3241114616e-02, /* 0x3d95ff70 */ 3.3442313671e+00, /* 0x405607e3 */ 4.2621845245e+01, /* 0x422a7cc5 */ 1.7080809021e+02, /* 0x432acedf */ 1.6673394775e+02, /* 0x4326bbe4 */ ]; const QS3: [f32; 6] = [ 4.8758872986e+01, /* 0x42430916 */ 7.0968920898e+02, /* 0x44316c1c */ 3.7041481934e+03, /* 0x4567825f */ 6.4604252930e+03, /* 0x45c9e367 */ 2.5163337402e+03, /* 0x451d4557 */ -1.4924745178e+02, /* 0xc3153f59 */ ]; const QR2: [f32; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ 1.5044444979e-07, /* 0x342189db */ 7.3223426938e-02, /* 0x3d95f62a */ 1.9981917143e+00, /* 0x3fffc4bf */ 1.4495602608e+01, /* 0x4167edfd */ 3.1666231155e+01, /* 0x41fd5471 */ 1.6252708435e+01, /* 0x4182058c */ ]; const QS2: [f32; 6] = [ 3.0365585327e+01, /* 0x41f2ecb8 */ 2.6934811401e+02, /* 0x4386ac8f */ 8.4478375244e+02, /* 0x44533229 */ 8.8293585205e+02, /* 0x445cbbe5 */ 2.1266638184e+02, /* 0x4354aa98 */ -5.3109550476e+00, /* 0xc0a9f358 */ ]; fn qzerof(x: f32) -> f32 { let p: &[f32; 6]; let q: &[f32; 6]; let s: f32; let r: f32; let z: f32; let mut ix: u32; ix = x.to_bits(); ix &= 0x7fffffff; if ix >= 0x41000000 { p = &QR8; q = &QS8; } else if ix >= 0x409173eb { p = &QR5; q = &QS5; } else if ix >= 0x4036d917 { p = &QR3; q = &QS3; } else /*ix >= 0x40000000*/ { p = &QR2; q = &QS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * (q[4] + z * q[5]))))); return (-0.125 + r / s) / x; } libm-0.2.1/src/math/j1.rs010066400017500001750000000350411351140252100132550ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_j1.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* j1(x), y1(x) * Bessel function of the first and second kinds of order zero. * Method -- j1(x): * 1. For tiny x, we use j1(x) = x/2 - x^3/16 + x^5/384 - ... * 2. Reduce x to |x| since j1(x)=-j1(-x), and * for x in (0,2) * j1(x) = x/2 + x*z*R0/S0, where z = x*x; * (precision: |j1/x - 1/2 - R0/S0 |<2**-61.51 ) * for x in (2,inf) * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x1)-q1(x)*sin(x1)) * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) * as follow: * cos(x1) = cos(x)cos(3pi/4)+sin(x)sin(3pi/4) * = 1/sqrt(2) * (sin(x) - cos(x)) * sin(x1) = sin(x)cos(3pi/4)-cos(x)sin(3pi/4) * = -1/sqrt(2) * (sin(x) + cos(x)) * (To avoid cancellation, use * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) * to compute the worse one.) * * 3 Special cases * j1(nan)= nan * j1(0) = 0 * j1(inf) = 0 * * Method -- y1(x): * 1. screen out x<=0 cases: y1(0)=-inf, y1(x<0)=NaN * 2. For x<2. * Since * y1(x) = 2/pi*(j1(x)*(ln(x/2)+Euler)-1/x-x/2+5/64*x^3-...) * therefore y1(x)-2/pi*j1(x)*ln(x)-1/x is an odd function. * We use the following function to approximate y1, * y1(x) = x*U(z)/V(z) + (2/pi)*(j1(x)*ln(x)-1/x), z= x^2 * where for x in [0,2] (abs err less than 2**-65.89) * U(z) = U0[0] + U0[1]*z + ... + U0[4]*z^4 * V(z) = 1 + v0[0]*z + ... + v0[4]*z^5 * Note: For tiny x, 1/x dominate y1 and hence * y1(tiny) = -2/pi/tiny, (choose tiny<2**-54) * 3. For x>=2. * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x1)+q1(x)*cos(x1)) * where x1 = x-3*pi/4. It is better to compute sin(x1),cos(x1) * by method mentioned above. */ use super::{cos, fabs, get_high_word, get_low_word, log, sin, sqrt}; const INVSQRTPI: f64 = 5.64189583547756279280e-01; /* 0x3FE20DD7, 0x50429B6D */ const TPI: f64 = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ fn common(ix: u32, x: f64, y1: bool, sign: bool) -> f64 { let z: f64; let mut s: f64; let c: f64; let mut ss: f64; let mut cc: f64; /* * j1(x) = sqrt(2/(pi*x))*(p1(x)*cos(x-3pi/4)-q1(x)*sin(x-3pi/4)) * y1(x) = sqrt(2/(pi*x))*(p1(x)*sin(x-3pi/4)+q1(x)*cos(x-3pi/4)) * * sin(x-3pi/4) = -(sin(x) + cos(x))/sqrt(2) * cos(x-3pi/4) = (sin(x) - cos(x))/sqrt(2) * sin(x) +- cos(x) = -cos(2x)/(sin(x) -+ cos(x)) */ s = sin(x); if y1 { s = -s; } c = cos(x); cc = s - c; if ix < 0x7fe00000 { /* avoid overflow in 2*x */ ss = -s - c; z = cos(2.0 * x); if s * c > 0.0 { cc = z / ss; } else { ss = z / cc; } if ix < 0x48000000 { if y1 { ss = -ss; } cc = pone(x) * cc - qone(x) * ss; } } if sign { cc = -cc; } return INVSQRTPI * cc / sqrt(x); } /* R0/S0 on [0,2] */ const R00: f64 = -6.25000000000000000000e-02; /* 0xBFB00000, 0x00000000 */ const R01: f64 = 1.40705666955189706048e-03; /* 0x3F570D9F, 0x98472C61 */ const R02: f64 = -1.59955631084035597520e-05; /* 0xBEF0C5C6, 0xBA169668 */ const R03: f64 = 4.96727999609584448412e-08; /* 0x3E6AAAFA, 0x46CA0BD9 */ const S01: f64 = 1.91537599538363460805e-02; /* 0x3F939D0B, 0x12637E53 */ const S02: f64 = 1.85946785588630915560e-04; /* 0x3F285F56, 0xB9CDF664 */ const S03: f64 = 1.17718464042623683263e-06; /* 0x3EB3BFF8, 0x333F8498 */ const S04: f64 = 5.04636257076217042715e-09; /* 0x3E35AC88, 0xC97DFF2C */ const S05: f64 = 1.23542274426137913908e-11; /* 0x3DAB2ACF, 0xCFB97ED8 */ pub fn j1(x: f64) -> f64 { let mut z: f64; let r: f64; let s: f64; let mut ix: u32; let sign: bool; ix = get_high_word(x); sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix >= 0x7ff00000 { return 1.0 / (x * x); } if ix >= 0x40000000 { /* |x| >= 2 */ return common(ix, fabs(x), false, sign); } if ix >= 0x38000000 { /* |x| >= 2**-127 */ z = x * x; r = z * (R00 + z * (R01 + z * (R02 + z * R03))); s = 1.0 + z * (S01 + z * (S02 + z * (S03 + z * (S04 + z * S05)))); z = r / s; } else { /* avoid underflow, raise inexact if x!=0 */ z = x; } return (0.5 + z) * x; } const U0: [f64; 5] = [ -1.96057090646238940668e-01, /* 0xBFC91866, 0x143CBC8A */ 5.04438716639811282616e-02, /* 0x3FA9D3C7, 0x76292CD1 */ -1.91256895875763547298e-03, /* 0xBF5F55E5, 0x4844F50F */ 2.35252600561610495928e-05, /* 0x3EF8AB03, 0x8FA6B88E */ -9.19099158039878874504e-08, /* 0xBE78AC00, 0x569105B8 */ ]; const V0: [f64; 5] = [ 1.99167318236649903973e-02, /* 0x3F94650D, 0x3F4DA9F0 */ 2.02552581025135171496e-04, /* 0x3F2A8C89, 0x6C257764 */ 1.35608801097516229404e-06, /* 0x3EB6C05A, 0x894E8CA6 */ 6.22741452364621501295e-09, /* 0x3E3ABF1D, 0x5BA69A86 */ 1.66559246207992079114e-11, /* 0x3DB25039, 0xDACA772A */ ]; pub fn y1(x: f64) -> f64 { let z: f64; let u: f64; let v: f64; let ix: u32; let lx: u32; ix = get_high_word(x); lx = get_low_word(x); /* y1(nan)=nan, y1(<0)=nan, y1(0)=-inf, y1(inf)=0 */ if (ix << 1 | lx) == 0 { return -1.0 / 0.0; } if (ix >> 31) != 0 { return 0.0 / 0.0; } if ix >= 0x7ff00000 { return 1.0 / x; } if ix >= 0x40000000 { /* x >= 2 */ return common(ix, x, true, false); } if ix < 0x3c900000 { /* x < 2**-54 */ return -TPI / x; } z = x * x; u = U0[0] + z * (U0[1] + z * (U0[2] + z * (U0[3] + z * U0[4]))); v = 1.0 + z * (V0[0] + z * (V0[1] + z * (V0[2] + z * (V0[3] + z * V0[4])))); return x * (u / v) + TPI * (j1(x) * log(x) - 1.0 / x); } /* For x >= 8, the asymptotic expansions of pone is * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. * We approximate pone by * pone(x) = 1 + (R/S) * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 * S = 1 + ps0*s^2 + ... + ps4*s^10 * and * | pone(x)-1-R/S | <= 2 ** ( -60.06) */ const PR8: [f64; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ 1.17187499999988647970e-01, /* 0x3FBDFFFF, 0xFFFFFCCE */ 1.32394806593073575129e+01, /* 0x402A7A9D, 0x357F7FCE */ 4.12051854307378562225e+02, /* 0x4079C0D4, 0x652EA590 */ 3.87474538913960532227e+03, /* 0x40AE457D, 0xA3A532CC */ 7.91447954031891731574e+03, /* 0x40BEEA7A, 0xC32782DD */ ]; const PS8: [f64; 5] = [ 1.14207370375678408436e+02, /* 0x405C8D45, 0x8E656CAC */ 3.65093083420853463394e+03, /* 0x40AC85DC, 0x964D274F */ 3.69562060269033463555e+04, /* 0x40E20B86, 0x97C5BB7F */ 9.76027935934950801311e+04, /* 0x40F7D42C, 0xB28F17BB */ 3.08042720627888811578e+04, /* 0x40DE1511, 0x697A0B2D */ ]; const PR5: [f64; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ 1.31990519556243522749e-11, /* 0x3DAD0667, 0xDAE1CA7D */ 1.17187493190614097638e-01, /* 0x3FBDFFFF, 0xE2C10043 */ 6.80275127868432871736e+00, /* 0x401B3604, 0x6E6315E3 */ 1.08308182990189109773e+02, /* 0x405B13B9, 0x452602ED */ 5.17636139533199752805e+02, /* 0x40802D16, 0xD052D649 */ 5.28715201363337541807e+02, /* 0x408085B8, 0xBB7E0CB7 */ ]; const PS5: [f64; 5] = [ 5.92805987221131331921e+01, /* 0x404DA3EA, 0xA8AF633D */ 9.91401418733614377743e+02, /* 0x408EFB36, 0x1B066701 */ 5.35326695291487976647e+03, /* 0x40B4E944, 0x5706B6FB */ 7.84469031749551231769e+03, /* 0x40BEA4B0, 0xB8A5BB15 */ 1.50404688810361062679e+03, /* 0x40978030, 0x036F5E51 */ ]; const PR3: [f64; 6] = [ 3.02503916137373618024e-09, /* 0x3E29FC21, 0xA7AD9EDD */ 1.17186865567253592491e-01, /* 0x3FBDFFF5, 0x5B21D17B */ 3.93297750033315640650e+00, /* 0x400F76BC, 0xE85EAD8A */ 3.51194035591636932736e+01, /* 0x40418F48, 0x9DA6D129 */ 9.10550110750781271918e+01, /* 0x4056C385, 0x4D2C1837 */ 4.85590685197364919645e+01, /* 0x4048478F, 0x8EA83EE5 */ ]; const PS3: [f64; 5] = [ 3.47913095001251519989e+01, /* 0x40416549, 0xA134069C */ 3.36762458747825746741e+02, /* 0x40750C33, 0x07F1A75F */ 1.04687139975775130551e+03, /* 0x40905B7C, 0x5037D523 */ 8.90811346398256432622e+02, /* 0x408BD67D, 0xA32E31E9 */ 1.03787932439639277504e+02, /* 0x4059F26D, 0x7C2EED53 */ ]; const PR2: [f64; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ 1.07710830106873743082e-07, /* 0x3E7CE9D4, 0xF65544F4 */ 1.17176219462683348094e-01, /* 0x3FBDFF42, 0xBE760D83 */ 2.36851496667608785174e+00, /* 0x4002F2B7, 0xF98FAEC0 */ 1.22426109148261232917e+01, /* 0x40287C37, 0x7F71A964 */ 1.76939711271687727390e+01, /* 0x4031B1A8, 0x177F8EE2 */ 5.07352312588818499250e+00, /* 0x40144B49, 0xA574C1FE */ ]; const PS2: [f64; 5] = [ 2.14364859363821409488e+01, /* 0x40356FBD, 0x8AD5ECDC */ 1.25290227168402751090e+02, /* 0x405F5293, 0x14F92CD5 */ 2.32276469057162813669e+02, /* 0x406D08D8, 0xD5A2DBD9 */ 1.17679373287147100768e+02, /* 0x405D6B7A, 0xDA1884A9 */ 8.36463893371618283368e+00, /* 0x4020BAB1, 0xF44E5192 */ ]; fn pone(x: f64) -> f64 { let p: &[f64; 6]; let q: &[f64; 5]; let z: f64; let r: f64; let s: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; if ix >= 0x40200000 { p = &PR8; q = &PS8; } else if ix >= 0x40122E8B { p = &PR5; q = &PS5; } else if ix >= 0x4006DB6D { p = &PR3; q = &PS3; } else /*ix >= 0x40000000*/ { p = &PR2; q = &PS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * q[4])))); return 1.0 + r / s; } /* For x >= 8, the asymptotic expansions of qone is * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. * We approximate pone by * qone(x) = s*(0.375 + (R/S)) * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 * S = 1 + qs1*s^2 + ... + qs6*s^12 * and * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) */ const QR8: [f64; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.00000000000000000000e+00, /* 0x00000000, 0x00000000 */ -1.02539062499992714161e-01, /* 0xBFBA3FFF, 0xFFFFFDF3 */ -1.62717534544589987888e+01, /* 0xC0304591, 0xA26779F7 */ -7.59601722513950107896e+02, /* 0xC087BCD0, 0x53E4B576 */ -1.18498066702429587167e+04, /* 0xC0C724E7, 0x40F87415 */ -4.84385124285750353010e+04, /* 0xC0E7A6D0, 0x65D09C6A */ ]; const QS8: [f64; 6] = [ 1.61395369700722909556e+02, /* 0x40642CA6, 0xDE5BCDE5 */ 7.82538599923348465381e+03, /* 0x40BE9162, 0xD0D88419 */ 1.33875336287249578163e+05, /* 0x4100579A, 0xB0B75E98 */ 7.19657723683240939863e+05, /* 0x4125F653, 0x72869C19 */ 6.66601232617776375264e+05, /* 0x412457D2, 0x7719AD5C */ -2.94490264303834643215e+05, /* 0xC111F969, 0x0EA5AA18 */ ]; const QR5: [f64; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ -2.08979931141764104297e-11, /* 0xBDB6FA43, 0x1AA1A098 */ -1.02539050241375426231e-01, /* 0xBFBA3FFF, 0xCB597FEF */ -8.05644828123936029840e+00, /* 0xC0201CE6, 0xCA03AD4B */ -1.83669607474888380239e+02, /* 0xC066F56D, 0x6CA7B9B0 */ -1.37319376065508163265e+03, /* 0xC09574C6, 0x6931734F */ -2.61244440453215656817e+03, /* 0xC0A468E3, 0x88FDA79D */ ]; const QS5: [f64; 6] = [ 8.12765501384335777857e+01, /* 0x405451B2, 0xFF5A11B2 */ 1.99179873460485964642e+03, /* 0x409F1F31, 0xE77BF839 */ 1.74684851924908907677e+04, /* 0x40D10F1F, 0x0D64CE29 */ 4.98514270910352279316e+04, /* 0x40E8576D, 0xAABAD197 */ 2.79480751638918118260e+04, /* 0x40DB4B04, 0xCF7C364B */ -4.71918354795128470869e+03, /* 0xC0B26F2E, 0xFCFFA004 */ ]; const QR3: [f64; 6] = [ -5.07831226461766561369e-09, /* 0xBE35CFA9, 0xD38FC84F */ -1.02537829820837089745e-01, /* 0xBFBA3FEB, 0x51AEED54 */ -4.61011581139473403113e+00, /* 0xC01270C2, 0x3302D9FF */ -5.78472216562783643212e+01, /* 0xC04CEC71, 0xC25D16DA */ -2.28244540737631695038e+02, /* 0xC06C87D3, 0x4718D55F */ -2.19210128478909325622e+02, /* 0xC06B66B9, 0x5F5C1BF6 */ ]; const QS3: [f64; 6] = [ 4.76651550323729509273e+01, /* 0x4047D523, 0xCCD367E4 */ 6.73865112676699709482e+02, /* 0x40850EEB, 0xC031EE3E */ 3.38015286679526343505e+03, /* 0x40AA684E, 0x448E7C9A */ 5.54772909720722782367e+03, /* 0x40B5ABBA, 0xA61D54A6 */ 1.90311919338810798763e+03, /* 0x409DBC7A, 0x0DD4DF4B */ -1.35201191444307340817e+02, /* 0xC060E670, 0x290A311F */ ]; const QR2: [f64; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ -1.78381727510958865572e-07, /* 0xBE87F126, 0x44C626D2 */ -1.02517042607985553460e-01, /* 0xBFBA3E8E, 0x9148B010 */ -2.75220568278187460720e+00, /* 0xC0060484, 0x69BB4EDA */ -1.96636162643703720221e+01, /* 0xC033A9E2, 0xC168907F */ -4.23253133372830490089e+01, /* 0xC04529A3, 0xDE104AAA */ -2.13719211703704061733e+01, /* 0xC0355F36, 0x39CF6E52 */ ]; const QS2: [f64; 6] = [ 2.95333629060523854548e+01, /* 0x403D888A, 0x78AE64FF */ 2.52981549982190529136e+02, /* 0x406F9F68, 0xDB821CBA */ 7.57502834868645436472e+02, /* 0x4087AC05, 0xCE49A0F7 */ 7.39393205320467245656e+02, /* 0x40871B25, 0x48D4C029 */ 1.55949003336666123687e+02, /* 0x40637E5E, 0x3C3ED8D4 */ -4.95949898822628210127e+00, /* 0xC013D686, 0xE71BE86B */ ]; fn qone(x: f64) -> f64 { let p: &[f64; 6]; let q: &[f64; 6]; let s: f64; let r: f64; let z: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; if ix >= 0x40200000 { p = &QR8; q = &QS8; } else if ix >= 0x40122E8B { p = &QR5; q = &QS5; } else if ix >= 0x4006DB6D { p = &QR3; q = &QS3; } else /*ix >= 0x40000000*/ { p = &QR2; q = &QS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * (q[4] + z * q[5]))))); return (0.375 + r / s) / x; } libm-0.2.1/src/math/j1f.rs010066400017500001750000000240761353572365600134560ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_j1f.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{cosf, fabsf, logf, sinf, sqrtf}; const INVSQRTPI: f32 = 5.6418961287e-01; /* 0x3f106ebb */ const TPI: f32 = 6.3661974669e-01; /* 0x3f22f983 */ fn common(ix: u32, x: f32, y1: bool, sign: bool) -> f32 { let z: f64; let mut s: f64; let c: f64; let mut ss: f64; let mut cc: f64; s = sinf(x) as f64; if y1 { s = -s; } c = cosf(x) as f64; cc = s - c; if ix < 0x7f000000 { ss = -s - c; z = cosf(2.0 * x) as f64; if s * c > 0.0 { cc = z / ss; } else { ss = z / cc; } if ix < 0x58800000 { if y1 { ss = -ss; } cc = (ponef(x) as f64) * cc - (qonef(x) as f64) * ss; } } if sign { cc = -cc; } return (((INVSQRTPI as f64) * cc) / (sqrtf(x) as f64)) as f32; } /* R0/S0 on [0,2] */ const R00: f32 = -6.2500000000e-02; /* 0xbd800000 */ const R01: f32 = 1.4070566976e-03; /* 0x3ab86cfd */ const R02: f32 = -1.5995563444e-05; /* 0xb7862e36 */ const R03: f32 = 4.9672799207e-08; /* 0x335557d2 */ const S01: f32 = 1.9153760746e-02; /* 0x3c9ce859 */ const S02: f32 = 1.8594678841e-04; /* 0x3942fab6 */ const S03: f32 = 1.1771846857e-06; /* 0x359dffc2 */ const S04: f32 = 5.0463624390e-09; /* 0x31ad6446 */ const S05: f32 = 1.2354227016e-11; /* 0x2d59567e */ pub fn j1f(x: f32) -> f32 { let mut z: f32; let r: f32; let s: f32; let mut ix: u32; let sign: bool; ix = x.to_bits(); sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix >= 0x7f800000 { return 1.0 / (x * x); } if ix >= 0x40000000 { /* |x| >= 2 */ return common(ix, fabsf(x), false, sign); } if ix >= 0x39000000 { /* |x| >= 2**-13 */ z = x * x; r = z * (R00 + z * (R01 + z * (R02 + z * R03))); s = 1.0 + z * (S01 + z * (S02 + z * (S03 + z * (S04 + z * S05)))); z = 0.5 + r / s; } else { z = 0.5; } return z * x; } const U0: [f32; 5] = [ -1.9605709612e-01, /* 0xbe48c331 */ 5.0443872809e-02, /* 0x3d4e9e3c */ -1.9125689287e-03, /* 0xbafaaf2a */ 2.3525259166e-05, /* 0x37c5581c */ -9.1909917899e-08, /* 0xb3c56003 */ ]; const V0: [f32; 5] = [ 1.9916731864e-02, /* 0x3ca3286a */ 2.0255257550e-04, /* 0x3954644b */ 1.3560879779e-06, /* 0x35b602d4 */ 6.2274145840e-09, /* 0x31d5f8eb */ 1.6655924903e-11, /* 0x2d9281cf */ ]; pub fn y1f(x: f32) -> f32 { let z: f32; let u: f32; let v: f32; let ix: u32; ix = x.to_bits(); if (ix & 0x7fffffff) == 0 { return -1.0 / 0.0; } if (ix >> 31) != 0 { return 0.0 / 0.0; } if ix >= 0x7f800000 { return 1.0 / x; } if ix >= 0x40000000 { /* |x| >= 2.0 */ return common(ix, x, true, false); } if ix < 0x33000000 { /* x < 2**-25 */ return -TPI / x; } z = x * x; u = U0[0] + z * (U0[1] + z * (U0[2] + z * (U0[3] + z * U0[4]))); v = 1.0 + z * (V0[0] + z * (V0[1] + z * (V0[2] + z * (V0[3] + z * V0[4])))); return x * (u / v) + TPI * (j1f(x) * logf(x) - 1.0 / x); } /* For x >= 8, the asymptotic expansions of pone is * 1 + 15/128 s^2 - 4725/2^15 s^4 - ..., where s = 1/x. * We approximate pone by * pone(x) = 1 + (R/S) * where R = pr0 + pr1*s^2 + pr2*s^4 + ... + pr5*s^10 * S = 1 + ps0*s^2 + ... + ps4*s^10 * and * | pone(x)-1-R/S | <= 2 ** ( -60.06) */ const PR8: [f32; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.0000000000e+00, /* 0x00000000 */ 1.1718750000e-01, /* 0x3df00000 */ 1.3239480972e+01, /* 0x4153d4ea */ 4.1205184937e+02, /* 0x43ce06a3 */ 3.8747453613e+03, /* 0x45722bed */ 7.9144794922e+03, /* 0x45f753d6 */ ]; const PS8: [f32; 5] = [ 1.1420736694e+02, /* 0x42e46a2c */ 3.6509309082e+03, /* 0x45642ee5 */ 3.6956207031e+04, /* 0x47105c35 */ 9.7602796875e+04, /* 0x47bea166 */ 3.0804271484e+04, /* 0x46f0a88b */ ]; const PR5: [f32; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ 1.3199052094e-11, /* 0x2d68333f */ 1.1718749255e-01, /* 0x3defffff */ 6.8027510643e+00, /* 0x40d9b023 */ 1.0830818176e+02, /* 0x42d89dca */ 5.1763616943e+02, /* 0x440168b7 */ 5.2871520996e+02, /* 0x44042dc6 */ ]; const PS5: [f32; 5] = [ 5.9280597687e+01, /* 0x426d1f55 */ 9.9140142822e+02, /* 0x4477d9b1 */ 5.3532670898e+03, /* 0x45a74a23 */ 7.8446904297e+03, /* 0x45f52586 */ 1.5040468750e+03, /* 0x44bc0180 */ ]; const PR3: [f32; 6] = [ 3.0250391081e-09, /* 0x314fe10d */ 1.1718686670e-01, /* 0x3defffab */ 3.9329774380e+00, /* 0x407bb5e7 */ 3.5119403839e+01, /* 0x420c7a45 */ 9.1055007935e+01, /* 0x42b61c2a */ 4.8559066772e+01, /* 0x42423c7c */ ]; const PS3: [f32; 5] = [ 3.4791309357e+01, /* 0x420b2a4d */ 3.3676245117e+02, /* 0x43a86198 */ 1.0468714600e+03, /* 0x4482dbe3 */ 8.9081134033e+02, /* 0x445eb3ed */ 1.0378793335e+02, /* 0x42cf936c */ ]; const PR2: [f32; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ 1.0771083225e-07, /* 0x33e74ea8 */ 1.1717621982e-01, /* 0x3deffa16 */ 2.3685150146e+00, /* 0x401795c0 */ 1.2242610931e+01, /* 0x4143e1bc */ 1.7693971634e+01, /* 0x418d8d41 */ 5.0735230446e+00, /* 0x40a25a4d */ ]; const PS2: [f32; 5] = [ 2.1436485291e+01, /* 0x41ab7dec */ 1.2529022980e+02, /* 0x42fa9499 */ 2.3227647400e+02, /* 0x436846c7 */ 1.1767937469e+02, /* 0x42eb5bd7 */ 8.3646392822e+00, /* 0x4105d590 */ ]; fn ponef(x: f32) -> f32 { let p: &[f32; 6]; let q: &[f32; 5]; let z: f32; let r: f32; let s: f32; let mut ix: u32; ix = x.to_bits(); ix &= 0x7fffffff; if ix >= 0x41000000 { p = &PR8; q = &PS8; } else if ix >= 0x409173eb { p = &PR5; q = &PS5; } else if ix >= 0x4036d917 { p = &PR3; q = &PS3; } else /*ix >= 0x40000000*/ { p = &PR2; q = &PS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * q[4])))); return 1.0 + r / s; } /* For x >= 8, the asymptotic expansions of qone is * 3/8 s - 105/1024 s^3 - ..., where s = 1/x. * We approximate pone by * qone(x) = s*(0.375 + (R/S)) * where R = qr1*s^2 + qr2*s^4 + ... + qr5*s^10 * S = 1 + qs1*s^2 + ... + qs6*s^12 * and * | qone(x)/s -0.375-R/S | <= 2 ** ( -61.13) */ const QR8: [f32; 6] = [ /* for x in [inf, 8]=1/[0,0.125] */ 0.0000000000e+00, /* 0x00000000 */ -1.0253906250e-01, /* 0xbdd20000 */ -1.6271753311e+01, /* 0xc1822c8d */ -7.5960174561e+02, /* 0xc43de683 */ -1.1849806641e+04, /* 0xc639273a */ -4.8438511719e+04, /* 0xc73d3683 */ ]; const QS8: [f32; 6] = [ 1.6139537048e+02, /* 0x43216537 */ 7.8253862305e+03, /* 0x45f48b17 */ 1.3387534375e+05, /* 0x4802bcd6 */ 7.1965775000e+05, /* 0x492fb29c */ 6.6660125000e+05, /* 0x4922be94 */ -2.9449025000e+05, /* 0xc88fcb48 */ ]; const QR5: [f32; 6] = [ /* for x in [8,4.5454]=1/[0.125,0.22001] */ -2.0897993405e-11, /* 0xadb7d219 */ -1.0253904760e-01, /* 0xbdd1fffe */ -8.0564479828e+00, /* 0xc100e736 */ -1.8366960144e+02, /* 0xc337ab6b */ -1.3731937256e+03, /* 0xc4aba633 */ -2.6124443359e+03, /* 0xc523471c */ ]; const QS5: [f32; 6] = [ 8.1276550293e+01, /* 0x42a28d98 */ 1.9917987061e+03, /* 0x44f8f98f */ 1.7468484375e+04, /* 0x468878f8 */ 4.9851425781e+04, /* 0x4742bb6d */ 2.7948074219e+04, /* 0x46da5826 */ -4.7191835938e+03, /* 0xc5937978 */ ]; const QR3: [f32; 6] = [ -5.0783124372e-09, /* 0xb1ae7d4f */ -1.0253783315e-01, /* 0xbdd1ff5b */ -4.6101160049e+00, /* 0xc0938612 */ -5.7847221375e+01, /* 0xc267638e */ -2.2824453735e+02, /* 0xc3643e9a */ -2.1921012878e+02, /* 0xc35b35cb */ ]; const QS3: [f32; 6] = [ 4.7665153503e+01, /* 0x423ea91e */ 6.7386511230e+02, /* 0x4428775e */ 3.3801528320e+03, /* 0x45534272 */ 5.5477290039e+03, /* 0x45ad5dd5 */ 1.9031191406e+03, /* 0x44ede3d0 */ -1.3520118713e+02, /* 0xc3073381 */ ]; const QR2: [f32; 6] = [ /* for x in [2.8570,2]=1/[0.3499,0.5] */ -1.7838172539e-07, /* 0xb43f8932 */ -1.0251704603e-01, /* 0xbdd1f475 */ -2.7522056103e+00, /* 0xc0302423 */ -1.9663616180e+01, /* 0xc19d4f16 */ -4.2325313568e+01, /* 0xc2294d1f */ -2.1371921539e+01, /* 0xc1aaf9b2 */ ]; const QS2: [f32; 6] = [ 2.9533363342e+01, /* 0x41ec4454 */ 2.5298155212e+02, /* 0x437cfb47 */ 7.5750280762e+02, /* 0x443d602e */ 7.3939318848e+02, /* 0x4438d92a */ 1.5594900513e+02, /* 0x431bf2f2 */ -4.9594988823e+00, /* 0xc09eb437 */ ]; fn qonef(x: f32) -> f32 { let p: &[f32; 6]; let q: &[f32; 6]; let s: f32; let r: f32; let z: f32; let mut ix: u32; ix = x.to_bits(); ix &= 0x7fffffff; if ix >= 0x41000000 { p = &QR8; q = &QS8; } else if ix >= 0x409173eb { p = &QR5; q = &QS5; } else if ix >= 0x4036d917 { p = &QR3; q = &QS3; } else /*ix >= 0x40000000*/ { p = &QR2; q = &QS2; } z = 1.0 / (x * x); r = p[0] + z * (p[1] + z * (p[2] + z * (p[3] + z * (p[4] + z * p[5])))); s = 1.0 + z * (q[0] + z * (q[1] + z * (q[2] + z * (q[3] + z * (q[4] + z * q[5]))))); return (0.375 + r / s) / x; } #[cfg(test)] mod tests { use super::{j1f, y1f}; #[test] fn test_j1f_2488() { // 0x401F3E49 assert_eq!(j1f(2.4881766_f32), 0.49999475_f32); } #[test] fn test_y1f_2002() { assert_eq!(y1f(2.0000002_f32), -0.10703229_f32); } } libm-0.2.1/src/math/jn.rs010066400017500001750000000237031351140252100133540ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_jn.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* * jn(n, x), yn(n, x) * floating point Bessel's function of the 1st and 2nd kind * of order n * * Special cases: * y0(0)=y1(0)=yn(n,0) = -inf with division by zero signal; * y0(-ve)=y1(-ve)=yn(n,-ve) are NaN with invalid signal. * Note 2. About jn(n,x), yn(n,x) * For n=0, j0(x) is called, * for n=1, j1(x) is called, * for n<=x, forward recursion is used starting * from values of j0(x) and j1(x). * for n>x, a continued fraction approximation to * j(n,x)/j(n-1,x) is evaluated and then backward * recursion is used starting from a supposed value * for j(n,x). The resulting value of j(0,x) is * compared with the actual value to correct the * supposed value of j(n,x). * * yn(n,x) is similar in all respects, except * that forward recursion is used for all * values of n>1. */ use super::{cos, fabs, get_high_word, get_low_word, j0, j1, log, sin, sqrt, y0, y1}; const INVSQRTPI: f64 = 5.64189583547756279280e-01; /* 0x3FE20DD7, 0x50429B6D */ pub fn jn(n: i32, mut x: f64) -> f64 { let mut ix: u32; let lx: u32; let nm1: i32; let mut i: i32; let mut sign: bool; let mut a: f64; let mut b: f64; let mut temp: f64; ix = get_high_word(x); lx = get_low_word(x); sign = (ix >> 31) != 0; ix &= 0x7fffffff; // -lx == !lx + 1 if (ix | (lx | ((!lx).wrapping_add(1))) >> 31) > 0x7ff00000 { /* nan */ return x; } /* J(-n,x) = (-1)^n * J(n, x), J(n, -x) = (-1)^n * J(n, x) * Thus, J(-n,x) = J(n,-x) */ /* nm1 = |n|-1 is used instead of |n| to handle n==INT_MIN */ if n == 0 { return j0(x); } if n < 0 { nm1 = -(n + 1); x = -x; sign = !sign; } else { nm1 = n - 1; } if nm1 == 0 { return j1(x); } sign &= (n & 1) != 0; /* even n: 0, odd n: signbit(x) */ x = fabs(x); if (ix | lx) == 0 || ix == 0x7ff00000 { /* if x is 0 or inf */ b = 0.0; } else if (nm1 as f64) < x { /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ if ix >= 0x52d00000 { /* x > 2**302 */ /* (x >> n**2) * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) * Let s=sin(x), c=cos(x), * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then * * n sin(xn)*sqt2 cos(xn)*sqt2 * ---------------------------------- * 0 s-c c+s * 1 -s-c -c+s * 2 -s+c -c-s * 3 s+c c-s */ temp = match nm1 & 3 { 0 => -cos(x) + sin(x), 1 => -cos(x) - sin(x), 2 => cos(x) - sin(x), 3 | _ => cos(x) + sin(x), }; b = INVSQRTPI * temp / sqrt(x); } else { a = j0(x); b = j1(x); i = 0; while i < nm1 { i += 1; temp = b; b = b * (2.0 * (i as f64) / x) - a; /* avoid underflow */ a = temp; } } } else { if ix < 0x3e100000 { /* x < 2**-29 */ /* x is tiny, return the first Taylor expansion of J(n,x) * J(n,x) = 1/n!*(x/2)^n - ... */ if nm1 > 32 { /* underflow */ b = 0.0; } else { temp = x * 0.5; b = temp; a = 1.0; i = 2; while i <= nm1 + 1 { a *= i as f64; /* a = n! */ b *= temp; /* b = (x/2)^n */ i += 1; } b = b / a; } } else { /* use backward recurrence */ /* x x^2 x^2 * J(n,x)/J(n-1,x) = ---- ------ ------ ..... * 2n - 2(n+1) - 2(n+2) * * 1 1 1 * (for large x) = ---- ------ ------ ..... * 2n 2(n+1) 2(n+2) * -- - ------ - ------ - * x x x * * Let w = 2n/x and h=2/x, then the above quotient * is equal to the continued fraction: * 1 * = ----------------------- * 1 * w - ----------------- * 1 * w+h - --------- * w+2h - ... * * To determine how many terms needed, let * Q(0) = w, Q(1) = w(w+h) - 1, * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), * When Q(k) > 1e4 good for single * When Q(k) > 1e9 good for double * When Q(k) > 1e17 good for quadruple */ /* determine k */ let mut t: f64; let mut q0: f64; let mut q1: f64; let mut w: f64; let h: f64; let mut z: f64; let mut tmp: f64; let nf: f64; let mut k: i32; nf = (nm1 as f64) + 1.0; w = 2.0 * nf / x; h = 2.0 / x; z = w + h; q0 = w; q1 = w * z - 1.0; k = 1; while q1 < 1.0e9 { k += 1; z += h; tmp = z * q1 - q0; q0 = q1; q1 = tmp; } t = 0.0; i = k; while i >= 0 { t = 1.0 / (2.0 * ((i as f64) + nf) / x - t); i -= 1; } a = t; b = 1.0; /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) * Hence, if n*(log(2n/x)) > ... * single 8.8722839355e+01 * double 7.09782712893383973096e+02 * long double 1.1356523406294143949491931077970765006170e+04 * then recurrent value may overflow and the result is * likely underflow to zero */ tmp = nf * log(fabs(w)); if tmp < 7.09782712893383973096e+02 { i = nm1; while i > 0 { temp = b; b = b * (2.0 * (i as f64)) / x - a; a = temp; i -= 1; } } else { i = nm1; while i > 0 { temp = b; b = b * (2.0 * (i as f64)) / x - a; a = temp; /* scale b to avoid spurious overflow */ let x1p500 = f64::from_bits(0x5f30000000000000); // 0x1p500 == 2^500 if b > x1p500 { a /= b; t /= b; b = 1.0; } i -= 1; } } z = j0(x); w = j1(x); if fabs(z) >= fabs(w) { b = t * z / b; } else { b = t * w / a; } } } if sign { -b } else { b } } pub fn yn(n: i32, x: f64) -> f64 { let mut ix: u32; let lx: u32; let mut ib: u32; let nm1: i32; let mut sign: bool; let mut i: i32; let mut a: f64; let mut b: f64; let mut temp: f64; ix = get_high_word(x); lx = get_low_word(x); sign = (ix >> 31) != 0; ix &= 0x7fffffff; // -lx == !lx + 1 if (ix | (lx | ((!lx).wrapping_add(1))) >> 31) > 0x7ff00000 { /* nan */ return x; } if sign && (ix | lx) != 0 { /* x < 0 */ return 0.0 / 0.0; } if ix == 0x7ff00000 { return 0.0; } if n == 0 { return y0(x); } if n < 0 { nm1 = -(n + 1); sign = (n & 1) != 0; } else { nm1 = n - 1; sign = false; } if nm1 == 0 { if sign { return -y1(x); } else { return y1(x); } } if ix >= 0x52d00000 { /* x > 2**302 */ /* (x >> n**2) * Jn(x) = cos(x-(2n+1)*pi/4)*sqrt(2/x*pi) * Yn(x) = sin(x-(2n+1)*pi/4)*sqrt(2/x*pi) * Let s=sin(x), c=cos(x), * xn=x-(2n+1)*pi/4, sqt2 = sqrt(2),then * * n sin(xn)*sqt2 cos(xn)*sqt2 * ---------------------------------- * 0 s-c c+s * 1 -s-c -c+s * 2 -s+c -c-s * 3 s+c c-s */ temp = match nm1 & 3 { 0 => -sin(x) - cos(x), 1 => -sin(x) + cos(x), 2 => sin(x) + cos(x), 3 | _ => sin(x) - cos(x), }; b = INVSQRTPI * temp / sqrt(x); } else { a = y0(x); b = y1(x); /* quit if b is -inf */ ib = get_high_word(b); i = 0; while i < nm1 && ib != 0xfff00000 { i += 1; temp = b; b = (2.0 * (i as f64) / x) * b - a; ib = get_high_word(b); a = temp; } } if sign { -b } else { b } } libm-0.2.1/src/math/jnf.rs010066400017500001750000000154221351140252100135210ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_jnf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{fabsf, j0f, j1f, logf, y0f, y1f}; pub fn jnf(n: i32, mut x: f32) -> f32 { let mut ix: u32; let mut nm1: i32; let mut sign: bool; let mut i: i32; let mut a: f32; let mut b: f32; let mut temp: f32; ix = x.to_bits(); sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix > 0x7f800000 { /* nan */ return x; } /* J(-n,x) = J(n,-x), use |n|-1 to avoid overflow in -n */ if n == 0 { return j0f(x); } if n < 0 { nm1 = -(n + 1); x = -x; sign = !sign; } else { nm1 = n - 1; } if nm1 == 0 { return j1f(x); } sign &= (n & 1) != 0; /* even n: 0, odd n: signbit(x) */ x = fabsf(x); if ix == 0 || ix == 0x7f800000 { /* if x is 0 or inf */ b = 0.0; } else if (nm1 as f32) < x { /* Safe to use J(n+1,x)=2n/x *J(n,x)-J(n-1,x) */ a = j0f(x); b = j1f(x); i = 0; while i < nm1 { i += 1; temp = b; b = b * (2.0 * (i as f32) / x) - a; a = temp; } } else { if ix < 0x35800000 { /* x < 2**-20 */ /* x is tiny, return the first Taylor expansion of J(n,x) * J(n,x) = 1/n!*(x/2)^n - ... */ if nm1 > 8 { /* underflow */ nm1 = 8; } temp = 0.5 * x; b = temp; a = 1.0; i = 2; while i <= nm1 + 1 { a *= i as f32; /* a = n! */ b *= temp; /* b = (x/2)^n */ i += 1; } b = b / a; } else { /* use backward recurrence */ /* x x^2 x^2 * J(n,x)/J(n-1,x) = ---- ------ ------ ..... * 2n - 2(n+1) - 2(n+2) * * 1 1 1 * (for large x) = ---- ------ ------ ..... * 2n 2(n+1) 2(n+2) * -- - ------ - ------ - * x x x * * Let w = 2n/x and h=2/x, then the above quotient * is equal to the continued fraction: * 1 * = ----------------------- * 1 * w - ----------------- * 1 * w+h - --------- * w+2h - ... * * To determine how many terms needed, let * Q(0) = w, Q(1) = w(w+h) - 1, * Q(k) = (w+k*h)*Q(k-1) - Q(k-2), * When Q(k) > 1e4 good for single * When Q(k) > 1e9 good for double * When Q(k) > 1e17 good for quadruple */ /* determine k */ let mut t: f32; let mut q0: f32; let mut q1: f32; let mut w: f32; let h: f32; let mut z: f32; let mut tmp: f32; let nf: f32; let mut k: i32; nf = (nm1 as f32) + 1.0; w = 2.0 * (nf as f32) / x; h = 2.0 / x; z = w + h; q0 = w; q1 = w * z - 1.0; k = 1; while q1 < 1.0e4 { k += 1; z += h; tmp = z * q1 - q0; q0 = q1; q1 = tmp; } t = 0.0; i = k; while i >= 0 { t = 1.0 / (2.0 * ((i as f32) + nf) / x - t); i -= 1; } a = t; b = 1.0; /* estimate log((2/x)^n*n!) = n*log(2/x)+n*ln(n) * Hence, if n*(log(2n/x)) > ... * single 8.8722839355e+01 * double 7.09782712893383973096e+02 * long double 1.1356523406294143949491931077970765006170e+04 * then recurrent value may overflow and the result is * likely underflow to zero */ tmp = nf * logf(fabsf(w)); if tmp < 88.721679688 { i = nm1; while i > 0 { temp = b; b = 2.0 * (i as f32) * b / x - a; a = temp; i -= 1; } } else { i = nm1; while i > 0 { temp = b; b = 2.0 * (i as f32) * b / x - a; a = temp; /* scale b to avoid spurious overflow */ let x1p60 = f32::from_bits(0x5d800000); // 0x1p60 == 2^60 if b > x1p60 { a /= b; t /= b; b = 1.0; } i -= 1; } } z = j0f(x); w = j1f(x); if fabsf(z) >= fabsf(w) { b = t * z / b; } else { b = t * w / a; } } } if sign { -b } else { b } } pub fn ynf(n: i32, x: f32) -> f32 { let mut ix: u32; let mut ib: u32; let nm1: i32; let mut sign: bool; let mut i: i32; let mut a: f32; let mut b: f32; let mut temp: f32; ix = x.to_bits(); sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix > 0x7f800000 { /* nan */ return x; } if sign && ix != 0 { /* x < 0 */ return 0.0 / 0.0; } if ix == 0x7f800000 { return 0.0; } if n == 0 { return y0f(x); } if n < 0 { nm1 = -(n + 1); sign = (n & 1) != 0; } else { nm1 = n - 1; sign = false; } if nm1 == 0 { if sign { return -y1f(x); } else { return y1f(x); } } a = y0f(x); b = y1f(x); /* quit if b is -inf */ ib = b.to_bits(); i = 0; while i < nm1 && ib != 0xff800000 { i += 1; temp = b; b = (2.0 * (i as f32) / x) * b - a; ib = b.to_bits(); a = temp; } if sign { -b } else { b } } libm-0.2.1/src/math/k_cos.rs010066400017500001750000000056511351140323700140520ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/k_cos.c // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunSoft, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== const C1: f64 = 4.16666666666666019037e-02; /* 0x3FA55555, 0x5555554C */ const C2: f64 = -1.38888888888741095749e-03; /* 0xBF56C16C, 0x16C15177 */ const C3: f64 = 2.48015872894767294178e-05; /* 0x3EFA01A0, 0x19CB1590 */ const C4: f64 = -2.75573143513906633035e-07; /* 0xBE927E4F, 0x809C52AD */ const C5: f64 = 2.08757232129817482790e-09; /* 0x3E21EE9E, 0xBDB4B1C4 */ const C6: f64 = -1.13596475577881948265e-11; /* 0xBDA8FAE9, 0xBE8838D4 */ // kernel cos function on [-pi/4, pi/4], pi/4 ~ 0.785398164 // Input x is assumed to be bounded by ~pi/4 in magnitude. // Input y is the tail of x. // // Algorithm // 1. Since cos(-x) = cos(x), we need only to consider positive x. // 2. if x < 2^-27 (hx<0x3e400000 0), return 1 with inexact if x!=0. // 3. cos(x) is approximated by a polynomial of degree 14 on // [0,pi/4] // 4 14 // cos(x) ~ 1 - x*x/2 + C1*x + ... + C6*x // where the remez error is // // | 2 4 6 8 10 12 14 | -58 // |cos(x)-(1-.5*x +C1*x +C2*x +C3*x +C4*x +C5*x +C6*x )| <= 2 // | | // // 4 6 8 10 12 14 // 4. let r = C1*x +C2*x +C3*x +C4*x +C5*x +C6*x , then // cos(x) ~ 1 - x*x/2 + r // since cos(x+y) ~ cos(x) - sin(x)*y // ~ cos(x) - x*y, // a correction term is necessary in cos(x) and hence // cos(x+y) = 1 - (x*x/2 - (r - x*y)) // For better accuracy, rearrange to // cos(x+y) ~ w + (tmp + (r-x*y)) // where w = 1 - x*x/2 and tmp is a tiny correction term // (1 - x*x/2 == w + tmp exactly in infinite precision). // The exactness of w + tmp in infinite precision depends on w // and tmp having the same precision as x. If they have extra // precision due to compiler bugs, then the extra precision is // only good provided it is retained in all terms of the final // expression for cos(). Retention happens in all cases tested // under FreeBSD, so don't pessimize things by forcibly clipping // any extra precision in w. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_cos(x: f64, y: f64) -> f64 { let z = x * x; let w = z * z; let r = z * (C1 + z * (C2 + z * C3)) + w * w * (C4 + z * (C5 + z * C6)); let hz = 0.5 * z; let w = 1.0 - hz; w + (((1.0 - w) - hz) + (z * r - x * y)) } libm-0.2.1/src/math/k_cosf.rs010066400017500001750000000021541351140327700142170ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/k_cosf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Debugged and optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* |cos(x) - c(x)| < 2**-34.1 (~[-5.37e-11, 5.295e-11]). */ const C0: f64 = -0.499999997251031003120; /* -0x1ffffffd0c5e81.0p-54 */ const C1: f64 = 0.0416666233237390631894; /* 0x155553e1053a42.0p-57 */ const C2: f64 = -0.00138867637746099294692; /* -0x16c087e80f1e27.0p-62 */ const C3: f64 = 0.0000243904487962774090654; /* 0x199342e0ee5069.0p-68 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_cosf(x: f64) -> f32 { let z = x * x; let w = z * z; let r = C2 + z * C3; (((1.0 + z * C0) + w * C1) + (w * z) * r) as f32 } libm-0.2.1/src/math/k_expo2.rs010066400017500001750000000010661351140315200143130ustar0000000000000000use super::exp; /* k is such that k*ln2 has minimal relative error and x - kln2 > log(FLT_MIN) */ const K: i32 = 2043; /* expf(x)/2 for x >= log(FLT_MAX), slightly better than 0.5f*expf(x/2)*expf(x/2) */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_expo2(x: f64) -> f64 { let k_ln2 = f64::from_bits(0x40962066151add8b); /* note that k is odd and scale*scale overflows */ let scale = f64::from_bits(((((0x3ff + K / 2) as u32) << 20) as u64) << 32); /* exp(x - k ln2) * 2**(k-1) */ exp(x - k_ln2) * scale * scale } libm-0.2.1/src/math/k_expo2f.rs010066400017500001750000000010361351140337600144660ustar0000000000000000use super::expf; /* k is such that k*ln2 has minimal relative error and x - kln2 > log(FLT_MIN) */ const K: i32 = 235; /* expf(x)/2 for x >= log(FLT_MAX), slightly better than 0.5f*expf(x/2)*expf(x/2) */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_expo2f(x: f32) -> f32 { let k_ln2 = f32::from_bits(0x4322e3bc); /* note that k is odd and scale*scale overflows */ let scale = f32::from_bits(((0x7f + K / 2) as u32) << 23); /* exp(x - k ln2) * 2**(k-1) */ expf(x - k_ln2) * scale * scale } libm-0.2.1/src/math/k_sin.rs010066400017500001750000000046461351140266300140640ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/k_sin.c // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunSoft, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== const S1: f64 = -1.66666666666666324348e-01; /* 0xBFC55555, 0x55555549 */ const S2: f64 = 8.33333333332248946124e-03; /* 0x3F811111, 0x1110F8A6 */ const S3: f64 = -1.98412698298579493134e-04; /* 0xBF2A01A0, 0x19C161D5 */ const S4: f64 = 2.75573137070700676789e-06; /* 0x3EC71DE3, 0x57B1FE7D */ const S5: f64 = -2.50507602534068634195e-08; /* 0xBE5AE5E6, 0x8A2B9CEB */ const S6: f64 = 1.58969099521155010221e-10; /* 0x3DE5D93A, 0x5ACFD57C */ // kernel sin function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 // Input x is assumed to be bounded by ~pi/4 in magnitude. // Input y is the tail of x. // Input iy indicates whether y is 0. (if iy=0, y assume to be 0). // // Algorithm // 1. Since sin(-x) = -sin(x), we need only to consider positive x. // 2. Callers must return sin(-0) = -0 without calling here since our // odd polynomial is not evaluated in a way that preserves -0. // Callers may do the optimization sin(x) ~ x for tiny x. // 3. sin(x) is approximated by a polynomial of degree 13 on // [0,pi/4] // 3 13 // sin(x) ~ x + S1*x + ... + S6*x // where // // |sin(x) 2 4 6 8 10 12 | -58 // |----- - (1+S1*x +S2*x +S3*x +S4*x +S5*x +S6*x )| <= 2 // | x | // // 4. sin(x+y) = sin(x) + sin'(x')*y // ~ sin(x) + (1-x*x/2)*y // For better accuracy, let // 3 2 2 2 2 // r = x *(S2+x *(S3+x *(S4+x *(S5+x *S6)))) // then 3 2 // sin(x) = x + (S1*x + (x *(r-y/2)+y)) #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_sin(x: f64, y: f64, iy: i32) -> f64 { let z = x * x; let w = z * z; let r = S2 + z * (S3 + z * S4) + z * w * (S5 + z * S6); let v = z * x; if iy == 0 { x + v * (S1 + z * r) } else { x - ((z * (0.5 * y - v * r) - y) - v * S1) } } libm-0.2.1/src/math/k_sinf.rs010066400017500001750000000021611351140330200142070ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/k_sinf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* |sin(x)/x - s(x)| < 2**-37.5 (~[-4.89e-12, 4.824e-12]). */ const S1: f64 = -0.166666666416265235595; /* -0x15555554cbac77.0p-55 */ const S2: f64 = 0.0083333293858894631756; /* 0x111110896efbb2.0p-59 */ const S3: f64 = -0.000198393348360966317347; /* -0x1a00f9e2cae774.0p-65 */ const S4: f64 = 0.0000027183114939898219064; /* 0x16cd878c3b46a7.0p-71 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_sinf(x: f64) -> f32 { let z = x * x; let w = z * z; let r = S3 + z * S4; let s = z * x; ((x + s * (S1 + z * S2)) + s * w * r) as f32 } libm-0.2.1/src/math/k_tan.rs010066400017500001750000000102141351140307100140330ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/k_tan.c */ // // ==================================================== // Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. // // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== // kernel tan function on ~[-pi/4, pi/4] (except on -0), pi/4 ~ 0.7854 // Input x is assumed to be bounded by ~pi/4 in magnitude. // Input y is the tail of x. // Input odd indicates whether tan (if odd = 0) or -1/tan (if odd = 1) is returned. // // Algorithm // 1. Since tan(-x) = -tan(x), we need only to consider positive x. // 2. Callers must return tan(-0) = -0 without calling here since our // odd polynomial is not evaluated in a way that preserves -0. // Callers may do the optimization tan(x) ~ x for tiny x. // 3. tan(x) is approximated by a odd polynomial of degree 27 on // [0,0.67434] // 3 27 // tan(x) ~ x + T1*x + ... + T13*x // where // // |tan(x) 2 4 26 | -59.2 // |----- - (1+T1*x +T2*x +.... +T13*x )| <= 2 // | x | // // Note: tan(x+y) = tan(x) + tan'(x)*y // ~ tan(x) + (1+x*x)*y // Therefore, for better accuracy in computing tan(x+y), let // 3 2 2 2 2 // r = x *(T2+x *(T3+x *(...+x *(T12+x *T13)))) // then // 3 2 // tan(x+y) = x + (T1*x + (x *(r+y)+y)) // // 4. For x in [0.67434,pi/4], let y = pi/4 - x, then // tan(x) = tan(pi/4-y) = (1-tan(y))/(1+tan(y)) // = 1 - 2*(tan(y) - (tan(y)^2)/(1+tan(y))) static T: [f64; 13] = [ 3.33333333333334091986e-01, /* 3FD55555, 55555563 */ 1.33333333333201242699e-01, /* 3FC11111, 1110FE7A */ 5.39682539762260521377e-02, /* 3FABA1BA, 1BB341FE */ 2.18694882948595424599e-02, /* 3F9664F4, 8406D637 */ 8.86323982359930005737e-03, /* 3F8226E3, E96E8493 */ 3.59207910759131235356e-03, /* 3F6D6D22, C9560328 */ 1.45620945432529025516e-03, /* 3F57DBC8, FEE08315 */ 5.88041240820264096874e-04, /* 3F4344D8, F2F26501 */ 2.46463134818469906812e-04, /* 3F3026F7, 1A8D1068 */ 7.81794442939557092300e-05, /* 3F147E88, A03792A6 */ 7.14072491382608190305e-05, /* 3F12B80F, 32F0A7E9 */ -1.85586374855275456654e-05, /* BEF375CB, DB605373 */ 2.59073051863633712884e-05, /* 3EFB2A70, 74BF7AD4 */ ]; const PIO4: f64 = 7.85398163397448278999e-01; /* 3FE921FB, 54442D18 */ const PIO4_LO: f64 = 3.06161699786838301793e-17; /* 3C81A626, 33145C07 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_tan(mut x: f64, mut y: f64, odd: i32) -> f64 { let hx = (f64::to_bits(x) >> 32) as u32; let big = (hx & 0x7fffffff) >= 0x3FE59428; /* |x| >= 0.6744 */ if big { let sign = hx >> 31; if sign != 0 { x = -x; y = -y; } x = (PIO4 - x) + (PIO4_LO - y); y = 0.0; } let z = x * x; let w = z * z; /* * Break x^5*(T[1]+x^2*T[2]+...) into * x^5(T[1]+x^4*T[3]+...+x^20*T[11]) + * x^5(x^2*(T[2]+x^4*T[4]+...+x^22*[T12])) */ let r = T[1] + w * (T[3] + w * (T[5] + w * (T[7] + w * (T[9] + w * T[11])))); let v = z * (T[2] + w * (T[4] + w * (T[6] + w * (T[8] + w * (T[10] + w * T[12]))))); let s = z * x; let r = y + z * (s * (r + v) + y) + s * T[0]; let w = x + r; if big { let sign = hx >> 31; let s = 1.0 - 2.0 * odd as f64; let v = s - 2.0 * (x + (r - w * w / (w + s))); return if sign != 0 { -v } else { v }; } if odd == 0 { return w; } /* -1.0/(x+r) has up to 2ulp error, so compute it accurately */ let w0 = zero_low_word(w); let v = r - (w0 - x); /* w0+v = r+x */ let a = -1.0 / w; let a0 = zero_low_word(a); a0 + a * (1.0 + a0 * w0 + a0 * v) } fn zero_low_word(x: f64) -> f64 { f64::from_bits(f64::to_bits(x) & 0xFFFF_FFFF_0000_0000) } libm-0.2.1/src/math/k_tanf.rs010066400017500001750000000036041351140301000141770ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/k_tan.c */ /* * ==================================================== * Copyright 2004 Sun Microsystems, Inc. All Rights Reserved. * * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* |tan(x)/x - t(x)| < 2**-25.5 (~[-2e-08, 2e-08]). */ const T: [f64; 6] = [ 0.333331395030791399758, /* 0x15554d3418c99f.0p-54 */ 0.133392002712976742718, /* 0x1112fd38999f72.0p-55 */ 0.0533812378445670393523, /* 0x1b54c91d865afe.0p-57 */ 0.0245283181166547278873, /* 0x191df3908c33ce.0p-58 */ 0.00297435743359967304927, /* 0x185dadfcecf44e.0p-61 */ 0.00946564784943673166728, /* 0x1362b9bf971bcd.0p-59 */ ]; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn k_tanf(x: f64, odd: bool) -> f32 { let z = x * x; /* * Split up the polynomial into small independent terms to give * opportunities for parallel evaluation. The chosen splitting is * micro-optimized for Athlons (XP, X64). It costs 2 multiplications * relative to Horner's method on sequential machines. * * We add the small terms from lowest degree up for efficiency on * non-sequential machines (the lowest degree terms tend to be ready * earlier). Apart from this, we don't care about order of * operations, and don't need to to care since we have precision to * spare. However, the chosen splitting is good for accuracy too, * and would give results as accurate as Horner's method if the * small terms were added from highest degree down. */ let mut r = T[4] + z * T[5]; let t = T[2] + z * T[3]; let w = z * z; let s = z * x; let u = T[0] + z * T[1]; r = (x + s * u) + (s * w) * (t + w * r); (if odd { -1. / r } else { r }) as f32 } libm-0.2.1/src/math/ldexp.rs010066400017500001750000000001741351140276500140700ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn ldexp(x: f64, n: i32) -> f64 { super::scalbn(x, n) } libm-0.2.1/src/math/ldexpf.rs010066400017500001750000000001761351140277000142340ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn ldexpf(x: f32, n: i32) -> f32 { super::scalbnf(x, n) } libm-0.2.1/src/math/lgamma.rs010066400017500001750000000001111351140252100141670ustar0000000000000000use super::lgamma_r; pub fn lgamma(x: f64) -> f64 { lgamma_r(x).0 } libm-0.2.1/src/math/lgamma_r.rs010066400017500001750000000305441353572366000145450ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_lgamma_r.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== * */ /* lgamma_r(x, signgamp) * Reentrant version of the logarithm of the Gamma function * with user provide pointer for the sign of Gamma(x). * * Method: * 1. Argument Reduction for 0 < x <= 8 * Since gamma(1+s)=s*gamma(s), for x in [0,8], we may * reduce x to a number in [1.5,2.5] by * lgamma(1+s) = log(s) + lgamma(s) * for example, * lgamma(7.3) = log(6.3) + lgamma(6.3) * = log(6.3*5.3) + lgamma(5.3) * = log(6.3*5.3*4.3*3.3*2.3) + lgamma(2.3) * 2. Polynomial approximation of lgamma around its * minimun ymin=1.461632144968362245 to maintain monotonicity. * On [ymin-0.23, ymin+0.27] (i.e., [1.23164,1.73163]), use * Let z = x-ymin; * lgamma(x) = -1.214862905358496078218 + z^2*poly(z) * where * poly(z) is a 14 degree polynomial. * 2. Rational approximation in the primary interval [2,3] * We use the following approximation: * s = x-2.0; * lgamma(x) = 0.5*s + s*P(s)/Q(s) * with accuracy * |P/Q - (lgamma(x)-0.5s)| < 2**-61.71 * Our algorithms are based on the following observation * * zeta(2)-1 2 zeta(3)-1 3 * lgamma(2+s) = s*(1-Euler) + --------- * s - --------- * s + ... * 2 3 * * where Euler = 0.5771... is the Euler constant, which is very * close to 0.5. * * 3. For x>=8, we have * lgamma(x)~(x-0.5)log(x)-x+0.5*log(2pi)+1/(12x)-1/(360x**3)+.... * (better formula: * lgamma(x)~(x-0.5)*(log(x)-1)-.5*(log(2pi)-1) + ...) * Let z = 1/x, then we approximation * f(z) = lgamma(x) - (x-0.5)(log(x)-1) * by * 3 5 11 * w = w0 + w1*z + w2*z + w3*z + ... + w6*z * where * |w - f(z)| < 2**-58.74 * * 4. For negative x, since (G is gamma function) * -x*G(-x)*G(x) = PI/sin(PI*x), * we have * G(x) = PI/(sin(PI*x)*(-x)*G(-x)) * since G(-x) is positive, sign(G(x)) = sign(sin(PI*x)) for x<0 * Hence, for x<0, signgam = sign(sin(PI*x)) and * lgamma(x) = log(|Gamma(x)|) * = log(PI/(|x*sin(PI*x)|)) - lgamma(-x); * Note: one should avoid compute PI*(-x) directly in the * computation of sin(PI*(-x)). * * 5. Special Cases * lgamma(2+s) ~ s*(1-Euler) for tiny s * lgamma(1) = lgamma(2) = 0 * lgamma(x) ~ -log(|x|) for tiny x * lgamma(0) = lgamma(neg.integer) = inf and raise divide-by-zero * lgamma(inf) = inf * lgamma(-inf) = inf (bug for bug compatible with C99!?) * */ use super::{floor, k_cos, k_sin, log}; const PI: f64 = 3.14159265358979311600e+00; /* 0x400921FB, 0x54442D18 */ const A0: f64 = 7.72156649015328655494e-02; /* 0x3FB3C467, 0xE37DB0C8 */ const A1: f64 = 3.22467033424113591611e-01; /* 0x3FD4A34C, 0xC4A60FAD */ const A2: f64 = 6.73523010531292681824e-02; /* 0x3FB13E00, 0x1A5562A7 */ const A3: f64 = 2.05808084325167332806e-02; /* 0x3F951322, 0xAC92547B */ const A4: f64 = 7.38555086081402883957e-03; /* 0x3F7E404F, 0xB68FEFE8 */ const A5: f64 = 2.89051383673415629091e-03; /* 0x3F67ADD8, 0xCCB7926B */ const A6: f64 = 1.19270763183362067845e-03; /* 0x3F538A94, 0x116F3F5D */ const A7: f64 = 5.10069792153511336608e-04; /* 0x3F40B6C6, 0x89B99C00 */ const A8: f64 = 2.20862790713908385557e-04; /* 0x3F2CF2EC, 0xED10E54D */ const A9: f64 = 1.08011567247583939954e-04; /* 0x3F1C5088, 0x987DFB07 */ const A10: f64 = 2.52144565451257326939e-05; /* 0x3EFA7074, 0x428CFA52 */ const A11: f64 = 4.48640949618915160150e-05; /* 0x3F07858E, 0x90A45837 */ const TC: f64 = 1.46163214496836224576e+00; /* 0x3FF762D8, 0x6356BE3F */ const TF: f64 = -1.21486290535849611461e-01; /* 0xBFBF19B9, 0xBCC38A42 */ /* tt = -(tail of TF) */ const TT: f64 = -3.63867699703950536541e-18; /* 0xBC50C7CA, 0xA48A971F */ const T0: f64 = 4.83836122723810047042e-01; /* 0x3FDEF72B, 0xC8EE38A2 */ const T1: f64 = -1.47587722994593911752e-01; /* 0xBFC2E427, 0x8DC6C509 */ const T2: f64 = 6.46249402391333854778e-02; /* 0x3FB08B42, 0x94D5419B */ const T3: f64 = -3.27885410759859649565e-02; /* 0xBFA0C9A8, 0xDF35B713 */ const T4: f64 = 1.79706750811820387126e-02; /* 0x3F9266E7, 0x970AF9EC */ const T5: f64 = -1.03142241298341437450e-02; /* 0xBF851F9F, 0xBA91EC6A */ const T6: f64 = 6.10053870246291332635e-03; /* 0x3F78FCE0, 0xE370E344 */ const T7: f64 = -3.68452016781138256760e-03; /* 0xBF6E2EFF, 0xB3E914D7 */ const T8: f64 = 2.25964780900612472250e-03; /* 0x3F6282D3, 0x2E15C915 */ const T9: f64 = -1.40346469989232843813e-03; /* 0xBF56FE8E, 0xBF2D1AF1 */ const T10: f64 = 8.81081882437654011382e-04; /* 0x3F4CDF0C, 0xEF61A8E9 */ const T11: f64 = -5.38595305356740546715e-04; /* 0xBF41A610, 0x9C73E0EC */ const T12: f64 = 3.15632070903625950361e-04; /* 0x3F34AF6D, 0x6C0EBBF7 */ const T13: f64 = -3.12754168375120860518e-04; /* 0xBF347F24, 0xECC38C38 */ const T14: f64 = 3.35529192635519073543e-04; /* 0x3F35FD3E, 0xE8C2D3F4 */ const U0: f64 = -7.72156649015328655494e-02; /* 0xBFB3C467, 0xE37DB0C8 */ const U1: f64 = 6.32827064025093366517e-01; /* 0x3FE4401E, 0x8B005DFF */ const U2: f64 = 1.45492250137234768737e+00; /* 0x3FF7475C, 0xD119BD6F */ const U3: f64 = 9.77717527963372745603e-01; /* 0x3FEF4976, 0x44EA8450 */ const U4: f64 = 2.28963728064692451092e-01; /* 0x3FCD4EAE, 0xF6010924 */ const U5: f64 = 1.33810918536787660377e-02; /* 0x3F8B678B, 0xBF2BAB09 */ const V1: f64 = 2.45597793713041134822e+00; /* 0x4003A5D7, 0xC2BD619C */ const V2: f64 = 2.12848976379893395361e+00; /* 0x40010725, 0xA42B18F5 */ const V3: f64 = 7.69285150456672783825e-01; /* 0x3FE89DFB, 0xE45050AF */ const V4: f64 = 1.04222645593369134254e-01; /* 0x3FBAAE55, 0xD6537C88 */ const V5: f64 = 3.21709242282423911810e-03; /* 0x3F6A5ABB, 0x57D0CF61 */ const S0: f64 = -7.72156649015328655494e-02; /* 0xBFB3C467, 0xE37DB0C8 */ const S1: f64 = 2.14982415960608852501e-01; /* 0x3FCB848B, 0x36E20878 */ const S2: f64 = 3.25778796408930981787e-01; /* 0x3FD4D98F, 0x4F139F59 */ const S3: f64 = 1.46350472652464452805e-01; /* 0x3FC2BB9C, 0xBEE5F2F7 */ const S4: f64 = 2.66422703033638609560e-02; /* 0x3F9B481C, 0x7E939961 */ const S5: f64 = 1.84028451407337715652e-03; /* 0x3F5E26B6, 0x7368F239 */ const S6: f64 = 3.19475326584100867617e-05; /* 0x3F00BFEC, 0xDD17E945 */ const R1: f64 = 1.39200533467621045958e+00; /* 0x3FF645A7, 0x62C4AB74 */ const R2: f64 = 7.21935547567138069525e-01; /* 0x3FE71A18, 0x93D3DCDC */ const R3: f64 = 1.71933865632803078993e-01; /* 0x3FC601ED, 0xCCFBDF27 */ const R4: f64 = 1.86459191715652901344e-02; /* 0x3F9317EA, 0x742ED475 */ const R5: f64 = 7.77942496381893596434e-04; /* 0x3F497DDA, 0xCA41A95B */ const R6: f64 = 7.32668430744625636189e-06; /* 0x3EDEBAF7, 0xA5B38140 */ const W0: f64 = 4.18938533204672725052e-01; /* 0x3FDACFE3, 0x90C97D69 */ const W1: f64 = 8.33333333333329678849e-02; /* 0x3FB55555, 0x5555553B */ const W2: f64 = -2.77777777728775536470e-03; /* 0xBF66C16C, 0x16B02E5C */ const W3: f64 = 7.93650558643019558500e-04; /* 0x3F4A019F, 0x98CF38B6 */ const W4: f64 = -5.95187557450339963135e-04; /* 0xBF4380CB, 0x8C0FE741 */ const W5: f64 = 8.36339918996282139126e-04; /* 0x3F4B67BA, 0x4CDAD5D1 */ const W6: f64 = -1.63092934096575273989e-03; /* 0xBF5AB89D, 0x0B9E43E4 */ /* sin(PI*x) assuming x > 2^-100, if sin(PI*x)==0 the sign is arbitrary */ fn sin_pi(mut x: f64) -> f64 { let mut n: i32; /* spurious inexact if odd int */ x = 2.0 * (x * 0.5 - floor(x * 0.5)); /* x mod 2.0 */ n = (x * 4.0) as i32; n = (n + 1) / 2; x -= (n as f64) * 0.5; x *= PI; match n { 1 => k_cos(x, 0.0), 2 => k_sin(-x, 0.0, 0), 3 => -k_cos(x, 0.0), 0 | _ => k_sin(x, 0.0, 0), } } pub fn lgamma_r(mut x: f64) -> (f64, i32) { let u: u64 = x.to_bits(); let mut t: f64; let y: f64; let mut z: f64; let nadj: f64; let p: f64; let p1: f64; let p2: f64; let p3: f64; let q: f64; let mut r: f64; let w: f64; let ix: u32; let sign: bool; let i: i32; let mut signgam: i32; /* purge off +-inf, NaN, +-0, tiny and negative arguments */ signgam = 1; sign = (u >> 63) != 0; ix = ((u >> 32) as u32) & 0x7fffffff; if ix >= 0x7ff00000 { return (x * x, signgam); } if ix < (0x3ff - 70) << 20 { /* |x|<2**-70, return -log(|x|) */ if sign { x = -x; signgam = -1; } return (-log(x), signgam); } if sign { x = -x; t = sin_pi(x); if t == 0.0 { /* -integer */ return (1.0 / (x - x), signgam); } if t > 0.0 { signgam = -1; } else { t = -t; } nadj = log(PI / (t * x)); } else { nadj = 0.0; } /* purge off 1 and 2 */ if (ix == 0x3ff00000 || ix == 0x40000000) && (u & 0xffffffff) == 0 { r = 0.0; } /* for x < 2.0 */ else if ix < 0x40000000 { if ix <= 0x3feccccc { /* lgamma(x) = lgamma(x+1)-log(x) */ r = -log(x); if ix >= 0x3FE76944 { y = 1.0 - x; i = 0; } else if ix >= 0x3FCDA661 { y = x - (TC - 1.0); i = 1; } else { y = x; i = 2; } } else { r = 0.0; if ix >= 0x3FFBB4C3 { /* [1.7316,2] */ y = 2.0 - x; i = 0; } else if ix >= 0x3FF3B4C4 { /* [1.23,1.73] */ y = x - TC; i = 1; } else { y = x - 1.0; i = 2; } } match i { 0 => { z = y * y; p1 = A0 + z * (A2 + z * (A4 + z * (A6 + z * (A8 + z * A10)))); p2 = z * (A1 + z * (A3 + z * (A5 + z * (A7 + z * (A9 + z * A11))))); p = y * p1 + p2; r += p - 0.5 * y; } 1 => { z = y * y; w = z * y; p1 = T0 + w * (T3 + w * (T6 + w * (T9 + w * T12))); /* parallel comp */ p2 = T1 + w * (T4 + w * (T7 + w * (T10 + w * T13))); p3 = T2 + w * (T5 + w * (T8 + w * (T11 + w * T14))); p = z * p1 - (TT - w * (p2 + y * p3)); r += TF + p; } 2 => { p1 = y * (U0 + y * (U1 + y * (U2 + y * (U3 + y * (U4 + y * U5))))); p2 = 1.0 + y * (V1 + y * (V2 + y * (V3 + y * (V4 + y * V5)))); r += -0.5 * y + p1 / p2; } #[cfg(debug_assertions)] _ => unreachable!(), #[cfg(not(debug_assertions))] _ => {} } } else if ix < 0x40200000 { /* x < 8.0 */ i = x as i32; y = x - (i as f64); p = y * (S0 + y * (S1 + y * (S2 + y * (S3 + y * (S4 + y * (S5 + y * S6)))))); q = 1.0 + y * (R1 + y * (R2 + y * (R3 + y * (R4 + y * (R5 + y * R6))))); r = 0.5 * y + p / q; z = 1.0; /* lgamma(1+s) = log(s) + lgamma(s) */ // TODO: In C, this was implemented using switch jumps with fallthrough. // Does this implementation have performance problems? if i >= 7 { z *= y + 6.0; } if i >= 6 { z *= y + 5.0; } if i >= 5 { z *= y + 4.0; } if i >= 4 { z *= y + 3.0; } if i >= 3 { z *= y + 2.0; r += log(z); } } else if ix < 0x43900000 { /* 8.0 <= x < 2**58 */ t = log(x); z = 1.0 / x; y = z * z; w = W0 + z * (W1 + y * (W2 + y * (W3 + y * (W4 + y * (W5 + y * W6))))); r = (x - 0.5) * (t - 1.0) + w; } else { /* 2**58 <= x <= inf */ r = x * (log(x) - 1.0); } if sign { r = nadj - r; } return (r, signgam); } libm-0.2.1/src/math/lgammaf.rs010066400017500001750000000001141351140252100143400ustar0000000000000000use super::lgammaf_r; pub fn lgammaf(x: f32) -> f32 { lgammaf_r(x).0 } libm-0.2.1/src/math/lgammaf_r.rs010066400017500001750000000204761353572366000147160ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_lgammaf_r.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{floorf, k_cosf, k_sinf, logf}; const PI: f32 = 3.1415927410e+00; /* 0x40490fdb */ const A0: f32 = 7.7215664089e-02; /* 0x3d9e233f */ const A1: f32 = 3.2246702909e-01; /* 0x3ea51a66 */ const A2: f32 = 6.7352302372e-02; /* 0x3d89f001 */ const A3: f32 = 2.0580807701e-02; /* 0x3ca89915 */ const A4: f32 = 7.3855509982e-03; /* 0x3bf2027e */ const A5: f32 = 2.8905137442e-03; /* 0x3b3d6ec6 */ const A6: f32 = 1.1927076848e-03; /* 0x3a9c54a1 */ const A7: f32 = 5.1006977446e-04; /* 0x3a05b634 */ const A8: f32 = 2.2086278477e-04; /* 0x39679767 */ const A9: f32 = 1.0801156895e-04; /* 0x38e28445 */ const A10: f32 = 2.5214456400e-05; /* 0x37d383a2 */ const A11: f32 = 4.4864096708e-05; /* 0x383c2c75 */ const TC: f32 = 1.4616321325e+00; /* 0x3fbb16c3 */ const TF: f32 = -1.2148628384e-01; /* 0xbdf8cdcd */ /* TT = -(tail of TF) */ const TT: f32 = 6.6971006518e-09; /* 0x31e61c52 */ const T0: f32 = 4.8383611441e-01; /* 0x3ef7b95e */ const T1: f32 = -1.4758771658e-01; /* 0xbe17213c */ const T2: f32 = 6.4624942839e-02; /* 0x3d845a15 */ const T3: f32 = -3.2788541168e-02; /* 0xbd064d47 */ const T4: f32 = 1.7970675603e-02; /* 0x3c93373d */ const T5: f32 = -1.0314224288e-02; /* 0xbc28fcfe */ const T6: f32 = 6.1005386524e-03; /* 0x3bc7e707 */ const T7: f32 = -3.6845202558e-03; /* 0xbb7177fe */ const T8: f32 = 2.2596477065e-03; /* 0x3b141699 */ const T9: f32 = -1.4034647029e-03; /* 0xbab7f476 */ const T10: f32 = 8.8108185446e-04; /* 0x3a66f867 */ const T11: f32 = -5.3859531181e-04; /* 0xba0d3085 */ const T12: f32 = 3.1563205994e-04; /* 0x39a57b6b */ const T13: f32 = -3.1275415677e-04; /* 0xb9a3f927 */ const T14: f32 = 3.3552918467e-04; /* 0x39afe9f7 */ const U0: f32 = -7.7215664089e-02; /* 0xbd9e233f */ const U1: f32 = 6.3282704353e-01; /* 0x3f2200f4 */ const U2: f32 = 1.4549225569e+00; /* 0x3fba3ae7 */ const U3: f32 = 9.7771751881e-01; /* 0x3f7a4bb2 */ const U4: f32 = 2.2896373272e-01; /* 0x3e6a7578 */ const U5: f32 = 1.3381091878e-02; /* 0x3c5b3c5e */ const V1: f32 = 2.4559779167e+00; /* 0x401d2ebe */ const V2: f32 = 2.1284897327e+00; /* 0x4008392d */ const V3: f32 = 7.6928514242e-01; /* 0x3f44efdf */ const V4: f32 = 1.0422264785e-01; /* 0x3dd572af */ const V5: f32 = 3.2170924824e-03; /* 0x3b52d5db */ const S0: f32 = -7.7215664089e-02; /* 0xbd9e233f */ const S1: f32 = 2.1498242021e-01; /* 0x3e5c245a */ const S2: f32 = 3.2577878237e-01; /* 0x3ea6cc7a */ const S3: f32 = 1.4635047317e-01; /* 0x3e15dce6 */ const S4: f32 = 2.6642270386e-02; /* 0x3cda40e4 */ const S5: f32 = 1.8402845599e-03; /* 0x3af135b4 */ const S6: f32 = 3.1947532989e-05; /* 0x3805ff67 */ const R1: f32 = 1.3920053244e+00; /* 0x3fb22d3b */ const R2: f32 = 7.2193557024e-01; /* 0x3f38d0c5 */ const R3: f32 = 1.7193385959e-01; /* 0x3e300f6e */ const R4: f32 = 1.8645919859e-02; /* 0x3c98bf54 */ const R5: f32 = 7.7794247773e-04; /* 0x3a4beed6 */ const R6: f32 = 7.3266842264e-06; /* 0x36f5d7bd */ const W0: f32 = 4.1893854737e-01; /* 0x3ed67f1d */ const W1: f32 = 8.3333335817e-02; /* 0x3daaaaab */ const W2: f32 = -2.7777778450e-03; /* 0xbb360b61 */ const W3: f32 = 7.9365057172e-04; /* 0x3a500cfd */ const W4: f32 = -5.9518753551e-04; /* 0xba1c065c */ const W5: f32 = 8.3633989561e-04; /* 0x3a5b3dd2 */ const W6: f32 = -1.6309292987e-03; /* 0xbad5c4e8 */ /* sin(PI*x) assuming x > 2^-100, if sin(PI*x)==0 the sign is arbitrary */ fn sin_pi(mut x: f32) -> f32 { let mut y: f64; let mut n: isize; /* spurious inexact if odd int */ x = 2.0 * (x * 0.5 - floorf(x * 0.5)); /* x mod 2.0 */ n = (x * 4.0) as isize; n = (n + 1) / 2; y = (x as f64) - (n as f64) * 0.5; y *= 3.14159265358979323846; match n { 1 => k_cosf(y), 2 => k_sinf(-y), 3 => -k_cosf(y), 0 | _ => k_sinf(y), } } pub fn lgammaf_r(mut x: f32) -> (f32, i32) { let u = x.to_bits(); let mut t: f32; let y: f32; let mut z: f32; let nadj: f32; let p: f32; let p1: f32; let p2: f32; let p3: f32; let q: f32; let mut r: f32; let w: f32; let ix: u32; let i: i32; let sign: bool; let mut signgam: i32; /* purge off +-inf, NaN, +-0, tiny and negative arguments */ signgam = 1; sign = (u >> 31) != 0; ix = u & 0x7fffffff; if ix >= 0x7f800000 { return (x * x, signgam); } if ix < 0x35000000 { /* |x| < 2**-21, return -log(|x|) */ if sign { signgam = -1; x = -x; } return (-logf(x), signgam); } if sign { x = -x; t = sin_pi(x); if t == 0.0 { /* -integer */ return (1.0 / (x - x), signgam); } if t > 0.0 { signgam = -1; } else { t = -t; } nadj = logf(PI / (t * x)); } else { nadj = 0.0; } /* purge off 1 and 2 */ if ix == 0x3f800000 || ix == 0x40000000 { r = 0.0; } /* for x < 2.0 */ else if ix < 0x40000000 { if ix <= 0x3f666666 { /* lgamma(x) = lgamma(x+1)-log(x) */ r = -logf(x); if ix >= 0x3f3b4a20 { y = 1.0 - x; i = 0; } else if ix >= 0x3e6d3308 { y = x - (TC - 1.0); i = 1; } else { y = x; i = 2; } } else { r = 0.0; if ix >= 0x3fdda618 { /* [1.7316,2] */ y = 2.0 - x; i = 0; } else if ix >= 0x3F9da620 { /* [1.23,1.73] */ y = x - TC; i = 1; } else { y = x - 1.0; i = 2; } } match i { 0 => { z = y * y; p1 = A0 + z * (A2 + z * (A4 + z * (A6 + z * (A8 + z * A10)))); p2 = z * (A1 + z * (A3 + z * (A5 + z * (A7 + z * (A9 + z * A11))))); p = y * p1 + p2; r += p - 0.5 * y; } 1 => { z = y * y; w = z * y; p1 = T0 + w * (T3 + w * (T6 + w * (T9 + w * T12))); /* parallel comp */ p2 = T1 + w * (T4 + w * (T7 + w * (T10 + w * T13))); p3 = T2 + w * (T5 + w * (T8 + w * (T11 + w * T14))); p = z * p1 - (TT - w * (p2 + y * p3)); r += TF + p; } 2 => { p1 = y * (U0 + y * (U1 + y * (U2 + y * (U3 + y * (U4 + y * U5))))); p2 = 1.0 + y * (V1 + y * (V2 + y * (V3 + y * (V4 + y * V5)))); r += -0.5 * y + p1 / p2; } #[cfg(debug_assertions)] _ => unreachable!(), #[cfg(not(debug_assertions))] _ => {} } } else if ix < 0x41000000 { /* x < 8.0 */ i = x as i32; y = x - (i as f32); p = y * (S0 + y * (S1 + y * (S2 + y * (S3 + y * (S4 + y * (S5 + y * S6)))))); q = 1.0 + y * (R1 + y * (R2 + y * (R3 + y * (R4 + y * (R5 + y * R6))))); r = 0.5 * y + p / q; z = 1.0; /* lgamma(1+s) = log(s) + lgamma(s) */ // TODO: In C, this was implemented using switch jumps with fallthrough. // Does this implementation have performance problems? if i >= 7 { z *= y + 6.0; } if i >= 6 { z *= y + 5.0; } if i >= 5 { z *= y + 4.0; } if i >= 4 { z *= y + 3.0; } if i >= 3 { z *= y + 2.0; r += logf(z); } } else if ix < 0x5c800000 { /* 8.0 <= x < 2**58 */ t = logf(x); z = 1.0 / x; y = z * z; w = W0 + z * (W1 + y * (W2 + y * (W3 + y * (W4 + y * (W5 + y * W6))))); r = (x - 0.5) * (t - 1.0) + w; } else { /* 2**58 <= x <= inf */ r = x * (logf(x) - 1.0); } if sign { r = nadj - r; } return (r, signgam); } libm-0.2.1/src/math/log.rs010066400017500001750000000107101351140305000135160ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_log.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* log(x) * Return the logarithm of x * * Method : * 1. Argument Reduction: find k and f such that * x = 2^k * (1+f), * where sqrt(2)/2 < 1+f < sqrt(2) . * * 2. Approximation of log(1+f). * Let s = f/(2+f) ; based on log(1+f) = log(1+s) - log(1-s) * = 2s + 2/3 s**3 + 2/5 s**5 + ....., * = 2s + s*R * We use a special Remez algorithm on [0,0.1716] to generate * a polynomial of degree 14 to approximate R The maximum error * of this polynomial approximation is bounded by 2**-58.45. In * other words, * 2 4 6 8 10 12 14 * R(z) ~ Lg1*s +Lg2*s +Lg3*s +Lg4*s +Lg5*s +Lg6*s +Lg7*s * (the values of Lg1 to Lg7 are listed in the program) * and * | 2 14 | -58.45 * | Lg1*s +...+Lg7*s - R(z) | <= 2 * | | * Note that 2s = f - s*f = f - hfsq + s*hfsq, where hfsq = f*f/2. * In order to guarantee error in log below 1ulp, we compute log * by * log(1+f) = f - s*(f - R) (if f is not too large) * log(1+f) = f - (hfsq - s*(hfsq+R)). (better accuracy) * * 3. Finally, log(x) = k*ln2 + log(1+f). * = k*ln2_hi+(f-(hfsq-(s*(hfsq+R)+k*ln2_lo))) * Here ln2 is split into two floating point number: * ln2_hi + ln2_lo, * where n*ln2_hi is always exact for |n| < 2000. * * Special cases: * log(x) is NaN with signal if x < 0 (including -INF) ; * log(+INF) is +INF; log(0) is -INF with signal; * log(NaN) is that NaN with no signal. * * Accuracy: * according to an error analysis, the error is always less than * 1 ulp (unit in the last place). * * Constants: * The hexadecimal values are the intended ones for the following * constants. The decimal values may be used, provided that the * compiler will convert from decimal to binary accurately enough * to produce the hexadecimal values shown. */ const LN2_HI: f64 = 6.93147180369123816490e-01; /* 3fe62e42 fee00000 */ const LN2_LO: f64 = 1.90821492927058770002e-10; /* 3dea39ef 35793c76 */ const LG1: f64 = 6.666666666666735130e-01; /* 3FE55555 55555593 */ const LG2: f64 = 3.999999999940941908e-01; /* 3FD99999 9997FA04 */ const LG3: f64 = 2.857142874366239149e-01; /* 3FD24924 94229359 */ const LG4: f64 = 2.222219843214978396e-01; /* 3FCC71C5 1D8E78AF */ const LG5: f64 = 1.818357216161805012e-01; /* 3FC74664 96CB03DE */ const LG6: f64 = 1.531383769920937332e-01; /* 3FC39A09 D078C69F */ const LG7: f64 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log(mut x: f64) -> f64 { let x1p54 = f64::from_bits(0x4350000000000000); // 0x1p54 === 2 ^ 54 let mut ui = x.to_bits(); let mut hx: u32 = (ui >> 32) as u32; let mut k: i32 = 0; if (hx < 0x00100000) || ((hx >> 31) != 0) { /* x < 2**-126 */ if ui << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if hx >> 31 != 0 { return (x - x) / 0.0; /* log(-#) = NaN */ } /* subnormal number, scale x up */ k -= 54; x *= x1p54; ui = x.to_bits(); hx = (ui >> 32) as u32; } else if hx >= 0x7ff00000 { return x; } else if hx == 0x3ff00000 && ui << 32 == 0 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ hx += 0x3ff00000 - 0x3fe6a09e; k += ((hx >> 20) as i32) - 0x3ff; hx = (hx & 0x000fffff) + 0x3fe6a09e; ui = ((hx as u64) << 32) | (ui & 0xffffffff); x = f64::from_bits(ui); let f: f64 = x - 1.0; let hfsq: f64 = 0.5 * f * f; let s: f64 = f / (2.0 + f); let z: f64 = s * s; let w: f64 = z * z; let t1: f64 = w * (LG2 + w * (LG4 + w * LG6)); let t2: f64 = z * (LG1 + w * (LG3 + w * (LG5 + w * LG7))); let r: f64 = t2 + t1; let dk: f64 = k as f64; s * (hfsq + r) + dk * LN2_LO - hfsq + f + dk * LN2_HI } libm-0.2.1/src/math/log10.rs010066400017500001750000000072671351140305300136770ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_log10.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* * Return the base 10 logarithm of x. See log.c for most comments. * * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 * as in log.c, then combine and scale in extra precision: * log10(x) = (f - f*f/2 + r)/log(10) + k*log10(2) */ use core::f64; const IVLN10HI: f64 = 4.34294481878168880939e-01; /* 0x3fdbcb7b, 0x15200000 */ const IVLN10LO: f64 = 2.50829467116452752298e-11; /* 0x3dbb9438, 0xca9aadd5 */ const LOG10_2HI: f64 = 3.01029995663611771306e-01; /* 0x3FD34413, 0x509F6000 */ const LOG10_2LO: f64 = 3.69423907715893078616e-13; /* 0x3D59FEF3, 0x11F12B36 */ const LG1: f64 = 6.666666666666735130e-01; /* 3FE55555 55555593 */ const LG2: f64 = 3.999999999940941908e-01; /* 3FD99999 9997FA04 */ const LG3: f64 = 2.857142874366239149e-01; /* 3FD24924 94229359 */ const LG4: f64 = 2.222219843214978396e-01; /* 3FCC71C5 1D8E78AF */ const LG5: f64 = 1.818357216161805012e-01; /* 3FC74664 96CB03DE */ const LG6: f64 = 1.531383769920937332e-01; /* 3FC39A09 D078C69F */ const LG7: f64 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log10(mut x: f64) -> f64 { let x1p54 = f64::from_bits(0x4350000000000000); // 0x1p54 === 2 ^ 54 let mut ui: u64 = x.to_bits(); let hfsq: f64; let f: f64; let s: f64; let z: f64; let r: f64; let mut w: f64; let t1: f64; let t2: f64; let dk: f64; let y: f64; let mut hi: f64; let lo: f64; let mut val_hi: f64; let mut val_lo: f64; let mut hx: u32; let mut k: i32; hx = (ui >> 32) as u32; k = 0; if hx < 0x00100000 || (hx >> 31) > 0 { if ui << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if (hx >> 31) > 0 { return (x - x) / 0.0; /* log(-#) = NaN */ } /* subnormal number, scale x up */ k -= 54; x *= x1p54; ui = x.to_bits(); hx = (ui >> 32) as u32; } else if hx >= 0x7ff00000 { return x; } else if hx == 0x3ff00000 && ui << 32 == 0 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ hx += 0x3ff00000 - 0x3fe6a09e; k += (hx >> 20) as i32 - 0x3ff; hx = (hx & 0x000fffff) + 0x3fe6a09e; ui = (hx as u64) << 32 | (ui & 0xffffffff); x = f64::from_bits(ui); f = x - 1.0; hfsq = 0.5 * f * f; s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * (LG4 + w * LG6)); t2 = z * (LG1 + w * (LG3 + w * (LG5 + w * LG7))); r = t2 + t1; /* See log2.c for details. */ /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ hi = f - hfsq; ui = hi.to_bits(); ui &= (-1i64 as u64) << 32; hi = f64::from_bits(ui); lo = f - hi - hfsq + s * (hfsq + r); /* val_hi+val_lo ~ log10(1+f) + k*log10(2) */ val_hi = hi * IVLN10HI; dk = k as f64; y = dk * LOG10_2HI; val_lo = dk * LOG10_2LO + (lo + hi) * IVLN10LO + lo * IVLN10HI; /* * Extra precision in for adding y is not strictly needed * since there is no very large cancellation near x = sqrt(2) or * x = 1/sqrt(2), but we do it anyway since it costs little on CPUs * with some parallelism and it reduces the error for many args. */ w = y + val_hi; val_lo += (y - w) + val_hi; val_hi = w; val_lo + val_hi } libm-0.2.1/src/math/log10f.rs010066400017500001750000000050011351140266700140370ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_log10f.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* * See comments in log10.c. */ use core::f32; const IVLN10HI: f32 = 4.3432617188e-01; /* 0x3ede6000 */ const IVLN10LO: f32 = -3.1689971365e-05; /* 0xb804ead9 */ const LOG10_2HI: f32 = 3.0102920532e-01; /* 0x3e9a2080 */ const LOG10_2LO: f32 = 7.9034151668e-07; /* 0x355427db */ /* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ const LG1: f32 = 0.66666662693; /* 0xaaaaaa.0p-24 */ const LG2: f32 = 0.40000972152; /* 0xccce13.0p-25 */ const LG3: f32 = 0.28498786688; /* 0x91e9ee.0p-25 */ const LG4: f32 = 0.24279078841; /* 0xf89e26.0p-26 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log10f(mut x: f32) -> f32 { let x1p25f = f32::from_bits(0x4c000000); // 0x1p25f === 2 ^ 25 let mut ui: u32 = x.to_bits(); let hfsq: f32; let f: f32; let s: f32; let z: f32; let r: f32; let w: f32; let t1: f32; let t2: f32; let dk: f32; let mut hi: f32; let lo: f32; let mut ix: u32; let mut k: i32; ix = ui; k = 0; if ix < 0x00800000 || (ix >> 31) > 0 { /* x < 2**-126 */ if ix << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if (ix >> 31) > 0 { return (x - x) / 0.0; /* log(-#) = NaN */ } /* subnormal number, scale up x */ k -= 25; x *= x1p25f; ui = x.to_bits(); ix = ui; } else if ix >= 0x7f800000 { return x; } else if ix == 0x3f800000 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ ix += 0x3f800000 - 0x3f3504f3; k += (ix >> 23) as i32 - 0x7f; ix = (ix & 0x007fffff) + 0x3f3504f3; ui = ix; x = f32::from_bits(ui); f = x - 1.0; s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * LG4); t2 = z * (LG1 + w * LG3); r = t2 + t1; hfsq = 0.5 * f * f; hi = f - hfsq; ui = hi.to_bits(); ui &= 0xfffff000; hi = f32::from_bits(ui); lo = f - hi - hfsq + s * (hfsq + r); dk = k as f32; dk * LOG10_2LO + (lo + hi) * IVLN10LO + lo * IVLN10HI + hi * IVLN10HI + dk * LOG10_2HI } libm-0.2.1/src/math/log1p.rs010066400017500001750000000112411351140254600137700ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_log1p.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* double log1p(double x) * Return the natural logarithm of 1+x. * * Method : * 1. Argument Reduction: find k and f such that * 1+x = 2^k * (1+f), * where sqrt(2)/2 < 1+f < sqrt(2) . * * Note. If k=0, then f=x is exact. However, if k!=0, then f * may not be representable exactly. In that case, a correction * term is need. Let u=1+x rounded. Let c = (1+x)-u, then * log(1+x) - log(u) ~ c/u. Thus, we proceed to compute log(u), * and add back the correction term c/u. * (Note: when x > 2**53, one can simply return log(x)) * * 2. Approximation of log(1+f): See log.c * * 3. Finally, log1p(x) = k*ln2 + log(1+f) + c/u. See log.c * * Special cases: * log1p(x) is NaN with signal if x < -1 (including -INF) ; * log1p(+INF) is +INF; log1p(-1) is -INF with signal; * log1p(NaN) is that NaN with no signal. * * Accuracy: * according to an error analysis, the error is always less than * 1 ulp (unit in the last place). * * Constants: * The hexadecimal values are the intended ones for the following * constants. The decimal values may be used, provided that the * compiler will convert from decimal to binary accurately enough * to produce the hexadecimal values shown. * * Note: Assuming log() return accurate answer, the following * algorithm can be used to compute log1p(x) to within a few ULP: * * u = 1+x; * if(u==1.0) return x ; else * return log(u)*(x/(u-1.0)); * * See HP-15C Advanced Functions Handbook, p.193. */ use core::f64; const LN2_HI: f64 = 6.93147180369123816490e-01; /* 3fe62e42 fee00000 */ const LN2_LO: f64 = 1.90821492927058770002e-10; /* 3dea39ef 35793c76 */ const LG1: f64 = 6.666666666666735130e-01; /* 3FE55555 55555593 */ const LG2: f64 = 3.999999999940941908e-01; /* 3FD99999 9997FA04 */ const LG3: f64 = 2.857142874366239149e-01; /* 3FD24924 94229359 */ const LG4: f64 = 2.222219843214978396e-01; /* 3FCC71C5 1D8E78AF */ const LG5: f64 = 1.818357216161805012e-01; /* 3FC74664 96CB03DE */ const LG6: f64 = 1.531383769920937332e-01; /* 3FC39A09 D078C69F */ const LG7: f64 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log1p(x: f64) -> f64 { let mut ui: u64 = x.to_bits(); let hfsq: f64; let mut f: f64 = 0.; let mut c: f64 = 0.; let s: f64; let z: f64; let r: f64; let w: f64; let t1: f64; let t2: f64; let dk: f64; let hx: u32; let mut hu: u32; let mut k: i32; hx = (ui >> 32) as u32; k = 1; if hx < 0x3fda827a || (hx >> 31) > 0 { /* 1+x < sqrt(2)+ */ if hx >= 0xbff00000 { /* x <= -1.0 */ if x == -1. { return x / 0.0; /* log1p(-1) = -inf */ } return (x - x) / 0.0; /* log1p(x<-1) = NaN */ } if hx << 1 < 0x3ca00000 << 1 { /* |x| < 2**-53 */ /* underflow if subnormal */ if (hx & 0x7ff00000) == 0 { force_eval!(x as f32); } return x; } if hx <= 0xbfd2bec4 { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ k = 0; c = 0.; f = x; } } else if hx >= 0x7ff00000 { return x; } if k > 0 { ui = (1. + x).to_bits(); hu = (ui >> 32) as u32; hu += 0x3ff00000 - 0x3fe6a09e; k = (hu >> 20) as i32 - 0x3ff; /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ if k < 54 { c = if k >= 2 { 1. - (f64::from_bits(ui) - x) } else { x - (f64::from_bits(ui) - 1.) }; c /= f64::from_bits(ui); } else { c = 0.; } /* reduce u into [sqrt(2)/2, sqrt(2)] */ hu = (hu & 0x000fffff) + 0x3fe6a09e; ui = (hu as u64) << 32 | (ui & 0xffffffff); f = f64::from_bits(ui) - 1.; } hfsq = 0.5 * f * f; s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * (LG4 + w * LG6)); t2 = z * (LG1 + w * (LG3 + w * (LG5 + w * LG7))); r = t2 + t1; dk = k as f64; s * (hfsq + r) + (dk * LN2_LO + c) - hfsq + f + dk * LN2_HI } libm-0.2.1/src/math/log1pf.rs010066400017500001750000000054241351140313000141320ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_log1pf.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use core::f32; const LN2_HI: f32 = 6.9313812256e-01; /* 0x3f317180 */ const LN2_LO: f32 = 9.0580006145e-06; /* 0x3717f7d1 */ /* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ const LG1: f32 = 0.66666662693; /* 0xaaaaaa.0p-24 */ const LG2: f32 = 0.40000972152; /* 0xccce13.0p-25 */ const LG3: f32 = 0.28498786688; /* 0x91e9ee.0p-25 */ const LG4: f32 = 0.24279078841; /* 0xf89e26.0p-26 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log1pf(x: f32) -> f32 { let mut ui: u32 = x.to_bits(); let hfsq: f32; let mut f: f32 = 0.; let mut c: f32 = 0.; let s: f32; let z: f32; let r: f32; let w: f32; let t1: f32; let t2: f32; let dk: f32; let ix: u32; let mut iu: u32; let mut k: i32; ix = ui; k = 1; if ix < 0x3ed413d0 || (ix >> 31) > 0 { /* 1+x < sqrt(2)+ */ if ix >= 0xbf800000 { /* x <= -1.0 */ if x == -1. { return x / 0.0; /* log1p(-1)=+inf */ } return (x - x) / 0.0; /* log1p(x<-1)=NaN */ } if ix << 1 < 0x33800000 << 1 { /* |x| < 2**-24 */ /* underflow if subnormal */ if (ix & 0x7f800000) == 0 { force_eval!(x * x); } return x; } if ix <= 0xbe95f619 { /* sqrt(2)/2- <= 1+x < sqrt(2)+ */ k = 0; c = 0.; f = x; } } else if ix >= 0x7f800000 { return x; } if k > 0 { ui = (1. + x).to_bits(); iu = ui; iu += 0x3f800000 - 0x3f3504f3; k = (iu >> 23) as i32 - 0x7f; /* correction term ~ log(1+x)-log(u), avoid underflow in c/u */ if k < 25 { c = if k >= 2 { 1. - (f32::from_bits(ui) - x) } else { x - (f32::from_bits(ui) - 1.) }; c /= f32::from_bits(ui); } else { c = 0.; } /* reduce u into [sqrt(2)/2, sqrt(2)] */ iu = (iu & 0x007fffff) + 0x3f3504f3; ui = iu; f = f32::from_bits(ui) - 1.; } s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * LG4); t2 = z * (LG1 + w * LG3); r = t2 + t1; hfsq = 0.5 * f * f; dk = k as f32; s * (hfsq + r) + (dk * LN2_LO + c) - hfsq + f + dk * LN2_HI } libm-0.2.1/src/math/log2.rs010066400017500001750000000062311351140261600136120ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_log2.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* * Return the base 2 logarithm of x. See log.c for most comments. * * Reduce x to 2^k (1+f) and calculate r = log(1+f) - f + f*f/2 * as in log.c, then combine and scale in extra precision: * log2(x) = (f - f*f/2 + r)/log(2) + k */ use core::f64; const IVLN2HI: f64 = 1.44269504072144627571e+00; /* 0x3ff71547, 0x65200000 */ const IVLN2LO: f64 = 1.67517131648865118353e-10; /* 0x3de705fc, 0x2eefa200 */ const LG1: f64 = 6.666666666666735130e-01; /* 3FE55555 55555593 */ const LG2: f64 = 3.999999999940941908e-01; /* 3FD99999 9997FA04 */ const LG3: f64 = 2.857142874366239149e-01; /* 3FD24924 94229359 */ const LG4: f64 = 2.222219843214978396e-01; /* 3FCC71C5 1D8E78AF */ const LG5: f64 = 1.818357216161805012e-01; /* 3FC74664 96CB03DE */ const LG6: f64 = 1.531383769920937332e-01; /* 3FC39A09 D078C69F */ const LG7: f64 = 1.479819860511658591e-01; /* 3FC2F112 DF3E5244 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log2(mut x: f64) -> f64 { let x1p54 = f64::from_bits(0x4350000000000000); // 0x1p54 === 2 ^ 54 let mut ui: u64 = x.to_bits(); let hfsq: f64; let f: f64; let s: f64; let z: f64; let r: f64; let mut w: f64; let t1: f64; let t2: f64; let y: f64; let mut hi: f64; let lo: f64; let mut val_hi: f64; let mut val_lo: f64; let mut hx: u32; let mut k: i32; hx = (ui >> 32) as u32; k = 0; if hx < 0x00100000 || (hx >> 31) > 0 { if ui << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if (hx >> 31) > 0 { return (x - x) / 0.0; /* log(-#) = NaN */ } /* subnormal number, scale x up */ k -= 54; x *= x1p54; ui = x.to_bits(); hx = (ui >> 32) as u32; } else if hx >= 0x7ff00000 { return x; } else if hx == 0x3ff00000 && ui << 32 == 0 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ hx += 0x3ff00000 - 0x3fe6a09e; k += (hx >> 20) as i32 - 0x3ff; hx = (hx & 0x000fffff) + 0x3fe6a09e; ui = (hx as u64) << 32 | (ui & 0xffffffff); x = f64::from_bits(ui); f = x - 1.0; hfsq = 0.5 * f * f; s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * (LG4 + w * LG6)); t2 = z * (LG1 + w * (LG3 + w * (LG5 + w * LG7))); r = t2 + t1; /* hi+lo = f - hfsq + s*(hfsq+R) ~ log(1+f) */ hi = f - hfsq; ui = hi.to_bits(); ui &= (-1i64 as u64) << 32; hi = f64::from_bits(ui); lo = f - hi - hfsq + s * (hfsq + r); val_hi = hi * IVLN2HI; val_lo = (lo + hi) * IVLN2LO + lo * IVLN2HI; /* spadd(val_hi, val_lo, y), except for not using double_t: */ y = k.into(); w = y + val_hi; val_lo += (y - w) + val_hi; val_hi = w; val_lo + val_hi } libm-0.2.1/src/math/log2f.rs010066400017500001750000000045121351140310100137460ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_log2f.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* * See comments in log2.c. */ use core::f32; const IVLN2HI: f32 = 1.4428710938e+00; /* 0x3fb8b000 */ const IVLN2LO: f32 = -1.7605285393e-04; /* 0xb9389ad4 */ /* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ const LG1: f32 = 0.66666662693; /* 0xaaaaaa.0p-24 */ const LG2: f32 = 0.40000972152; /* 0xccce13.0p-25 */ const LG3: f32 = 0.28498786688; /* 0x91e9ee.0p-25 */ const LG4: f32 = 0.24279078841; /* 0xf89e26.0p-26 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn log2f(mut x: f32) -> f32 { let x1p25f = f32::from_bits(0x4c000000); // 0x1p25f === 2 ^ 25 let mut ui: u32 = x.to_bits(); let hfsq: f32; let f: f32; let s: f32; let z: f32; let r: f32; let w: f32; let t1: f32; let t2: f32; let mut hi: f32; let lo: f32; let mut ix: u32; let mut k: i32; ix = ui; k = 0; if ix < 0x00800000 || (ix >> 31) > 0 { /* x < 2**-126 */ if ix << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if (ix >> 31) > 0 { return (x - x) / 0.0; /* log(-#) = NaN */ } /* subnormal number, scale up x */ k -= 25; x *= x1p25f; ui = x.to_bits(); ix = ui; } else if ix >= 0x7f800000 { return x; } else if ix == 0x3f800000 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ ix += 0x3f800000 - 0x3f3504f3; k += (ix >> 23) as i32 - 0x7f; ix = (ix & 0x007fffff) + 0x3f3504f3; ui = ix; x = f32::from_bits(ui); f = x - 1.0; s = f / (2.0 + f); z = s * s; w = z * z; t1 = w * (LG2 + w * LG4); t2 = z * (LG1 + w * LG3); r = t2 + t1; hfsq = 0.5 * f * f; hi = f - hfsq; ui = hi.to_bits(); ui &= 0xfffff000; hi = f32::from_bits(ui); lo = f - hi - hfsq + s * (hfsq + r); (lo + hi) * IVLN2LO + lo * IVLN2HI + hi * IVLN2HI + k as f32 } libm-0.2.1/src/math/logf.rs010066400017500001750000000040341351140321000136640ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_logf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ const LN2_HI: f32 = 6.9313812256e-01; /* 0x3f317180 */ const LN2_LO: f32 = 9.0580006145e-06; /* 0x3717f7d1 */ /* |(log(1+s)-log(1-s))/s - Lg(s)| < 2**-34.24 (~[-4.95e-11, 4.97e-11]). */ const LG1: f32 = 0.66666662693; /* 0xaaaaaa.0p-24*/ const LG2: f32 = 0.40000972152; /* 0xccce13.0p-25 */ const LG3: f32 = 0.28498786688; /* 0x91e9ee.0p-25 */ const LG4: f32 = 0.24279078841; /* 0xf89e26.0p-26 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn logf(mut x: f32) -> f32 { let x1p25 = f32::from_bits(0x4c000000); // 0x1p25f === 2 ^ 25 let mut ix = x.to_bits(); let mut k = 0i32; if (ix < 0x00800000) || ((ix >> 31) != 0) { /* x < 2**-126 */ if ix << 1 == 0 { return -1. / (x * x); /* log(+-0)=-inf */ } if (ix >> 31) != 0 { return (x - x) / 0.; /* log(-#) = NaN */ } /* subnormal number, scale up x */ k -= 25; x *= x1p25; ix = x.to_bits(); } else if ix >= 0x7f800000 { return x; } else if ix == 0x3f800000 { return 0.; } /* reduce x into [sqrt(2)/2, sqrt(2)] */ ix += 0x3f800000 - 0x3f3504f3; k += ((ix >> 23) as i32) - 0x7f; ix = (ix & 0x007fffff) + 0x3f3504f3; x = f32::from_bits(ix); let f = x - 1.; let s = f / (2. + f); let z = s * s; let w = z * z; let t1 = w * (LG2 + w * LG4); let t2 = z * (LG1 + w * LG3); let r = t2 + t1; let hfsq = 0.5 * f * f; let dk = k as f32; s * (hfsq + r) + dk * LN2_LO - hfsq + f + dk * LN2_HI } libm-0.2.1/src/math/mod.rs010066400017500001750000000163211353572366000135420ustar0000000000000000macro_rules! force_eval { ($e:expr) => { unsafe { ::core::ptr::read_volatile(&$e); } }; } #[cfg(not(debug_assertions))] macro_rules! i { ($array:expr, $index:expr) => { unsafe { *$array.get_unchecked($index) } }; ($array:expr, $index:expr, = , $rhs:expr) => { unsafe { *$array.get_unchecked_mut($index) = $rhs; } }; ($array:expr, $index:expr, += , $rhs:expr) => { unsafe { *$array.get_unchecked_mut($index) += $rhs; } }; ($array:expr, $index:expr, -= , $rhs:expr) => { unsafe { *$array.get_unchecked_mut($index) -= $rhs; } }; ($array:expr, $index:expr, &= , $rhs:expr) => { unsafe { *$array.get_unchecked_mut($index) &= $rhs; } }; ($array:expr, $index:expr, == , $rhs:expr) => { unsafe { *$array.get_unchecked_mut($index) == $rhs } }; } #[cfg(debug_assertions)] macro_rules! i { ($array:expr, $index:expr) => { *$array.get($index).unwrap() }; ($array:expr, $index:expr, = , $rhs:expr) => { *$array.get_mut($index).unwrap() = $rhs; }; ($array:expr, $index:expr, -= , $rhs:expr) => { *$array.get_mut($index).unwrap() -= $rhs; }; ($array:expr, $index:expr, += , $rhs:expr) => { *$array.get_mut($index).unwrap() += $rhs; }; ($array:expr, $index:expr, &= , $rhs:expr) => { *$array.get_mut($index).unwrap() &= $rhs; }; ($array:expr, $index:expr, == , $rhs:expr) => { *$array.get_mut($index).unwrap() == $rhs }; } macro_rules! llvm_intrinsically_optimized { (#[cfg($($clause:tt)*)] $e:expr) => { #[cfg(all(feature = "unstable", $($clause)*))] { if true { // thwart the dead code lint $e } } }; } // Public modules mod acos; mod acosf; mod acosh; mod acoshf; mod asin; mod asinf; mod asinh; mod asinhf; mod atan; mod atan2; mod atan2f; mod atanf; mod atanh; mod atanhf; mod cbrt; mod cbrtf; mod ceil; mod ceilf; mod copysign; mod copysignf; mod cos; mod cosf; mod cosh; mod coshf; mod erf; mod erff; mod exp; mod exp10; mod exp10f; mod exp2; mod exp2f; mod expf; mod expm1; mod expm1f; mod fabs; mod fabsf; mod fdim; mod fdimf; mod floor; mod floorf; mod fma; mod fmaf; mod fmax; mod fmaxf; mod fmin; mod fminf; mod fmod; mod fmodf; mod frexp; mod frexpf; mod hypot; mod hypotf; mod ilogb; mod ilogbf; mod j0; mod j0f; mod j1; mod j1f; mod jn; mod jnf; mod ldexp; mod ldexpf; mod lgamma; mod lgamma_r; mod lgammaf; mod lgammaf_r; mod log; mod log10; mod log10f; mod log1p; mod log1pf; mod log2; mod log2f; mod logf; mod modf; mod modff; mod nextafter; mod nextafterf; mod pow; mod powf; mod remainder; mod remainderf; mod remquo; mod remquof; mod round; mod roundf; mod scalbn; mod scalbnf; mod sin; mod sincos; mod sincosf; mod sinf; mod sinh; mod sinhf; mod sqrt; mod sqrtf; mod tan; mod tanf; mod tanh; mod tanhf; mod tgamma; mod tgammaf; mod trunc; mod truncf; // Use separated imports instead of {}-grouped imports for easier merging. pub use self::acos::acos; pub use self::acosf::acosf; pub use self::acosh::acosh; pub use self::acoshf::acoshf; pub use self::asin::asin; pub use self::asinf::asinf; pub use self::asinh::asinh; pub use self::asinhf::asinhf; pub use self::atan::atan; pub use self::atan2::atan2; pub use self::atan2f::atan2f; pub use self::atanf::atanf; pub use self::atanh::atanh; pub use self::atanhf::atanhf; pub use self::cbrt::cbrt; pub use self::cbrtf::cbrtf; pub use self::ceil::ceil; pub use self::ceilf::ceilf; pub use self::copysign::copysign; pub use self::copysignf::copysignf; pub use self::cos::cos; pub use self::cosf::cosf; pub use self::cosh::cosh; pub use self::coshf::coshf; pub use self::erf::erf; pub use self::erf::erfc; pub use self::erff::erfcf; pub use self::erff::erff; pub use self::exp::exp; pub use self::exp10::exp10; pub use self::exp10f::exp10f; pub use self::exp2::exp2; pub use self::exp2f::exp2f; pub use self::expf::expf; pub use self::expm1::expm1; pub use self::expm1f::expm1f; pub use self::fabs::fabs; pub use self::fabsf::fabsf; pub use self::fdim::fdim; pub use self::fdimf::fdimf; pub use self::floor::floor; pub use self::floorf::floorf; pub use self::fma::fma; pub use self::fmaf::fmaf; pub use self::fmax::fmax; pub use self::fmaxf::fmaxf; pub use self::fmin::fmin; pub use self::fminf::fminf; pub use self::fmod::fmod; pub use self::fmodf::fmodf; pub use self::frexp::frexp; pub use self::frexpf::frexpf; pub use self::hypot::hypot; pub use self::hypotf::hypotf; pub use self::ilogb::ilogb; pub use self::ilogbf::ilogbf; pub use self::j0::j0; pub use self::j0::y0; pub use self::j0f::j0f; pub use self::j0f::y0f; pub use self::j1::j1; pub use self::j1::y1; pub use self::j1f::j1f; pub use self::j1f::y1f; pub use self::jn::jn; pub use self::jn::yn; pub use self::jnf::jnf; pub use self::jnf::ynf; pub use self::ldexp::ldexp; pub use self::ldexpf::ldexpf; pub use self::lgamma::lgamma; pub use self::lgamma_r::lgamma_r; pub use self::lgammaf::lgammaf; pub use self::lgammaf_r::lgammaf_r; pub use self::log::log; pub use self::log10::log10; pub use self::log10f::log10f; pub use self::log1p::log1p; pub use self::log1pf::log1pf; pub use self::log2::log2; pub use self::log2f::log2f; pub use self::logf::logf; pub use self::modf::modf; pub use self::modff::modff; pub use self::nextafter::nextafter; pub use self::nextafterf::nextafterf; pub use self::pow::pow; pub use self::powf::powf; pub use self::remainder::remainder; pub use self::remainderf::remainderf; pub use self::remquo::remquo; pub use self::remquof::remquof; pub use self::round::round; pub use self::roundf::roundf; pub use self::scalbn::scalbn; pub use self::scalbnf::scalbnf; pub use self::sin::sin; pub use self::sincos::sincos; pub use self::sincosf::sincosf; pub use self::sinf::sinf; pub use self::sinh::sinh; pub use self::sinhf::sinhf; pub use self::sqrt::sqrt; pub use self::sqrtf::sqrtf; pub use self::tan::tan; pub use self::tanf::tanf; pub use self::tanh::tanh; pub use self::tanhf::tanhf; pub use self::tgamma::tgamma; pub use self::tgammaf::tgammaf; pub use self::trunc::trunc; pub use self::truncf::truncf; // Private modules mod expo2; mod fenv; mod k_cos; mod k_cosf; mod k_expo2; mod k_expo2f; mod k_sin; mod k_sinf; mod k_tan; mod k_tanf; mod rem_pio2; mod rem_pio2_large; mod rem_pio2f; // Private re-imports use self::expo2::expo2; use self::k_cos::k_cos; use self::k_cosf::k_cosf; use self::k_expo2::k_expo2; use self::k_expo2f::k_expo2f; use self::k_sin::k_sin; use self::k_sinf::k_sinf; use self::k_tan::k_tan; use self::k_tanf::k_tanf; use self::rem_pio2::rem_pio2; use self::rem_pio2_large::rem_pio2_large; use self::rem_pio2f::rem_pio2f; #[inline] fn get_high_word(x: f64) -> u32 { (x.to_bits() >> 32) as u32 } #[inline] fn get_low_word(x: f64) -> u32 { x.to_bits() as u32 } #[inline] fn with_set_high_word(f: f64, hi: u32) -> f64 { let mut tmp = f.to_bits(); tmp &= 0x00000000_ffffffff; tmp |= (hi as u64) << 32; f64::from_bits(tmp) } #[inline] fn with_set_low_word(f: f64, lo: u32) -> f64 { let mut tmp = f.to_bits(); tmp &= 0xffffffff_00000000; tmp |= lo as u64; f64::from_bits(tmp) } #[inline] fn combine_words(hi: u32, lo: u32) -> f64 { f64::from_bits((hi as u64) << 32 | lo as u64) } libm-0.2.1/src/math/modf.rs010066400017500001750000000013321346656360500137100ustar0000000000000000pub fn modf(x: f64) -> (f64, f64) { let rv2: f64; let mut u = x.to_bits(); let mask: u64; let e = ((u >> 52 & 0x7ff) as i32) - 0x3ff; /* no fractional part */ if e >= 52 { rv2 = x; if e == 0x400 && (u << 12) != 0 { /* nan */ return (x, rv2); } u &= 1 << 63; return (f64::from_bits(u), rv2); } /* no integral part*/ if e < 0 { u &= 1 << 63; rv2 = f64::from_bits(u); return (x, rv2); } mask = ((!0) >> 12) >> e; if (u & mask) == 0 { rv2 = x; u &= 1 << 63; return (f64::from_bits(u), rv2); } u &= !mask; rv2 = f64::from_bits(u); return (x - rv2, rv2); } libm-0.2.1/src/math/modff.rs010066400017500001750000000013431346656360500140600ustar0000000000000000pub fn modff(x: f32) -> (f32, f32) { let rv2: f32; let mut u: u32 = x.to_bits(); let mask: u32; let e = ((u >> 23 & 0xff) as i32) - 0x7f; /* no fractional part */ if e >= 23 { rv2 = x; if e == 0x80 && (u << 9) != 0 { /* nan */ return (x, rv2); } u &= 0x80000000; return (f32::from_bits(u), rv2); } /* no integral part */ if e < 0 { u &= 0x80000000; rv2 = f32::from_bits(u); return (x, rv2); } mask = 0x007fffff >> e; if (u & mask) == 0 { rv2 = x; u &= 0x80000000; return (f32::from_bits(u), rv2); } u &= !mask; rv2 = f32::from_bits(u); return (x - rv2, rv2); } libm-0.2.1/src/math/nextafter.rs010066400017500001750000000015661351140334500147550ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn nextafter(x: f64, y: f64) -> f64 { if x.is_nan() || y.is_nan() { return x + y; } let mut ux_i = x.to_bits(); let uy_i = y.to_bits(); if ux_i == uy_i { return y; } let ax = ux_i & !1_u64 / 2; let ay = uy_i & !1_u64 / 2; if ax == 0 { if ay == 0 { return y; } ux_i = (uy_i & 1_u64 << 63) | 1; } else if ax > ay || ((ux_i ^ uy_i) & 1_u64 << 63) != 0 { ux_i -= 1; } else { ux_i += 1; } let e = ux_i.wrapping_shr(52 & 0x7ff); // raise overflow if ux.f is infinite and x is finite if e == 0x7ff { force_eval!(x + x); } let ux_f = f64::from_bits(ux_i); // raise underflow if ux.f is subnormal or zero if e == 0 { force_eval!(x * x + ux_f * ux_f); } ux_f } libm-0.2.1/src/math/nextafterf.rs010066400017500001750000000016301351140314200151060ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn nextafterf(x: f32, y: f32) -> f32 { if x.is_nan() || y.is_nan() { return x + y; } let mut ux_i = x.to_bits(); let uy_i = y.to_bits(); if ux_i == uy_i { return y; } let ax = ux_i & 0x7fff_ffff_u32; let ay = uy_i & 0x7fff_ffff_u32; if ax == 0 { if ay == 0 { return y; } ux_i = (uy_i & 0x8000_0000_u32) | 1; } else if ax > ay || ((ux_i ^ uy_i) & 0x8000_0000_u32) != 0 { ux_i -= 1; } else { ux_i += 1; } let e = ux_i.wrapping_shr(0x7f80_0000_u32); // raise overflow if ux_f is infinite and x is finite if e == 0x7f80_0000_u32 { force_eval!(x + x); } let ux_f = f32::from_bits(ux_i); // raise underflow if ux_f is subnormal or zero if e == 0 { force_eval!(x * x + ux_f * ux_f); } ux_f } libm-0.2.1/src/math/pow.rs010066400017500001750000000514301351140334100135510ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_pow.c */ /* * ==================================================== * Copyright (C) 2004 by Sun Microsystems, Inc. All rights reserved. * * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ // pow(x,y) return x**y // // n // Method: Let x = 2 * (1+f) // 1. Compute and return log2(x) in two pieces: // log2(x) = w1 + w2, // where w1 has 53-24 = 29 bit trailing zeros. // 2. Perform y*log2(x) = n+y' by simulating muti-precision // arithmetic, where |y'|<=0.5. // 3. Return x**y = 2**n*exp(y'*log2) // // Special cases: // 1. (anything) ** 0 is 1 // 2. 1 ** (anything) is 1 // 3. (anything except 1) ** NAN is NAN // 4. NAN ** (anything except 0) is NAN // 5. +-(|x| > 1) ** +INF is +INF // 6. +-(|x| > 1) ** -INF is +0 // 7. +-(|x| < 1) ** +INF is +0 // 8. +-(|x| < 1) ** -INF is +INF // 9. -1 ** +-INF is 1 // 10. +0 ** (+anything except 0, NAN) is +0 // 11. -0 ** (+anything except 0, NAN, odd integer) is +0 // 12. +0 ** (-anything except 0, NAN) is +INF, raise divbyzero // 13. -0 ** (-anything except 0, NAN, odd integer) is +INF, raise divbyzero // 14. -0 ** (+odd integer) is -0 // 15. -0 ** (-odd integer) is -INF, raise divbyzero // 16. +INF ** (+anything except 0,NAN) is +INF // 17. +INF ** (-anything except 0,NAN) is +0 // 18. -INF ** (+odd integer) is -INF // 19. -INF ** (anything) = -0 ** (-anything), (anything except odd integer) // 20. (anything) ** 1 is (anything) // 21. (anything) ** -1 is 1/(anything) // 22. (-anything) ** (integer) is (-1)**(integer)*(+anything**integer) // 23. (-anything except 0 and inf) ** (non-integer) is NAN // // Accuracy: // pow(x,y) returns x**y nearly rounded. In particular // pow(integer,integer) // always returns the correct integer provided it is // representable. // // Constants : // The hexadecimal values are the intended ones for the following // constants. The decimal values may be used, provided that the // compiler will convert from decimal to binary accurately enough // to produce the hexadecimal values shown. // use super::{fabs, get_high_word, scalbn, sqrt, with_set_high_word, with_set_low_word}; const BP: [f64; 2] = [1.0, 1.5]; const DP_H: [f64; 2] = [0.0, 5.84962487220764160156e-01]; /* 0x3fe2b803_40000000 */ const DP_L: [f64; 2] = [0.0, 1.35003920212974897128e-08]; /* 0x3E4CFDEB, 0x43CFD006 */ const TWO53: f64 = 9007199254740992.0; /* 0x43400000_00000000 */ const HUGE: f64 = 1.0e300; const TINY: f64 = 1.0e-300; // poly coefs for (3/2)*(log(x)-2s-2/3*s**3: const L1: f64 = 5.99999999999994648725e-01; /* 0x3fe33333_33333303 */ const L2: f64 = 4.28571428578550184252e-01; /* 0x3fdb6db6_db6fabff */ const L3: f64 = 3.33333329818377432918e-01; /* 0x3fd55555_518f264d */ const L4: f64 = 2.72728123808534006489e-01; /* 0x3fd17460_a91d4101 */ const L5: f64 = 2.30660745775561754067e-01; /* 0x3fcd864a_93c9db65 */ const L6: f64 = 2.06975017800338417784e-01; /* 0x3fca7e28_4a454eef */ const P1: f64 = 1.66666666666666019037e-01; /* 0x3fc55555_5555553e */ const P2: f64 = -2.77777777770155933842e-03; /* 0xbf66c16c_16bebd93 */ const P3: f64 = 6.61375632143793436117e-05; /* 0x3f11566a_af25de2c */ const P4: f64 = -1.65339022054652515390e-06; /* 0xbebbbd41_c5d26bf1 */ const P5: f64 = 4.13813679705723846039e-08; /* 0x3e663769_72bea4d0 */ const LG2: f64 = 6.93147180559945286227e-01; /* 0x3fe62e42_fefa39ef */ const LG2_H: f64 = 6.93147182464599609375e-01; /* 0x3fe62e43_00000000 */ const LG2_L: f64 = -1.90465429995776804525e-09; /* 0xbe205c61_0ca86c39 */ const OVT: f64 = 8.0085662595372944372e-017; /* -(1024-log2(ovfl+.5ulp)) */ const CP: f64 = 9.61796693925975554329e-01; /* 0x3feec709_dc3a03fd =2/(3ln2) */ const CP_H: f64 = 9.61796700954437255859e-01; /* 0x3feec709_e0000000 =(float)cp */ const CP_L: f64 = -7.02846165095275826516e-09; /* 0xbe3e2fe0_145b01f5 =tail of cp_h*/ const IVLN2: f64 = 1.44269504088896338700e+00; /* 0x3ff71547_652b82fe =1/ln2 */ const IVLN2_H: f64 = 1.44269502162933349609e+00; /* 0x3ff71547_60000000 =24b 1/ln2*/ const IVLN2_L: f64 = 1.92596299112661746887e-08; /* 0x3e54ae0b_f85ddf44 =1/ln2 tail*/ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn pow(x: f64, y: f64) -> f64 { let t1: f64; let t2: f64; let (hx, lx): (i32, u32) = ((x.to_bits() >> 32) as i32, x.to_bits() as u32); let (hy, ly): (i32, u32) = ((y.to_bits() >> 32) as i32, y.to_bits() as u32); let mut ix: i32 = (hx & 0x7fffffff) as i32; let iy: i32 = (hy & 0x7fffffff) as i32; /* x**0 = 1, even if x is NaN */ if ((iy as u32) | ly) == 0 { return 1.0; } /* 1**y = 1, even if y is NaN */ if hx == 0x3ff00000 && lx == 0 { return 1.0; } /* NaN if either arg is NaN */ if ix > 0x7ff00000 || (ix == 0x7ff00000 && lx != 0) || iy > 0x7ff00000 || (iy == 0x7ff00000 && ly != 0) { return x + y; } /* determine if y is an odd int when x < 0 * yisint = 0 ... y is not an integer * yisint = 1 ... y is an odd int * yisint = 2 ... y is an even int */ let mut yisint: i32 = 0; let mut k: i32; let mut j: i32; if hx < 0 { if iy >= 0x43400000 { yisint = 2; /* even integer y */ } else if iy >= 0x3ff00000 { k = (iy >> 20) - 0x3ff; /* exponent */ if k > 20 { j = (ly >> (52 - k)) as i32; if (j << (52 - k)) == (ly as i32) { yisint = 2 - (j & 1); } } else if ly == 0 { j = iy >> (20 - k); if (j << (20 - k)) == iy { yisint = 2 - (j & 1); } } } } if ly == 0 { /* special value of y */ if iy == 0x7ff00000 { /* y is +-inf */ return if ((ix - 0x3ff00000) | (lx as i32)) == 0 { /* (-1)**+-inf is 1 */ 1.0 } else if ix >= 0x3ff00000 { /* (|x|>1)**+-inf = inf,0 */ if hy >= 0 { y } else { 0.0 } } else { /* (|x|<1)**+-inf = 0,inf */ if hy >= 0 { 0.0 } else { -y } }; } if iy == 0x3ff00000 { /* y is +-1 */ return if hy >= 0 { x } else { 1.0 / x }; } if hy == 0x40000000 { /* y is 2 */ return x * x; } if hy == 0x3fe00000 { /* y is 0.5 */ if hx >= 0 { /* x >= +0 */ return sqrt(x); } } } let mut ax: f64 = fabs(x); if lx == 0 { /* special value of x */ if ix == 0x7ff00000 || ix == 0 || ix == 0x3ff00000 { /* x is +-0,+-inf,+-1 */ let mut z: f64 = ax; if hy < 0 { /* z = (1/|x|) */ z = 1.0 / z; } if hx < 0 { if ((ix - 0x3ff00000) | yisint) == 0 { z = (z - z) / (z - z); /* (-1)**non-int is NaN */ } else if yisint == 1 { z = -z; /* (x<0)**odd = -(|x|**odd) */ } } return z; } } let mut s: f64 = 1.0; /* sign of result */ if hx < 0 { if yisint == 0 { /* (x<0)**(non-int) is NaN */ return (x - x) / (x - x); } if yisint == 1 { /* (x<0)**(odd int) */ s = -1.0; } } /* |y| is HUGE */ if iy > 0x41e00000 { /* if |y| > 2**31 */ if iy > 0x43f00000 { /* if |y| > 2**64, must o/uflow */ if ix <= 0x3fefffff { return if hy < 0 { HUGE * HUGE } else { TINY * TINY }; } if ix >= 0x3ff00000 { return if hy > 0 { HUGE * HUGE } else { TINY * TINY }; } } /* over/underflow if x is not close to one */ if ix < 0x3fefffff { return if hy < 0 { s * HUGE * HUGE } else { s * TINY * TINY }; } if ix > 0x3ff00000 { return if hy > 0 { s * HUGE * HUGE } else { s * TINY * TINY }; } /* now |1-x| is TINY <= 2**-20, suffice to compute log(x) by x-x^2/2+x^3/3-x^4/4 */ let t: f64 = ax - 1.0; /* t has 20 trailing zeros */ let w: f64 = (t * t) * (0.5 - t * (0.3333333333333333333333 - t * 0.25)); let u: f64 = IVLN2_H * t; /* ivln2_h has 21 sig. bits */ let v: f64 = t * IVLN2_L - w * IVLN2; t1 = with_set_low_word(u + v, 0); t2 = v - (t1 - u); } else { // double ss,s2,s_h,s_l,t_h,t_l; let mut n: i32 = 0; if ix < 0x00100000 { /* take care subnormal number */ ax *= TWO53; n -= 53; ix = get_high_word(ax) as i32; } n += (ix >> 20) - 0x3ff; j = ix & 0x000fffff; /* determine interval */ let k: i32; ix = j | 0x3ff00000; /* normalize ix */ if j <= 0x3988E { /* |x|> 1) | 0x20000000) + 0x00080000 + ((k as u32) << 18), ); let t_l: f64 = ax - (t_h - BP[k as usize]); let s_l: f64 = v * ((u - s_h * t_h) - s_h * t_l); /* compute log(ax) */ let s2: f64 = ss * ss; let mut r: f64 = s2 * s2 * (L1 + s2 * (L2 + s2 * (L3 + s2 * (L4 + s2 * (L5 + s2 * L6))))); r += s_l * (s_h + ss); let s2: f64 = s_h * s_h; let t_h: f64 = with_set_low_word(3.0 + s2 + r, 0); let t_l: f64 = r - ((t_h - 3.0) - s2); /* u+v = ss*(1+...) */ let u: f64 = s_h * t_h; let v: f64 = s_l * t_h + t_l * ss; /* 2/(3log2)*(ss+...) */ let p_h: f64 = with_set_low_word(u + v, 0); let p_l = v - (p_h - u); let z_h: f64 = CP_H * p_h; /* cp_h+cp_l = 2/(3*log2) */ let z_l: f64 = CP_L * p_h + p_l * CP + DP_L[k as usize]; /* log2(ax) = (ss+..)*2/(3*log2) = n + dp_h + z_h + z_l */ let t: f64 = n as f64; t1 = with_set_low_word(((z_h + z_l) + DP_H[k as usize]) + t, 0); t2 = z_l - (((t1 - t) - DP_H[k as usize]) - z_h); } /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ let y1: f64 = with_set_low_word(y, 0); let p_l: f64 = (y - y1) * t1 + y * t2; let mut p_h: f64 = y1 * t1; let z: f64 = p_l + p_h; let mut j: i32 = (z.to_bits() >> 32) as i32; let i: i32 = z.to_bits() as i32; // let (j, i): (i32, i32) = ((z.to_bits() >> 32) as i32, z.to_bits() as i32); if j >= 0x40900000 { /* z >= 1024 */ if (j - 0x40900000) | i != 0 { /* if z > 1024 */ return s * HUGE * HUGE; /* overflow */ } if p_l + OVT > z - p_h { return s * HUGE * HUGE; /* overflow */ } } else if (j & 0x7fffffff) >= 0x4090cc00 { /* z <= -1075 */ // FIXME: instead of abs(j) use unsigned j if (((j as u32) - 0xc090cc00) | (i as u32)) != 0 { /* z < -1075 */ return s * TINY * TINY; /* underflow */ } if p_l <= z - p_h { return s * TINY * TINY; /* underflow */ } } /* compute 2**(p_h+p_l) */ let i: i32 = j & (0x7fffffff as i32); k = (i >> 20) - 0x3ff; let mut n: i32 = 0; if i > 0x3fe00000 { /* if |z| > 0.5, set n = [z+0.5] */ n = j + (0x00100000 >> (k + 1)); k = ((n & 0x7fffffff) >> 20) - 0x3ff; /* new k for n */ let t: f64 = with_set_high_word(0.0, (n & !(0x000fffff >> k)) as u32); n = ((n & 0x000fffff) | 0x00100000) >> (20 - k); if j < 0 { n = -n; } p_h -= t; } let t: f64 = with_set_low_word(p_l + p_h, 0); let u: f64 = t * LG2_H; let v: f64 = (p_l - (t - p_h)) * LG2 + t * LG2_L; let mut z: f64 = u + v; let w: f64 = v - (z - u); let t: f64 = z * z; let t1: f64 = z - t * (P1 + t * (P2 + t * (P3 + t * (P4 + t * P5)))); let r: f64 = (z * t1) / (t1 - 2.0) - (w + z * w); z = 1.0 - (r - z); j = get_high_word(z) as i32; j += n << 20; if (j >> 20) <= 0 { /* subnormal output */ z = scalbn(z, n); } else { z = with_set_high_word(z, j as u32); } s * z } #[cfg(test)] mod tests { extern crate core; use self::core::f64::consts::{E, PI}; use self::core::f64::{EPSILON, INFINITY, MAX, MIN, MIN_POSITIVE, NAN, NEG_INFINITY}; use super::pow; const POS_ZERO: &[f64] = &[0.0]; const NEG_ZERO: &[f64] = &[-0.0]; const POS_ONE: &[f64] = &[1.0]; const NEG_ONE: &[f64] = &[-1.0]; const POS_FLOATS: &[f64] = &[99.0 / 70.0, E, PI]; const NEG_FLOATS: &[f64] = &[-99.0 / 70.0, -E, -PI]; const POS_SMALL_FLOATS: &[f64] = &[(1.0 / 2.0), MIN_POSITIVE, EPSILON]; const NEG_SMALL_FLOATS: &[f64] = &[-(1.0 / 2.0), -MIN_POSITIVE, -EPSILON]; const POS_EVENS: &[f64] = &[2.0, 6.0, 8.0, 10.0, 22.0, 100.0, MAX]; const NEG_EVENS: &[f64] = &[MIN, -100.0, -22.0, -10.0, -8.0, -6.0, -2.0]; const POS_ODDS: &[f64] = &[3.0, 7.0]; const NEG_ODDS: &[f64] = &[-7.0, -3.0]; const NANS: &[f64] = &[NAN]; const POS_INF: &[f64] = &[INFINITY]; const NEG_INF: &[f64] = &[NEG_INFINITY]; const ALL: &[&[f64]] = &[ POS_ZERO, NEG_ZERO, NANS, NEG_SMALL_FLOATS, POS_SMALL_FLOATS, NEG_FLOATS, POS_FLOATS, NEG_EVENS, POS_EVENS, NEG_ODDS, POS_ODDS, NEG_INF, POS_INF, NEG_ONE, POS_ONE, ]; const POS: &[&[f64]] = &[POS_ZERO, POS_ODDS, POS_ONE, POS_FLOATS, POS_EVENS, POS_INF]; const NEG: &[&[f64]] = &[NEG_ZERO, NEG_ODDS, NEG_ONE, NEG_FLOATS, NEG_EVENS, NEG_INF]; fn pow_test(base: f64, exponent: f64, expected: f64) { let res = pow(base, exponent); assert!( if expected.is_nan() { res.is_nan() } else { pow(base, exponent) == expected }, "{} ** {} was {} instead of {}", base, exponent, res, expected ); } fn test_sets_as_base(sets: &[&[f64]], exponent: f64, expected: f64) { sets.iter() .for_each(|s| s.iter().for_each(|val| pow_test(*val, exponent, expected))); } fn test_sets_as_exponent(base: f64, sets: &[&[f64]], expected: f64) { sets.iter() .for_each(|s| s.iter().for_each(|val| pow_test(base, *val, expected))); } fn test_sets(sets: &[&[f64]], computed: &dyn Fn(f64) -> f64, expected: &dyn Fn(f64) -> f64) { sets.iter().for_each(|s| { s.iter().for_each(|val| { let exp = expected(*val); let res = computed(*val); assert!( if exp.is_nan() { res.is_nan() } else { exp == res }, "test for {} was {} instead of {}", val, res, exp ); }) }); } #[test] fn zero_as_exponent() { test_sets_as_base(ALL, 0.0, 1.0); test_sets_as_base(ALL, -0.0, 1.0); } #[test] fn one_as_base() { test_sets_as_exponent(1.0, ALL, 1.0); } #[test] fn nan_inputs() { // NAN as the base: // (NAN ^ anything *but 0* should be NAN) test_sets_as_exponent(NAN, &ALL[2..], NAN); // NAN as the exponent: // (anything *but 1* ^ NAN should be NAN) test_sets_as_base(&ALL[..(ALL.len() - 2)], NAN, NAN); } #[test] fn infinity_as_base() { // Positive Infinity as the base: // (+Infinity ^ positive anything but 0 and NAN should be +Infinity) test_sets_as_exponent(INFINITY, &POS[1..], INFINITY); // (+Infinity ^ negative anything except 0 and NAN should be 0.0) test_sets_as_exponent(INFINITY, &NEG[1..], 0.0); // Negative Infinity as the base: // (-Infinity ^ positive odd ints should be -Infinity) test_sets_as_exponent(NEG_INFINITY, &[POS_ODDS], NEG_INFINITY); // (-Infinity ^ anything but odd ints should be == -0 ^ (-anything)) // We can lump in pos/neg odd ints here because they don't seem to // cause panics (div by zero) in release mode (I think). test_sets(ALL, &|v: f64| pow(NEG_INFINITY, v), &|v: f64| pow(-0.0, -v)); } #[test] fn infinity_as_exponent() { // Positive/Negative base greater than 1: // (pos/neg > 1 ^ Infinity should be Infinity - note this excludes NAN as the base) test_sets_as_base(&ALL[5..(ALL.len() - 2)], INFINITY, INFINITY); // (pos/neg > 1 ^ -Infinity should be 0.0) test_sets_as_base(&ALL[5..ALL.len() - 2], NEG_INFINITY, 0.0); // Positive/Negative base less than 1: let base_below_one = &[POS_ZERO, NEG_ZERO, NEG_SMALL_FLOATS, POS_SMALL_FLOATS]; // (pos/neg < 1 ^ Infinity should be 0.0 - this also excludes NAN as the base) test_sets_as_base(base_below_one, INFINITY, 0.0); // (pos/neg < 1 ^ -Infinity should be Infinity) test_sets_as_base(base_below_one, NEG_INFINITY, INFINITY); // Positive/Negative 1 as the base: // (pos/neg 1 ^ Infinity should be 1) test_sets_as_base(&[NEG_ONE, POS_ONE], INFINITY, 1.0); // (pos/neg 1 ^ -Infinity should be 1) test_sets_as_base(&[NEG_ONE, POS_ONE], NEG_INFINITY, 1.0); } #[test] fn zero_as_base() { // Positive Zero as the base: // (+0 ^ anything positive but 0 and NAN should be +0) test_sets_as_exponent(0.0, &POS[1..], 0.0); // (+0 ^ anything negative but 0 and NAN should be Infinity) // (this should panic because we're dividing by zero) test_sets_as_exponent(0.0, &NEG[1..], INFINITY); // Negative Zero as the base: // (-0 ^ anything positive but 0, NAN, and odd ints should be +0) test_sets_as_exponent(-0.0, &POS[3..], 0.0); // (-0 ^ anything negative but 0, NAN, and odd ints should be Infinity) // (should panic because of divide by zero) test_sets_as_exponent(-0.0, &NEG[3..], INFINITY); // (-0 ^ positive odd ints should be -0) test_sets_as_exponent(-0.0, &[POS_ODDS], -0.0); // (-0 ^ negative odd ints should be -Infinity) // (should panic because of divide by zero) test_sets_as_exponent(-0.0, &[NEG_ODDS], NEG_INFINITY); } #[test] fn special_cases() { // One as the exponent: // (anything ^ 1 should be anything - i.e. the base) test_sets(ALL, &|v: f64| pow(v, 1.0), &|v: f64| v); // Negative One as the exponent: // (anything ^ -1 should be 1/anything) test_sets(ALL, &|v: f64| pow(v, -1.0), &|v: f64| 1.0 / v); // Factoring -1 out: // (negative anything ^ integer should be (-1 ^ integer) * (positive anything ^ integer)) &[POS_ZERO, NEG_ZERO, POS_ONE, NEG_ONE, POS_EVENS, NEG_EVENS] .iter() .for_each(|int_set| { int_set.iter().for_each(|int| { test_sets(ALL, &|v: f64| pow(-v, *int), &|v: f64| { pow(-1.0, *int) * pow(v, *int) }); }) }); // Negative base (imaginary results): // (-anything except 0 and Infinity ^ non-integer should be NAN) &NEG[1..(NEG.len() - 1)].iter().for_each(|set| { set.iter().for_each(|val| { test_sets(&ALL[3..7], &|v: f64| pow(*val, v), &|_| NAN); }) }); } #[test] fn normal_cases() { assert_eq!(pow(2.0, 20.0), (1 << 20) as f64); assert_eq!(pow(-1.0, 9.0), -1.0); assert!(pow(-1.0, 2.2).is_nan()); assert!(pow(-1.0, -1.14).is_nan()); } } libm-0.2.1/src/math/powf.rs010066400017500001750000000234371351140326100137260ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_powf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{fabsf, scalbnf, sqrtf}; const BP: [f32; 2] = [1.0, 1.5]; const DP_H: [f32; 2] = [0.0, 5.84960938e-01]; /* 0x3f15c000 */ const DP_L: [f32; 2] = [0.0, 1.56322085e-06]; /* 0x35d1cfdc */ const TWO24: f32 = 16777216.0; /* 0x4b800000 */ const HUGE: f32 = 1.0e30; const TINY: f32 = 1.0e-30; const L1: f32 = 6.0000002384e-01; /* 0x3f19999a */ const L2: f32 = 4.2857143283e-01; /* 0x3edb6db7 */ const L3: f32 = 3.3333334327e-01; /* 0x3eaaaaab */ const L4: f32 = 2.7272811532e-01; /* 0x3e8ba305 */ const L5: f32 = 2.3066075146e-01; /* 0x3e6c3255 */ const L6: f32 = 2.0697501302e-01; /* 0x3e53f142 */ const P1: f32 = 1.6666667163e-01; /* 0x3e2aaaab */ const P2: f32 = -2.7777778450e-03; /* 0xbb360b61 */ const P3: f32 = 6.6137559770e-05; /* 0x388ab355 */ const P4: f32 = -1.6533901999e-06; /* 0xb5ddea0e */ const P5: f32 = 4.1381369442e-08; /* 0x3331bb4c */ const LG2: f32 = 6.9314718246e-01; /* 0x3f317218 */ const LG2_H: f32 = 6.93145752e-01; /* 0x3f317200 */ const LG2_L: f32 = 1.42860654e-06; /* 0x35bfbe8c */ const OVT: f32 = 4.2995665694e-08; /* -(128-log2(ovfl+.5ulp)) */ const CP: f32 = 9.6179670095e-01; /* 0x3f76384f =2/(3ln2) */ const CP_H: f32 = 9.6191406250e-01; /* 0x3f764000 =12b cp */ const CP_L: f32 = -1.1736857402e-04; /* 0xb8f623c6 =tail of cp_h */ const IVLN2: f32 = 1.4426950216e+00; const IVLN2_H: f32 = 1.4426879883e+00; const IVLN2_L: f32 = 7.0526075433e-06; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn powf(x: f32, y: f32) -> f32 { let mut z: f32; let mut ax: f32; let z_h: f32; let z_l: f32; let mut p_h: f32; let mut p_l: f32; let y1: f32; let mut t1: f32; let t2: f32; let mut r: f32; let s: f32; let mut sn: f32; let mut t: f32; let mut u: f32; let mut v: f32; let mut w: f32; let i: i32; let mut j: i32; let mut k: i32; let mut yisint: i32; let mut n: i32; let hx: i32; let hy: i32; let mut ix: i32; let iy: i32; let mut is: i32; hx = x.to_bits() as i32; hy = y.to_bits() as i32; ix = hx & 0x7fffffff; iy = hy & 0x7fffffff; /* x**0 = 1, even if x is NaN */ if iy == 0 { return 1.0; } /* 1**y = 1, even if y is NaN */ if hx == 0x3f800000 { return 1.0; } /* NaN if either arg is NaN */ if ix > 0x7f800000 || iy > 0x7f800000 { return x + y; } /* determine if y is an odd int when x < 0 * yisint = 0 ... y is not an integer * yisint = 1 ... y is an odd int * yisint = 2 ... y is an even int */ yisint = 0; if hx < 0 { if iy >= 0x4b800000 { yisint = 2; /* even integer y */ } else if iy >= 0x3f800000 { k = (iy >> 23) - 0x7f; /* exponent */ j = iy >> (23 - k); if (j << (23 - k)) == iy { yisint = 2 - (j & 1); } } } /* special value of y */ if iy == 0x7f800000 { /* y is +-inf */ if ix == 0x3f800000 { /* (-1)**+-inf is 1 */ return 1.0; } else if ix > 0x3f800000 { /* (|x|>1)**+-inf = inf,0 */ return if hy >= 0 { y } else { 0.0 }; } else { /* (|x|<1)**+-inf = 0,inf */ return if hy >= 0 { 0.0 } else { -y }; } } if iy == 0x3f800000 { /* y is +-1 */ return if hy >= 0 { x } else { 1.0 / x }; } if hy == 0x40000000 { /* y is 2 */ return x * x; } if hy == 0x3f000000 /* y is 0.5 */ && hx >= 0 { /* x >= +0 */ return sqrtf(x); } ax = fabsf(x); /* special value of x */ if ix == 0x7f800000 || ix == 0 || ix == 0x3f800000 { /* x is +-0,+-inf,+-1 */ z = ax; if hy < 0 { /* z = (1/|x|) */ z = 1.0 / z; } if hx < 0 { if ((ix - 0x3f800000) | yisint) == 0 { z = (z - z) / (z - z); /* (-1)**non-int is NaN */ } else if yisint == 1 { z = -z; /* (x<0)**odd = -(|x|**odd) */ } } return z; } sn = 1.0; /* sign of result */ if hx < 0 { if yisint == 0 { /* (x<0)**(non-int) is NaN */ return (x - x) / (x - x); } if yisint == 1 { /* (x<0)**(odd int) */ sn = -1.0; } } /* |y| is HUGE */ if iy > 0x4d000000 { /* if |y| > 2**27 */ /* over/underflow if x is not close to one */ if ix < 0x3f7ffff8 { return if hy < 0 { sn * HUGE * HUGE } else { sn * TINY * TINY }; } if ix > 0x3f800007 { return if hy > 0 { sn * HUGE * HUGE } else { sn * TINY * TINY }; } /* now |1-x| is TINY <= 2**-20, suffice to compute log(x) by x-x^2/2+x^3/3-x^4/4 */ t = ax - 1.; /* t has 20 trailing zeros */ w = (t * t) * (0.5 - t * (0.333333333333 - t * 0.25)); u = IVLN2_H * t; /* IVLN2_H has 16 sig. bits */ v = t * IVLN2_L - w * IVLN2; t1 = u + v; is = t1.to_bits() as i32; t1 = f32::from_bits(is as u32 & 0xfffff000); t2 = v - (t1 - u); } else { let mut s2: f32; let mut s_h: f32; let s_l: f32; let mut t_h: f32; let mut t_l: f32; n = 0; /* take care subnormal number */ if ix < 0x00800000 { ax *= TWO24; n -= 24; ix = ax.to_bits() as i32; } n += ((ix) >> 23) - 0x7f; j = ix & 0x007fffff; /* determine interval */ ix = j | 0x3f800000; /* normalize ix */ if j <= 0x1cc471 { /* |x|> 1) & 0xfffff000) | 0x20000000) as i32; t_h = f32::from_bits(is as u32 + 0x00400000 + ((k as u32) << 21)); t_l = ax - (t_h - BP[k as usize]); s_l = v * ((u - s_h * t_h) - s_h * t_l); /* compute log(ax) */ s2 = s * s; r = s2 * s2 * (L1 + s2 * (L2 + s2 * (L3 + s2 * (L4 + s2 * (L5 + s2 * L6))))); r += s_l * (s_h + s); s2 = s_h * s_h; t_h = 3.0 + s2 + r; is = t_h.to_bits() as i32; t_h = f32::from_bits(is as u32 & 0xfffff000); t_l = r - ((t_h - 3.0) - s2); /* u+v = s*(1+...) */ u = s_h * t_h; v = s_l * t_h + t_l * s; /* 2/(3log2)*(s+...) */ p_h = u + v; is = p_h.to_bits() as i32; p_h = f32::from_bits(is as u32 & 0xfffff000); p_l = v - (p_h - u); z_h = CP_H * p_h; /* cp_h+cp_l = 2/(3*log2) */ z_l = CP_L * p_h + p_l * CP + DP_L[k as usize]; /* log2(ax) = (s+..)*2/(3*log2) = n + dp_h + z_h + z_l */ t = n as f32; t1 = ((z_h + z_l) + DP_H[k as usize]) + t; is = t1.to_bits() as i32; t1 = f32::from_bits(is as u32 & 0xfffff000); t2 = z_l - (((t1 - t) - DP_H[k as usize]) - z_h); }; /* split up y into y1+y2 and compute (y1+y2)*(t1+t2) */ is = y.to_bits() as i32; y1 = f32::from_bits(is as u32 & 0xfffff000); p_l = (y - y1) * t1 + y * t2; p_h = y1 * t1; z = p_l + p_h; j = z.to_bits() as i32; if j > 0x43000000 { /* if z > 128 */ return sn * HUGE * HUGE; /* overflow */ } else if j == 0x43000000 { /* if z == 128 */ if p_l + OVT > z - p_h { return sn * HUGE * HUGE; /* overflow */ } } else if (j & 0x7fffffff) > 0x43160000 { /* z < -150 */ // FIXME: check should be (uint32_t)j > 0xc3160000 return sn * TINY * TINY; /* underflow */ } else if j as u32 == 0xc3160000 /* z == -150 */ && p_l <= z - p_h { return sn * TINY * TINY; /* underflow */ } /* * compute 2**(p_h+p_l) */ i = j & 0x7fffffff; k = (i >> 23) - 0x7f; n = 0; if i > 0x3f000000 { /* if |z| > 0.5, set n = [z+0.5] */ n = j + (0x00800000 >> (k + 1)); k = ((n & 0x7fffffff) >> 23) - 0x7f; /* new k for n */ t = f32::from_bits(n as u32 & !(0x007fffff >> k)); n = ((n & 0x007fffff) | 0x00800000) >> (23 - k); if j < 0 { n = -n; } p_h -= t; } t = p_l + p_h; is = t.to_bits() as i32; t = f32::from_bits(is as u32 & 0xffff8000); u = t * LG2_H; v = (p_l - (t - p_h)) * LG2 + t * LG2_L; z = u + v; w = v - (z - u); t = z * z; t1 = z - t * (P1 + t * (P2 + t * (P3 + t * (P4 + t * P5)))); r = (z * t1) / (t1 - 2.0) - (w + z * w); z = 1.0 - (r - z); j = z.to_bits() as i32; j += n << 23; if (j >> 23) <= 0 { /* subnormal output */ z = scalbnf(z, n); } else { z = f32::from_bits(j as u32); } sn * z } libm-0.2.1/src/math/rem_pio2.rs010066400017500001750000000155211351140332400144620ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2.c // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunPro, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== // // Optimized by Bruce D. Evans. */ use super::rem_pio2_large; // #if FLT_EVAL_METHOD==0 || FLT_EVAL_METHOD==1 // #define EPS DBL_EPSILON const EPS: f64 = 2.2204460492503131e-16; // #elif FLT_EVAL_METHOD==2 // #define EPS LDBL_EPSILON // #endif // TODO: Support FLT_EVAL_METHOD? const TO_INT: f64 = 1.5 / EPS; /// 53 bits of 2/pi const INV_PIO2: f64 = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ /// first 33 bits of pi/2 const PIO2_1: f64 = 1.57079632673412561417e+00; /* 0x3FF921FB, 0x54400000 */ /// pi/2 - PIO2_1 const PIO2_1T: f64 = 6.07710050650619224932e-11; /* 0x3DD0B461, 0x1A626331 */ /// second 33 bits of pi/2 const PIO2_2: f64 = 6.07710050630396597660e-11; /* 0x3DD0B461, 0x1A600000 */ /// pi/2 - (PIO2_1+PIO2_2) const PIO2_2T: f64 = 2.02226624879595063154e-21; /* 0x3BA3198A, 0x2E037073 */ /// third 33 bits of pi/2 const PIO2_3: f64 = 2.02226624871116645580e-21; /* 0x3BA3198A, 0x2E000000 */ /// pi/2 - (PIO2_1+PIO2_2+PIO2_3) const PIO2_3T: f64 = 8.47842766036889956997e-32; /* 0x397B839A, 0x252049C1 */ // return the remainder of x rem pi/2 in y[0]+y[1] // use rem_pio2_large() for large x // // caller must handle the case when reduction is not needed: |x| ~<= pi/4 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn rem_pio2(x: f64) -> (i32, f64, f64) { let x1p24 = f64::from_bits(0x4170000000000000); let sign = (f64::to_bits(x) >> 63) as i32; let ix = (f64::to_bits(x) >> 32) as u32 & 0x7fffffff; fn medium(x: f64, ix: u32) -> (i32, f64, f64) { /* rint(x/(pi/2)), Assume round-to-nearest. */ let f_n = x as f64 * INV_PIO2 + TO_INT - TO_INT; let n = f_n as i32; let mut r = x - f_n * PIO2_1; let mut w = f_n * PIO2_1T; /* 1st round, good to 85 bits */ let mut y0 = r - w; let ui = f64::to_bits(y0); let ey = (ui >> 52) as i32 & 0x7ff; let ex = (ix >> 20) as i32; if ex - ey > 16 { /* 2nd round, good to 118 bits */ let t = r; w = f_n * PIO2_2; r = t - w; w = f_n * PIO2_2T - ((t - r) - w); y0 = r - w; let ey = (f64::to_bits(y0) >> 52) as i32 & 0x7ff; if ex - ey > 49 { /* 3rd round, good to 151 bits, covers all cases */ let t = r; w = f_n * PIO2_3; r = t - w; w = f_n * PIO2_3T - ((t - r) - w); y0 = r - w; } } let y1 = (r - y0) - w; (n, y0, y1) } if ix <= 0x400f6a7a { /* |x| ~<= 5pi/4 */ if (ix & 0xfffff) == 0x921fb { /* |x| ~= pi/2 or 2pi/2 */ return medium(x, ix); /* cancellation -- use medium case */ } if ix <= 0x4002d97c { /* |x| ~<= 3pi/4 */ if sign == 0 { let z = x - PIO2_1; /* one round good to 85 bits */ let y0 = z - PIO2_1T; let y1 = (z - y0) - PIO2_1T; return (1, y0, y1); } else { let z = x + PIO2_1; let y0 = z + PIO2_1T; let y1 = (z - y0) + PIO2_1T; return (-1, y0, y1); } } else if sign == 0 { let z = x - 2.0 * PIO2_1; let y0 = z - 2.0 * PIO2_1T; let y1 = (z - y0) - 2.0 * PIO2_1T; return (2, y0, y1); } else { let z = x + 2.0 * PIO2_1; let y0 = z + 2.0 * PIO2_1T; let y1 = (z - y0) + 2.0 * PIO2_1T; return (-2, y0, y1); } } if ix <= 0x401c463b { /* |x| ~<= 9pi/4 */ if ix <= 0x4015fdbc { /* |x| ~<= 7pi/4 */ if ix == 0x4012d97c { /* |x| ~= 3pi/2 */ return medium(x, ix); } if sign == 0 { let z = x - 3.0 * PIO2_1; let y0 = z - 3.0 * PIO2_1T; let y1 = (z - y0) - 3.0 * PIO2_1T; return (3, y0, y1); } else { let z = x + 3.0 * PIO2_1; let y0 = z + 3.0 * PIO2_1T; let y1 = (z - y0) + 3.0 * PIO2_1T; return (-3, y0, y1); } } else { if ix == 0x401921fb { /* |x| ~= 4pi/2 */ return medium(x, ix); } if sign == 0 { let z = x - 4.0 * PIO2_1; let y0 = z - 4.0 * PIO2_1T; let y1 = (z - y0) - 4.0 * PIO2_1T; return (4, y0, y1); } else { let z = x + 4.0 * PIO2_1; let y0 = z + 4.0 * PIO2_1T; let y1 = (z - y0) + 4.0 * PIO2_1T; return (-4, y0, y1); } } } if ix < 0x413921fb { /* |x| ~< 2^20*(pi/2), medium size */ return medium(x, ix); } /* * all other (large) arguments */ if ix >= 0x7ff00000 { /* x is inf or NaN */ let y0 = x - x; let y1 = y0; return (0, y0, y1); } /* set z = scalbn(|x|,-ilogb(x)+23) */ let mut ui = f64::to_bits(x); ui &= (!1) >> 12; ui |= (0x3ff + 23) << 52; let mut z = f64::from_bits(ui); let mut tx = [0.0; 3]; for i in 0..2 { tx[i] = z as i32 as f64; z = (z - tx[i]) * x1p24; } tx[2] = z; /* skip zero terms, first term is non-zero */ let mut i = 2; while i != 0 && tx[i] == 0.0 { i -= 1; } let mut ty = [0.0; 3]; let n = rem_pio2_large(&tx[..=i], &mut ty, ((ix as i32) >> 20) - (0x3ff + 23), 1); if sign != 0 { return (-n, -ty[0], -ty[1]); } (n, ty[0], ty[1]) } #[cfg(test)] mod tests { use super::rem_pio2; #[test] fn test_near_pi() { assert_eq!( rem_pio2(3.141592025756836), (2, -6.278329573009626e-7, -2.1125998133974653e-23) ); assert_eq!( rem_pio2(3.141592033207416), (2, -6.20382377148128e-7, -2.1125998133974653e-23) ); assert_eq!( rem_pio2(3.141592144966125), (2, -5.086236681942706e-7, -2.1125998133974653e-23) ); assert_eq!( rem_pio2(3.141592979431152), (2, 3.2584135866119817e-7, -2.1125998133974653e-23) ); } #[test] fn test_overflow_b9b847() { let _ = rem_pio2(-3054214.5490637687); } #[test] fn test_overflow_4747b9() { let _ = rem_pio2(917340800458.2274); } } libm-0.2.1/src/math/rem_pio2_large.rs010066400017500001750000000475311353572366000156600ustar0000000000000000#![allow(unused_unsafe)] /* origin: FreeBSD /usr/src/lib/msun/src/k_rem_pio2.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::floor; use super::scalbn; // initial value for jk const INIT_JK: [usize; 4] = [3, 4, 4, 6]; // Table of constants for 2/pi, 396 Hex digits (476 decimal) of 2/pi // // integer array, contains the (24*i)-th to (24*i+23)-th // bit of 2/pi after binary point. The corresponding // floating value is // // ipio2[i] * 2^(-24(i+1)). // // NB: This table must have at least (e0-3)/24 + jk terms. // For quad precision (e0 <= 16360, jk = 6), this is 686. #[cfg(target_pointer_width = "32")] const IPIO2: [i32; 66] = [ 0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, 0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, 0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, 0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, 0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, 0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, 0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, 0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, 0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, 0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, 0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, ]; #[cfg(target_pointer_width = "64")] const IPIO2: [i32; 690] = [ 0xA2F983, 0x6E4E44, 0x1529FC, 0x2757D1, 0xF534DD, 0xC0DB62, 0x95993C, 0x439041, 0xFE5163, 0xABDEBB, 0xC561B7, 0x246E3A, 0x424DD2, 0xE00649, 0x2EEA09, 0xD1921C, 0xFE1DEB, 0x1CB129, 0xA73EE8, 0x8235F5, 0x2EBB44, 0x84E99C, 0x7026B4, 0x5F7E41, 0x3991D6, 0x398353, 0x39F49C, 0x845F8B, 0xBDF928, 0x3B1FF8, 0x97FFDE, 0x05980F, 0xEF2F11, 0x8B5A0A, 0x6D1F6D, 0x367ECF, 0x27CB09, 0xB74F46, 0x3F669E, 0x5FEA2D, 0x7527BA, 0xC7EBE5, 0xF17B3D, 0x0739F7, 0x8A5292, 0xEA6BFB, 0x5FB11F, 0x8D5D08, 0x560330, 0x46FC7B, 0x6BABF0, 0xCFBC20, 0x9AF436, 0x1DA9E3, 0x91615E, 0xE61B08, 0x659985, 0x5F14A0, 0x68408D, 0xFFD880, 0x4D7327, 0x310606, 0x1556CA, 0x73A8C9, 0x60E27B, 0xC08C6B, 0x47C419, 0xC367CD, 0xDCE809, 0x2A8359, 0xC4768B, 0x961CA6, 0xDDAF44, 0xD15719, 0x053EA5, 0xFF0705, 0x3F7E33, 0xE832C2, 0xDE4F98, 0x327DBB, 0xC33D26, 0xEF6B1E, 0x5EF89F, 0x3A1F35, 0xCAF27F, 0x1D87F1, 0x21907C, 0x7C246A, 0xFA6ED5, 0x772D30, 0x433B15, 0xC614B5, 0x9D19C3, 0xC2C4AD, 0x414D2C, 0x5D000C, 0x467D86, 0x2D71E3, 0x9AC69B, 0x006233, 0x7CD2B4, 0x97A7B4, 0xD55537, 0xF63ED7, 0x1810A3, 0xFC764D, 0x2A9D64, 0xABD770, 0xF87C63, 0x57B07A, 0xE71517, 0x5649C0, 0xD9D63B, 0x3884A7, 0xCB2324, 0x778AD6, 0x23545A, 0xB91F00, 0x1B0AF1, 0xDFCE19, 0xFF319F, 0x6A1E66, 0x615799, 0x47FBAC, 0xD87F7E, 0xB76522, 0x89E832, 0x60BFE6, 0xCDC4EF, 0x09366C, 0xD43F5D, 0xD7DE16, 0xDE3B58, 0x929BDE, 0x2822D2, 0xE88628, 0x4D58E2, 0x32CAC6, 0x16E308, 0xCB7DE0, 0x50C017, 0xA71DF3, 0x5BE018, 0x34132E, 0x621283, 0x014883, 0x5B8EF5, 0x7FB0AD, 0xF2E91E, 0x434A48, 0xD36710, 0xD8DDAA, 0x425FAE, 0xCE616A, 0xA4280A, 0xB499D3, 0xF2A606, 0x7F775C, 0x83C2A3, 0x883C61, 0x78738A, 0x5A8CAF, 0xBDD76F, 0x63A62D, 0xCBBFF4, 0xEF818D, 0x67C126, 0x45CA55, 0x36D9CA, 0xD2A828, 0x8D61C2, 0x77C912, 0x142604, 0x9B4612, 0xC459C4, 0x44C5C8, 0x91B24D, 0xF31700, 0xAD43D4, 0xE54929, 0x10D5FD, 0xFCBE00, 0xCC941E, 0xEECE70, 0xF53E13, 0x80F1EC, 0xC3E7B3, 0x28F8C7, 0x940593, 0x3E71C1, 0xB3092E, 0xF3450B, 0x9C1288, 0x7B20AB, 0x9FB52E, 0xC29247, 0x2F327B, 0x6D550C, 0x90A772, 0x1FE76B, 0x96CB31, 0x4A1679, 0xE27941, 0x89DFF4, 0x9794E8, 0x84E6E2, 0x973199, 0x6BED88, 0x365F5F, 0x0EFDBB, 0xB49A48, 0x6CA467, 0x427271, 0x325D8D, 0xB8159F, 0x09E5BC, 0x25318D, 0x3974F7, 0x1C0530, 0x010C0D, 0x68084B, 0x58EE2C, 0x90AA47, 0x02E774, 0x24D6BD, 0xA67DF7, 0x72486E, 0xEF169F, 0xA6948E, 0xF691B4, 0x5153D1, 0xF20ACF, 0x339820, 0x7E4BF5, 0x6863B2, 0x5F3EDD, 0x035D40, 0x7F8985, 0x295255, 0xC06437, 0x10D86D, 0x324832, 0x754C5B, 0xD4714E, 0x6E5445, 0xC1090B, 0x69F52A, 0xD56614, 0x9D0727, 0x50045D, 0xDB3BB4, 0xC576EA, 0x17F987, 0x7D6B49, 0xBA271D, 0x296996, 0xACCCC6, 0x5414AD, 0x6AE290, 0x89D988, 0x50722C, 0xBEA404, 0x940777, 0x7030F3, 0x27FC00, 0xA871EA, 0x49C266, 0x3DE064, 0x83DD97, 0x973FA3, 0xFD9443, 0x8C860D, 0xDE4131, 0x9D3992, 0x8C70DD, 0xE7B717, 0x3BDF08, 0x2B3715, 0xA0805C, 0x93805A, 0x921110, 0xD8E80F, 0xAF806C, 0x4BFFDB, 0x0F9038, 0x761859, 0x15A562, 0xBBCB61, 0xB989C7, 0xBD4010, 0x04F2D2, 0x277549, 0xF6B6EB, 0xBB22DB, 0xAA140A, 0x2F2689, 0x768364, 0x333B09, 0x1A940E, 0xAA3A51, 0xC2A31D, 0xAEEDAF, 0x12265C, 0x4DC26D, 0x9C7A2D, 0x9756C0, 0x833F03, 0xF6F009, 0x8C402B, 0x99316D, 0x07B439, 0x15200C, 0x5BC3D8, 0xC492F5, 0x4BADC6, 0xA5CA4E, 0xCD37A7, 0x36A9E6, 0x9492AB, 0x6842DD, 0xDE6319, 0xEF8C76, 0x528B68, 0x37DBFC, 0xABA1AE, 0x3115DF, 0xA1AE00, 0xDAFB0C, 0x664D64, 0xB705ED, 0x306529, 0xBF5657, 0x3AFF47, 0xB9F96A, 0xF3BE75, 0xDF9328, 0x3080AB, 0xF68C66, 0x15CB04, 0x0622FA, 0x1DE4D9, 0xA4B33D, 0x8F1B57, 0x09CD36, 0xE9424E, 0xA4BE13, 0xB52333, 0x1AAAF0, 0xA8654F, 0xA5C1D2, 0x0F3F0B, 0xCD785B, 0x76F923, 0x048B7B, 0x721789, 0x53A6C6, 0xE26E6F, 0x00EBEF, 0x584A9B, 0xB7DAC4, 0xBA66AA, 0xCFCF76, 0x1D02D1, 0x2DF1B1, 0xC1998C, 0x77ADC3, 0xDA4886, 0xA05DF7, 0xF480C6, 0x2FF0AC, 0x9AECDD, 0xBC5C3F, 0x6DDED0, 0x1FC790, 0xB6DB2A, 0x3A25A3, 0x9AAF00, 0x9353AD, 0x0457B6, 0xB42D29, 0x7E804B, 0xA707DA, 0x0EAA76, 0xA1597B, 0x2A1216, 0x2DB7DC, 0xFDE5FA, 0xFEDB89, 0xFDBE89, 0x6C76E4, 0xFCA906, 0x70803E, 0x156E85, 0xFF87FD, 0x073E28, 0x336761, 0x86182A, 0xEABD4D, 0xAFE7B3, 0x6E6D8F, 0x396795, 0x5BBF31, 0x48D784, 0x16DF30, 0x432DC7, 0x356125, 0xCE70C9, 0xB8CB30, 0xFD6CBF, 0xA200A4, 0xE46C05, 0xA0DD5A, 0x476F21, 0xD21262, 0x845CB9, 0x496170, 0xE0566B, 0x015299, 0x375550, 0xB7D51E, 0xC4F133, 0x5F6E13, 0xE4305D, 0xA92E85, 0xC3B21D, 0x3632A1, 0xA4B708, 0xD4B1EA, 0x21F716, 0xE4698F, 0x77FF27, 0x80030C, 0x2D408D, 0xA0CD4F, 0x99A520, 0xD3A2B3, 0x0A5D2F, 0x42F9B4, 0xCBDA11, 0xD0BE7D, 0xC1DB9B, 0xBD17AB, 0x81A2CA, 0x5C6A08, 0x17552E, 0x550027, 0xF0147F, 0x8607E1, 0x640B14, 0x8D4196, 0xDEBE87, 0x2AFDDA, 0xB6256B, 0x34897B, 0xFEF305, 0x9EBFB9, 0x4F6A68, 0xA82A4A, 0x5AC44F, 0xBCF82D, 0x985AD7, 0x95C7F4, 0x8D4D0D, 0xA63A20, 0x5F57A4, 0xB13F14, 0x953880, 0x0120CC, 0x86DD71, 0xB6DEC9, 0xF560BF, 0x11654D, 0x6B0701, 0xACB08C, 0xD0C0B2, 0x485551, 0x0EFB1E, 0xC37295, 0x3B06A3, 0x3540C0, 0x7BDC06, 0xCC45E0, 0xFA294E, 0xC8CAD6, 0x41F3E8, 0xDE647C, 0xD8649B, 0x31BED9, 0xC397A4, 0xD45877, 0xC5E369, 0x13DAF0, 0x3C3ABA, 0x461846, 0x5F7555, 0xF5BDD2, 0xC6926E, 0x5D2EAC, 0xED440E, 0x423E1C, 0x87C461, 0xE9FD29, 0xF3D6E7, 0xCA7C22, 0x35916F, 0xC5E008, 0x8DD7FF, 0xE26A6E, 0xC6FDB0, 0xC10893, 0x745D7C, 0xB2AD6B, 0x9D6ECD, 0x7B723E, 0x6A11C6, 0xA9CFF7, 0xDF7329, 0xBAC9B5, 0x5100B7, 0x0DB2E2, 0x24BA74, 0x607DE5, 0x8AD874, 0x2C150D, 0x0C1881, 0x94667E, 0x162901, 0x767A9F, 0xBEFDFD, 0xEF4556, 0x367ED9, 0x13D9EC, 0xB9BA8B, 0xFC97C4, 0x27A831, 0xC36EF1, 0x36C594, 0x56A8D8, 0xB5A8B4, 0x0ECCCF, 0x2D8912, 0x34576F, 0x89562C, 0xE3CE99, 0xB920D6, 0xAA5E6B, 0x9C2A3E, 0xCC5F11, 0x4A0BFD, 0xFBF4E1, 0x6D3B8E, 0x2C86E2, 0x84D4E9, 0xA9B4FC, 0xD1EEEF, 0xC9352E, 0x61392F, 0x442138, 0xC8D91B, 0x0AFC81, 0x6A4AFB, 0xD81C2F, 0x84B453, 0x8C994E, 0xCC2254, 0xDC552A, 0xD6C6C0, 0x96190B, 0xB8701A, 0x649569, 0x605A26, 0xEE523F, 0x0F117F, 0x11B5F4, 0xF5CBFC, 0x2DBC34, 0xEEBC34, 0xCC5DE8, 0x605EDD, 0x9B8E67, 0xEF3392, 0xB817C9, 0x9B5861, 0xBC57E1, 0xC68351, 0x103ED8, 0x4871DD, 0xDD1C2D, 0xA118AF, 0x462C21, 0xD7F359, 0x987AD9, 0xC0549E, 0xFA864F, 0xFC0656, 0xAE79E5, 0x362289, 0x22AD38, 0xDC9367, 0xAAE855, 0x382682, 0x9BE7CA, 0xA40D51, 0xB13399, 0x0ED7A9, 0x480569, 0xF0B265, 0xA7887F, 0x974C88, 0x36D1F9, 0xB39221, 0x4A827B, 0x21CF98, 0xDC9F40, 0x5547DC, 0x3A74E1, 0x42EB67, 0xDF9DFE, 0x5FD45E, 0xA4677B, 0x7AACBA, 0xA2F655, 0x23882B, 0x55BA41, 0x086E59, 0x862A21, 0x834739, 0xE6E389, 0xD49EE5, 0x40FB49, 0xE956FF, 0xCA0F1C, 0x8A59C5, 0x2BFA94, 0xC5C1D3, 0xCFC50F, 0xAE5ADB, 0x86C547, 0x624385, 0x3B8621, 0x94792C, 0x876110, 0x7B4C2A, 0x1A2C80, 0x12BF43, 0x902688, 0x893C78, 0xE4C4A8, 0x7BDBE5, 0xC23AC4, 0xEAF426, 0x8A67F7, 0xBF920D, 0x2BA365, 0xB1933D, 0x0B7CBD, 0xDC51A4, 0x63DD27, 0xDDE169, 0x19949A, 0x9529A8, 0x28CE68, 0xB4ED09, 0x209F44, 0xCA984E, 0x638270, 0x237C7E, 0x32B90F, 0x8EF5A7, 0xE75614, 0x08F121, 0x2A9DB5, 0x4D7E6F, 0x5119A5, 0xABF9B5, 0xD6DF82, 0x61DD96, 0x023616, 0x9F3AC4, 0xA1A283, 0x6DED72, 0x7A8D39, 0xA9B882, 0x5C326B, 0x5B2746, 0xED3400, 0x7700D2, 0x55F4FC, 0x4D5901, 0x8071E0, ]; const PIO2: [f64; 8] = [ 1.57079625129699707031e+00, /* 0x3FF921FB, 0x40000000 */ 7.54978941586159635335e-08, /* 0x3E74442D, 0x00000000 */ 5.39030252995776476554e-15, /* 0x3CF84698, 0x80000000 */ 3.28200341580791294123e-22, /* 0x3B78CC51, 0x60000000 */ 1.27065575308067607349e-29, /* 0x39F01B83, 0x80000000 */ 1.22933308981111328932e-36, /* 0x387A2520, 0x40000000 */ 2.73370053816464559624e-44, /* 0x36E38222, 0x80000000 */ 2.16741683877804819444e-51, /* 0x3569F31D, 0x00000000 */ ]; // fn rem_pio2_large(x : &[f64], y : &mut [f64], e0 : i32, prec : usize) -> i32 // // Input parameters: // x[] The input value (must be positive) is broken into nx // pieces of 24-bit integers in double precision format. // x[i] will be the i-th 24 bit of x. The scaled exponent // of x[0] is given in input parameter e0 (i.e., x[0]*2^e0 // match x's up to 24 bits. // // Example of breaking a double positive z into x[0]+x[1]+x[2]: // e0 = ilogb(z)-23 // z = scalbn(z,-e0) // for i = 0,1,2 // x[i] = floor(z) // z = (z-x[i])*2**24 // // y[] ouput result in an array of double precision numbers. // The dimension of y[] is: // 24-bit precision 1 // 53-bit precision 2 // 64-bit precision 2 // 113-bit precision 3 // The actual value is the sum of them. Thus for 113-bit // precison, one may have to do something like: // // long double t,w,r_head, r_tail; // t = (long double)y[2] + (long double)y[1]; // w = (long double)y[0]; // r_head = t+w; // r_tail = w - (r_head - t); // // e0 The exponent of x[0]. Must be <= 16360 or you need to // expand the ipio2 table. // // prec an integer indicating the precision: // 0 24 bits (single) // 1 53 bits (double) // 2 64 bits (extended) // 3 113 bits (quad) // // Here is the description of some local variables: // // jk jk+1 is the initial number of terms of ipio2[] needed // in the computation. The minimum and recommended value // for jk is 3,4,4,6 for single, double, extended, and quad. // jk+1 must be 2 larger than you might expect so that our // recomputation test works. (Up to 24 bits in the integer // part (the 24 bits of it that we compute) and 23 bits in // the fraction part may be lost to cancelation before we // recompute.) // // jz local integer variable indicating the number of // terms of ipio2[] used. // // jx nx - 1 // // jv index for pointing to the suitable ipio2[] for the // computation. In general, we want // ( 2^e0*x[0] * ipio2[jv-1]*2^(-24jv) )/8 // is an integer. Thus // e0-3-24*jv >= 0 or (e0-3)/24 >= jv // Hence jv = max(0,(e0-3)/24). // // jp jp+1 is the number of terms in PIo2[] needed, jp = jk. // // q[] double array with integral value, representing the // 24-bits chunk of the product of x and 2/pi. // // q0 the corresponding exponent of q[0]. Note that the // exponent for q[i] would be q0-24*i. // // PIo2[] double precision array, obtained by cutting pi/2 // into 24 bits chunks. // // f[] ipio2[] in floating point // // iq[] integer array by breaking up q[] in 24-bits chunk. // // fq[] final product of x*(2/pi) in fq[0],..,fq[jk] // // ih integer. If >0 it indicates q[] is >= 0.5, hence // it also indicates the *sign* of the result. /// Return the last three digits of N with y = x - N*pi/2 /// so that |y| < pi/2. /// /// The method is to compute the integer (mod 8) and fraction parts of /// (2/pi)*x without doing the full multiplication. In general we /// skip the part of the product that are known to be a huge integer ( /// more accurately, = 0 mod 8 ). Thus the number of operations are /// independent of the exponent of the input. #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn rem_pio2_large(x: &[f64], y: &mut [f64], e0: i32, prec: usize) -> i32 { let x1p24 = f64::from_bits(0x4170000000000000); // 0x1p24 === 2 ^ 24 let x1p_24 = f64::from_bits(0x3e70000000000000); // 0x1p_24 === 2 ^ (-24) #[cfg(all(target_pointer_width = "64", feature = "checked"))] assert!(e0 <= 16360); let nx = x.len(); let mut fw: f64; let mut n: i32; let mut ih: i32; let mut z: f64; let mut f: [f64; 20] = [0.; 20]; let mut fq: [f64; 20] = [0.; 20]; let mut q: [f64; 20] = [0.; 20]; let mut iq: [i32; 20] = [0; 20]; /* initialize jk*/ let jk = INIT_JK[prec]; let jp = jk; /* determine jx,jv,q0, note that 3>q0 */ let jx = nx - 1; let mut jv = (e0 - 3) / 24; if jv < 0 { jv = 0; } let mut q0 = e0 - 24 * (jv + 1); let jv = jv as usize; /* set up f[0] to f[jx+jk] where f[jx+jk] = ipio2[jv+jk] */ let mut j = (jv as i32) - (jx as i32); let m = jx + jk; for i in 0..=m { i!(f, i, =, if j < 0 { 0. } else { i!(IPIO2, j as usize) as f64 }); j += 1; } /* compute q[0],q[1],...q[jk] */ for i in 0..=jk { fw = 0f64; for j in 0..=jx { fw += i!(x, j) * i!(f, jx + i - j); } i!(q, i, =, fw); } let mut jz = jk; 'recompute: loop { /* distill q[] into iq[] reversingly */ let mut i = 0i32; z = i!(q, jz); for j in (1..=jz).rev() { fw = (x1p_24 * z) as i32 as f64; i!(iq, i as usize, =, (z - x1p24 * fw) as i32); z = i!(q, j - 1) + fw; i += 1; } /* compute n */ z = scalbn(z, q0); /* actual value of z */ z -= 8.0 * floor(z * 0.125); /* trim off integer >= 8 */ n = z as i32; z -= n as f64; ih = 0; if q0 > 0 { /* need iq[jz-1] to determine n */ i = i!(iq, jz - 1) >> (24 - q0); n += i; i!(iq, jz - 1, -=, i << (24 - q0)); ih = i!(iq, jz - 1) >> (23 - q0); } else if q0 == 0 { ih = i!(iq, jz - 1) >> 23; } else if z >= 0.5 { ih = 2; } if ih > 0 { /* q > 0.5 */ n += 1; let mut carry = 0i32; for i in 0..jz { /* compute 1-q */ let j = i!(iq, i); if carry == 0 { if j != 0 { carry = 1; i!(iq, i, =, 0x1000000 - j); } } else { i!(iq, i, =, 0xffffff - j); } } if q0 > 0 { /* rare case: chance is 1 in 12 */ match q0 { 1 => { i!(iq, jz - 1, &=, 0x7fffff); } 2 => { i!(iq, jz - 1, &=, 0x3fffff); } _ => {} } } if ih == 2 { z = 1. - z; if carry != 0 { z -= scalbn(1., q0); } } } /* check if recomputation is needed */ if z == 0. { let mut j = 0; for i in (jk..=jz - 1).rev() { j |= i!(iq, i); } if j == 0 { /* need recomputation */ let mut k = 1; while i!(iq, jk - k, ==, 0) { k += 1; /* k = no. of terms needed */ } for i in (jz + 1)..=(jz + k) { /* add q[jz+1] to q[jz+k] */ i!(f, jx + i, =, i!(IPIO2, jv + i) as f64); fw = 0f64; for j in 0..=jx { fw += i!(x, j) * i!(f, jx + i - j); } i!(q, i, =, fw); } jz += k; continue 'recompute; } } break; } /* chop off zero terms */ if z == 0. { jz -= 1; q0 -= 24; while i!(iq, jz) == 0 { jz -= 1; q0 -= 24; } } else { /* break z into 24-bit if necessary */ z = scalbn(z, -q0); if z >= x1p24 { fw = (x1p_24 * z) as i32 as f64; i!(iq, jz, =, (z - x1p24 * fw) as i32); jz += 1; q0 += 24; i!(iq, jz, =, fw as i32); } else { i!(iq, jz, =, z as i32); } } /* convert integer "bit" chunk to floating-point value */ fw = scalbn(1., q0); for i in (0..=jz).rev() { i!(q, i, =, fw * (i!(iq, i) as f64)); fw *= x1p_24; } /* compute PIo2[0,...,jp]*q[jz,...,0] */ for i in (0..=jz).rev() { fw = 0f64; let mut k = 0; while (k <= jp) && (k <= jz - i) { fw += i!(PIO2, k) * i!(q, i + k); k += 1; } i!(fq, jz - i, =, fw); } /* compress fq[] into y[] */ match prec { 0 => { fw = 0f64; for i in (0..=jz).rev() { fw += i!(fq, i); } i!(y, 0, =, if ih == 0 { fw } else { -fw }); } 1 | 2 => { fw = 0f64; for i in (0..=jz).rev() { fw += i!(fq, i); } // TODO: drop excess precision here once double_t is used fw = fw as f64; i!(y, 0, =, if ih == 0 { fw } else { -fw }); fw = i!(fq, 0) - fw; for i in 1..=jz { fw += i!(fq, i); } i!(y, 1, =, if ih == 0 { fw } else { -fw }); } 3 => { /* painful */ for i in (1..=jz).rev() { fw = i!(fq, i - 1) + i!(fq, i); i!(fq, i, +=, i!(fq, i - 1) - fw); i!(fq, i - 1, =, fw); } for i in (2..=jz).rev() { fw = i!(fq, i - 1) + i!(fq, i); i!(fq, i, +=, i!(fq, i - 1) - fw); i!(fq, i - 1, =, fw); } fw = 0f64; for i in (2..=jz).rev() { fw += i!(fq, i); } if ih == 0 { i!(y, 0, =, i!(fq, 0)); i!(y, 1, =, i!(fq, 1)); i!(y, 2, =, fw); } else { i!(y, 0, =, -i!(fq, 0)); i!(y, 1, =, -i!(fq, 1)); i!(y, 2, =, -fw); } } #[cfg(debug_assertions)] _ => unreachable!(), #[cfg(not(debug_assertions))] _ => {} } n & 7 } libm-0.2.1/src/math/rem_pio2f.rs010066400017500001750000000040451351140325100146260ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_rem_pio2f.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Debugged and optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::rem_pio2_large; use core::f64; const TOINT: f64 = 1.5 / f64::EPSILON; /// 53 bits of 2/pi const INV_PIO2: f64 = 6.36619772367581382433e-01; /* 0x3FE45F30, 0x6DC9C883 */ /// first 25 bits of pi/2 const PIO2_1: f64 = 1.57079631090164184570e+00; /* 0x3FF921FB, 0x50000000 */ /// pi/2 - pio2_1 const PIO2_1T: f64 = 1.58932547735281966916e-08; /* 0x3E5110b4, 0x611A6263 */ /// Return the remainder of x rem pi/2 in *y /// /// use double precision for everything except passing x /// use __rem_pio2_large() for large x #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub(crate) fn rem_pio2f(x: f32) -> (i32, f64) { let x64 = x as f64; let mut tx: [f64; 1] = [0.]; let mut ty: [f64; 1] = [0.]; let ix = x.to_bits() & 0x7fffffff; /* 25+53 bit pi is good enough for medium size */ if ix < 0x4dc90fdb { /* |x| ~< 2^28*(pi/2), medium size */ /* Use a specialized rint() to get fn. Assume round-to-nearest. */ let f_n = x64 * INV_PIO2 + TOINT - TOINT; return (f_n as i32, x64 - f_n * PIO2_1 - f_n * PIO2_1T); } if ix >= 0x7f800000 { /* x is inf or NaN */ return (0, x64 - x64); } /* scale x into [2^23, 2^24-1] */ let sign = (x.to_bits() >> 31) != 0; let e0 = ((ix >> 23) - (0x7f + 23)) as i32; /* e0 = ilogb(|x|)-23, positive */ tx[0] = f32::from_bits(ix - (e0 << 23) as u32) as f64; let n = rem_pio2_large(&tx, &mut ty, e0, 0); if sign { return (-n, -ty[0]); } (n, ty[0]) } libm-0.2.1/src/math/remainder.rs010066400017500001750000000002361351140263300147130ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn remainder(x: f64, y: f64) -> f64 { let (result, _) = super::remquo(x, y); result } libm-0.2.1/src/math/remainderf.rs010066400017500001750000000002401351140263100150520ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn remainderf(x: f32, y: f32) -> f32 { let (result, _) = super::remquof(x, y); result } libm-0.2.1/src/math/remquo.rs010066400017500001750000000046361351140345600142710ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn remquo(mut x: f64, mut y: f64) -> (f64, i32) { let ux: u64 = x.to_bits(); let mut uy: u64 = y.to_bits(); let mut ex = ((ux >> 52) & 0x7ff) as i32; let mut ey = ((uy >> 52) & 0x7ff) as i32; let sx = (ux >> 63) != 0; let sy = (uy >> 63) != 0; let mut q: u32; let mut i: u64; let mut uxi: u64 = ux; if (uy << 1) == 0 || y.is_nan() || ex == 0x7ff { return ((x * y) / (x * y), 0); } if (ux << 1) == 0 { return (x, 0); } /* normalize x and y */ if ex == 0 { i = uxi << 12; while (i >> 63) == 0 { ex -= 1; i <<= 1; } uxi <<= -ex + 1; } else { uxi &= (!0) >> 12; uxi |= 1 << 52; } if ey == 0 { i = uy << 12; while (i >> 63) == 0 { ey -= 1; i <<= 1; } uy <<= -ey + 1; } else { uy &= (!0) >> 12; uy |= 1 << 52; } q = 0; if ex + 1 != ey { if ex < ey { return (x, 0); } /* x mod y */ while ex > ey { i = uxi.wrapping_sub(uy); if (i >> 63) == 0 { uxi = i; q += 1; } uxi <<= 1; q <<= 1; ex -= 1; } i = uxi.wrapping_sub(uy); if (i >> 63) == 0 { uxi = i; q += 1; } if uxi == 0 { ex = -60; } else { while (uxi >> 52) == 0 { uxi <<= 1; ex -= 1; } } } /* scale result and decide between |x| and |x|-|y| */ if ex > 0 { uxi -= 1 << 52; uxi |= (ex as u64) << 52; } else { uxi >>= -ex + 1; } x = f64::from_bits(uxi); if sy { y = -y; } if ex == ey || (ex + 1 == ey && (2.0 * x > y || (2.0 * x == y && (q % 2) != 0))) { x -= y; // TODO: this matches musl behavior, but it is incorrect q = q.wrapping_add(1); } q &= 0x7fffffff; let quo = if sx ^ sy { -(q as i32) } else { q as i32 }; if sx { (-x, quo) } else { (x, quo) } } #[cfg(test)] mod tests { use super::remquo; #[test] fn test_q_overflow() { // 0xc000000000000001, 0x04c0000000000004 let _ = remquo(-2.0000000000000004, 8.406091369059082e-286); } } libm-0.2.1/src/math/remquof.rs010066400017500001750000000041571351140343700144340ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn remquof(mut x: f32, mut y: f32) -> (f32, i32) { let ux: u32 = x.to_bits(); let mut uy: u32 = y.to_bits(); let mut ex = ((ux >> 23) & 0xff) as i32; let mut ey = ((uy >> 23) & 0xff) as i32; let sx = (ux >> 31) != 0; let sy = (uy >> 31) != 0; let mut q: u32; let mut i: u32; let mut uxi: u32 = ux; if (uy << 1) == 0 || y.is_nan() || ex == 0xff { return ((x * y) / (x * y), 0); } if (ux << 1) == 0 { return (x, 0); } /* normalize x and y */ if ex == 0 { i = uxi << 9; while (i >> 31) == 0 { ex -= 1; i <<= 1; } uxi <<= -ex + 1; } else { uxi &= (!0) >> 9; uxi |= 1 << 23; } if ey == 0 { i = uy << 9; while (i >> 31) == 0 { ey -= 1; i <<= 1; } uy <<= -ey + 1; } else { uy &= (!0) >> 9; uy |= 1 << 23; } q = 0; if ex + 1 != ey { if ex < ey { return (x, 0); } /* x mod y */ while ex > ey { i = uxi.wrapping_sub(uy); if (i >> 31) == 0 { uxi = i; q += 1; } uxi <<= 1; q <<= 1; ex -= 1; } i = uxi.wrapping_sub(uy); if (i >> 31) == 0 { uxi = i; q += 1; } if uxi == 0 { ex = -30; } else { while (uxi >> 23) == 0 { uxi <<= 1; ex -= 1; } } } /* scale result and decide between |x| and |x|-|y| */ if ex > 0 { uxi -= 1 << 23; uxi |= (ex as u32) << 23; } else { uxi >>= -ex + 1; } x = f32::from_bits(uxi); if sy { y = -y; } if ex == ey || (ex + 1 == ey && (2.0 * x > y || (2.0 * x == y && (q % 2) != 0))) { x -= y; q += 1; } q &= 0x7fffffff; let quo = if sx ^ sy { -(q as i32) } else { q as i32 }; if sx { (-x, quo) } else { (x, quo) } } libm-0.2.1/src/math/round.rs010066400017500001750000000014771351140324300141020ustar0000000000000000use core::f64; const TOINT: f64 = 1.0 / f64::EPSILON; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn round(mut x: f64) -> f64 { let i = x.to_bits(); let e: u64 = i >> 52 & 0x7ff; let mut y: f64; if e >= 0x3ff + 52 { return x; } if e < 0x3ff - 1 { // raise inexact if x!=0 force_eval!(x + TOINT); return 0.0 * x; } if i >> 63 != 0 { x = -x; } y = x + TOINT - TOINT - x; if y > 0.5 { y = y + x - 1.0; } else if y <= -0.5 { y = y + x + 1.0; } else { y = y + x; } if i >> 63 != 0 { -y } else { y } } #[cfg(test)] mod tests { use super::round; #[test] fn negative_zero() { assert_eq!(round(-0.0_f64).to_bits(), (-0.0_f64).to_bits()); } } libm-0.2.1/src/math/roundf.rs010066400017500001750000000014431351140300200142320ustar0000000000000000use core::f32; const TOINT: f32 = 1.0 / f32::EPSILON; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn roundf(mut x: f32) -> f32 { let i = x.to_bits(); let e: u32 = i >> 23 & 0xff; let mut y: f32; if e >= 0x7f + 23 { return x; } if e < 0x7f - 1 { force_eval!(x + TOINT); return 0.0 * x; } if i >> 31 != 0 { x = -x; } y = x + TOINT - TOINT - x; if y > 0.5f32 { y = y + x - 1.0; } else if y <= -0.5f32 { y = y + x + 1.0; } else { y = y + x; } if i >> 31 != 0 { -y } else { y } } #[cfg(test)] mod tests { use super::roundf; #[test] fn negative_zero() { assert_eq!(roundf(-0.0_f32).to_bits(), (-0.0_f32).to_bits()); } } libm-0.2.1/src/math/scalbn.rs010066400017500001750000000017041351140327000142060ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn scalbn(x: f64, mut n: i32) -> f64 { let x1p1023 = f64::from_bits(0x7fe0000000000000); // 0x1p1023 === 2 ^ 1023 let x1p53 = f64::from_bits(0x4340000000000000); // 0x1p53 === 2 ^ 53 let x1p_1022 = f64::from_bits(0x0010000000000000); // 0x1p-1022 === 2 ^ (-1022) let mut y = x; if n > 1023 { y *= x1p1023; n -= 1023; if n > 1023 { y *= x1p1023; n -= 1023; if n > 1023 { n = 1023; } } } else if n < -1022 { /* make sure final n < -53 to avoid double rounding in the subnormal range */ y *= x1p_1022 * x1p53; n += 1022 - 53; if n < -1022 { y *= x1p_1022 * x1p53; n += 1022 - 53; if n < -1022 { n = -1022; } } } y * f64::from_bits(((0x3ff + n) as u64) << 52) } libm-0.2.1/src/math/scalbnf.rs010066400017500001750000000014471351140335500143640ustar0000000000000000#[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn scalbnf(mut x: f32, mut n: i32) -> f32 { let x1p127 = f32::from_bits(0x7f000000); // 0x1p127f === 2 ^ 127 let x1p_126 = f32::from_bits(0x800000); // 0x1p-126f === 2 ^ -126 let x1p24 = f32::from_bits(0x4b800000); // 0x1p24f === 2 ^ 24 if n > 127 { x *= x1p127; n -= 127; if n > 127 { x *= x1p127; n -= 127; if n > 127 { n = 127; } } } else if n < -126 { x *= x1p_126 * x1p24; n += 126 - 24; if n < -126 { x *= x1p_126 * x1p24; n += 126 - 24; if n < -126 { n = -126; } } } x * f32::from_bits(((0x7f + n) as u32) << 23) } libm-0.2.1/src/math/sin.rs010066400017500001750000000051611351140311100135300ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunPro, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== use super::{k_cos, k_sin, rem_pio2}; // sin(x) // Return sine function of x. // // kernel function: // k_sin ... sine function on [-pi/4,pi/4] // k_cos ... cose function on [-pi/4,pi/4] // rem_pio2 ... argument reduction routine // // Method. // Let S,C and T denote the sin, cos and tan respectively on // [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 // in [-pi/4 , +pi/4], and let n = k mod 4. // We have // // n sin(x) cos(x) tan(x) // ---------------------------------------------------------- // 0 S C T // 1 C -S -1/T // 2 -S -C T // 3 -C S -1/T // ---------------------------------------------------------- // // Special cases: // Let trig be any of sin, cos, or tan. // trig(+-INF) is NaN, with signals; // trig(NaN) is that NaN; // // Accuracy: // TRIG(x) returns trig(x) nearly rounded #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sin(x: f64) -> f64 { let x1p120 = f64::from_bits(0x4770000000000000); // 0x1p120f === 2 ^ 120 /* High word of x. */ let ix = (f64::to_bits(x) >> 32) as u32 & 0x7fffffff; /* |x| ~< pi/4 */ if ix <= 0x3fe921fb { if ix < 0x3e500000 { /* |x| < 2**-26 */ /* raise inexact if x != 0 and underflow if subnormal*/ if ix < 0x00100000 { force_eval!(x / x1p120); } else { force_eval!(x + x1p120); } return x; } return k_sin(x, 0.0, 0); } /* sin(Inf or NaN) is NaN */ if ix >= 0x7ff00000 { return x - x; } /* argument reduction needed */ let (n, y0, y1) = rem_pio2(x); match n & 3 { 0 => k_sin(y0, y1, 1), 1 => k_cos(y0, y1), 2 => -k_sin(y0, y1, 1), _ => -k_cos(y0, y1), } } #[test] fn test_near_pi() { let x = f64::from_bits(0x400921fb000FD5DD); // 3.141592026217707 let sx = f64::from_bits(0x3ea50d15ced1a4a2); // 6.273720864039205e-7 assert_eq!(sin(x), sx); } libm-0.2.1/src/math/sincos.rs010066400017500001750000000031201353572366000142520ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_sin.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{get_high_word, k_cos, k_sin, rem_pio2}; pub fn sincos(x: f64) -> (f64, f64) { let s: f64; let c: f64; let mut ix: u32; ix = get_high_word(x); ix &= 0x7fffffff; /* |x| ~< pi/4 */ if ix <= 0x3fe921fb { /* if |x| < 2**-27 * sqrt(2) */ if ix < 0x3e46a09e { /* raise inexact if x!=0 and underflow if subnormal */ let x1p120 = f64::from_bits(0x4770000000000000); // 0x1p120 == 2^120 if ix < 0x00100000 { force_eval!(x / x1p120); } else { force_eval!(x + x1p120); } return (x, 1.0); } return (k_sin(x, 0.0, 0), k_cos(x, 0.0)); } /* sincos(Inf or NaN) is NaN */ if ix >= 0x7ff00000 { let rv = x - x; return (rv, rv); } /* argument reduction needed */ let (n, y0, y1) = rem_pio2(x); s = k_sin(y0, y1, 1); c = k_cos(y0, y1); match n & 3 { 0 => (s, c), 1 => (c, -s), 2 => (-s, -c), 3 => (-c, s), #[cfg(debug_assertions)] _ => unreachable!(), #[cfg(not(debug_assertions))] _ => (0.0, 1.0), } } libm-0.2.1/src/math/sincosf.rs010066400017500001750000000104471356603200700144220ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{k_cosf, k_sinf, rem_pio2f}; /* Small multiples of pi/2 rounded to double precision. */ const PI_2: f32 = 0.5 * 3.1415926535897931160E+00; const S1PIO2: f32 = 1.0 * PI_2; /* 0x3FF921FB, 0x54442D18 */ const S2PIO2: f32 = 2.0 * PI_2; /* 0x400921FB, 0x54442D18 */ const S3PIO2: f32 = 3.0 * PI_2; /* 0x4012D97C, 0x7F3321D2 */ const S4PIO2: f32 = 4.0 * PI_2; /* 0x401921FB, 0x54442D18 */ pub fn sincosf(x: f32) -> (f32, f32) { let s: f32; let c: f32; let mut ix: u32; let sign: bool; ix = x.to_bits(); sign = (ix >> 31) != 0; ix &= 0x7fffffff; /* |x| ~<= pi/4 */ if ix <= 0x3f490fda { /* |x| < 2**-12 */ if ix < 0x39800000 { /* raise inexact if x!=0 and underflow if subnormal */ let x1p120 = f32::from_bits(0x7b800000); // 0x1p120 == 2^120 if ix < 0x00100000 { force_eval!(x / x1p120); } else { force_eval!(x + x1p120); } return (x, 1.0); } return (k_sinf(x as f64), k_cosf(x as f64)); } /* |x| ~<= 5*pi/4 */ if ix <= 0x407b53d1 { if ix <= 0x4016cbe3 { /* |x| ~<= 3pi/4 */ if sign { s = -k_cosf((x + S1PIO2) as f64); c = k_sinf((x + S1PIO2) as f64); } else { s = k_cosf((S1PIO2 - x) as f64); c = k_sinf((S1PIO2 - x) as f64); } } /* -sin(x+c) is not correct if x+c could be 0: -0 vs +0 */ else { if sign { s = -k_sinf((x + S2PIO2) as f64); c = -k_cosf((x + S2PIO2) as f64); } else { s = -k_sinf((x - S2PIO2) as f64); c = -k_cosf((x - S2PIO2) as f64); } } return (s, c); } /* |x| ~<= 9*pi/4 */ if ix <= 0x40e231d5 { if ix <= 0x40afeddf { /* |x| ~<= 7*pi/4 */ if sign { s = k_cosf((x + S3PIO2) as f64); c = -k_sinf((x + S3PIO2) as f64); } else { s = -k_cosf((x - S3PIO2) as f64); c = k_sinf((x - S3PIO2) as f64); } } else { if sign { s = k_sinf((x + S4PIO2) as f64); c = k_cosf((x + S4PIO2) as f64); } else { s = k_sinf((x - S4PIO2) as f64); c = k_cosf((x - S4PIO2) as f64); } } return (s, c); } /* sin(Inf or NaN) is NaN */ if ix >= 0x7f800000 { let rv = x - x; return (rv, rv); } /* general argument reduction needed */ let (n, y) = rem_pio2f(x); s = k_sinf(y); c = k_cosf(y); match n & 3 { 0 => (s, c), 1 => (c, -s), 2 => (-s, -c), 3 => (-c, s), #[cfg(debug_assertions)] _ => unreachable!(), #[cfg(not(debug_assertions))] _ => (0.0, 1.0), } } #[cfg(test)] mod tests { use super::sincosf; use crate::_eqf; #[test] fn with_pi() { let (s, c) = sincosf(core::f32::consts::PI); _eqf(s.abs(), 0.0).unwrap(); _eqf(c, -1.0).unwrap(); } #[test] fn rotational_symmetry() { use core::f32::consts::PI; const N: usize = 24; for n in 0..N { let theta = 2. * PI * (n as f32) / (N as f32); let (s, c) = sincosf(theta); let (s_plus, c_plus) = sincosf(theta + 2. * PI); let (s_minus, c_minus) = sincosf(theta - 2. * PI); const TOLERANCE: f32 = 1e-6; assert!((s - s_plus).abs() < TOLERANCE); assert!((s - s_minus).abs() < TOLERANCE); assert!((c - c_plus).abs() < TOLERANCE); assert!((c - c_minus).abs() < TOLERANCE); } } } libm-0.2.1/src/math/sinf.rs010066400017500001750000000051271353572365600137310ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_sinf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{k_cosf, k_sinf, rem_pio2f}; use core::f64::consts::FRAC_PI_2; /* Small multiples of pi/2 rounded to double precision. */ const S1_PIO2: f64 = 1. * FRAC_PI_2; /* 0x3FF921FB, 0x54442D18 */ const S2_PIO2: f64 = 2. * FRAC_PI_2; /* 0x400921FB, 0x54442D18 */ const S3_PIO2: f64 = 3. * FRAC_PI_2; /* 0x4012D97C, 0x7F3321D2 */ const S4_PIO2: f64 = 4. * FRAC_PI_2; /* 0x401921FB, 0x54442D18 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sinf(x: f32) -> f32 { let x64 = x as f64; let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 let mut ix = x.to_bits(); let sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix <= 0x3f490fda { /* |x| ~<= pi/4 */ if ix < 0x39800000 { /* |x| < 2**-12 */ /* raise inexact if x!=0 and underflow if subnormal */ force_eval!(if ix < 0x00800000 { x / x1p120 } else { x + x1p120 }); return x; } return k_sinf(x64); } if ix <= 0x407b53d1 { /* |x| ~<= 5*pi/4 */ if ix <= 0x4016cbe3 { /* |x| ~<= 3pi/4 */ if sign { return -k_cosf(x64 + S1_PIO2); } else { return k_cosf(x64 - S1_PIO2); } } return k_sinf(if sign { -(x64 + S2_PIO2) } else { -(x64 - S2_PIO2) }); } if ix <= 0x40e231d5 { /* |x| ~<= 9*pi/4 */ if ix <= 0x40afeddf { /* |x| ~<= 7*pi/4 */ if sign { return k_cosf(x64 + S3_PIO2); } else { return -k_cosf(x64 - S3_PIO2); } } return k_sinf(if sign { x64 + S4_PIO2 } else { x64 - S4_PIO2 }); } /* sin(Inf or NaN) is NaN */ if ix >= 0x7f800000 { return x - x; } /* general argument reduction needed */ let (n, y) = rem_pio2f(x); match n & 3 { 0 => k_sinf(y), 1 => k_cosf(y), 2 => k_sinf(-y), _ => -k_cosf(y), } } libm-0.2.1/src/math/sinh.rs010066400017500001750000000023551351140271600137140ustar0000000000000000use super::{expm1, expo2}; // sinh(x) = (exp(x) - 1/exp(x))/2 // = (exp(x)-1 + (exp(x)-1)/exp(x))/2 // = x + x^3/6 + o(x^5) // #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sinh(x: f64) -> f64 { // union {double f; uint64_t i;} u = {.f = x}; // uint32_t w; // double t, h, absx; let mut uf: f64 = x; let mut ui: u64 = f64::to_bits(uf); let w: u32; let t: f64; let mut h: f64; let absx: f64; h = 0.5; if ui >> 63 != 0 { h = -h; } /* |x| */ ui &= !1 / 2; uf = f64::from_bits(ui); absx = uf; w = (ui >> 32) as u32; /* |x| < log(DBL_MAX) */ if w < 0x40862e42 { t = expm1(absx); if w < 0x3ff00000 { if w < 0x3ff00000 - (26 << 20) { /* note: inexact and underflow are raised by expm1 */ /* note: this branch avoids spurious underflow */ return x; } return h * (2.0 * t - t * t / (t + 1.0)); } /* note: |x|>log(0x1p26)+eps could be just h*exp(x) */ return h * (t + t / (t + 1.0)); } /* |x| > log(DBL_MAX) or nan */ /* note: the result is stored to handle overflow */ t = 2.0 * h * expo2(absx); t } libm-0.2.1/src/math/sinhf.rs010066400017500001750000000012651351140302400140520ustar0000000000000000use super::expm1f; use super::k_expo2f; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sinhf(x: f32) -> f32 { let mut h = 0.5f32; let mut ix = x.to_bits(); if (ix >> 31) != 0 { h = -h; } /* |x| */ ix &= 0x7fffffff; let absx = f32::from_bits(ix); let w = ix; /* |x| < log(FLT_MAX) */ if w < 0x42b17217 { let t = expm1f(absx); if w < 0x3f800000 { if w < (0x3f800000 - (12 << 23)) { return x; } return h * (2. * t - t * t / (t + 1.)); } return h * (t + t / (t + 1.)); } /* |x| > logf(FLT_MAX) or nan */ 2. * h * k_expo2f(absx) } libm-0.2.1/src/math/sqrt.rs010066400017500001750000000212111353572366000137460ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrt.c */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunSoft, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ /* sqrt(x) * Return correctly rounded sqrt. * ------------------------------------------ * | Use the hardware sqrt if you have one | * ------------------------------------------ * Method: * Bit by bit method using integer arithmetic. (Slow, but portable) * 1. Normalization * Scale x to y in [1,4) with even powers of 2: * find an integer k such that 1 <= (y=x*2^(2k)) < 4, then * sqrt(x) = 2^k * sqrt(y) * 2. Bit by bit computation * Let q = sqrt(y) truncated to i bit after binary point (q = 1), * i 0 * i+1 2 * s = 2*q , and y = 2 * ( y - q ). (1) * i i i i * * To compute q from q , one checks whether * i+1 i * * -(i+1) 2 * (q + 2 ) <= y. (2) * i * -(i+1) * If (2) is false, then q = q ; otherwise q = q + 2 . * i+1 i i+1 i * * With some algebraic manipulation, it is not difficult to see * that (2) is equivalent to * -(i+1) * s + 2 <= y (3) * i i * * The advantage of (3) is that s and y can be computed by * i i * the following recurrence formula: * if (3) is false * * s = s , y = y ; (4) * i+1 i i+1 i * * otherwise, * -i -(i+1) * s = s + 2 , y = y - s - 2 (5) * i+1 i i+1 i i * * One may easily use induction to prove (4) and (5). * Note. Since the left hand side of (3) contain only i+2 bits, * it does not necessary to do a full (53-bit) comparison * in (3). * 3. Final rounding * After generating the 53 bits result, we compute one more bit. * Together with the remainder, we can decide whether the * result is exact, bigger than 1/2ulp, or less than 1/2ulp * (it will never equal to 1/2ulp). * The rounding mode can be detected by checking whether * huge + tiny is equal to huge, and whether huge - tiny is * equal to huge for some floating point number "huge" and "tiny". * * Special cases: * sqrt(+-0) = +-0 ... exact * sqrt(inf) = inf * sqrt(-ve) = NaN ... with invalid signal * sqrt(NaN) = NaN ... with invalid signal for signaling NaN */ use core::f64; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sqrt(x: f64) -> f64 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f64.sqrt` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return if x < 0.0 { f64::NAN } else { unsafe { ::core::intrinsics::sqrtf64(x) } } } } #[cfg(target_feature = "sse2")] { // Note: This path is unlikely since LLVM will usually have already // optimized sqrt calls into hardware instructions if sse2 is available, // but if someone does end up here they'll apprected the speed increase. #[cfg(target_arch = "x86")] use core::arch::x86::*; #[cfg(target_arch = "x86_64")] use core::arch::x86_64::*; unsafe { let m = _mm_set_sd(x); let m_sqrt = _mm_sqrt_pd(m); _mm_cvtsd_f64(m_sqrt) } } #[cfg(not(target_feature = "sse2"))] { use core::num::Wrapping; const TINY: f64 = 1.0e-300; let mut z: f64; let sign: Wrapping = Wrapping(0x80000000); let mut ix0: i32; let mut s0: i32; let mut q: i32; let mut m: i32; let mut t: i32; let mut i: i32; let mut r: Wrapping; let mut t1: Wrapping; let mut s1: Wrapping; let mut ix1: Wrapping; let mut q1: Wrapping; ix0 = (x.to_bits() >> 32) as i32; ix1 = Wrapping(x.to_bits() as u32); /* take care of Inf and NaN */ if (ix0 & 0x7ff00000) == 0x7ff00000 { return x * x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ } /* take care of zero */ if ix0 <= 0 { if ((ix0 & !(sign.0 as i32)) | ix1.0 as i32) == 0 { return x; /* sqrt(+-0) = +-0 */ } if ix0 < 0 { return (x - x) / (x - x); /* sqrt(-ve) = sNaN */ } } /* normalize x */ m = ix0 >> 20; if m == 0 { /* subnormal x */ while ix0 == 0 { m -= 21; ix0 |= (ix1 >> 11).0 as i32; ix1 <<= 21; } i = 0; while (ix0 & 0x00100000) == 0 { i += 1; ix0 <<= 1; } m -= i - 1; ix0 |= (ix1 >> (32 - i) as usize).0 as i32; ix1 = ix1 << i as usize; } m -= 1023; /* unbias exponent */ ix0 = (ix0 & 0x000fffff) | 0x00100000; if (m & 1) == 1 { /* odd m, double x to make it even */ ix0 += ix0 + ((ix1 & sign) >> 31).0 as i32; ix1 += ix1; } m >>= 1; /* m = [m/2] */ /* generate sqrt(x) bit by bit */ ix0 += ix0 + ((ix1 & sign) >> 31).0 as i32; ix1 += ix1; q = 0; /* [q,q1] = sqrt(x) */ q1 = Wrapping(0); s0 = 0; s1 = Wrapping(0); r = Wrapping(0x00200000); /* r = moving bit from right to left */ while r != Wrapping(0) { t = s0 + r.0 as i32; if t <= ix0 { s0 = t + r.0 as i32; ix0 -= t; q += r.0 as i32; } ix0 += ix0 + ((ix1 & sign) >> 31).0 as i32; ix1 += ix1; r >>= 1; } r = sign; while r != Wrapping(0) { t1 = s1 + r; t = s0; if t < ix0 || (t == ix0 && t1 <= ix1) { s1 = t1 + r; if (t1 & sign) == sign && (s1 & sign) == Wrapping(0) { s0 += 1; } ix0 -= t; if ix1 < t1 { ix0 -= 1; } ix1 -= t1; q1 += r; } ix0 += ix0 + ((ix1 & sign) >> 31).0 as i32; ix1 += ix1; r >>= 1; } /* use floating add to find out rounding direction */ if (ix0 as u32 | ix1.0) != 0 { z = 1.0 - TINY; /* raise inexact flag */ if z >= 1.0 { z = 1.0 + TINY; if q1.0 == 0xffffffff { q1 = Wrapping(0); q += 1; } else if z > 1.0 { if q1.0 == 0xfffffffe { q += 1; } q1 += Wrapping(2); } else { q1 += q1 & Wrapping(1); } } } ix0 = (q >> 1) + 0x3fe00000; ix1 = q1 >> 1; if (q & 1) == 1 { ix1 |= sign; } ix0 += m << 20; f64::from_bits((ix0 as u64) << 32 | ix1.0 as u64) } } #[cfg(test)] mod tests { use super::*; use core::f64::*; #[test] fn sanity_check() { assert_eq!(sqrt(100.0), 10.0); assert_eq!(sqrt(4.0), 2.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/sqrt #[test] fn spec_tests() { // Not Asserted: FE_INVALID exception is raised if argument is negative. assert!(sqrt(-1.0).is_nan()); assert!(sqrt(NAN).is_nan()); for f in [0.0, -0.0, INFINITY].iter().copied() { assert_eq!(sqrt(f), f); } } } libm-0.2.1/src/math/sqrtf.rs010066400017500001750000000103031353572366000141140ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/e_sqrtf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn sqrtf(x: f32) -> f32 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f32.sqrt` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return if x < 0.0 { ::core::f32::NAN } else { unsafe { ::core::intrinsics::sqrtf32(x) } } } } #[cfg(target_feature = "sse")] { // Note: This path is unlikely since LLVM will usually have already // optimized sqrt calls into hardware instructions if sse is available, // but if someone does end up here they'll apprected the speed increase. #[cfg(target_arch = "x86")] use core::arch::x86::*; #[cfg(target_arch = "x86_64")] use core::arch::x86_64::*; unsafe { let m = _mm_set_ss(x); let m_sqrt = _mm_sqrt_ss(m); _mm_cvtss_f32(m_sqrt) } } #[cfg(not(target_feature = "sse"))] { const TINY: f32 = 1.0e-30; let mut z: f32; let sign: i32 = 0x80000000u32 as i32; let mut ix: i32; let mut s: i32; let mut q: i32; let mut m: i32; let mut t: i32; let mut i: i32; let mut r: u32; ix = x.to_bits() as i32; /* take care of Inf and NaN */ if (ix as u32 & 0x7f800000) == 0x7f800000 { return x * x + x; /* sqrt(NaN)=NaN, sqrt(+inf)=+inf, sqrt(-inf)=sNaN */ } /* take care of zero */ if ix <= 0 { if (ix & !sign) == 0 { return x; /* sqrt(+-0) = +-0 */ } if ix < 0 { return (x - x) / (x - x); /* sqrt(-ve) = sNaN */ } } /* normalize x */ m = ix >> 23; if m == 0 { /* subnormal x */ i = 0; while ix & 0x00800000 == 0 { ix <<= 1; i = i + 1; } m -= i - 1; } m -= 127; /* unbias exponent */ ix = (ix & 0x007fffff) | 0x00800000; if m & 1 == 1 { /* odd m, double x to make it even */ ix += ix; } m >>= 1; /* m = [m/2] */ /* generate sqrt(x) bit by bit */ ix += ix; q = 0; s = 0; r = 0x01000000; /* r = moving bit from right to left */ while r != 0 { t = s + r as i32; if t <= ix { s = t + r as i32; ix -= t; q += r as i32; } ix += ix; r >>= 1; } /* use floating add to find out rounding direction */ if ix != 0 { z = 1.0 - TINY; /* raise inexact flag */ if z >= 1.0 { z = 1.0 + TINY; if z > 1.0 { q += 2; } else { q += q & 1; } } } ix = (q >> 1) + 0x3f000000; ix += m << 23; f32::from_bits(ix as u32) } } #[cfg(test)] mod tests { use super::*; use core::f32::*; #[test] fn sanity_check() { assert_eq!(sqrtf(100.0), 10.0); assert_eq!(sqrtf(4.0), 2.0); } /// The spec: https://en.cppreference.com/w/cpp/numeric/math/sqrt #[test] fn spec_tests() { // Not Asserted: FE_INVALID exception is raised if argument is negative. assert!(sqrtf(-1.0).is_nan()); assert!(sqrtf(NAN).is_nan()); for f in [0.0, -0.0, INFINITY].iter().copied() { assert_eq!(sqrtf(f), f); } } } libm-0.2.1/src/math/tan.rs010066400017500001750000000043101351140277500135330ustar0000000000000000// origin: FreeBSD /usr/src/lib/msun/src/s_tan.c */ // // ==================================================== // Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. // // Developed at SunPro, a Sun Microsystems, Inc. business. // Permission to use, copy, modify, and distribute this // software is freely granted, provided that this notice // is preserved. // ==================================================== use super::{k_tan, rem_pio2}; // tan(x) // Return tangent function of x. // // kernel function: // k_tan ... tangent function on [-pi/4,pi/4] // rem_pio2 ... argument reduction routine // // Method. // Let S,C and T denote the sin, cos and tan respectively on // [-PI/4, +PI/4]. Reduce the argument x to y1+y2 = x-k*pi/2 // in [-pi/4 , +pi/4], and let n = k mod 4. // We have // // n sin(x) cos(x) tan(x) // ---------------------------------------------------------- // 0 S C T // 1 C -S -1/T // 2 -S -C T // 3 -C S -1/T // ---------------------------------------------------------- // // Special cases: // Let trig be any of sin, cos, or tan. // trig(+-INF) is NaN, with signals; // trig(NaN) is that NaN; // // Accuracy: // TRIG(x) returns trig(x) nearly rounded #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn tan(x: f64) -> f64 { let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 let ix = (f64::to_bits(x) >> 32) as u32 & 0x7fffffff; /* |x| ~< pi/4 */ if ix <= 0x3fe921fb { if ix < 0x3e400000 { /* |x| < 2**-27 */ /* raise inexact if x!=0 and underflow if subnormal */ force_eval!(if ix < 0x00100000 { x / x1p120 as f64 } else { x + x1p120 as f64 }); return x; } return k_tan(x, 0.0, 0); } /* tan(Inf or NaN) is NaN */ if ix >= 0x7ff00000 { return x - x; } /* argument reduction */ let (n, y0, y1) = rem_pio2(x); k_tan(y0, y1, n & 1) } libm-0.2.1/src/math/tanf.rs010066400017500001750000000045531351140320400136760ustar0000000000000000/* origin: FreeBSD /usr/src/lib/msun/src/s_tanf.c */ /* * Conversion to float by Ian Lance Taylor, Cygnus Support, ian@cygnus.com. * Optimized by Bruce D. Evans. */ /* * ==================================================== * Copyright (C) 1993 by Sun Microsystems, Inc. All rights reserved. * * Developed at SunPro, a Sun Microsystems, Inc. business. * Permission to use, copy, modify, and distribute this * software is freely granted, provided that this notice * is preserved. * ==================================================== */ use super::{k_tanf, rem_pio2f}; use core::f64::consts::FRAC_PI_2; /* Small multiples of pi/2 rounded to double precision. */ const T1_PIO2: f64 = 1. * FRAC_PI_2; /* 0x3FF921FB, 0x54442D18 */ const T2_PIO2: f64 = 2. * FRAC_PI_2; /* 0x400921FB, 0x54442D18 */ const T3_PIO2: f64 = 3. * FRAC_PI_2; /* 0x4012D97C, 0x7F3321D2 */ const T4_PIO2: f64 = 4. * FRAC_PI_2; /* 0x401921FB, 0x54442D18 */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn tanf(x: f32) -> f32 { let x64 = x as f64; let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 let mut ix = x.to_bits(); let sign = (ix >> 31) != 0; ix &= 0x7fffffff; if ix <= 0x3f490fda { /* |x| ~<= pi/4 */ if ix < 0x39800000 { /* |x| < 2**-12 */ /* raise inexact if x!=0 and underflow if subnormal */ force_eval!(if ix < 0x00800000 { x / x1p120 } else { x + x1p120 }); return x; } return k_tanf(x64, false); } if ix <= 0x407b53d1 { /* |x| ~<= 5*pi/4 */ if ix <= 0x4016cbe3 { /* |x| ~<= 3pi/4 */ return k_tanf(if sign { x64 + T1_PIO2 } else { x64 - T1_PIO2 }, true); } else { return k_tanf(if sign { x64 + T2_PIO2 } else { x64 - T2_PIO2 }, false); } } if ix <= 0x40e231d5 { /* |x| ~<= 9*pi/4 */ if ix <= 0x40afeddf { /* |x| ~<= 7*pi/4 */ return k_tanf(if sign { x64 + T3_PIO2 } else { x64 - T3_PIO2 }, true); } else { return k_tanf(if sign { x64 + T4_PIO2 } else { x64 - T4_PIO2 }, false); } } /* tan(Inf or NaN) is NaN */ if ix >= 0x7f800000 { return x - x; } /* argument reduction */ let (n, y) = rem_pio2f(x); k_tanf(y, n & 1 != 0) } libm-0.2.1/src/math/tanh.rs010066400017500001750000000025201351140304500136730ustar0000000000000000use super::expm1; /* tanh(x) = (exp(x) - exp(-x))/(exp(x) + exp(-x)) * = (exp(2*x) - 1)/(exp(2*x) - 1 + 2) * = (1 - exp(-2*x))/(exp(-2*x) - 1 + 2) */ #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn tanh(mut x: f64) -> f64 { let mut uf: f64 = x; let mut ui: u64 = f64::to_bits(uf); let w: u32; let sign: bool; let mut t: f64; /* x = |x| */ sign = ui >> 63 != 0; ui &= !1 / 2; uf = f64::from_bits(ui); x = uf; w = (ui >> 32) as u32; if w > 0x3fe193ea { /* |x| > log(3)/2 ~= 0.5493 or nan */ if w > 0x40340000 { /* |x| > 20 or nan */ /* note: this branch avoids raising overflow */ t = 1.0 - 0.0 / x; } else { t = expm1(2.0 * x); t = 1.0 - 2.0 / (t + 2.0); } } else if w > 0x3fd058ae { /* |x| > log(5/3)/2 ~= 0.2554 */ t = expm1(2.0 * x); t = t / (t + 2.0); } else if w >= 0x00100000 { /* |x| >= 0x1p-1022, up to 2ulp error in [0.1,0.2554] */ t = expm1(-2.0 * x); t = -t / (t + 2.0); } else { /* |x| is subnormal */ /* note: the branch above would not raise underflow in [0x1p-1023,0x1p-1022) */ force_eval!(x as f32); t = x; } if sign { -t } else { t } } libm-0.2.1/src/math/tanhf.rs010066400017500001750000000016061351140304200140420ustar0000000000000000use super::expm1f; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn tanhf(mut x: f32) -> f32 { /* x = |x| */ let mut ix = x.to_bits(); let sign = (ix >> 31) != 0; ix &= 0x7fffffff; x = f32::from_bits(ix); let w = ix; let tt = if w > 0x3f0c9f54 { /* |x| > log(3)/2 ~= 0.5493 or nan */ if w > 0x41200000 { /* |x| > 10 */ 1. + 0. / x } else { let t = expm1f(2. * x); 1. - 2. / (t + 2.) } } else if w > 0x3e82c578 { /* |x| > log(5/3)/2 ~= 0.2554 */ let t = expm1f(2. * x); t / (t + 2.) } else if w >= 0x00800000 { /* |x| >= 0x1p-126 */ let t = expm1f(-2. * x); -t / (t + 2.) } else { /* |x| is subnormal */ force_eval!(x * x); x }; if sign { -tt } else { tt } } libm-0.2.1/src/math/tgamma.rs010066400017500001750000000124731351140252100142150ustar0000000000000000/* "A Precision Approximation of the Gamma Function" - Cornelius Lanczos (1964) "Lanczos Implementation of the Gamma Function" - Paul Godfrey (2001) "An Analysis of the Lanczos Gamma Approximation" - Glendon Ralph Pugh (2004) approximation method: (x - 0.5) S(x) Gamma(x) = (x + g - 0.5) * ---------------- exp(x + g - 0.5) with a1 a2 a3 aN S(x) ~= [ a0 + ----- + ----- + ----- + ... + ----- ] x + 1 x + 2 x + 3 x + N with a0, a1, a2, a3,.. aN constants which depend on g. for x < 0 the following reflection formula is used: Gamma(x)*Gamma(-x) = -pi/(x sin(pi x)) most ideas and constants are from boost and python */ extern crate core; use super::{exp, floor, k_cos, k_sin, pow}; const PI: f64 = 3.141592653589793238462643383279502884; /* sin(pi x) with x > 0x1p-100, if sin(pi*x)==0 the sign is arbitrary */ fn sinpi(mut x: f64) -> f64 { let mut n: isize; /* argument reduction: x = |x| mod 2 */ /* spurious inexact when x is odd int */ x = x * 0.5; x = 2.0 * (x - floor(x)); /* reduce x into [-.25,.25] */ n = (4.0 * x) as isize; n = (n + 1) / 2; x -= (n as f64) * 0.5; x *= PI; match n { 1 => k_cos(x, 0.0), 2 => k_sin(-x, 0.0, 0), 3 => -k_cos(x, 0.0), 0 | _ => k_sin(x, 0.0, 0), } } const N: usize = 12; //static const double g = 6.024680040776729583740234375; const GMHALF: f64 = 5.524680040776729583740234375; const SNUM: [f64; N + 1] = [ 23531376880.410759688572007674451636754734846804940, 42919803642.649098768957899047001988850926355848959, 35711959237.355668049440185451547166705960488635843, 17921034426.037209699919755754458931112671403265390, 6039542586.3520280050642916443072979210699388420708, 1439720407.3117216736632230727949123939715485786772, 248874557.86205415651146038641322942321632125127801, 31426415.585400194380614231628318205362874684987640, 2876370.6289353724412254090516208496135991145378768, 186056.26539522349504029498971604569928220784236328, 8071.6720023658162106380029022722506138218516325024, 210.82427775157934587250973392071336271166969580291, 2.5066282746310002701649081771338373386264310793408, ]; const SDEN: [f64; N + 1] = [ 0.0, 39916800.0, 120543840.0, 150917976.0, 105258076.0, 45995730.0, 13339535.0, 2637558.0, 357423.0, 32670.0, 1925.0, 66.0, 1.0, ]; /* n! for small integer n */ const FACT: [f64; 23] = [ 1.0, 1.0, 2.0, 6.0, 24.0, 120.0, 720.0, 5040.0, 40320.0, 362880.0, 3628800.0, 39916800.0, 479001600.0, 6227020800.0, 87178291200.0, 1307674368000.0, 20922789888000.0, 355687428096000.0, 6402373705728000.0, 121645100408832000.0, 2432902008176640000.0, 51090942171709440000.0, 1124000727777607680000.0, ]; /* S(x) rational function for positive x */ fn s(x: f64) -> f64 { let mut num: f64 = 0.0; let mut den: f64 = 0.0; /* to avoid overflow handle large x differently */ if x < 8.0 { for i in (0..=N).rev() { num = num * x + SNUM[i]; den = den * x + SDEN[i]; } } else { for i in 0..=N { num = num / x + SNUM[i]; den = den / x + SDEN[i]; } } return num / den; } pub fn tgamma(mut x: f64) -> f64 { let u: u64 = x.to_bits(); let absx: f64; let mut y: f64; let mut dy: f64; let mut z: f64; let mut r: f64; let ix: u32 = ((u >> 32) as u32) & 0x7fffffff; let sign: bool = (u >> 63) != 0; /* special cases */ if ix >= 0x7ff00000 { /* tgamma(nan)=nan, tgamma(inf)=inf, tgamma(-inf)=nan with invalid */ return x + core::f64::INFINITY; } if ix < ((0x3ff - 54) << 20) { /* |x| < 2^-54: tgamma(x) ~ 1/x, +-0 raises div-by-zero */ return 1.0 / x; } /* integer arguments */ /* raise inexact when non-integer */ if x == floor(x) { if sign { return 0.0 / 0.0; } if x <= FACT.len() as f64 { return FACT[(x as usize) - 1]; } } /* x >= 172: tgamma(x)=inf with overflow */ /* x =< -184: tgamma(x)=+-0 with underflow */ if ix >= 0x40670000 { /* |x| >= 184 */ if sign { let x1p_126 = f64::from_bits(0x3810000000000000); // 0x1p-126 == 2^-126 force_eval!((x1p_126 / x) as f32); if floor(x) * 0.5 == floor(x * 0.5) { return 0.0; } else { return -0.0; } } let x1p1023 = f64::from_bits(0x7fe0000000000000); // 0x1p1023 == 2^1023 x *= x1p1023; return x; } absx = if sign { -x } else { x }; /* handle the error of x + g - 0.5 */ y = absx + GMHALF; if absx > GMHALF { dy = y - absx; dy -= GMHALF; } else { dy = y - GMHALF; dy -= absx; } z = absx - 0.5; r = s(absx) * exp(-y); if x < 0.0 { /* reflection formula for negative x */ /* sinpi(absx) is not 0, integers are already handled */ r = -PI / (sinpi(absx) * absx * r); dy = -dy; z = -z; } r += dy * (GMHALF + 0.5) * r / y; z = pow(y, 0.5 * z); y = r * z * z; return y; } libm-0.2.1/src/math/tgammaf.rs010066400017500001750000000001221351140252100143470ustar0000000000000000use super::tgamma; pub fn tgammaf(x: f32) -> f32 { tgamma(x as f64) as f32 } libm-0.2.1/src/math/trunc.rs010066400017500001750000000017021351140331200140720ustar0000000000000000use core::f64; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn trunc(x: f64) -> f64 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f64.trunc` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::truncf64(x) } } } let x1p120 = f64::from_bits(0x4770000000000000); // 0x1p120f === 2 ^ 120 let mut i: u64 = x.to_bits(); let mut e: i64 = (i >> 52 & 0x7ff) as i64 - 0x3ff + 12; let m: u64; if e >= 52 + 12 { return x; } if e < 12 { e = 1; } m = -1i64 as u64 >> e; if (i & m) == 0 { return x; } force_eval!(x + x1p120); i &= !m; f64::from_bits(i) } #[cfg(test)] mod tests { #[test] fn sanity_check() { assert_eq!(super::trunc(1.1), 1.0); } } libm-0.2.1/src/math/truncf.rs010066400017500001750000000016671351140306300142550ustar0000000000000000use core::f32; #[cfg_attr(all(test, assert_no_panic), no_panic::no_panic)] pub fn truncf(x: f32) -> f32 { // On wasm32 we know that LLVM's intrinsic will compile to an optimized // `f32.trunc` native instruction, so we can leverage this for both code size // and speed. llvm_intrinsically_optimized! { #[cfg(target_arch = "wasm32")] { return unsafe { ::core::intrinsics::truncf32(x) } } } let x1p120 = f32::from_bits(0x7b800000); // 0x1p120f === 2 ^ 120 let mut i: u32 = x.to_bits(); let mut e: i32 = (i >> 23 & 0xff) as i32 - 0x7f + 9; let m: u32; if e >= 23 + 9 { return x; } if e < 9 { e = 1; } m = -1i32 as u32 >> e; if (i & m) == 0 { return x; } force_eval!(x + x1p120); i &= !m; f32::from_bits(i) } #[cfg(test)] mod tests { #[test] fn sanity_check() { assert_eq!(super::truncf(1.1), 1.0); } } libm-0.2.1/.cargo_vcs_info.json0000644000000001120000000000000120100ustar00{ "git": { "sha1": "3d729b7a85daad3b4d54b22e02d00681762bc602" } }